` tag we check the equality\n * of the VNodes corresponding to the `
` tags and, since they are the\n * same tag in the same position, we'd be able to avoid completely\n * re-rendering the subtree under them with a new DOM element and would just\n * call out to `patch` to handle reconciling their children and so on.\n *\n * 3. Check, for both windows, to see if the element at the beginning of the\n * window corresponds to the element at the end of the other window. This is\n * a heuristic which will let us identify _some_ situations in which\n * elements have changed position, for instance it _should_ detect that the\n * children nodes themselves have not changed but merely moved in the\n * following example:\n *\n * oldVNode: `
`\n * newVNode: `
`\n *\n * If we find cases like this then we also need to move the concrete DOM\n * elements corresponding to the moved children to write the re-order to the\n * DOM.\n *\n * 4. Finally, if VNodes have the `key` attribute set on them we check for any\n * nodes in the old children which have the same key as the first element in\n * our window on the new children. If we find such a node we handle calling\n * out to `patch`, moving relevant DOM nodes, and so on, in accordance with\n * what we find.\n *\n * Finally, once we've narrowed our 'windows' to the point that either of them\n * collapse (i.e. they have length 0) we then handle any remaining VNode\n * insertion or deletion that needs to happen to get a DOM state that correctly\n * reflects the new child VNodes. If, for instance, after our window on the old\n * children has collapsed we still have more nodes on the new children that\n * we haven't dealt with yet then we need to add them, or if the new children\n * collapse but we still have unhandled _old_ children then we need to make\n * sure the corresponding DOM nodes are removed.\n *\n * @param parentElm the node into which the parent VNode is rendered\n * @param oldCh the old children of the parent node\n * @param newVNode the new VNode which will replace the parent\n * @param newCh the new children of the parent node\n */\nconst updateChildren = (parentElm, oldCh, newVNode, newCh) => {\n let oldStartIdx = 0;\n let newStartIdx = 0;\n let idxInOld = 0;\n let i = 0;\n let oldEndIdx = oldCh.length - 1;\n let oldStartVnode = oldCh[0];\n let oldEndVnode = oldCh[oldEndIdx];\n let newEndIdx = newCh.length - 1;\n let newStartVnode = newCh[0];\n let newEndVnode = newCh[newEndIdx];\n let node;\n let elmToMove;\n while (oldStartIdx <= oldEndIdx && newStartIdx <= newEndIdx) {\n if (oldStartVnode == null) {\n // VNode might have been moved left\n oldStartVnode = oldCh[++oldStartIdx];\n }\n else if (oldEndVnode == null) {\n oldEndVnode = oldCh[--oldEndIdx];\n }\n else if (newStartVnode == null) {\n newStartVnode = newCh[++newStartIdx];\n }\n else if (newEndVnode == null) {\n newEndVnode = newCh[--newEndIdx];\n }\n else if (isSameVnode(oldStartVnode, newStartVnode)) {\n // if the start nodes are the same then we should patch the new VNode\n // onto the old one, and increment our `newStartIdx` and `oldStartIdx`\n // indices to reflect that. We don't need to move any DOM Nodes around\n // since things are matched up in order.\n patch(oldStartVnode, newStartVnode);\n oldStartVnode = oldCh[++oldStartIdx];\n newStartVnode = newCh[++newStartIdx];\n }\n else if (isSameVnode(oldEndVnode, newEndVnode)) {\n // likewise, if the end nodes are the same we patch new onto old and\n // decrement our end indices, and also likewise in this case we don't\n // need to move any DOM Nodes.\n patch(oldEndVnode, newEndVnode);\n oldEndVnode = oldCh[--oldEndIdx];\n newEndVnode = newCh[--newEndIdx];\n }\n else if (isSameVnode(oldStartVnode, newEndVnode)) {\n // case: \"Vnode moved right\"\n //\n // We've found that the last node in our window on the new children is\n // the same VNode as the _first_ node in our window on the old children\n // we're dealing with now. Visually, this is the layout of these two\n // nodes:\n //\n // newCh: [..., newStartVnode , ... , newEndVnode , ...]\n // ^^^^^^^^^^^\n // oldCh: [..., oldStartVnode , ... , oldEndVnode , ...]\n // ^^^^^^^^^^^^^\n //\n // In this situation we need to patch `newEndVnode` onto `oldStartVnode`\n // and move the DOM element for `oldStartVnode`.\n if ((oldStartVnode.$tag$ === 'slot' || newEndVnode.$tag$ === 'slot')) {\n putBackInOriginalLocation(oldStartVnode.$elm$.parentNode, false);\n }\n patch(oldStartVnode, newEndVnode);\n // We need to move the element for `oldStartVnode` into a position which\n // will be appropriate for `newEndVnode`. For this we can use\n // `.insertBefore` and `oldEndVnode.$elm$.nextSibling`. If there is a\n // sibling for `oldEndVnode.$elm$` then we want to move the DOM node for\n // `oldStartVnode` between `oldEndVnode` and it's sibling, like so:\n //\n //
\n //
\n //
\n // \n //
\n // \n // ```\n // In this case if we do not unshadow here and use the value of the shadowing property, attributeChangedCallback\n // will be called with `newValue = \"some-value\"` and will set the shadowed property (this.someAttribute = \"another-value\")\n // to the value that was set inline i.e. \"some-value\" from above example. When\n // the connectedCallback attempts to unshadow it will use \"some-value\" as the initial value rather than \"another-value\"\n //\n // The case where the attribute was NOT set inline but was not set programmatically shall be handled/unshadowed\n // by connectedCallback as this attributeChangedCallback will not fire.\n //\n // https://developers.google.com/web/fundamentals/web-components/best-practices#lazy-properties\n //\n // TODO(STENCIL-16) we should think about whether or not we actually want to be reflecting the attributes to\n // properties here given that this goes against best practices outlined here\n // https://developers.google.com/web/fundamentals/web-components/best-practices#avoid-reentrancy\n if (this.hasOwnProperty(propName)) {\n newValue = this[propName];\n delete this[propName];\n }\n else if (prototype.hasOwnProperty(propName) &&\n typeof this[propName] === 'number' &&\n this[propName] == newValue) {\n // if the propName exists on the prototype of `Cstr`, this update may be a result of Stencil using native\n // APIs to reflect props as attributes. Calls to `setAttribute(someElement, propName)` will result in\n // `propName` to be converted to a `DOMString`, which may not be what we want for other primitive props.\n return;\n }\n this[propName] = newValue === null && typeof this[propName] === 'boolean' ? false : newValue;\n });\n };\n // create an array of attributes to observe\n // and also create a map of html attribute name to js property name\n Cstr.observedAttributes = members\n .filter(([_, m]) => m[0] & 15 /* MEMBER_FLAGS.HasAttribute */) // filter to only keep props that should match attributes\n .map(([propName, m]) => {\n const attrName = m[1] || propName;\n attrNameToPropName.set(attrName, propName);\n if (m[0] & 512 /* MEMBER_FLAGS.ReflectAttr */) {\n cmpMeta.$attrsToReflect$.push([propName, attrName]);\n }\n return attrName;\n });\n }\n }\n return Cstr;\n};\nconst initializeComponent = async (elm, hostRef, cmpMeta, hmrVersionId, Cstr) => {\n // initializeComponent\n if ((hostRef.$flags$ & 32 /* HOST_FLAGS.hasInitializedComponent */) === 0) {\n {\n // we haven't initialized this element yet\n hostRef.$flags$ |= 32 /* HOST_FLAGS.hasInitializedComponent */;\n // lazy loaded components\n // request the component's implementation to be\n // wired up with the host element\n Cstr = loadModule(cmpMeta);\n if (Cstr.then) {\n // Await creates a micro-task avoid if possible\n const endLoad = uniqueTime();\n Cstr = await Cstr;\n endLoad();\n }\n if (!Cstr.isProxied) {\n // we've never proxied this Constructor before\n // let's add the getters/setters to its prototype before\n // the first time we create an instance of the implementation\n {\n cmpMeta.$watchers$ = Cstr.watchers;\n }\n proxyComponent(Cstr, cmpMeta, 2 /* PROXY_FLAGS.proxyState */);\n Cstr.isProxied = true;\n }\n const endNewInstance = createTime('createInstance', cmpMeta.$tagName$);\n // ok, time to construct the instance\n // but let's keep track of when we start and stop\n // so that the getters/setters don't incorrectly step on data\n {\n hostRef.$flags$ |= 8 /* HOST_FLAGS.isConstructingInstance */;\n }\n // construct the lazy-loaded component implementation\n // passing the hostRef is very important during\n // construction in order to directly wire together the\n // host element and the lazy-loaded instance\n try {\n new Cstr(hostRef);\n }\n catch (e) {\n consoleError(e);\n }\n {\n hostRef.$flags$ &= ~8 /* HOST_FLAGS.isConstructingInstance */;\n }\n {\n hostRef.$flags$ |= 128 /* HOST_FLAGS.isWatchReady */;\n }\n endNewInstance();\n fireConnectedCallback(hostRef.$lazyInstance$);\n }\n if (Cstr.style) {\n // this component has styles but we haven't registered them yet\n let style = Cstr.style;\n if (typeof style !== 'string') {\n style = style[(hostRef.$modeName$ = computeMode(elm))];\n }\n const scopeId = getScopeId(cmpMeta, hostRef.$modeName$);\n if (!styles.has(scopeId)) {\n const endRegisterStyles = createTime('registerStyles', cmpMeta.$tagName$);\n registerStyle(scopeId, style, !!(cmpMeta.$flags$ & 1 /* CMP_FLAGS.shadowDomEncapsulation */));\n endRegisterStyles();\n }\n }\n }\n // we've successfully created a lazy instance\n const ancestorComponent = hostRef.$ancestorComponent$;\n const schedule = () => scheduleUpdate(hostRef, true);\n if (ancestorComponent && ancestorComponent['s-rc']) {\n // this is the initial load and this component it has an ancestor component\n // but the ancestor component has NOT fired its will update lifecycle yet\n // so let's just cool our jets and wait for the ancestor to continue first\n // this will get fired off when the ancestor component\n // finally gets around to rendering its lazy self\n // fire off the initial update\n ancestorComponent['s-rc'].push(schedule);\n }\n else {\n schedule();\n }\n};\nconst fireConnectedCallback = (instance) => {\n {\n safeCall(instance, 'connectedCallback');\n }\n};\nconst connectedCallback = (elm) => {\n if ((plt.$flags$ & 1 /* PLATFORM_FLAGS.isTmpDisconnected */) === 0) {\n const hostRef = getHostRef(elm);\n const cmpMeta = hostRef.$cmpMeta$;\n const endConnected = createTime('connectedCallback', cmpMeta.$tagName$);\n if (!(hostRef.$flags$ & 1 /* HOST_FLAGS.hasConnected */)) {\n // first time this component has connected\n hostRef.$flags$ |= 1 /* HOST_FLAGS.hasConnected */;\n let hostId;\n {\n hostId = elm.getAttribute(HYDRATE_ID);\n if (hostId) {\n if (cmpMeta.$flags$ & 1 /* CMP_FLAGS.shadowDomEncapsulation */) {\n const scopeId = addStyle(elm.shadowRoot, cmpMeta, elm.getAttribute('s-mode'))\n ;\n elm.classList.remove(scopeId + '-h', scopeId + '-s');\n }\n initializeClientHydrate(elm, cmpMeta.$tagName$, hostId, hostRef);\n }\n }\n if (!hostId) {\n // initUpdate\n // if the slot polyfill is required we'll need to put some nodes\n // in here to act as original content anchors as we move nodes around\n // host element has been connected to the DOM\n if ((cmpMeta.$flags$ & (4 /* CMP_FLAGS.hasSlotRelocation */ | 8 /* CMP_FLAGS.needsShadowDomShim */))) {\n setContentReference(elm);\n }\n }\n {\n // find the first ancestor component (if there is one) and register\n // this component as one of the actively loading child components for its ancestor\n let ancestorComponent = elm;\n while ((ancestorComponent = ancestorComponent.parentNode || ancestorComponent.host)) {\n // climb up the ancestors looking for the first\n // component that hasn't finished its lifecycle update yet\n if ((ancestorComponent.nodeType === 1 /* NODE_TYPE.ElementNode */ &&\n ancestorComponent.hasAttribute('s-id') &&\n ancestorComponent['s-p']) ||\n ancestorComponent['s-p']) {\n // we found this components first ancestor component\n // keep a reference to this component's ancestor component\n attachToAncestor(hostRef, (hostRef.$ancestorComponent$ = ancestorComponent));\n break;\n }\n }\n }\n // Lazy properties\n // https://developers.google.com/web/fundamentals/web-components/best-practices#lazy-properties\n if (cmpMeta.$members$) {\n Object.entries(cmpMeta.$members$).map(([memberName, [memberFlags]]) => {\n if (memberFlags & 31 /* MEMBER_FLAGS.Prop */ && elm.hasOwnProperty(memberName)) {\n const value = elm[memberName];\n delete elm[memberName];\n elm[memberName] = value;\n }\n });\n }\n {\n // connectedCallback, taskQueue, initialLoad\n // angular sets attribute AFTER connectCallback\n // https://github.com/angular/angular/issues/18909\n // https://github.com/angular/angular/issues/19940\n nextTick(() => initializeComponent(elm, hostRef, cmpMeta));\n }\n }\n else {\n // not the first time this has connected\n // reattach any event listeners to the host\n // since they would have been removed when disconnected\n addHostEventListeners(elm, hostRef, cmpMeta.$listeners$);\n // fire off connectedCallback() on component instance\n fireConnectedCallback(hostRef.$lazyInstance$);\n }\n endConnected();\n }\n};\nconst setContentReference = (elm) => {\n // only required when we're NOT using native shadow dom (slot)\n // or this browser doesn't support native shadow dom\n // and this host element was NOT created with SSR\n // let's pick out the inner content for slot projection\n // create a node to represent where the original\n // content was first placed, which is useful later on\n const contentRefElm = (elm['s-cr'] = doc.createComment(''));\n contentRefElm['s-cn'] = true;\n elm.insertBefore(contentRefElm, elm.firstChild);\n};\nconst disconnectedCallback = (elm) => {\n if ((plt.$flags$ & 1 /* PLATFORM_FLAGS.isTmpDisconnected */) === 0) {\n const hostRef = getHostRef(elm);\n const instance = hostRef.$lazyInstance$ ;\n {\n if (hostRef.$rmListeners$) {\n hostRef.$rmListeners$.map((rmListener) => rmListener());\n hostRef.$rmListeners$ = undefined;\n }\n }\n {\n safeCall(instance, 'disconnectedCallback');\n }\n }\n};\nconst bootstrapLazy = (lazyBundles, options = {}) => {\n const endBootstrap = createTime();\n const cmpTags = [];\n const exclude = options.exclude || [];\n const customElements = win.customElements;\n const head = doc.head;\n const metaCharset = /*@__PURE__*/ head.querySelector('meta[charset]');\n const visibilityStyle = /*@__PURE__*/ doc.createElement('style');\n const deferredConnectedCallbacks = [];\n const styles = /*@__PURE__*/ doc.querySelectorAll(`[${HYDRATED_STYLE_ID}]`);\n let appLoadFallback;\n let isBootstrapping = true;\n let i = 0;\n Object.assign(plt, options);\n plt.$resourcesUrl$ = new URL(options.resourcesUrl || './', doc.baseURI).href;\n {\n // If the app is already hydrated there is not point to disable the\n // async queue. This will improve the first input delay\n plt.$flags$ |= 2 /* PLATFORM_FLAGS.appLoaded */;\n }\n {\n for (; i < styles.length; i++) {\n registerStyle(styles[i].getAttribute(HYDRATED_STYLE_ID), convertScopedToShadow(styles[i].innerHTML), true);\n }\n }\n lazyBundles.map((lazyBundle) => {\n lazyBundle[1].map((compactMeta) => {\n const cmpMeta = {\n $flags$: compactMeta[0],\n $tagName$: compactMeta[1],\n $members$: compactMeta[2],\n $listeners$: compactMeta[3],\n };\n {\n cmpMeta.$members$ = compactMeta[2];\n }\n {\n cmpMeta.$listeners$ = compactMeta[3];\n }\n {\n cmpMeta.$attrsToReflect$ = [];\n }\n {\n cmpMeta.$watchers$ = {};\n }\n const tagName = cmpMeta.$tagName$;\n const HostElement = class extends HTMLElement {\n // StencilLazyHost\n constructor(self) {\n // @ts-ignore\n super(self);\n self = this;\n registerHost(self, cmpMeta);\n if (cmpMeta.$flags$ & 1 /* CMP_FLAGS.shadowDomEncapsulation */) {\n // this component is using shadow dom\n // and this browser supports shadow dom\n // add the read-only property \"shadowRoot\" to the host element\n // adding the shadow root build conditionals to minimize runtime\n {\n {\n self.attachShadow({\n mode: 'open',\n delegatesFocus: !!(cmpMeta.$flags$ & 16 /* CMP_FLAGS.shadowDelegatesFocus */),\n });\n }\n }\n }\n }\n connectedCallback() {\n if (appLoadFallback) {\n clearTimeout(appLoadFallback);\n appLoadFallback = null;\n }\n if (isBootstrapping) {\n // connectedCallback will be processed once all components have been registered\n deferredConnectedCallbacks.push(this);\n }\n else {\n plt.jmp(() => connectedCallback(this));\n }\n }\n disconnectedCallback() {\n plt.jmp(() => disconnectedCallback(this));\n }\n componentOnReady() {\n return getHostRef(this).$onReadyPromise$;\n }\n };\n cmpMeta.$lazyBundleId$ = lazyBundle[0];\n if (!exclude.includes(tagName) && !customElements.get(tagName)) {\n cmpTags.push(tagName);\n customElements.define(tagName, proxyComponent(HostElement, cmpMeta, 1 /* PROXY_FLAGS.isElementConstructor */));\n }\n });\n });\n {\n visibilityStyle.innerHTML = cmpTags + HYDRATED_CSS;\n visibilityStyle.setAttribute('data-styles', '');\n head.insertBefore(visibilityStyle, metaCharset ? metaCharset.nextSibling : head.firstChild);\n }\n // Process deferred connectedCallbacks now all components have been registered\n isBootstrapping = false;\n if (deferredConnectedCallbacks.length) {\n deferredConnectedCallbacks.map((host) => host.connectedCallback());\n }\n else {\n {\n plt.jmp(() => (appLoadFallback = setTimeout(appDidLoad, 30)));\n }\n }\n // Fallback appLoad event\n endBootstrap();\n};\nconst getAssetPath = (path) => {\n const assetUrl = new URL(path, plt.$resourcesUrl$);\n return assetUrl.origin !== win.location.origin ? assetUrl.href : assetUrl.pathname;\n};\nconst hostRefs = /*@__PURE__*/ new WeakMap();\nconst getHostRef = (ref) => hostRefs.get(ref);\nconst registerInstance = (lazyInstance, hostRef) => hostRefs.set((hostRef.$lazyInstance$ = lazyInstance), hostRef);\nconst registerHost = (elm, cmpMeta) => {\n const hostRef = {\n $flags$: 0,\n $hostElement$: elm,\n $cmpMeta$: cmpMeta,\n $instanceValues$: new Map(),\n };\n {\n hostRef.$onInstancePromise$ = new Promise((r) => (hostRef.$onInstanceResolve$ = r));\n }\n {\n hostRef.$onReadyPromise$ = new Promise((r) => (hostRef.$onReadyResolve$ = r));\n elm['s-p'] = [];\n elm['s-rc'] = [];\n }\n addHostEventListeners(elm, hostRef, cmpMeta.$listeners$);\n return hostRefs.set(elm, hostRef);\n};\nconst isMemberInElement = (elm, memberName) => memberName in elm;\nconst consoleError = (e, el) => (0, console.error)(e, el);\nconst cmpModules = /*@__PURE__*/ new Map();\nconst loadModule = (cmpMeta, hostRef, hmrVersionId) => {\n // loadModuleImport\n const exportName = cmpMeta.$tagName$.replace(/-/g, '_');\n const bundleId = cmpMeta.$lazyBundleId$;\n const module = cmpModules.get(bundleId) ;\n if (module) {\n return module[exportName];\n }\n /*!__STENCIL_STATIC_IMPORT_SWITCH__*/\n return import(\n /* @vite-ignore */\n /* webpackInclude: /\\.entry\\.js$/ */\n /* webpackExclude: /\\.system\\.entry\\.js$/ */\n /* webpackMode: \"lazy\" */\n `./${bundleId}.entry.js${''}`).then((importedModule) => {\n {\n cmpModules.set(bundleId, importedModule);\n }\n return importedModule[exportName];\n }, consoleError);\n};\nconst styles = /*@__PURE__*/ new Map();\nconst modeResolutionChain = [];\nconst queueDomReads = [];\nconst queueDomWrites = [];\nconst queueTask = (queue, write) => (cb) => {\n queue.push(cb);\n if (!queuePending) {\n queuePending = true;\n if (write && plt.$flags$ & 4 /* PLATFORM_FLAGS.queueSync */) {\n nextTick(flush);\n }\n else {\n plt.raf(flush);\n }\n }\n};\nconst consume = (queue) => {\n for (let i = 0; i < queue.length; i++) {\n try {\n queue[i](performance.now());\n }\n catch (e) {\n consoleError(e);\n }\n }\n queue.length = 0;\n};\nconst flush = () => {\n // always force a bunch of medium callbacks to run, but still have\n // a throttle on how many can run in a certain time\n // DOM READS!!!\n consume(queueDomReads);\n // DOM WRITES!!!\n {\n consume(queueDomWrites);\n if ((queuePending = queueDomReads.length > 0)) {\n // still more to do yet, but we've run out of time\n // let's let this thing cool off and try again in the next tick\n plt.raf(flush);\n }\n }\n};\nconst nextTick = /*@__PURE__*/ (cb) => promiseResolve().then(cb);\nconst readTask = /*@__PURE__*/ queueTask(queueDomReads, false);\nconst writeTask = /*@__PURE__*/ queueTask(queueDomWrites, true);\nconst Build = {\n isDev: false,\n isBrowser: true,\n isServer: false,\n isTesting: false,\n};\n\nexport { Build as B, Host as H, NAMESPACE as N, setMode as a, bootstrapLazy as b, writeTask as c, doc as d, createEvent as e, readTask as f, getMode as g, h, getElement as i, forceUpdate as j, getAssetPath as k, promiseResolve as p, registerInstance as r, setPlatformHelpers as s, win as w };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\n/**\n * Does a simple sanitization of all elements\n * in an untrusted string\n */\nconst sanitizeDOMString = (untrustedString) => {\n try {\n if (untrustedString instanceof IonicSafeString) {\n return untrustedString.value;\n }\n if (!isSanitizerEnabled() || typeof untrustedString !== 'string' || untrustedString === '') {\n return untrustedString;\n }\n /**\n * Create a document fragment\n * separate from the main DOM,\n * create a div to do our work in\n */\n const documentFragment = document.createDocumentFragment();\n const workingDiv = document.createElement('div');\n documentFragment.appendChild(workingDiv);\n workingDiv.innerHTML = untrustedString;\n /**\n * Remove any elements\n * that are blocked\n */\n blockedTags.forEach((blockedTag) => {\n const getElementsToRemove = documentFragment.querySelectorAll(blockedTag);\n for (let elementIndex = getElementsToRemove.length - 1; elementIndex >= 0; elementIndex--) {\n const element = getElementsToRemove[elementIndex];\n if (element.parentNode) {\n element.parentNode.removeChild(element);\n }\n else {\n documentFragment.removeChild(element);\n }\n /**\n * We still need to sanitize\n * the children of this element\n * as they are left behind\n */\n const childElements = getElementChildren(element);\n /* eslint-disable-next-line */\n for (let childIndex = 0; childIndex < childElements.length; childIndex++) {\n sanitizeElement(childElements[childIndex]);\n }\n }\n });\n /**\n * Go through remaining elements and remove\n * non-allowed attribs\n */\n // IE does not support .children on document fragments, only .childNodes\n const dfChildren = getElementChildren(documentFragment);\n /* eslint-disable-next-line */\n for (let childIndex = 0; childIndex < dfChildren.length; childIndex++) {\n sanitizeElement(dfChildren[childIndex]);\n }\n // Append document fragment to div\n const fragmentDiv = document.createElement('div');\n fragmentDiv.appendChild(documentFragment);\n // First child is always the div we did our work in\n const getInnerDiv = fragmentDiv.querySelector('div');\n return getInnerDiv !== null ? getInnerDiv.innerHTML : fragmentDiv.innerHTML;\n }\n catch (err) {\n console.error(err);\n return '';\n }\n};\n/**\n * Clean up current element based on allowed attributes\n * and then recursively dig down into any child elements to\n * clean those up as well\n */\nconst sanitizeElement = (element) => {\n // IE uses childNodes, so ignore nodes that are not elements\n if (element.nodeType && element.nodeType !== 1) {\n return;\n }\n for (let i = element.attributes.length - 1; i >= 0; i--) {\n const attribute = element.attributes.item(i);\n const attributeName = attribute.name;\n // remove non-allowed attribs\n if (!allowedAttributes.includes(attributeName.toLowerCase())) {\n element.removeAttribute(attributeName);\n continue;\n }\n // clean up any allowed attribs\n // that attempt to do any JS funny-business\n const attributeValue = attribute.value;\n /* eslint-disable-next-line */\n if (attributeValue != null && attributeValue.toLowerCase().includes('javascript:')) {\n element.removeAttribute(attributeName);\n }\n }\n /**\n * Sanitize any nested children\n */\n const childElements = getElementChildren(element);\n /* eslint-disable-next-line */\n for (let i = 0; i < childElements.length; i++) {\n sanitizeElement(childElements[i]);\n }\n};\n/**\n * IE doesn't always support .children\n * so we revert to .childNodes instead\n */\nconst getElementChildren = (el) => {\n return el.children != null ? el.children : el.childNodes;\n};\nconst isSanitizerEnabled = () => {\n var _a;\n const win = window;\n const config = (_a = win === null || win === void 0 ? void 0 : win.Ionic) === null || _a === void 0 ? void 0 : _a.config;\n if (config) {\n if (config.get) {\n return config.get('sanitizerEnabled', true);\n }\n else {\n return config.sanitizerEnabled === true || config.sanitizerEnabled === undefined;\n }\n }\n return true;\n};\nconst allowedAttributes = ['class', 'id', 'href', 'src', 'name', 'slot'];\nconst blockedTags = ['script', 'style', 'iframe', 'meta', 'link', 'object', 'embed'];\nclass IonicSafeString {\n constructor(value) {\n this.value = value;\n }\n}\n\nexport { IonicSafeString as I, sanitizeDOMString as s };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { G as GESTURE_CONTROLLER } from './gesture-controller-17060b7c.js';\nexport { G as GESTURE_CONTROLLER } from './gesture-controller-17060b7c.js';\n\nconst addEventListener = (el, eventName, callback, opts) => {\n // use event listener options when supported\n // otherwise it's just a boolean for the \"capture\" arg\n const listenerOpts = supportsPassive(el)\n ? {\n capture: !!opts.capture,\n passive: !!opts.passive,\n }\n : !!opts.capture;\n let add;\n let remove;\n if (el['__zone_symbol__addEventListener']) {\n add = '__zone_symbol__addEventListener';\n remove = '__zone_symbol__removeEventListener';\n }\n else {\n add = 'addEventListener';\n remove = 'removeEventListener';\n }\n el[add](eventName, callback, listenerOpts);\n return () => {\n el[remove](eventName, callback, listenerOpts);\n };\n};\nconst supportsPassive = (node) => {\n if (_sPassive === undefined) {\n try {\n const opts = Object.defineProperty({}, 'passive', {\n get: () => {\n _sPassive = true;\n },\n });\n node.addEventListener('optsTest', () => {\n return;\n }, opts);\n }\n catch (e) {\n _sPassive = false;\n }\n }\n return !!_sPassive;\n};\nlet _sPassive;\n\nconst MOUSE_WAIT = 2000;\nconst createPointerEvents = (el, pointerDown, pointerMove, pointerUp, options) => {\n let rmTouchStart;\n let rmTouchMove;\n let rmTouchEnd;\n let rmTouchCancel;\n let rmMouseStart;\n let rmMouseMove;\n let rmMouseUp;\n let lastTouchEvent = 0;\n const handleTouchStart = (ev) => {\n lastTouchEvent = Date.now() + MOUSE_WAIT;\n if (!pointerDown(ev)) {\n return;\n }\n if (!rmTouchMove && pointerMove) {\n rmTouchMove = addEventListener(el, 'touchmove', pointerMove, options);\n }\n /**\n * Events are dispatched on the element that is tapped and bubble up to\n * the reference element in the gesture. In the event that the element this\n * event was first dispatched on is removed from the DOM, the event will no\n * longer bubble up to our reference element. This leaves the gesture in an\n * unusable state. To account for this, the touchend and touchcancel listeners\n * should be added to the event target so that they still fire even if the target\n * is removed from the DOM.\n */\n if (!rmTouchEnd) {\n rmTouchEnd = addEventListener(ev.target, 'touchend', handleTouchEnd, options);\n }\n if (!rmTouchCancel) {\n rmTouchCancel = addEventListener(ev.target, 'touchcancel', handleTouchEnd, options);\n }\n };\n const handleMouseDown = (ev) => {\n if (lastTouchEvent > Date.now()) {\n return;\n }\n if (!pointerDown(ev)) {\n return;\n }\n if (!rmMouseMove && pointerMove) {\n rmMouseMove = addEventListener(getDocument(el), 'mousemove', pointerMove, options);\n }\n if (!rmMouseUp) {\n rmMouseUp = addEventListener(getDocument(el), 'mouseup', handleMouseUp, options);\n }\n };\n const handleTouchEnd = (ev) => {\n stopTouch();\n if (pointerUp) {\n pointerUp(ev);\n }\n };\n const handleMouseUp = (ev) => {\n stopMouse();\n if (pointerUp) {\n pointerUp(ev);\n }\n };\n const stopTouch = () => {\n if (rmTouchMove) {\n rmTouchMove();\n }\n if (rmTouchEnd) {\n rmTouchEnd();\n }\n if (rmTouchCancel) {\n rmTouchCancel();\n }\n rmTouchMove = rmTouchEnd = rmTouchCancel = undefined;\n };\n const stopMouse = () => {\n if (rmMouseMove) {\n rmMouseMove();\n }\n if (rmMouseUp) {\n rmMouseUp();\n }\n rmMouseMove = rmMouseUp = undefined;\n };\n const stop = () => {\n stopTouch();\n stopMouse();\n };\n const enable = (isEnabled = true) => {\n if (!isEnabled) {\n if (rmTouchStart) {\n rmTouchStart();\n }\n if (rmMouseStart) {\n rmMouseStart();\n }\n rmTouchStart = rmMouseStart = undefined;\n stop();\n }\n else {\n if (!rmTouchStart) {\n rmTouchStart = addEventListener(el, 'touchstart', handleTouchStart, options);\n }\n if (!rmMouseStart) {\n rmMouseStart = addEventListener(el, 'mousedown', handleMouseDown, options);\n }\n }\n };\n const destroy = () => {\n enable(false);\n pointerUp = pointerMove = pointerDown = undefined;\n };\n return {\n enable,\n stop,\n destroy,\n };\n};\nconst getDocument = (node) => {\n return node instanceof Document ? node : node.ownerDocument;\n};\n\nconst createPanRecognizer = (direction, thresh, maxAngle) => {\n const radians = maxAngle * (Math.PI / 180);\n const isDirX = direction === 'x';\n const maxCosine = Math.cos(radians);\n const threshold = thresh * thresh;\n let startX = 0;\n let startY = 0;\n let dirty = false;\n let isPan = 0;\n return {\n start(x, y) {\n startX = x;\n startY = y;\n isPan = 0;\n dirty = true;\n },\n detect(x, y) {\n if (!dirty) {\n return false;\n }\n const deltaX = x - startX;\n const deltaY = y - startY;\n const distance = deltaX * deltaX + deltaY * deltaY;\n if (distance < threshold) {\n return false;\n }\n const hypotenuse = Math.sqrt(distance);\n const cosine = (isDirX ? deltaX : deltaY) / hypotenuse;\n if (cosine > maxCosine) {\n isPan = 1;\n }\n else if (cosine < -maxCosine) {\n isPan = -1;\n }\n else {\n isPan = 0;\n }\n dirty = false;\n return true;\n },\n isGesture() {\n return isPan !== 0;\n },\n getDirection() {\n return isPan;\n },\n };\n};\n\nconst createGesture = (config) => {\n let hasCapturedPan = false;\n let hasStartedPan = false;\n let hasFiredStart = true;\n let isMoveQueued = false;\n const finalConfig = Object.assign({ disableScroll: false, direction: 'x', gesturePriority: 0, passive: true, maxAngle: 40, threshold: 10 }, config);\n const canStart = finalConfig.canStart;\n const onWillStart = finalConfig.onWillStart;\n const onStart = finalConfig.onStart;\n const onEnd = finalConfig.onEnd;\n const notCaptured = finalConfig.notCaptured;\n const onMove = finalConfig.onMove;\n const threshold = finalConfig.threshold;\n const passive = finalConfig.passive;\n const blurOnStart = finalConfig.blurOnStart;\n const detail = {\n type: 'pan',\n startX: 0,\n startY: 0,\n startTime: 0,\n currentX: 0,\n currentY: 0,\n velocityX: 0,\n velocityY: 0,\n deltaX: 0,\n deltaY: 0,\n currentTime: 0,\n event: undefined,\n data: undefined,\n };\n const pan = createPanRecognizer(finalConfig.direction, finalConfig.threshold, finalConfig.maxAngle);\n const gesture = GESTURE_CONTROLLER.createGesture({\n name: config.gestureName,\n priority: config.gesturePriority,\n disableScroll: config.disableScroll,\n });\n const pointerDown = (ev) => {\n const timeStamp = now(ev);\n if (hasStartedPan || !hasFiredStart) {\n return false;\n }\n updateDetail(ev, detail);\n detail.startX = detail.currentX;\n detail.startY = detail.currentY;\n detail.startTime = detail.currentTime = timeStamp;\n detail.velocityX = detail.velocityY = detail.deltaX = detail.deltaY = 0;\n detail.event = ev;\n // Check if gesture can start\n if (canStart && canStart(detail) === false) {\n return false;\n }\n // Release fallback\n gesture.release();\n // Start gesture\n if (!gesture.start()) {\n return false;\n }\n hasStartedPan = true;\n if (threshold === 0) {\n return tryToCapturePan();\n }\n pan.start(detail.startX, detail.startY);\n return true;\n };\n const pointerMove = (ev) => {\n // fast path, if gesture is currently captured\n // do minimum job to get user-land even dispatched\n if (hasCapturedPan) {\n if (!isMoveQueued && hasFiredStart) {\n isMoveQueued = true;\n calcGestureData(detail, ev);\n requestAnimationFrame(fireOnMove);\n }\n return;\n }\n // gesture is currently being detected\n calcGestureData(detail, ev);\n if (pan.detect(detail.currentX, detail.currentY)) {\n if (!pan.isGesture() || !tryToCapturePan()) {\n abortGesture();\n }\n }\n };\n const fireOnMove = () => {\n // Since fireOnMove is called inside a RAF, onEnd() might be called,\n // we must double check hasCapturedPan\n if (!hasCapturedPan) {\n return;\n }\n isMoveQueued = false;\n if (onMove) {\n onMove(detail);\n }\n };\n const tryToCapturePan = () => {\n if (!gesture.capture()) {\n return false;\n }\n hasCapturedPan = true;\n hasFiredStart = false;\n // reset start position since the real user-land event starts here\n // If the pan detector threshold is big, not resetting the start position\n // will cause a jump in the animation equal to the detector threshold.\n // the array of positions used to calculate the gesture velocity does not\n // need to be cleaned, more points in the positions array always results in a\n // more accurate value of the velocity.\n detail.startX = detail.currentX;\n detail.startY = detail.currentY;\n detail.startTime = detail.currentTime;\n if (onWillStart) {\n onWillStart(detail).then(fireOnStart);\n }\n else {\n fireOnStart();\n }\n return true;\n };\n const blurActiveElement = () => {\n if (typeof document !== 'undefined') {\n const activeElement = document.activeElement;\n if (activeElement === null || activeElement === void 0 ? void 0 : activeElement.blur) {\n activeElement.blur();\n }\n }\n };\n const fireOnStart = () => {\n if (blurOnStart) {\n blurActiveElement();\n }\n if (onStart) {\n onStart(detail);\n }\n hasFiredStart = true;\n };\n const reset = () => {\n hasCapturedPan = false;\n hasStartedPan = false;\n isMoveQueued = false;\n hasFiredStart = true;\n gesture.release();\n };\n // END *************************\n const pointerUp = (ev) => {\n const tmpHasCaptured = hasCapturedPan;\n const tmpHasFiredStart = hasFiredStart;\n reset();\n if (!tmpHasFiredStart) {\n return;\n }\n calcGestureData(detail, ev);\n // Try to capture press\n if (tmpHasCaptured) {\n if (onEnd) {\n onEnd(detail);\n }\n return;\n }\n // Not captured any event\n if (notCaptured) {\n notCaptured(detail);\n }\n };\n const pointerEvents = createPointerEvents(finalConfig.el, pointerDown, pointerMove, pointerUp, {\n capture: false,\n passive,\n });\n const abortGesture = () => {\n reset();\n pointerEvents.stop();\n if (notCaptured) {\n notCaptured(detail);\n }\n };\n return {\n enable(enable = true) {\n if (!enable) {\n if (hasCapturedPan) {\n pointerUp(undefined);\n }\n reset();\n }\n pointerEvents.enable(enable);\n },\n destroy() {\n gesture.destroy();\n pointerEvents.destroy();\n },\n };\n};\nconst calcGestureData = (detail, ev) => {\n if (!ev) {\n return;\n }\n const prevX = detail.currentX;\n const prevY = detail.currentY;\n const prevT = detail.currentTime;\n updateDetail(ev, detail);\n const currentX = detail.currentX;\n const currentY = detail.currentY;\n const timestamp = (detail.currentTime = now(ev));\n const timeDelta = timestamp - prevT;\n if (timeDelta > 0 && timeDelta < 100) {\n const velocityX = (currentX - prevX) / timeDelta;\n const velocityY = (currentY - prevY) / timeDelta;\n detail.velocityX = velocityX * 0.7 + detail.velocityX * 0.3;\n detail.velocityY = velocityY * 0.7 + detail.velocityY * 0.3;\n }\n detail.deltaX = currentX - detail.startX;\n detail.deltaY = currentY - detail.startY;\n detail.event = ev;\n};\nconst updateDetail = (ev, detail) => {\n // get X coordinates for either a mouse click\n // or a touch depending on the given event\n let x = 0;\n let y = 0;\n if (ev) {\n const changedTouches = ev.changedTouches;\n if (changedTouches && changedTouches.length > 0) {\n const touch = changedTouches[0];\n x = touch.clientX;\n y = touch.clientY;\n }\n else if (ev.pageX !== undefined) {\n x = ev.pageX;\n y = ev.pageY;\n }\n }\n detail.currentX = x;\n detail.currentY = y;\n};\nconst now = (ev) => {\n return ev.timeStamp || Date.now();\n};\n\nexport { createGesture };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { c as writeTask, B as Build } from './index-8e692445.js';\nimport { c as componentOnReady, r as raf } from './helpers-2914b3be.js';\n\nconst LIFECYCLE_WILL_ENTER = 'ionViewWillEnter';\nconst LIFECYCLE_DID_ENTER = 'ionViewDidEnter';\nconst LIFECYCLE_WILL_LEAVE = 'ionViewWillLeave';\nconst LIFECYCLE_DID_LEAVE = 'ionViewDidLeave';\nconst LIFECYCLE_WILL_UNLOAD = 'ionViewWillUnload';\n\nconst iosTransitionAnimation = () => import('./ios.transition-add97167.js');\nconst mdTransitionAnimation = () => import('./md.transition-41d5d0e3.js');\nconst transition = (opts) => {\n return new Promise((resolve, reject) => {\n writeTask(() => {\n beforeTransition(opts);\n runTransition(opts).then((result) => {\n if (result.animation) {\n result.animation.destroy();\n }\n afterTransition(opts);\n resolve(result);\n }, (error) => {\n afterTransition(opts);\n reject(error);\n });\n });\n });\n};\nconst beforeTransition = (opts) => {\n const enteringEl = opts.enteringEl;\n const leavingEl = opts.leavingEl;\n setZIndex(enteringEl, leavingEl, opts.direction);\n if (opts.showGoBack) {\n enteringEl.classList.add('can-go-back');\n }\n else {\n enteringEl.classList.remove('can-go-back');\n }\n setPageHidden(enteringEl, false);\n /**\n * When transitioning, the page should not\n * respond to click events. This resolves small\n * issues like users double tapping the ion-back-button.\n * These pointer events are removed in `afterTransition`.\n */\n enteringEl.style.setProperty('pointer-events', 'none');\n if (leavingEl) {\n setPageHidden(leavingEl, false);\n leavingEl.style.setProperty('pointer-events', 'none');\n }\n};\nconst runTransition = async (opts) => {\n const animationBuilder = await getAnimationBuilder(opts);\n const ani = animationBuilder && Build.isBrowser ? animation(animationBuilder, opts) : noAnimation(opts); // fast path for no animation\n return ani;\n};\nconst afterTransition = (opts) => {\n const enteringEl = opts.enteringEl;\n const leavingEl = opts.leavingEl;\n enteringEl.classList.remove('ion-page-invisible');\n enteringEl.style.removeProperty('pointer-events');\n if (leavingEl !== undefined) {\n leavingEl.classList.remove('ion-page-invisible');\n leavingEl.style.removeProperty('pointer-events');\n }\n};\nconst getAnimationBuilder = async (opts) => {\n if (!opts.leavingEl || !opts.animated || opts.duration === 0) {\n return undefined;\n }\n if (opts.animationBuilder) {\n return opts.animationBuilder;\n }\n const getAnimation = opts.mode === 'ios'\n ? (await iosTransitionAnimation()).iosTransitionAnimation\n : (await mdTransitionAnimation()).mdTransitionAnimation;\n return getAnimation;\n};\nconst animation = async (animationBuilder, opts) => {\n await waitForReady(opts, true);\n const trans = animationBuilder(opts.baseEl, opts);\n fireWillEvents(opts.enteringEl, opts.leavingEl);\n const didComplete = await playTransition(trans, opts);\n if (opts.progressCallback) {\n opts.progressCallback(undefined);\n }\n if (didComplete) {\n fireDidEvents(opts.enteringEl, opts.leavingEl);\n }\n return {\n hasCompleted: didComplete,\n animation: trans,\n };\n};\nconst noAnimation = async (opts) => {\n const enteringEl = opts.enteringEl;\n const leavingEl = opts.leavingEl;\n await waitForReady(opts, false);\n fireWillEvents(enteringEl, leavingEl);\n fireDidEvents(enteringEl, leavingEl);\n return {\n hasCompleted: true,\n };\n};\nconst waitForReady = async (opts, defaultDeep) => {\n const deep = opts.deepWait !== undefined ? opts.deepWait : defaultDeep;\n const promises = deep\n ? [deepReady(opts.enteringEl), deepReady(opts.leavingEl)]\n : [shallowReady(opts.enteringEl), shallowReady(opts.leavingEl)];\n await Promise.all(promises);\n await notifyViewReady(opts.viewIsReady, opts.enteringEl);\n};\nconst notifyViewReady = async (viewIsReady, enteringEl) => {\n if (viewIsReady) {\n await viewIsReady(enteringEl);\n }\n};\nconst playTransition = (trans, opts) => {\n const progressCallback = opts.progressCallback;\n const promise = new Promise((resolve) => {\n trans.onFinish((currentStep) => resolve(currentStep === 1));\n });\n // cool, let's do this, start the transition\n if (progressCallback) {\n // this is a swipe to go back, just get the transition progress ready\n // kick off the swipe animation start\n trans.progressStart(true);\n progressCallback(trans);\n }\n else {\n // only the top level transition should actually start \"play\"\n // kick it off and let it play through\n // ******** DOM WRITE ****************\n trans.play();\n }\n // create a callback for when the animation is done\n return promise;\n};\nconst fireWillEvents = (enteringEl, leavingEl) => {\n lifecycle(leavingEl, LIFECYCLE_WILL_LEAVE);\n lifecycle(enteringEl, LIFECYCLE_WILL_ENTER);\n};\nconst fireDidEvents = (enteringEl, leavingEl) => {\n lifecycle(enteringEl, LIFECYCLE_DID_ENTER);\n lifecycle(leavingEl, LIFECYCLE_DID_LEAVE);\n};\nconst lifecycle = (el, eventName) => {\n if (el) {\n const ev = new CustomEvent(eventName, {\n bubbles: false,\n cancelable: false,\n });\n el.dispatchEvent(ev);\n }\n};\nconst shallowReady = (el) => {\n if (el) {\n return new Promise((resolve) => componentOnReady(el, resolve));\n }\n return Promise.resolve();\n};\nconst deepReady = async (el) => {\n const element = el;\n if (element) {\n if (element.componentOnReady != null) {\n // eslint-disable-next-line custom-rules/no-component-on-ready-method\n const stencilEl = await element.componentOnReady();\n if (stencilEl != null) {\n return;\n }\n /**\n * Custom elements in Stencil will have __registerHost.\n */\n }\n else if (element.__registerHost != null) {\n /**\n * Non-lazy loaded custom elements need to wait\n * one frame for component to be loaded.\n */\n const waitForCustomElement = new Promise((resolve) => raf(resolve));\n await waitForCustomElement;\n return;\n }\n await Promise.all(Array.from(element.children).map(deepReady));\n }\n};\nconst setPageHidden = (el, hidden) => {\n if (hidden) {\n el.setAttribute('aria-hidden', 'true');\n el.classList.add('ion-page-hidden');\n }\n else {\n el.hidden = false;\n el.removeAttribute('aria-hidden');\n el.classList.remove('ion-page-hidden');\n }\n};\nconst setZIndex = (enteringEl, leavingEl, direction) => {\n if (enteringEl !== undefined) {\n enteringEl.style.zIndex = direction === 'back' ? '99' : '101';\n }\n if (leavingEl !== undefined) {\n leavingEl.style.zIndex = '100';\n }\n};\nconst getIonPageElement = (element) => {\n if (element.classList.contains('ion-page')) {\n return element;\n }\n const ionPage = element.querySelector(':scope > .ion-page, :scope > ion-nav, :scope > ion-tabs');\n if (ionPage) {\n return ionPage;\n }\n // idk, return the original element so at least something animates and we don't have a null pointer\n return element;\n};\n\nexport { LIFECYCLE_WILL_ENTER as L, LIFECYCLE_DID_ENTER as a, LIFECYCLE_WILL_LEAVE as b, LIFECYCLE_DID_LEAVE as c, LIFECYCLE_WILL_UNLOAD as d, deepReady as e, getIonPageElement as g, lifecycle as l, setPageHidden as s, transition as t };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nexport { c as createAnimation } from './animation-e5036198.js';\nexport { iosTransitionAnimation } from './ios.transition-add97167.js';\nexport { mdTransitionAnimation } from './md.transition-41d5d0e3.js';\nexport { g as getTimeGivenProgression } from './cubic-bezier-c313947a.js';\nexport { createGesture } from './index-f8d8aa5a.js';\nexport { g as getPlatforms, i as initialize, a as isPlatform } from './ionic-global-c95cf239.js';\nimport { a as addEventListener, r as raf, b as removeEventListener } from './helpers-2914b3be.js';\nexport { c as componentOnReady } from './helpers-2914b3be.js';\nexport { I as IonicSafeString } from './index-dff497fb.js';\nexport { a as LIFECYCLE_DID_ENTER, c as LIFECYCLE_DID_LEAVE, L as LIFECYCLE_WILL_ENTER, b as LIFECYCLE_WILL_LEAVE, d as LIFECYCLE_WILL_UNLOAD } from './index-fbafcf43.js';\nexport { m as menuController } from './index-32d8f55c.js';\nexport { b as actionSheetController, a as alertController, l as loadingController, m as modalController, p as pickerController, c as popoverController, t as toastController } from './overlays-6ab11907.js';\nimport './index-33ffec25.js';\nimport './gesture-controller-17060b7c.js';\nimport './index-8e692445.js';\nimport './hardware-back-button-490df115.js';\n\nconst setupConfig = (config) => {\n const win = window;\n const Ionic = win.Ionic;\n // eslint-disable-next-line @typescript-eslint/prefer-optional-chain\n if (Ionic && Ionic.config && Ionic.config.constructor.name !== 'Object') {\n return;\n }\n win.Ionic = win.Ionic || {};\n win.Ionic.config = Object.assign(Object.assign({}, win.Ionic.config), config);\n return win.Ionic.config;\n};\nconst getMode = () => {\n var _a;\n const win = window;\n const config = (_a = win === null || win === void 0 ? void 0 : win.Ionic) === null || _a === void 0 ? void 0 : _a.config;\n if (config) {\n if (config.mode) {\n return config.mode;\n }\n else {\n return config.get('mode');\n }\n }\n return 'md';\n};\n\n/**\n * This is a plugin for Swiper that allows it to work\n * with Ionic Framework and the routing integrations.\n * Without this plugin, Swiper would be incapable of correctly\n * determining the dimensions of the slides component as\n * each view is initially hidden before transitioning in.\n */\nconst setupSwiperInIonic = (swiper, watchForIonPageChanges = true) => {\n if (typeof window === 'undefined') {\n return;\n }\n const swiperEl = swiper.el;\n const ionPage = swiperEl.closest('.ion-page');\n if (!ionPage) {\n if (watchForIonPageChanges) {\n /**\n * If no ion page found, it is possible\n * that we are in the overlay setup step\n * where the inner component has been\n * created but not attached to the DOM yet.\n * If so, wait for the .ion-page class to\n * appear on the root div and re-run setup.\n */\n const rootNode = swiperEl.getRootNode();\n if (rootNode.tagName === 'DIV') {\n const mo = new MutationObserver((m) => {\n const mutation = m[0];\n const wasEmpty = mutation.oldValue === null;\n const hasIonPage = rootNode.classList.contains('ion-page');\n /**\n * Now that we have an .ion-page class\n * we can safely attempt setup again.\n */\n if (wasEmpty && hasIonPage) {\n mo.disconnect();\n /**\n * Set false here so we do not\n * get infinite loops\n */\n setupSwiperInIonic(swiper, false);\n }\n });\n mo.observe(rootNode, {\n attributeFilter: ['class'],\n attributeOldValue: true,\n });\n }\n }\n return;\n }\n /**\n * If using slides in a modal or\n * popover we need to wait for the\n * overlay to be shown as these components\n * are hidden when they are initially created.\n */\n const modalOrPopover = swiperEl.closest('ion-modal, ion-popover');\n if (modalOrPopover) {\n const eventName = modalOrPopover.tagName === 'ION-MODAL' ? 'ionModalWillPresent' : 'ionPopoverWillPresent';\n const overlayCallback = () => {\n /**\n * We need an raf here so the update\n * is fired one tick after the overlay is shown.\n */\n raf(() => {\n swiperEl.swiper.update();\n removeEventListener(modalOrPopover, eventName, overlayCallback);\n });\n };\n addEventListener(modalOrPopover, eventName, overlayCallback);\n }\n else {\n /**\n * If using slides in a page\n * we need to wait for the ion-page-invisible\n * class to be removed so Swiper can correctly\n * compute the dimensions of the slides.\n */\n const mo = new MutationObserver((m) => {\n var _a;\n const mutation = m[0];\n const wasPageHidden = (_a = mutation.oldValue) === null || _a === void 0 ? void 0 : _a.includes('ion-page-invisible');\n const isPageHidden = ionPage.classList.contains('ion-page-invisible');\n /**\n * Only update Swiper if the page was\n * hidden but is no longer hidden.\n */\n if (!isPageHidden && isPageHidden !== wasPageHidden) {\n swiperEl.swiper.update();\n }\n });\n mo.observe(ionPage, {\n attributeFilter: ['class'],\n attributeOldValue: true,\n });\n }\n /**\n * We also need to listen for the appload event\n * which is emitted by Stencil in the\n * event that Swiper is being used on the\n * view that is rendered initially.\n */\n const onAppLoad = () => {\n swiperEl.swiper.update();\n removeEventListener(window, 'appload', onAppLoad);\n };\n addEventListener(window, 'appload', onAppLoad);\n};\nconst IonicSwiper = {\n name: 'ionic',\n on: {\n afterInit(swiper) {\n console.warn('[Deprecation Warning]: The IonicSwiper module has been deprecated in favor of the IonSlides module. This change was made to better support the Swiper 7 release. The IonicSwiper module will be removed in Ionic 7.0. See https://ionicframework.com/docs/api/slides#migration for revised migration steps.');\n setupSwiperInIonic(swiper);\n },\n },\n};\n\nconst IonicSlides = (opts) => {\n const { swiper, extendParams } = opts;\n const slidesParams = {\n effect: undefined,\n direction: 'horizontal',\n initialSlide: 0,\n loop: false,\n parallax: false,\n slidesPerView: 1,\n spaceBetween: 0,\n speed: 300,\n slidesPerColumn: 1,\n slidesPerColumnFill: 'column',\n slidesPerGroup: 1,\n centeredSlides: false,\n slidesOffsetBefore: 0,\n slidesOffsetAfter: 0,\n touchEventsTarget: 'container',\n autoplay: false,\n freeMode: false,\n freeModeMomentum: true,\n freeModeMomentumRatio: 1,\n freeModeMomentumBounce: true,\n freeModeMomentumBounceRatio: 1,\n freeModeMomentumVelocityRatio: 1,\n freeModeSticky: false,\n freeModeMinimumVelocity: 0.02,\n autoHeight: false,\n setWrapperSize: false,\n zoom: {\n maxRatio: 3,\n minRatio: 1,\n toggle: false,\n },\n touchRatio: 1,\n touchAngle: 45,\n simulateTouch: true,\n touchStartPreventDefault: false,\n shortSwipes: true,\n longSwipes: true,\n longSwipesRatio: 0.5,\n longSwipesMs: 300,\n followFinger: true,\n threshold: 0,\n touchMoveStopPropagation: true,\n touchReleaseOnEdges: false,\n iOSEdgeSwipeDetection: false,\n iOSEdgeSwipeThreshold: 20,\n resistance: true,\n resistanceRatio: 0.85,\n watchSlidesProgress: false,\n watchSlidesVisibility: false,\n preventClicks: true,\n preventClicksPropagation: true,\n slideToClickedSlide: false,\n loopAdditionalSlides: 0,\n noSwiping: true,\n runCallbacksOnInit: true,\n coverflowEffect: {\n rotate: 50,\n stretch: 0,\n depth: 100,\n modifier: 1,\n slideShadows: true,\n },\n flipEffect: {\n slideShadows: true,\n limitRotation: true,\n },\n cubeEffect: {\n slideShadows: true,\n shadow: true,\n shadowOffset: 20,\n shadowScale: 0.94,\n },\n fadeEffect: {\n crossFade: false,\n },\n a11y: {\n prevSlideMessage: 'Previous slide',\n nextSlideMessage: 'Next slide',\n firstSlideMessage: 'This is the first slide',\n lastSlideMessage: 'This is the last slide',\n },\n };\n if (swiper.pagination) {\n slidesParams.pagination = {\n type: 'bullets',\n clickable: false,\n hideOnClick: false,\n };\n }\n if (swiper.scrollbar) {\n slidesParams.scrollbar = {\n hide: true,\n };\n }\n extendParams(slidesParams);\n};\n\nexport { IonicSlides, IonicSwiper, getMode, setupConfig };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { s as setPlatformHelpers, g as getMode, a as setMode } from './index-8e692445.js';\n\nclass Config {\n constructor() {\n this.m = new Map();\n }\n reset(configObj) {\n this.m = new Map(Object.entries(configObj));\n }\n get(key, fallback) {\n const value = this.m.get(key);\n return value !== undefined ? value : fallback;\n }\n getBoolean(key, fallback = false) {\n const val = this.m.get(key);\n if (val === undefined) {\n return fallback;\n }\n if (typeof val === 'string') {\n return val === 'true';\n }\n return !!val;\n }\n getNumber(key, fallback) {\n const val = parseFloat(this.m.get(key));\n return isNaN(val) ? (fallback !== undefined ? fallback : NaN) : val;\n }\n set(key, value) {\n this.m.set(key, value);\n }\n}\nconst config = /*@__PURE__*/ new Config();\nconst configFromSession = (win) => {\n try {\n const configStr = win.sessionStorage.getItem(IONIC_SESSION_KEY);\n return configStr !== null ? JSON.parse(configStr) : {};\n }\n catch (e) {\n return {};\n }\n};\nconst saveConfig = (win, c) => {\n try {\n win.sessionStorage.setItem(IONIC_SESSION_KEY, JSON.stringify(c));\n }\n catch (e) {\n return;\n }\n};\nconst configFromURL = (win) => {\n const configObj = {};\n win.location.search\n .slice(1)\n .split('&')\n .map((entry) => entry.split('='))\n .map(([key, value]) => [decodeURIComponent(key), decodeURIComponent(value)])\n .filter(([key]) => startsWith(key, IONIC_PREFIX))\n .map(([key, value]) => [key.slice(IONIC_PREFIX.length), value])\n .forEach(([key, value]) => {\n configObj[key] = value;\n });\n return configObj;\n};\nconst startsWith = (input, search) => {\n return input.substr(0, search.length) === search;\n};\nconst IONIC_PREFIX = 'ionic:';\nconst IONIC_SESSION_KEY = 'ionic-persist-config';\n\nconst getPlatforms = (win) => setupPlatforms(win);\nconst isPlatform = (winOrPlatform, platform) => {\n if (typeof winOrPlatform === 'string') {\n platform = winOrPlatform;\n winOrPlatform = undefined;\n }\n return getPlatforms(winOrPlatform).includes(platform);\n};\nconst setupPlatforms = (win = window) => {\n if (typeof win === 'undefined') {\n return [];\n }\n win.Ionic = win.Ionic || {};\n let platforms = win.Ionic.platforms;\n if (platforms == null) {\n platforms = win.Ionic.platforms = detectPlatforms(win);\n platforms.forEach((p) => win.document.documentElement.classList.add(`plt-${p}`));\n }\n return platforms;\n};\nconst detectPlatforms = (win) => {\n const customPlatformMethods = config.get('platform');\n return Object.keys(PLATFORMS_MAP).filter((p) => {\n const customMethod = customPlatformMethods === null || customPlatformMethods === void 0 ? void 0 : customPlatformMethods[p];\n return typeof customMethod === 'function' ? customMethod(win) : PLATFORMS_MAP[p](win);\n });\n};\nconst isMobileWeb = (win) => isMobile(win) && !isHybrid(win);\nconst isIpad = (win) => {\n // iOS 12 and below\n if (testUserAgent(win, /iPad/i)) {\n return true;\n }\n // iOS 13+\n if (testUserAgent(win, /Macintosh/i) && isMobile(win)) {\n return true;\n }\n return false;\n};\nconst isIphone = (win) => testUserAgent(win, /iPhone/i);\nconst isIOS = (win) => testUserAgent(win, /iPhone|iPod/i) || isIpad(win);\nconst isAndroid = (win) => testUserAgent(win, /android|sink/i);\nconst isAndroidTablet = (win) => {\n return isAndroid(win) && !testUserAgent(win, /mobile/i);\n};\nconst isPhablet = (win) => {\n const width = win.innerWidth;\n const height = win.innerHeight;\n const smallest = Math.min(width, height);\n const largest = Math.max(width, height);\n return smallest > 390 && smallest < 520 && largest > 620 && largest < 800;\n};\nconst isTablet = (win) => {\n const width = win.innerWidth;\n const height = win.innerHeight;\n const smallest = Math.min(width, height);\n const largest = Math.max(width, height);\n return isIpad(win) || isAndroidTablet(win) || (smallest > 460 && smallest < 820 && largest > 780 && largest < 1400);\n};\nconst isMobile = (win) => matchMedia(win, '(any-pointer:coarse)');\nconst isDesktop = (win) => !isMobile(win);\nconst isHybrid = (win) => isCordova(win) || isCapacitorNative(win);\nconst isCordova = (win) => !!(win['cordova'] || win['phonegap'] || win['PhoneGap']);\nconst isCapacitorNative = (win) => {\n const capacitor = win['Capacitor'];\n return !!(capacitor === null || capacitor === void 0 ? void 0 : capacitor.isNative);\n};\nconst isElectron = (win) => testUserAgent(win, /electron/i);\nconst isPWA = (win) => { var _a; return !!(((_a = win.matchMedia) === null || _a === void 0 ? void 0 : _a.call(win, '(display-mode: standalone)').matches) || win.navigator.standalone); };\nconst testUserAgent = (win, expr) => expr.test(win.navigator.userAgent);\nconst matchMedia = (win, query) => { var _a; return (_a = win.matchMedia) === null || _a === void 0 ? void 0 : _a.call(win, query).matches; };\nconst PLATFORMS_MAP = {\n ipad: isIpad,\n iphone: isIphone,\n ios: isIOS,\n android: isAndroid,\n phablet: isPhablet,\n tablet: isTablet,\n cordova: isCordova,\n capacitor: isCapacitorNative,\n electron: isElectron,\n pwa: isPWA,\n mobile: isMobile,\n mobileweb: isMobileWeb,\n desktop: isDesktop,\n hybrid: isHybrid,\n};\n\nlet defaultMode;\nconst getIonMode = (ref) => {\n return (ref && getMode(ref)) || defaultMode;\n};\nconst initialize = (userConfig = {}) => {\n if (typeof window === 'undefined') {\n return;\n }\n const doc = window.document;\n const win = window;\n const Ionic = (win.Ionic = win.Ionic || {});\n const platformHelpers = {};\n if (userConfig._ael) {\n platformHelpers.ael = userConfig._ael;\n }\n if (userConfig._rel) {\n platformHelpers.rel = userConfig._rel;\n }\n if (userConfig._ce) {\n platformHelpers.ce = userConfig._ce;\n }\n setPlatformHelpers(platformHelpers);\n // create the Ionic.config from raw config object (if it exists)\n // and convert Ionic.config into a ConfigApi that has a get() fn\n const configObj = Object.assign(Object.assign(Object.assign(Object.assign(Object.assign({}, configFromSession(win)), { persistConfig: false }), Ionic.config), configFromURL(win)), userConfig);\n config.reset(configObj);\n if (config.getBoolean('persistConfig')) {\n saveConfig(win, configObj);\n }\n // Setup platforms\n setupPlatforms(win);\n // first see if the mode was set as an attribute on \n // which could have been set by the user, or by pre-rendering\n // otherwise get the mode via config settings, and fallback to md\n Ionic.config = config;\n Ionic.mode = defaultMode = config.get('mode', doc.documentElement.getAttribute('mode') || (isPlatform(win, 'ios') ? 'ios' : 'md'));\n config.set('mode', defaultMode);\n doc.documentElement.setAttribute('mode', defaultMode);\n doc.documentElement.classList.add(defaultMode);\n if (config.getBoolean('_testing')) {\n config.set('animated', false);\n }\n const isIonicElement = (elm) => { var _a; return (_a = elm.tagName) === null || _a === void 0 ? void 0 : _a.startsWith('ION-'); };\n const isAllowedIonicModeValue = (elmMode) => ['ios', 'md'].includes(elmMode);\n setMode((elm) => {\n while (elm) {\n const elmMode = elm.mode || elm.getAttribute('mode');\n if (elmMode) {\n if (isAllowedIonicModeValue(elmMode)) {\n return elmMode;\n }\n else if (isIonicElement(elm)) {\n console.warn('Invalid ionic mode: \"' + elmMode + '\", expected: \"ios\" or \"md\"');\n }\n }\n elm = elm.parentElement;\n }\n return defaultMode;\n });\n};\n\nexport { isPlatform as a, getIonMode as b, config as c, getPlatforms as g, initialize as i };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { c as createAnimation } from './animation-e5036198.js';\nimport { g as getIonPageElement } from './index-fbafcf43.js';\nimport './helpers-2914b3be.js';\nimport './index-33ffec25.js';\nimport './index-8e692445.js';\n\nconst DURATION = 540;\nconst getClonedElement = (tagName) => {\n return document.querySelector(`${tagName}.ion-cloned-element`);\n};\nconst shadow = (el) => {\n return el.shadowRoot || el;\n};\nconst getLargeTitle = (refEl) => {\n const tabs = refEl.tagName === 'ION-TABS' ? refEl : refEl.querySelector('ion-tabs');\n const query = 'ion-content ion-header:not(.header-collapse-condense-inactive) ion-title.title-large';\n if (tabs != null) {\n const activeTab = tabs.querySelector('ion-tab:not(.tab-hidden), .ion-page:not(.ion-page-hidden)');\n return activeTab != null ? activeTab.querySelector(query) : null;\n }\n return refEl.querySelector(query);\n};\nconst getBackButton = (refEl, backDirection) => {\n const tabs = refEl.tagName === 'ION-TABS' ? refEl : refEl.querySelector('ion-tabs');\n let buttonsList = [];\n if (tabs != null) {\n const activeTab = tabs.querySelector('ion-tab:not(.tab-hidden), .ion-page:not(.ion-page-hidden)');\n if (activeTab != null) {\n buttonsList = activeTab.querySelectorAll('ion-buttons');\n }\n }\n else {\n buttonsList = refEl.querySelectorAll('ion-buttons');\n }\n for (const buttons of buttonsList) {\n const parentHeader = buttons.closest('ion-header');\n const activeHeader = parentHeader && !parentHeader.classList.contains('header-collapse-condense-inactive');\n const backButton = buttons.querySelector('ion-back-button');\n const buttonsCollapse = buttons.classList.contains('buttons-collapse');\n const startSlot = buttons.slot === 'start' || buttons.slot === '';\n if (backButton !== null && startSlot && ((buttonsCollapse && activeHeader && backDirection) || !buttonsCollapse)) {\n return backButton;\n }\n }\n return null;\n};\nconst createLargeTitleTransition = (rootAnimation, rtl, backDirection, enteringEl, leavingEl) => {\n const enteringBackButton = getBackButton(enteringEl, backDirection);\n const leavingLargeTitle = getLargeTitle(leavingEl);\n const enteringLargeTitle = getLargeTitle(enteringEl);\n const leavingBackButton = getBackButton(leavingEl, backDirection);\n const shouldAnimationForward = enteringBackButton !== null && leavingLargeTitle !== null && !backDirection;\n const shouldAnimationBackward = enteringLargeTitle !== null && leavingBackButton !== null && backDirection;\n if (shouldAnimationForward) {\n const leavingLargeTitleBox = leavingLargeTitle.getBoundingClientRect();\n const enteringBackButtonBox = enteringBackButton.getBoundingClientRect();\n animateLargeTitle(rootAnimation, rtl, backDirection, leavingLargeTitle, leavingLargeTitleBox, enteringBackButtonBox);\n animateBackButton(rootAnimation, rtl, backDirection, enteringBackButton, leavingLargeTitleBox, enteringBackButtonBox);\n }\n else if (shouldAnimationBackward) {\n const enteringLargeTitleBox = enteringLargeTitle.getBoundingClientRect();\n const leavingBackButtonBox = leavingBackButton.getBoundingClientRect();\n animateLargeTitle(rootAnimation, rtl, backDirection, enteringLargeTitle, enteringLargeTitleBox, leavingBackButtonBox);\n animateBackButton(rootAnimation, rtl, backDirection, leavingBackButton, enteringLargeTitleBox, leavingBackButtonBox);\n }\n return {\n forward: shouldAnimationForward,\n backward: shouldAnimationBackward,\n };\n};\nconst animateBackButton = (rootAnimation, rtl, backDirection, backButtonEl, largeTitleBox, backButtonBox) => {\n const BACK_BUTTON_START_OFFSET = rtl ? `calc(100% - ${backButtonBox.right + 4}px)` : `${backButtonBox.left - 4}px`;\n const START_TEXT_TRANSLATE = rtl ? '7px' : '-7px';\n const END_TEXT_TRANSLATE = rtl ? '-4px' : '4px';\n const ICON_TRANSLATE = rtl ? '-4px' : '4px';\n const TEXT_ORIGIN_X = rtl ? 'right' : 'left';\n const ICON_ORIGIN_X = rtl ? 'left' : 'right';\n const FORWARD_TEXT_KEYFRAMES = [\n {\n offset: 0,\n opacity: 0,\n transform: `translate3d(${START_TEXT_TRANSLATE}, ${largeTitleBox.top - 40}px, 0) scale(2.1)`,\n },\n { offset: 1, opacity: 1, transform: `translate3d(${END_TEXT_TRANSLATE}, ${backButtonBox.top - 46}px, 0) scale(1)` },\n ];\n const BACKWARD_TEXT_KEYFRAMES = [\n { offset: 0, opacity: 1, transform: `translate3d(${END_TEXT_TRANSLATE}, ${backButtonBox.top - 46}px, 0) scale(1)` },\n { offset: 0.6, opacity: 0 },\n {\n offset: 1,\n opacity: 0,\n transform: `translate3d(${START_TEXT_TRANSLATE}, ${largeTitleBox.top - 40}px, 0) scale(2.1)`,\n },\n ];\n const TEXT_KEYFRAMES = backDirection ? BACKWARD_TEXT_KEYFRAMES : FORWARD_TEXT_KEYFRAMES;\n const FORWARD_ICON_KEYFRAMES = [\n { offset: 0, opacity: 0, transform: `translate3d(${ICON_TRANSLATE}, ${backButtonBox.top - 41}px, 0) scale(0.6)` },\n { offset: 1, opacity: 1, transform: `translate3d(${ICON_TRANSLATE}, ${backButtonBox.top - 46}px, 0) scale(1)` },\n ];\n const BACKWARD_ICON_KEYFRAMES = [\n { offset: 0, opacity: 1, transform: `translate3d(${ICON_TRANSLATE}, ${backButtonBox.top - 46}px, 0) scale(1)` },\n { offset: 0.2, opacity: 0, transform: `translate3d(${ICON_TRANSLATE}, ${backButtonBox.top - 41}px, 0) scale(0.6)` },\n { offset: 1, opacity: 0, transform: `translate3d(${ICON_TRANSLATE}, ${backButtonBox.top - 41}px, 0) scale(0.6)` },\n ];\n const ICON_KEYFRAMES = backDirection ? BACKWARD_ICON_KEYFRAMES : FORWARD_ICON_KEYFRAMES;\n const enteringBackButtonTextAnimation = createAnimation();\n const enteringBackButtonIconAnimation = createAnimation();\n const clonedBackButtonEl = getClonedElement('ion-back-button');\n const backButtonTextEl = shadow(clonedBackButtonEl).querySelector('.button-text');\n const backButtonIconEl = shadow(clonedBackButtonEl).querySelector('ion-icon');\n clonedBackButtonEl.text = backButtonEl.text;\n clonedBackButtonEl.mode = backButtonEl.mode;\n clonedBackButtonEl.icon = backButtonEl.icon;\n clonedBackButtonEl.color = backButtonEl.color;\n clonedBackButtonEl.disabled = backButtonEl.disabled;\n clonedBackButtonEl.style.setProperty('display', 'block');\n clonedBackButtonEl.style.setProperty('position', 'fixed');\n enteringBackButtonIconAnimation.addElement(backButtonIconEl);\n enteringBackButtonTextAnimation.addElement(backButtonTextEl);\n enteringBackButtonTextAnimation\n .beforeStyles({\n 'transform-origin': `${TEXT_ORIGIN_X} center`,\n })\n .beforeAddWrite(() => {\n backButtonEl.style.setProperty('display', 'none');\n clonedBackButtonEl.style.setProperty(TEXT_ORIGIN_X, BACK_BUTTON_START_OFFSET);\n })\n .afterAddWrite(() => {\n backButtonEl.style.setProperty('display', '');\n clonedBackButtonEl.style.setProperty('display', 'none');\n clonedBackButtonEl.style.removeProperty(TEXT_ORIGIN_X);\n })\n .keyframes(TEXT_KEYFRAMES);\n enteringBackButtonIconAnimation\n .beforeStyles({\n 'transform-origin': `${ICON_ORIGIN_X} center`,\n })\n .keyframes(ICON_KEYFRAMES);\n rootAnimation.addAnimation([enteringBackButtonTextAnimation, enteringBackButtonIconAnimation]);\n};\nconst animateLargeTitle = (rootAnimation, rtl, backDirection, largeTitleEl, largeTitleBox, backButtonBox) => {\n const TITLE_START_OFFSET = rtl ? `calc(100% - ${largeTitleBox.right}px)` : `${largeTitleBox.left}px`;\n const START_TRANSLATE = rtl ? '-18px' : '18px';\n const ORIGIN_X = rtl ? 'right' : 'left';\n const BACKWARDS_KEYFRAMES = [\n { offset: 0, opacity: 0, transform: `translate3d(${START_TRANSLATE}, ${backButtonBox.top - 4}px, 0) scale(0.49)` },\n { offset: 0.1, opacity: 0 },\n { offset: 1, opacity: 1, transform: `translate3d(0, ${largeTitleBox.top - 2}px, 0) scale(1)` },\n ];\n const FORWARDS_KEYFRAMES = [\n { offset: 0, opacity: 0.99, transform: `translate3d(0, ${largeTitleBox.top - 2}px, 0) scale(1)` },\n { offset: 0.6, opacity: 0 },\n { offset: 1, opacity: 0, transform: `translate3d(${START_TRANSLATE}, ${backButtonBox.top - 4}px, 0) scale(0.5)` },\n ];\n const KEYFRAMES = backDirection ? BACKWARDS_KEYFRAMES : FORWARDS_KEYFRAMES;\n const clonedTitleEl = getClonedElement('ion-title');\n const clonedLargeTitleAnimation = createAnimation();\n clonedTitleEl.innerText = largeTitleEl.innerText;\n clonedTitleEl.size = largeTitleEl.size;\n clonedTitleEl.color = largeTitleEl.color;\n clonedLargeTitleAnimation.addElement(clonedTitleEl);\n clonedLargeTitleAnimation\n .beforeStyles({\n 'transform-origin': `${ORIGIN_X} center`,\n height: '46px',\n display: '',\n position: 'relative',\n [ORIGIN_X]: TITLE_START_OFFSET,\n })\n .beforeAddWrite(() => {\n largeTitleEl.style.setProperty('display', 'none');\n })\n .afterAddWrite(() => {\n largeTitleEl.style.setProperty('display', '');\n clonedTitleEl.style.setProperty('display', 'none');\n })\n .keyframes(KEYFRAMES);\n rootAnimation.addAnimation(clonedLargeTitleAnimation);\n};\nconst iosTransitionAnimation = (navEl, opts) => {\n var _a;\n try {\n const EASING = 'cubic-bezier(0.32,0.72,0,1)';\n const OPACITY = 'opacity';\n const TRANSFORM = 'transform';\n const CENTER = '0%';\n const OFF_OPACITY = 0.8;\n const isRTL = navEl.ownerDocument.dir === 'rtl';\n const OFF_RIGHT = isRTL ? '-99.5%' : '99.5%';\n const OFF_LEFT = isRTL ? '33%' : '-33%';\n const enteringEl = opts.enteringEl;\n const leavingEl = opts.leavingEl;\n const backDirection = opts.direction === 'back';\n const contentEl = enteringEl.querySelector(':scope > ion-content');\n const headerEls = enteringEl.querySelectorAll(':scope > ion-header > *:not(ion-toolbar), :scope > ion-footer > *');\n const enteringToolBarEls = enteringEl.querySelectorAll(':scope > ion-header > ion-toolbar');\n const rootAnimation = createAnimation();\n const enteringContentAnimation = createAnimation();\n rootAnimation\n .addElement(enteringEl)\n .duration(((_a = opts.duration) !== null && _a !== void 0 ? _a : 0) || DURATION)\n .easing(opts.easing || EASING)\n .fill('both')\n .beforeRemoveClass('ion-page-invisible');\n if (leavingEl && navEl !== null && navEl !== undefined) {\n const navDecorAnimation = createAnimation();\n navDecorAnimation.addElement(navEl);\n rootAnimation.addAnimation(navDecorAnimation);\n }\n if (!contentEl && enteringToolBarEls.length === 0 && headerEls.length === 0) {\n enteringContentAnimation.addElement(enteringEl.querySelector(':scope > .ion-page, :scope > ion-nav, :scope > ion-tabs')); // REVIEW\n }\n else {\n enteringContentAnimation.addElement(contentEl); // REVIEW\n enteringContentAnimation.addElement(headerEls);\n }\n rootAnimation.addAnimation(enteringContentAnimation);\n if (backDirection) {\n enteringContentAnimation\n .beforeClearStyles([OPACITY])\n .fromTo('transform', `translateX(${OFF_LEFT})`, `translateX(${CENTER})`)\n .fromTo(OPACITY, OFF_OPACITY, 1);\n }\n else {\n // entering content, forward direction\n enteringContentAnimation\n .beforeClearStyles([OPACITY])\n .fromTo('transform', `translateX(${OFF_RIGHT})`, `translateX(${CENTER})`);\n }\n if (contentEl) {\n const enteringTransitionEffectEl = shadow(contentEl).querySelector('.transition-effect');\n if (enteringTransitionEffectEl) {\n const enteringTransitionCoverEl = enteringTransitionEffectEl.querySelector('.transition-cover');\n const enteringTransitionShadowEl = enteringTransitionEffectEl.querySelector('.transition-shadow');\n const enteringTransitionEffect = createAnimation();\n const enteringTransitionCover = createAnimation();\n const enteringTransitionShadow = createAnimation();\n enteringTransitionEffect\n .addElement(enteringTransitionEffectEl)\n .beforeStyles({ opacity: '1', display: 'block' })\n .afterStyles({ opacity: '', display: '' });\n enteringTransitionCover\n .addElement(enteringTransitionCoverEl) // REVIEW\n .beforeClearStyles([OPACITY])\n .fromTo(OPACITY, 0, 0.1);\n enteringTransitionShadow\n .addElement(enteringTransitionShadowEl) // REVIEW\n .beforeClearStyles([OPACITY])\n .fromTo(OPACITY, 0.03, 0.7);\n enteringTransitionEffect.addAnimation([enteringTransitionCover, enteringTransitionShadow]);\n enteringContentAnimation.addAnimation([enteringTransitionEffect]);\n }\n }\n const enteringContentHasLargeTitle = enteringEl.querySelector('ion-header.header-collapse-condense');\n const { forward, backward } = createLargeTitleTransition(rootAnimation, isRTL, backDirection, enteringEl, leavingEl);\n enteringToolBarEls.forEach((enteringToolBarEl) => {\n const enteringToolBar = createAnimation();\n enteringToolBar.addElement(enteringToolBarEl);\n rootAnimation.addAnimation(enteringToolBar);\n const enteringTitle = createAnimation();\n enteringTitle.addElement(enteringToolBarEl.querySelector('ion-title')); // REVIEW\n const enteringToolBarButtons = createAnimation();\n const buttons = Array.from(enteringToolBarEl.querySelectorAll('ion-buttons,[menuToggle]'));\n const parentHeader = enteringToolBarEl.closest('ion-header');\n const inactiveHeader = parentHeader === null || parentHeader === void 0 ? void 0 : parentHeader.classList.contains('header-collapse-condense-inactive');\n let buttonsToAnimate;\n if (backDirection) {\n buttonsToAnimate = buttons.filter((button) => {\n const isCollapseButton = button.classList.contains('buttons-collapse');\n return (isCollapseButton && !inactiveHeader) || !isCollapseButton;\n });\n }\n else {\n buttonsToAnimate = buttons.filter((button) => !button.classList.contains('buttons-collapse'));\n }\n enteringToolBarButtons.addElement(buttonsToAnimate);\n const enteringToolBarItems = createAnimation();\n enteringToolBarItems.addElement(enteringToolBarEl.querySelectorAll(':scope > *:not(ion-title):not(ion-buttons):not([menuToggle])'));\n const enteringToolBarBg = createAnimation();\n enteringToolBarBg.addElement(shadow(enteringToolBarEl).querySelector('.toolbar-background')); // REVIEW\n const enteringBackButton = createAnimation();\n const backButtonEl = enteringToolBarEl.querySelector('ion-back-button');\n if (backButtonEl) {\n enteringBackButton.addElement(backButtonEl);\n }\n enteringToolBar.addAnimation([\n enteringTitle,\n enteringToolBarButtons,\n enteringToolBarItems,\n enteringToolBarBg,\n enteringBackButton,\n ]);\n enteringToolBarButtons.fromTo(OPACITY, 0.01, 1);\n enteringToolBarItems.fromTo(OPACITY, 0.01, 1);\n if (backDirection) {\n if (!inactiveHeader) {\n enteringTitle\n .fromTo('transform', `translateX(${OFF_LEFT})`, `translateX(${CENTER})`)\n .fromTo(OPACITY, 0.01, 1);\n }\n enteringToolBarItems.fromTo('transform', `translateX(${OFF_LEFT})`, `translateX(${CENTER})`);\n // back direction, entering page has a back button\n enteringBackButton.fromTo(OPACITY, 0.01, 1);\n }\n else {\n // entering toolbar, forward direction\n if (!enteringContentHasLargeTitle) {\n enteringTitle\n .fromTo('transform', `translateX(${OFF_RIGHT})`, `translateX(${CENTER})`)\n .fromTo(OPACITY, 0.01, 1);\n }\n enteringToolBarItems.fromTo('transform', `translateX(${OFF_RIGHT})`, `translateX(${CENTER})`);\n enteringToolBarBg.beforeClearStyles([OPACITY, 'transform']);\n const translucentHeader = parentHeader === null || parentHeader === void 0 ? void 0 : parentHeader.translucent;\n if (!translucentHeader) {\n enteringToolBarBg.fromTo(OPACITY, 0.01, 'var(--opacity)');\n }\n else {\n enteringToolBarBg.fromTo('transform', isRTL ? 'translateX(-100%)' : 'translateX(100%)', 'translateX(0px)');\n }\n // forward direction, entering page has a back button\n if (!forward) {\n enteringBackButton.fromTo(OPACITY, 0.01, 1);\n }\n if (backButtonEl && !forward) {\n const enteringBackBtnText = createAnimation();\n enteringBackBtnText\n .addElement(shadow(backButtonEl).querySelector('.button-text')) // REVIEW\n .fromTo(`transform`, isRTL ? 'translateX(-100px)' : 'translateX(100px)', 'translateX(0px)');\n enteringToolBar.addAnimation(enteringBackBtnText);\n }\n }\n });\n // setup leaving view\n if (leavingEl) {\n const leavingContent = createAnimation();\n const leavingContentEl = leavingEl.querySelector(':scope > ion-content');\n const leavingToolBarEls = leavingEl.querySelectorAll(':scope > ion-header > ion-toolbar');\n const leavingHeaderEls = leavingEl.querySelectorAll(':scope > ion-header > *:not(ion-toolbar), :scope > ion-footer > *');\n if (!leavingContentEl && leavingToolBarEls.length === 0 && leavingHeaderEls.length === 0) {\n leavingContent.addElement(leavingEl.querySelector(':scope > .ion-page, :scope > ion-nav, :scope > ion-tabs')); // REVIEW\n }\n else {\n leavingContent.addElement(leavingContentEl); // REVIEW\n leavingContent.addElement(leavingHeaderEls);\n }\n rootAnimation.addAnimation(leavingContent);\n if (backDirection) {\n // leaving content, back direction\n leavingContent\n .beforeClearStyles([OPACITY])\n .fromTo('transform', `translateX(${CENTER})`, isRTL ? 'translateX(-100%)' : 'translateX(100%)');\n const leavingPage = getIonPageElement(leavingEl);\n rootAnimation.afterAddWrite(() => {\n if (rootAnimation.getDirection() === 'normal') {\n leavingPage.style.setProperty('display', 'none');\n }\n });\n }\n else {\n // leaving content, forward direction\n leavingContent\n .fromTo('transform', `translateX(${CENTER})`, `translateX(${OFF_LEFT})`)\n .fromTo(OPACITY, 1, OFF_OPACITY);\n }\n if (leavingContentEl) {\n const leavingTransitionEffectEl = shadow(leavingContentEl).querySelector('.transition-effect');\n if (leavingTransitionEffectEl) {\n const leavingTransitionCoverEl = leavingTransitionEffectEl.querySelector('.transition-cover');\n const leavingTransitionShadowEl = leavingTransitionEffectEl.querySelector('.transition-shadow');\n const leavingTransitionEffect = createAnimation();\n const leavingTransitionCover = createAnimation();\n const leavingTransitionShadow = createAnimation();\n leavingTransitionEffect\n .addElement(leavingTransitionEffectEl)\n .beforeStyles({ opacity: '1', display: 'block' })\n .afterStyles({ opacity: '', display: '' });\n leavingTransitionCover\n .addElement(leavingTransitionCoverEl) // REVIEW\n .beforeClearStyles([OPACITY])\n .fromTo(OPACITY, 0.1, 0);\n leavingTransitionShadow\n .addElement(leavingTransitionShadowEl) // REVIEW\n .beforeClearStyles([OPACITY])\n .fromTo(OPACITY, 0.7, 0.03);\n leavingTransitionEffect.addAnimation([leavingTransitionCover, leavingTransitionShadow]);\n leavingContent.addAnimation([leavingTransitionEffect]);\n }\n }\n leavingToolBarEls.forEach((leavingToolBarEl) => {\n const leavingToolBar = createAnimation();\n leavingToolBar.addElement(leavingToolBarEl);\n const leavingTitle = createAnimation();\n leavingTitle.addElement(leavingToolBarEl.querySelector('ion-title')); // REVIEW\n const leavingToolBarButtons = createAnimation();\n const buttons = leavingToolBarEl.querySelectorAll('ion-buttons,[menuToggle]');\n const parentHeader = leavingToolBarEl.closest('ion-header');\n const inactiveHeader = parentHeader === null || parentHeader === void 0 ? void 0 : parentHeader.classList.contains('header-collapse-condense-inactive');\n const buttonsToAnimate = Array.from(buttons).filter((button) => {\n const isCollapseButton = button.classList.contains('buttons-collapse');\n return (isCollapseButton && !inactiveHeader) || !isCollapseButton;\n });\n leavingToolBarButtons.addElement(buttonsToAnimate);\n const leavingToolBarItems = createAnimation();\n const leavingToolBarItemEls = leavingToolBarEl.querySelectorAll(':scope > *:not(ion-title):not(ion-buttons):not([menuToggle])');\n if (leavingToolBarItemEls.length > 0) {\n leavingToolBarItems.addElement(leavingToolBarItemEls);\n }\n const leavingToolBarBg = createAnimation();\n leavingToolBarBg.addElement(shadow(leavingToolBarEl).querySelector('.toolbar-background')); // REVIEW\n const leavingBackButton = createAnimation();\n const backButtonEl = leavingToolBarEl.querySelector('ion-back-button');\n if (backButtonEl) {\n leavingBackButton.addElement(backButtonEl);\n }\n leavingToolBar.addAnimation([\n leavingTitle,\n leavingToolBarButtons,\n leavingToolBarItems,\n leavingBackButton,\n leavingToolBarBg,\n ]);\n rootAnimation.addAnimation(leavingToolBar);\n // fade out leaving toolbar items\n leavingBackButton.fromTo(OPACITY, 0.99, 0);\n leavingToolBarButtons.fromTo(OPACITY, 0.99, 0);\n leavingToolBarItems.fromTo(OPACITY, 0.99, 0);\n if (backDirection) {\n if (!inactiveHeader) {\n // leaving toolbar, back direction\n leavingTitle\n .fromTo('transform', `translateX(${CENTER})`, isRTL ? 'translateX(-100%)' : 'translateX(100%)')\n .fromTo(OPACITY, 0.99, 0);\n }\n leavingToolBarItems.fromTo('transform', `translateX(${CENTER})`, isRTL ? 'translateX(-100%)' : 'translateX(100%)');\n leavingToolBarBg.beforeClearStyles([OPACITY, 'transform']);\n // leaving toolbar, back direction, and there's no entering toolbar\n // should just slide out, no fading out\n const translucentHeader = parentHeader === null || parentHeader === void 0 ? void 0 : parentHeader.translucent;\n if (!translucentHeader) {\n leavingToolBarBg.fromTo(OPACITY, 'var(--opacity)', 0);\n }\n else {\n leavingToolBarBg.fromTo('transform', 'translateX(0px)', isRTL ? 'translateX(-100%)' : 'translateX(100%)');\n }\n if (backButtonEl && !backward) {\n const leavingBackBtnText = createAnimation();\n leavingBackBtnText\n .addElement(shadow(backButtonEl).querySelector('.button-text')) // REVIEW\n .fromTo('transform', `translateX(${CENTER})`, `translateX(${(isRTL ? -124 : 124) + 'px'})`);\n leavingToolBar.addAnimation(leavingBackBtnText);\n }\n }\n else {\n // leaving toolbar, forward direction\n if (!inactiveHeader) {\n leavingTitle\n .fromTo('transform', `translateX(${CENTER})`, `translateX(${OFF_LEFT})`)\n .fromTo(OPACITY, 0.99, 0)\n .afterClearStyles([TRANSFORM, OPACITY]);\n }\n leavingToolBarItems\n .fromTo('transform', `translateX(${CENTER})`, `translateX(${OFF_LEFT})`)\n .afterClearStyles([TRANSFORM, OPACITY]);\n leavingBackButton.afterClearStyles([OPACITY]);\n leavingTitle.afterClearStyles([OPACITY]);\n leavingToolBarButtons.afterClearStyles([OPACITY]);\n }\n });\n }\n return rootAnimation;\n }\n catch (err) {\n throw err;\n }\n};\n\nexport { iosTransitionAnimation, shadow };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { p as promiseResolve, b as bootstrapLazy } from './index-8e692445.js';\nimport { g as globalScripts } from './app-globals-275fb4c9.js';\nimport './ionic-global-c95cf239.js';\n\n/*\n Stencil Client Patch Esm v2.18.0 | MIT Licensed | https://stenciljs.com\n */\nconst patchEsm = () => {\n return promiseResolve();\n};\n\nconst defineCustomElements = (win, options) => {\n if (typeof window === 'undefined') return Promise.resolve();\n return patchEsm().then(() => {\n globalScripts();\n return bootstrapLazy(JSON.parse(\"[[\\\"ion-menu_3\\\",[[33,\\\"ion-menu-button\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"menu\\\":[1],\\\"autoHide\\\":[4,\\\"auto-hide\\\"],\\\"type\\\":[1],\\\"visible\\\":[32]},[[16,\\\"ionMenuChange\\\",\\\"visibilityChanged\\\"],[16,\\\"ionSplitPaneVisible\\\",\\\"visibilityChanged\\\"]]],[33,\\\"ion-menu\\\",{\\\"contentId\\\":[513,\\\"content-id\\\"],\\\"menuId\\\":[513,\\\"menu-id\\\"],\\\"type\\\":[1025],\\\"disabled\\\":[1028],\\\"side\\\":[513],\\\"swipeGesture\\\":[4,\\\"swipe-gesture\\\"],\\\"maxEdgeStart\\\":[2,\\\"max-edge-start\\\"],\\\"isPaneVisible\\\":[32],\\\"isEndSide\\\":[32],\\\"isOpen\\\":[64],\\\"isActive\\\":[64],\\\"open\\\":[64],\\\"close\\\":[64],\\\"toggle\\\":[64],\\\"setOpen\\\":[64]},[[16,\\\"ionSplitPaneVisible\\\",\\\"onSplitPaneChanged\\\"],[2,\\\"click\\\",\\\"onBackdropClick\\\"],[0,\\\"keydown\\\",\\\"onKeydown\\\"]]],[1,\\\"ion-menu-toggle\\\",{\\\"menu\\\":[1],\\\"autoHide\\\":[4,\\\"auto-hide\\\"],\\\"visible\\\":[32]},[[16,\\\"ionMenuChange\\\",\\\"visibilityChanged\\\"],[16,\\\"ionSplitPaneVisible\\\",\\\"visibilityChanged\\\"]]]]],[\\\"ion-fab_3\\\",[[33,\\\"ion-fab-button\\\",{\\\"color\\\":[513],\\\"activated\\\":[4],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1],\\\"show\\\":[4],\\\"translucent\\\":[4],\\\"type\\\":[1],\\\"size\\\":[1],\\\"closeIcon\\\":[1,\\\"close-icon\\\"]}],[1,\\\"ion-fab\\\",{\\\"horizontal\\\":[1],\\\"vertical\\\":[1],\\\"edge\\\":[4],\\\"activated\\\":[1028],\\\"close\\\":[64],\\\"toggle\\\":[64]}],[1,\\\"ion-fab-list\\\",{\\\"activated\\\":[4],\\\"side\\\":[1]}]]],[\\\"ion-refresher_2\\\",[[0,\\\"ion-refresher-content\\\",{\\\"pullingIcon\\\":[1025,\\\"pulling-icon\\\"],\\\"pullingText\\\":[1,\\\"pulling-text\\\"],\\\"refreshingSpinner\\\":[1025,\\\"refreshing-spinner\\\"],\\\"refreshingText\\\":[1,\\\"refreshing-text\\\"]}],[32,\\\"ion-refresher\\\",{\\\"pullMin\\\":[2,\\\"pull-min\\\"],\\\"pullMax\\\":[2,\\\"pull-max\\\"],\\\"closeDuration\\\":[1,\\\"close-duration\\\"],\\\"snapbackDuration\\\":[1,\\\"snapback-duration\\\"],\\\"pullFactor\\\":[2,\\\"pull-factor\\\"],\\\"disabled\\\":[4],\\\"nativeRefresher\\\":[32],\\\"state\\\":[32],\\\"complete\\\":[64],\\\"cancel\\\":[64],\\\"getProgress\\\":[64]}]]],[\\\"ion-back-button\\\",[[33,\\\"ion-back-button\\\",{\\\"color\\\":[513],\\\"defaultHref\\\":[1025,\\\"default-href\\\"],\\\"disabled\\\":[516],\\\"icon\\\":[1],\\\"text\\\":[1],\\\"type\\\":[1],\\\"routerAnimation\\\":[16]}]]],[\\\"ion-toast\\\",[[33,\\\"ion-toast\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"color\\\":[513],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"header\\\":[1],\\\"message\\\":[1],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"position\\\":[1],\\\"buttons\\\":[16],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"icon\\\":[1],\\\"htmlAttributes\\\":[16],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]}]]],[\\\"ion-card_5\\\",[[33,\\\"ion-card\\\",{\\\"color\\\":[513],\\\"button\\\":[4],\\\"type\\\":[1],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1]}],[32,\\\"ion-card-content\\\"],[33,\\\"ion-card-header\\\",{\\\"color\\\":[513],\\\"translucent\\\":[4]}],[33,\\\"ion-card-subtitle\\\",{\\\"color\\\":[513]}],[33,\\\"ion-card-title\\\",{\\\"color\\\":[513]}]]],[\\\"ion-item-option_3\\\",[[33,\\\"ion-item-option\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"expandable\\\":[4],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"target\\\":[1],\\\"type\\\":[1]}],[32,\\\"ion-item-options\\\",{\\\"side\\\":[1],\\\"fireSwipeEvent\\\":[64]}],[0,\\\"ion-item-sliding\\\",{\\\"disabled\\\":[4],\\\"state\\\":[32],\\\"getOpenAmount\\\":[64],\\\"getSlidingRatio\\\":[64],\\\"open\\\":[64],\\\"close\\\":[64],\\\"closeOpened\\\":[64]}]]],[\\\"ion-accordion_2\\\",[[49,\\\"ion-accordion\\\",{\\\"value\\\":[1],\\\"disabled\\\":[4],\\\"readonly\\\":[4],\\\"toggleIcon\\\":[1,\\\"toggle-icon\\\"],\\\"toggleIconSlot\\\":[1,\\\"toggle-icon-slot\\\"],\\\"state\\\":[32],\\\"isNext\\\":[32],\\\"isPrevious\\\":[32]}],[33,\\\"ion-accordion-group\\\",{\\\"animated\\\":[4],\\\"multiple\\\":[4],\\\"value\\\":[1025],\\\"disabled\\\":[4],\\\"readonly\\\":[4],\\\"expand\\\":[1],\\\"requestAccordionToggle\\\":[64],\\\"getAccordions\\\":[64]},[[0,\\\"keydown\\\",\\\"onKeydown\\\"]]]]],[\\\"ion-breadcrumb_2\\\",[[33,\\\"ion-breadcrumb\\\",{\\\"collapsed\\\":[4],\\\"last\\\":[4],\\\"showCollapsedIndicator\\\":[4,\\\"show-collapsed-indicator\\\"],\\\"color\\\":[1],\\\"active\\\":[4],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"separator\\\":[4],\\\"target\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16]}],[33,\\\"ion-breadcrumbs\\\",{\\\"color\\\":[1],\\\"maxItems\\\":[2,\\\"max-items\\\"],\\\"itemsBeforeCollapse\\\":[2,\\\"items-before-collapse\\\"],\\\"itemsAfterCollapse\\\":[2,\\\"items-after-collapse\\\"],\\\"collapsed\\\":[32],\\\"activeChanged\\\":[32]},[[0,\\\"collapsedClick\\\",\\\"onCollapsedClick\\\"]]]]],[\\\"ion-infinite-scroll_2\\\",[[32,\\\"ion-infinite-scroll-content\\\",{\\\"loadingSpinner\\\":[1025,\\\"loading-spinner\\\"],\\\"loadingText\\\":[1,\\\"loading-text\\\"]}],[0,\\\"ion-infinite-scroll\\\",{\\\"threshold\\\":[1],\\\"disabled\\\":[4],\\\"position\\\":[1],\\\"isLoading\\\":[32],\\\"complete\\\":[64]}]]],[\\\"ion-reorder_2\\\",[[33,\\\"ion-reorder\\\",null,[[2,\\\"click\\\",\\\"onClick\\\"]]],[0,\\\"ion-reorder-group\\\",{\\\"disabled\\\":[4],\\\"state\\\":[32],\\\"complete\\\":[64]}]]],[\\\"ion-segment_2\\\",[[33,\\\"ion-segment-button\\\",{\\\"disabled\\\":[4],\\\"layout\\\":[1],\\\"type\\\":[1],\\\"value\\\":[1],\\\"checked\\\":[32]}],[33,\\\"ion-segment\\\",{\\\"color\\\":[513],\\\"disabled\\\":[4],\\\"scrollable\\\":[4],\\\"swipeGesture\\\":[4,\\\"swipe-gesture\\\"],\\\"value\\\":[1025],\\\"selectOnFocus\\\":[4,\\\"select-on-focus\\\"],\\\"activated\\\":[32]},[[0,\\\"keydown\\\",\\\"onKeyDown\\\"]]]]],[\\\"ion-tab-bar_2\\\",[[33,\\\"ion-tab-button\\\",{\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"layout\\\":[1025],\\\"selected\\\":[1028],\\\"tab\\\":[1],\\\"target\\\":[1]},[[8,\\\"ionTabBarChanged\\\",\\\"onTabBarChanged\\\"]]],[33,\\\"ion-tab-bar\\\",{\\\"color\\\":[513],\\\"selectedTab\\\":[1,\\\"selected-tab\\\"],\\\"translucent\\\":[4],\\\"keyboardVisible\\\":[32]}]]],[\\\"ion-chip\\\",[[1,\\\"ion-chip\\\",{\\\"color\\\":[513],\\\"outline\\\":[4],\\\"disabled\\\":[4]}]]],[\\\"ion-datetime-button\\\",[[33,\\\"ion-datetime-button\\\",{\\\"color\\\":[513],\\\"disabled\\\":[516],\\\"datetime\\\":[1],\\\"datetimePresentation\\\":[32],\\\"dateText\\\":[32],\\\"timeText\\\":[32],\\\"datetimeActive\\\":[32],\\\"selectedButton\\\":[32]}]]],[\\\"ion-searchbar\\\",[[34,\\\"ion-searchbar\\\",{\\\"color\\\":[513],\\\"animated\\\":[4],\\\"autocomplete\\\":[1],\\\"autocorrect\\\":[1],\\\"cancelButtonIcon\\\":[1,\\\"cancel-button-icon\\\"],\\\"cancelButtonText\\\":[1,\\\"cancel-button-text\\\"],\\\"clearIcon\\\":[1,\\\"clear-icon\\\"],\\\"debounce\\\":[2],\\\"disabled\\\":[4],\\\"inputmode\\\":[1],\\\"enterkeyhint\\\":[1],\\\"placeholder\\\":[1],\\\"searchIcon\\\":[1,\\\"search-icon\\\"],\\\"showCancelButton\\\":[1,\\\"show-cancel-button\\\"],\\\"showClearButton\\\":[1,\\\"show-clear-button\\\"],\\\"spellcheck\\\":[4],\\\"type\\\":[1],\\\"value\\\":[1025],\\\"focused\\\":[32],\\\"noAnimate\\\":[32],\\\"setFocus\\\":[64],\\\"getInputElement\\\":[64]}]]],[\\\"ion-toggle\\\",[[33,\\\"ion-toggle\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"checked\\\":[1028],\\\"disabled\\\":[4],\\\"value\\\":[1],\\\"enableOnOffLabels\\\":[4,\\\"enable-on-off-labels\\\"],\\\"activated\\\":[32]}]]],[\\\"ion-nav_2\\\",[[1,\\\"ion-nav\\\",{\\\"delegate\\\":[16],\\\"swipeGesture\\\":[1028,\\\"swipe-gesture\\\"],\\\"animated\\\":[4],\\\"animation\\\":[16],\\\"rootParams\\\":[16],\\\"root\\\":[1],\\\"push\\\":[64],\\\"insert\\\":[64],\\\"insertPages\\\":[64],\\\"pop\\\":[64],\\\"popTo\\\":[64],\\\"popToRoot\\\":[64],\\\"removeIndex\\\":[64],\\\"setRoot\\\":[64],\\\"setPages\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64],\\\"getActive\\\":[64],\\\"getByIndex\\\":[64],\\\"canGoBack\\\":[64],\\\"getPrevious\\\":[64]}],[0,\\\"ion-nav-link\\\",{\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16]}]]],[\\\"ion-input\\\",[[34,\\\"ion-input\\\",{\\\"fireFocusEvents\\\":[4,\\\"fire-focus-events\\\"],\\\"color\\\":[513],\\\"accept\\\":[1],\\\"autocapitalize\\\":[1],\\\"autocomplete\\\":[1],\\\"autocorrect\\\":[1],\\\"autofocus\\\":[4],\\\"clearInput\\\":[4,\\\"clear-input\\\"],\\\"clearOnEdit\\\":[4,\\\"clear-on-edit\\\"],\\\"debounce\\\":[2],\\\"disabled\\\":[4],\\\"enterkeyhint\\\":[1],\\\"inputmode\\\":[1],\\\"max\\\":[8],\\\"maxlength\\\":[2],\\\"min\\\":[8],\\\"minlength\\\":[2],\\\"multiple\\\":[4],\\\"name\\\":[1],\\\"pattern\\\":[1],\\\"placeholder\\\":[1],\\\"readonly\\\":[4],\\\"required\\\":[4],\\\"spellcheck\\\":[4],\\\"step\\\":[1],\\\"size\\\":[2],\\\"type\\\":[1],\\\"value\\\":[1032],\\\"hasFocus\\\":[32],\\\"setFocus\\\":[64],\\\"setBlur\\\":[64],\\\"getInputElement\\\":[64]}]]],[\\\"ion-textarea\\\",[[34,\\\"ion-textarea\\\",{\\\"fireFocusEvents\\\":[4,\\\"fire-focus-events\\\"],\\\"color\\\":[513],\\\"autocapitalize\\\":[1],\\\"autofocus\\\":[4],\\\"clearOnEdit\\\":[1028,\\\"clear-on-edit\\\"],\\\"debounce\\\":[2],\\\"disabled\\\":[4],\\\"inputmode\\\":[1],\\\"enterkeyhint\\\":[1],\\\"maxlength\\\":[2],\\\"minlength\\\":[2],\\\"name\\\":[1],\\\"placeholder\\\":[1],\\\"readonly\\\":[4],\\\"required\\\":[4],\\\"spellcheck\\\":[4],\\\"cols\\\":[2],\\\"rows\\\":[2],\\\"wrap\\\":[1],\\\"autoGrow\\\":[516,\\\"auto-grow\\\"],\\\"value\\\":[1025],\\\"hasFocus\\\":[32],\\\"setFocus\\\":[64],\\\"setBlur\\\":[64],\\\"getInputElement\\\":[64]}]]],[\\\"ion-backdrop\\\",[[33,\\\"ion-backdrop\\\",{\\\"visible\\\":[4],\\\"tappable\\\":[4],\\\"stopPropagation\\\":[4,\\\"stop-propagation\\\"]},[[2,\\\"click\\\",\\\"onMouseDown\\\"]]]]],[\\\"ion-loading\\\",[[34,\\\"ion-loading\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"message\\\":[1],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"spinner\\\":[1025],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]}]]],[\\\"ion-modal\\\",[[33,\\\"ion-modal\\\",{\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"delegate\\\":[16],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"breakpoints\\\":[16],\\\"initialBreakpoint\\\":[2,\\\"initial-breakpoint\\\"],\\\"backdropBreakpoint\\\":[2,\\\"backdrop-breakpoint\\\"],\\\"handle\\\":[4],\\\"handleBehavior\\\":[1,\\\"handle-behavior\\\"],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"animated\\\":[4],\\\"swipeToClose\\\":[4,\\\"swipe-to-close\\\"],\\\"presentingElement\\\":[16],\\\"htmlAttributes\\\":[16],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"trigger\\\":[1],\\\"keepContentsMounted\\\":[4,\\\"keep-contents-mounted\\\"],\\\"canDismiss\\\":[4,\\\"can-dismiss\\\"],\\\"presented\\\":[32],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64],\\\"setCurrentBreakpoint\\\":[64],\\\"getCurrentBreakpoint\\\":[64]}]]],[\\\"ion-route_4\\\",[[0,\\\"ion-route\\\",{\\\"url\\\":[1],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"beforeLeave\\\":[16],\\\"beforeEnter\\\":[16]}],[0,\\\"ion-route-redirect\\\",{\\\"from\\\":[1],\\\"to\\\":[1]}],[0,\\\"ion-router\\\",{\\\"root\\\":[1],\\\"useHash\\\":[4,\\\"use-hash\\\"],\\\"canTransition\\\":[64],\\\"push\\\":[64],\\\"back\\\":[64],\\\"printDebug\\\":[64],\\\"navChanged\\\":[64]},[[8,\\\"popstate\\\",\\\"onPopState\\\"],[4,\\\"ionBackButton\\\",\\\"onBackButton\\\"]]],[1,\\\"ion-router-link\\\",{\\\"color\\\":[513],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"target\\\":[1]}]]],[\\\"ion-avatar_3\\\",[[33,\\\"ion-avatar\\\"],[33,\\\"ion-badge\\\",{\\\"color\\\":[513]}],[1,\\\"ion-thumbnail\\\"]]],[\\\"ion-col_3\\\",[[1,\\\"ion-col\\\",{\\\"offset\\\":[1],\\\"offsetXs\\\":[1,\\\"offset-xs\\\"],\\\"offsetSm\\\":[1,\\\"offset-sm\\\"],\\\"offsetMd\\\":[1,\\\"offset-md\\\"],\\\"offsetLg\\\":[1,\\\"offset-lg\\\"],\\\"offsetXl\\\":[1,\\\"offset-xl\\\"],\\\"pull\\\":[1],\\\"pullXs\\\":[1,\\\"pull-xs\\\"],\\\"pullSm\\\":[1,\\\"pull-sm\\\"],\\\"pullMd\\\":[1,\\\"pull-md\\\"],\\\"pullLg\\\":[1,\\\"pull-lg\\\"],\\\"pullXl\\\":[1,\\\"pull-xl\\\"],\\\"push\\\":[1],\\\"pushXs\\\":[1,\\\"push-xs\\\"],\\\"pushSm\\\":[1,\\\"push-sm\\\"],\\\"pushMd\\\":[1,\\\"push-md\\\"],\\\"pushLg\\\":[1,\\\"push-lg\\\"],\\\"pushXl\\\":[1,\\\"push-xl\\\"],\\\"size\\\":[1],\\\"sizeXs\\\":[1,\\\"size-xs\\\"],\\\"sizeSm\\\":[1,\\\"size-sm\\\"],\\\"sizeMd\\\":[1,\\\"size-md\\\"],\\\"sizeLg\\\":[1,\\\"size-lg\\\"],\\\"sizeXl\\\":[1,\\\"size-xl\\\"]},[[9,\\\"resize\\\",\\\"onResize\\\"]]],[1,\\\"ion-grid\\\",{\\\"fixed\\\":[4]}],[1,\\\"ion-row\\\"]]],[\\\"ion-slide_2\\\",[[0,\\\"ion-slide\\\"],[36,\\\"ion-slides\\\",{\\\"options\\\":[8],\\\"pager\\\":[4],\\\"scrollbar\\\":[4],\\\"update\\\":[64],\\\"updateAutoHeight\\\":[64],\\\"slideTo\\\":[64],\\\"slideNext\\\":[64],\\\"slidePrev\\\":[64],\\\"getActiveIndex\\\":[64],\\\"getPreviousIndex\\\":[64],\\\"length\\\":[64],\\\"isEnd\\\":[64],\\\"isBeginning\\\":[64],\\\"startAutoplay\\\":[64],\\\"stopAutoplay\\\":[64],\\\"lockSwipeToNext\\\":[64],\\\"lockSwipeToPrev\\\":[64],\\\"lockSwipes\\\":[64],\\\"getSwiper\\\":[64]}]]],[\\\"ion-tab_2\\\",[[1,\\\"ion-tab\\\",{\\\"active\\\":[1028],\\\"delegate\\\":[16],\\\"tab\\\":[1],\\\"component\\\":[1],\\\"setActive\\\":[64]}],[1,\\\"ion-tabs\\\",{\\\"useRouter\\\":[1028,\\\"use-router\\\"],\\\"selectedTab\\\":[32],\\\"select\\\":[64],\\\"getTab\\\":[64],\\\"getSelected\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64]}]]],[\\\"ion-img\\\",[[1,\\\"ion-img\\\",{\\\"alt\\\":[1],\\\"src\\\":[1],\\\"loadSrc\\\":[32],\\\"loadError\\\":[32]}]]],[\\\"ion-progress-bar\\\",[[33,\\\"ion-progress-bar\\\",{\\\"type\\\":[1],\\\"reversed\\\":[4],\\\"value\\\":[2],\\\"buffer\\\":[2],\\\"color\\\":[513]}]]],[\\\"ion-range\\\",[[33,\\\"ion-range\\\",{\\\"color\\\":[513],\\\"debounce\\\":[2],\\\"name\\\":[1],\\\"dualKnobs\\\":[4,\\\"dual-knobs\\\"],\\\"min\\\":[2],\\\"max\\\":[2],\\\"pin\\\":[4],\\\"pinFormatter\\\":[16],\\\"snaps\\\":[4],\\\"step\\\":[2],\\\"ticks\\\":[4],\\\"activeBarStart\\\":[1026,\\\"active-bar-start\\\"],\\\"disabled\\\":[4],\\\"value\\\":[1026],\\\"ratioA\\\":[32],\\\"ratioB\\\":[32],\\\"pressedKnob\\\":[32]}]]],[\\\"ion-split-pane\\\",[[33,\\\"ion-split-pane\\\",{\\\"contentId\\\":[513,\\\"content-id\\\"],\\\"disabled\\\":[4],\\\"when\\\":[8],\\\"visible\\\":[32]}]]],[\\\"ion-text\\\",[[1,\\\"ion-text\\\",{\\\"color\\\":[513]}]]],[\\\"ion-virtual-scroll\\\",[[0,\\\"ion-virtual-scroll\\\",{\\\"approxItemHeight\\\":[2,\\\"approx-item-height\\\"],\\\"approxHeaderHeight\\\":[2,\\\"approx-header-height\\\"],\\\"approxFooterHeight\\\":[2,\\\"approx-footer-height\\\"],\\\"headerFn\\\":[16],\\\"footerFn\\\":[16],\\\"items\\\":[16],\\\"itemHeight\\\":[16],\\\"headerHeight\\\":[16],\\\"footerHeight\\\":[16],\\\"renderItem\\\":[16],\\\"renderHeader\\\":[16],\\\"renderFooter\\\":[16],\\\"nodeRender\\\":[16],\\\"domRender\\\":[16],\\\"totalHeight\\\":[32],\\\"positionForItem\\\":[64],\\\"checkRange\\\":[64],\\\"checkEnd\\\":[64]},[[9,\\\"resize\\\",\\\"onResize\\\"]]]]],[\\\"ion-picker-column-internal\\\",[[33,\\\"ion-picker-column-internal\\\",{\\\"items\\\":[16],\\\"value\\\":[1032],\\\"color\\\":[513],\\\"numericInput\\\":[4,\\\"numeric-input\\\"],\\\"isActive\\\":[32],\\\"scrollActiveItemIntoView\\\":[64],\\\"setValue\\\":[64]}]]],[\\\"ion-picker-internal\\\",[[33,\\\"ion-picker-internal\\\",null,[[1,\\\"touchstart\\\",\\\"preventTouchStartPropagation\\\"]]]]],[\\\"ion-radio_2\\\",[[33,\\\"ion-radio\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"disabled\\\":[4],\\\"value\\\":[8],\\\"checked\\\":[32],\\\"buttonTabindex\\\":[32],\\\"setFocus\\\":[64],\\\"setButtonTabindex\\\":[64]}],[0,\\\"ion-radio-group\\\",{\\\"allowEmptySelection\\\":[4,\\\"allow-empty-selection\\\"],\\\"name\\\":[1],\\\"value\\\":[1032]},[[4,\\\"keydown\\\",\\\"onKeydown\\\"]]]]],[\\\"ion-ripple-effect\\\",[[1,\\\"ion-ripple-effect\\\",{\\\"type\\\":[1],\\\"addRipple\\\":[64]}]]],[\\\"ion-button_2\\\",[[33,\\\"ion-button\\\",{\\\"color\\\":[513],\\\"buttonType\\\":[1025,\\\"button-type\\\"],\\\"disabled\\\":[516],\\\"expand\\\":[513],\\\"fill\\\":[1537],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"routerAnimation\\\":[16],\\\"download\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"shape\\\":[513],\\\"size\\\":[513],\\\"strong\\\":[4],\\\"target\\\":[1],\\\"type\\\":[1],\\\"form\\\":[1]}],[1,\\\"ion-icon\\\",{\\\"mode\\\":[1025],\\\"color\\\":[1],\\\"ios\\\":[1],\\\"md\\\":[1],\\\"flipRtl\\\":[4,\\\"flip-rtl\\\"],\\\"name\\\":[513],\\\"src\\\":[1],\\\"icon\\\":[8],\\\"size\\\":[1],\\\"lazy\\\":[4],\\\"sanitize\\\":[4],\\\"svgContent\\\":[32],\\\"isVisible\\\":[32],\\\"ariaLabel\\\":[32]}]]],[\\\"ion-datetime_3\\\",[[33,\\\"ion-datetime\\\",{\\\"color\\\":[1],\\\"name\\\":[1],\\\"disabled\\\":[4],\\\"readonly\\\":[4],\\\"isDateEnabled\\\":[16],\\\"min\\\":[1025],\\\"max\\\":[1025],\\\"presentation\\\":[1],\\\"cancelText\\\":[1,\\\"cancel-text\\\"],\\\"doneText\\\":[1,\\\"done-text\\\"],\\\"clearText\\\":[1,\\\"clear-text\\\"],\\\"yearValues\\\":[8,\\\"year-values\\\"],\\\"monthValues\\\":[8,\\\"month-values\\\"],\\\"dayValues\\\":[8,\\\"day-values\\\"],\\\"hourValues\\\":[8,\\\"hour-values\\\"],\\\"minuteValues\\\":[8,\\\"minute-values\\\"],\\\"locale\\\":[1],\\\"firstDayOfWeek\\\":[2,\\\"first-day-of-week\\\"],\\\"titleSelectedDatesFormatter\\\":[16],\\\"multiple\\\":[4],\\\"value\\\":[1025],\\\"showDefaultTitle\\\":[4,\\\"show-default-title\\\"],\\\"showDefaultButtons\\\":[4,\\\"show-default-buttons\\\"],\\\"showClearButton\\\":[4,\\\"show-clear-button\\\"],\\\"showDefaultTimeLabel\\\":[4,\\\"show-default-time-label\\\"],\\\"hourCycle\\\":[1,\\\"hour-cycle\\\"],\\\"size\\\":[1],\\\"preferWheel\\\":[4,\\\"prefer-wheel\\\"],\\\"showMonthAndYear\\\":[32],\\\"activeParts\\\":[32],\\\"workingParts\\\":[32],\\\"isPresented\\\":[32],\\\"isTimePopoverOpen\\\":[32],\\\"confirm\\\":[64],\\\"reset\\\":[64],\\\"cancel\\\":[64]}],[34,\\\"ion-picker\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"buttons\\\":[16],\\\"columns\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"duration\\\":[2],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"presented\\\":[32],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64],\\\"getColumn\\\":[64]}],[32,\\\"ion-picker-column\\\",{\\\"col\\\":[16]}]]],[\\\"ion-action-sheet\\\",[[34,\\\"ion-action-sheet\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"buttons\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]}]]],[\\\"ion-alert\\\",[[34,\\\"ion-alert\\\",{\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"message\\\":[1],\\\"buttons\\\":[16],\\\"inputs\\\":[1040],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]},[[4,\\\"keydown\\\",\\\"onKeydown\\\"]]]]],[\\\"ion-popover\\\",[[33,\\\"ion-popover\\\",{\\\"hasController\\\":[4,\\\"has-controller\\\"],\\\"delegate\\\":[16],\\\"overlayIndex\\\":[2,\\\"overlay-index\\\"],\\\"enterAnimation\\\":[16],\\\"leaveAnimation\\\":[16],\\\"component\\\":[1],\\\"componentProps\\\":[16],\\\"keyboardClose\\\":[4,\\\"keyboard-close\\\"],\\\"cssClass\\\":[1,\\\"css-class\\\"],\\\"backdropDismiss\\\":[4,\\\"backdrop-dismiss\\\"],\\\"event\\\":[8],\\\"showBackdrop\\\":[4,\\\"show-backdrop\\\"],\\\"translucent\\\":[4],\\\"animated\\\":[4],\\\"htmlAttributes\\\":[16],\\\"triggerAction\\\":[1,\\\"trigger-action\\\"],\\\"trigger\\\":[1],\\\"size\\\":[1],\\\"dismissOnSelect\\\":[4,\\\"dismiss-on-select\\\"],\\\"reference\\\":[1],\\\"side\\\":[1],\\\"alignment\\\":[1025],\\\"arrow\\\":[4],\\\"isOpen\\\":[4,\\\"is-open\\\"],\\\"keyboardEvents\\\":[4,\\\"keyboard-events\\\"],\\\"keepContentsMounted\\\":[4,\\\"keep-contents-mounted\\\"],\\\"presented\\\":[32],\\\"presentFromTrigger\\\":[64],\\\"present\\\":[64],\\\"dismiss\\\":[64],\\\"getParentPopover\\\":[64],\\\"onDidDismiss\\\":[64],\\\"onWillDismiss\\\":[64]}]]],[\\\"ion-checkbox\\\",[[33,\\\"ion-checkbox\\\",{\\\"color\\\":[513],\\\"name\\\":[1],\\\"checked\\\":[1028],\\\"indeterminate\\\":[1028],\\\"disabled\\\":[4],\\\"value\\\":[8]}]]],[\\\"ion-select_3\\\",[[33,\\\"ion-select\\\",{\\\"disabled\\\":[4],\\\"cancelText\\\":[1,\\\"cancel-text\\\"],\\\"okText\\\":[1,\\\"ok-text\\\"],\\\"placeholder\\\":[1],\\\"name\\\":[1],\\\"selectedText\\\":[1,\\\"selected-text\\\"],\\\"multiple\\\":[4],\\\"interface\\\":[1],\\\"interfaceOptions\\\":[8,\\\"interface-options\\\"],\\\"compareWith\\\":[1,\\\"compare-with\\\"],\\\"value\\\":[1032],\\\"isExpanded\\\":[32],\\\"open\\\":[64]}],[1,\\\"ion-select-option\\\",{\\\"disabled\\\":[4],\\\"value\\\":[8]}],[34,\\\"ion-select-popover\\\",{\\\"header\\\":[1],\\\"subHeader\\\":[1,\\\"sub-header\\\"],\\\"message\\\":[1],\\\"multiple\\\":[4],\\\"options\\\":[16]},[[0,\\\"ionChange\\\",\\\"onSelect\\\"]]]]],[\\\"ion-app_8\\\",[[0,\\\"ion-app\\\",{\\\"setFocus\\\":[64]}],[1,\\\"ion-content\\\",{\\\"color\\\":[513],\\\"fullscreen\\\":[4],\\\"forceOverscroll\\\":[1028,\\\"force-overscroll\\\"],\\\"scrollX\\\":[4,\\\"scroll-x\\\"],\\\"scrollY\\\":[4,\\\"scroll-y\\\"],\\\"scrollEvents\\\":[4,\\\"scroll-events\\\"],\\\"getScrollElement\\\":[64],\\\"getBackgroundElement\\\":[64],\\\"scrollToTop\\\":[64],\\\"scrollToBottom\\\":[64],\\\"scrollByPoint\\\":[64],\\\"scrollToPoint\\\":[64]},[[8,\\\"appload\\\",\\\"onAppLoad\\\"]]],[36,\\\"ion-footer\\\",{\\\"collapse\\\":[1],\\\"translucent\\\":[4],\\\"keyboardVisible\\\":[32]}],[36,\\\"ion-header\\\",{\\\"collapse\\\":[1],\\\"translucent\\\":[4]}],[1,\\\"ion-router-outlet\\\",{\\\"mode\\\":[1025],\\\"delegate\\\":[16],\\\"animated\\\":[4],\\\"animation\\\":[16],\\\"swipeHandler\\\":[16],\\\"commit\\\":[64],\\\"setRouteId\\\":[64],\\\"getRouteId\\\":[64]}],[33,\\\"ion-title\\\",{\\\"color\\\":[513],\\\"size\\\":[1]}],[33,\\\"ion-toolbar\\\",{\\\"color\\\":[513]},[[0,\\\"ionStyle\\\",\\\"childrenStyle\\\"]]],[34,\\\"ion-buttons\\\",{\\\"collapse\\\":[4]}]]],[\\\"ion-spinner\\\",[[1,\\\"ion-spinner\\\",{\\\"color\\\":[513],\\\"duration\\\":[2],\\\"name\\\":[1],\\\"paused\\\":[4]}]]],[\\\"ion-item_8\\\",[[33,\\\"ion-item-divider\\\",{\\\"color\\\":[513],\\\"sticky\\\":[4]}],[32,\\\"ion-item-group\\\"],[1,\\\"ion-skeleton-text\\\",{\\\"animated\\\":[4]}],[32,\\\"ion-list\\\",{\\\"lines\\\":[1],\\\"inset\\\":[4],\\\"closeSlidingItems\\\":[64]}],[33,\\\"ion-list-header\\\",{\\\"color\\\":[513],\\\"lines\\\":[1]}],[49,\\\"ion-item\\\",{\\\"color\\\":[513],\\\"button\\\":[4],\\\"detail\\\":[4],\\\"detailIcon\\\":[1,\\\"detail-icon\\\"],\\\"disabled\\\":[4],\\\"download\\\":[1],\\\"fill\\\":[1],\\\"shape\\\":[1],\\\"href\\\":[1],\\\"rel\\\":[1],\\\"lines\\\":[1],\\\"counter\\\":[4],\\\"routerAnimation\\\":[16],\\\"routerDirection\\\":[1,\\\"router-direction\\\"],\\\"target\\\":[1],\\\"type\\\":[1],\\\"counterFormatter\\\":[16],\\\"multipleInputs\\\":[32],\\\"focusable\\\":[32],\\\"counterString\\\":[32]},[[0,\\\"ionChange\\\",\\\"handleIonChange\\\"],[0,\\\"ionColor\\\",\\\"labelColorChanged\\\"],[0,\\\"ionStyle\\\",\\\"itemStyle\\\"]]],[34,\\\"ion-label\\\",{\\\"color\\\":[513],\\\"position\\\":[1],\\\"noAnimate\\\":[32]}],[33,\\\"ion-note\\\",{\\\"color\\\":[513]}]]]]\"), options);\n });\n};\n\nexport { defineCustomElements };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { c as createAnimation } from './animation-e5036198.js';\nimport { g as getIonPageElement } from './index-fbafcf43.js';\nimport './helpers-2914b3be.js';\nimport './index-33ffec25.js';\nimport './index-8e692445.js';\n\nconst mdTransitionAnimation = (_, opts) => {\n var _a, _b, _c;\n const OFF_BOTTOM = '40px';\n const CENTER = '0px';\n const backDirection = opts.direction === 'back';\n const enteringEl = opts.enteringEl;\n const leavingEl = opts.leavingEl;\n const ionPageElement = getIonPageElement(enteringEl);\n const enteringToolbarEle = ionPageElement.querySelector('ion-toolbar');\n const rootTransition = createAnimation();\n rootTransition.addElement(ionPageElement).fill('both').beforeRemoveClass('ion-page-invisible');\n // animate the component itself\n if (backDirection) {\n rootTransition.duration(((_a = opts.duration) !== null && _a !== void 0 ? _a : 0) || 200).easing('cubic-bezier(0.47,0,0.745,0.715)');\n }\n else {\n rootTransition\n .duration(((_b = opts.duration) !== null && _b !== void 0 ? _b : 0) || 280)\n .easing('cubic-bezier(0.36,0.66,0.04,1)')\n .fromTo('transform', `translateY(${OFF_BOTTOM})`, `translateY(${CENTER})`)\n .fromTo('opacity', 0.01, 1);\n }\n // Animate toolbar if it's there\n if (enteringToolbarEle) {\n const enteringToolBar = createAnimation();\n enteringToolBar.addElement(enteringToolbarEle);\n rootTransition.addAnimation(enteringToolBar);\n }\n // setup leaving view\n if (leavingEl && backDirection) {\n // leaving content\n rootTransition.duration(((_c = opts.duration) !== null && _c !== void 0 ? _c : 0) || 200).easing('cubic-bezier(0.47,0,0.745,0.715)');\n const leavingPage = createAnimation();\n leavingPage\n .addElement(getIonPageElement(leavingEl))\n .onFinish((currentStep) => {\n if (currentStep === 1 && leavingPage.elements.length > 0) {\n leavingPage.elements[0].style.setProperty('display', 'none');\n }\n })\n .fromTo('transform', `translateY(${CENTER})`, `translateY(${OFF_BOTTOM})`)\n .fromTo('opacity', 1, 0);\n rootTransition.addAnimation(leavingPage);\n }\n return rootTransition;\n};\n\nexport { mdTransitionAnimation };\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nimport { b as getIonMode, c as config } from './ionic-global-c95cf239.js';\nimport { OVERLAY_BACK_BUTTON_PRIORITY } from './hardware-back-button-490df115.js';\nimport { c as componentOnReady, f as focusElement, a as addEventListener, b as removeEventListener, g as getElementRoot } from './helpers-2914b3be.js';\n\nlet lastId = 0;\nconst activeAnimations = new WeakMap();\nconst createController = (tagName) => {\n return {\n create(options) {\n return createOverlay(tagName, options);\n },\n dismiss(data, role, id) {\n return dismissOverlay(document, data, role, tagName, id);\n },\n async getTop() {\n return getOverlay(document, tagName);\n },\n };\n};\nconst alertController = /*@__PURE__*/ createController('ion-alert');\nconst actionSheetController = /*@__PURE__*/ createController('ion-action-sheet');\nconst loadingController = /*@__PURE__*/ createController('ion-loading');\nconst modalController = /*@__PURE__*/ createController('ion-modal');\nconst pickerController = /*@__PURE__*/ createController('ion-picker');\nconst popoverController = /*@__PURE__*/ createController('ion-popover');\nconst toastController = /*@__PURE__*/ createController('ion-toast');\nconst prepareOverlay = (el) => {\n if (typeof document !== 'undefined') {\n connectListeners(document);\n }\n const overlayIndex = lastId++;\n el.overlayIndex = overlayIndex;\n if (!el.hasAttribute('id')) {\n el.id = `ion-overlay-${overlayIndex}`;\n }\n};\nconst createOverlay = (tagName, opts) => {\n if (typeof window !== 'undefined' && typeof window.customElements !== 'undefined') {\n return window.customElements.whenDefined(tagName).then(() => {\n const element = document.createElement(tagName);\n element.classList.add('overlay-hidden');\n /**\n * Convert the passed in overlay options into props\n * that get passed down into the new overlay.\n */\n Object.assign(element, Object.assign(Object.assign({}, opts), { hasController: true }));\n // append the overlay element to the document body\n getAppRoot(document).appendChild(element);\n return new Promise((resolve) => componentOnReady(element, resolve));\n });\n }\n return Promise.resolve();\n};\n/**\n * This query string selects elements that\n * are eligible to receive focus. We select\n * interactive elements that meet the following\n * criteria:\n * 1. Element does not have a negative tabindex\n * 2. Element does not have `hidden`\n * 3. Element does not have `disabled` for non-Ionic components.\n * 4. Element does not have `disabled` or `disabled=\"true\"` for Ionic components.\n * Note: We need this distinction because `disabled=\"false\"` is\n * valid usage for the disabled property on ion-button.\n */\nconst focusableQueryString = '[tabindex]:not([tabindex^=\"-\"]):not([hidden]):not([disabled]), input:not([type=hidden]):not([tabindex^=\"-\"]):not([hidden]):not([disabled]), textarea:not([tabindex^=\"-\"]):not([hidden]):not([disabled]), button:not([tabindex^=\"-\"]):not([hidden]):not([disabled]), select:not([tabindex^=\"-\"]):not([hidden]):not([disabled]), .ion-focusable:not([tabindex^=\"-\"]):not([hidden]):not([disabled]), .ion-focusable[disabled=\"false\"]:not([tabindex^=\"-\"]):not([hidden])';\nconst focusFirstDescendant = (ref, overlay) => {\n let firstInput = ref.querySelector(focusableQueryString);\n const shadowRoot = firstInput === null || firstInput === void 0 ? void 0 : firstInput.shadowRoot;\n if (shadowRoot) {\n // If there are no inner focusable elements, just focus the host element.\n firstInput = shadowRoot.querySelector(focusableQueryString) || firstInput;\n }\n if (firstInput) {\n focusElement(firstInput);\n }\n else {\n // Focus overlay instead of letting focus escape\n overlay.focus();\n }\n};\nconst isOverlayHidden = (overlay) => overlay.classList.contains('overlay-hidden');\nconst focusLastDescendant = (ref, overlay) => {\n const inputs = Array.from(ref.querySelectorAll(focusableQueryString));\n let lastInput = inputs.length > 0 ? inputs[inputs.length - 1] : null;\n const shadowRoot = lastInput === null || lastInput === void 0 ? void 0 : lastInput.shadowRoot;\n if (shadowRoot) {\n // If there are no inner focusable elements, just focus the host element.\n lastInput = shadowRoot.querySelector(focusableQueryString) || lastInput;\n }\n if (lastInput) {\n lastInput.focus();\n }\n else {\n // Focus overlay instead of letting focus escape\n overlay.focus();\n }\n};\n/**\n * Traps keyboard focus inside of overlay components.\n * Based on https://w3c.github.io/aria-practices/examples/dialog-modal/alertdialog.html\n * This includes the following components: Action Sheet, Alert, Loading, Modal,\n * Picker, and Popover.\n * Should NOT include: Toast\n */\nconst trapKeyboardFocus = (ev, doc) => {\n const lastOverlay = getOverlay(doc, 'ion-alert,ion-action-sheet,ion-loading,ion-modal,ion-picker,ion-popover');\n const target = ev.target;\n /**\n * If no active overlay, ignore this event.\n *\n * If this component uses the shadow dom,\n * this global listener is pointless\n * since it will not catch the focus\n * traps as they are inside the shadow root.\n * We need to add a listener to the shadow root\n * itself to ensure the focus trap works.\n */\n if (!lastOverlay || !target) {\n return;\n }\n /**\n * If the ion-disable-focus-trap class\n * is present on an overlay, then this component\n * instance has opted out of focus trapping.\n * An example of this is when the sheet modal\n * has a backdrop that is disabled. The content\n * behind the sheet should be focusable until\n * the backdrop is enabled.\n */\n if (lastOverlay.classList.contains('ion-disable-focus-trap')) {\n return;\n }\n const trapScopedFocus = () => {\n /**\n * If we are focusing the overlay, clear\n * the last focused element so that hitting\n * tab activates the first focusable element\n * in the overlay wrapper.\n */\n if (lastOverlay === target) {\n lastOverlay.lastFocus = undefined;\n /**\n * Otherwise, we must be focusing an element\n * inside of the overlay. The two possible options\n * here are an input/button/etc or the ion-focus-trap\n * element. The focus trap element is used to prevent\n * the keyboard focus from leaving the overlay when\n * using Tab or screen assistants.\n */\n }\n else {\n /**\n * We do not want to focus the traps, so get the overlay\n * wrapper element as the traps live outside of the wrapper.\n */\n const overlayRoot = getElementRoot(lastOverlay);\n if (!overlayRoot.contains(target)) {\n return;\n }\n const overlayWrapper = overlayRoot.querySelector('.ion-overlay-wrapper');\n if (!overlayWrapper) {\n return;\n }\n /**\n * If the target is inside the wrapper, let the browser\n * focus as normal and keep a log of the last focused element.\n */\n if (overlayWrapper.contains(target)) {\n lastOverlay.lastFocus = target;\n }\n else {\n /**\n * Otherwise, we must have focused one of the focus traps.\n * We need to wrap the focus to either the first element\n * or the last element.\n */\n /**\n * Once we call `focusFirstDescendant` and focus the first\n * descendant, another focus event will fire which will\n * cause `lastOverlay.lastFocus` to be updated before\n * we can run the code after that. We will cache the value\n * here to avoid that.\n */\n const lastFocus = lastOverlay.lastFocus;\n // Focus the first element in the overlay wrapper\n focusFirstDescendant(overlayWrapper, lastOverlay);\n /**\n * If the cached last focused element is the\n * same as the active element, then we need\n * to wrap focus to the last descendant. This happens\n * when the first descendant is focused, and the user\n * presses Shift + Tab. The previous line will focus\n * the same descendant again (the first one), causing\n * last focus to equal the active element.\n */\n if (lastFocus === doc.activeElement) {\n focusLastDescendant(overlayWrapper, lastOverlay);\n }\n lastOverlay.lastFocus = doc.activeElement;\n }\n }\n };\n const trapShadowFocus = () => {\n /**\n * If the target is inside the wrapper, let the browser\n * focus as normal and keep a log of the last focused element.\n */\n if (lastOverlay.contains(target)) {\n lastOverlay.lastFocus = target;\n }\n else {\n /**\n * Otherwise, we are about to have focus\n * go out of the overlay. We need to wrap\n * the focus to either the first element\n * or the last element.\n */\n /**\n * Once we call `focusFirstDescendant` and focus the first\n * descendant, another focus event will fire which will\n * cause `lastOverlay.lastFocus` to be updated before\n * we can run the code after that. We will cache the value\n * here to avoid that.\n */\n const lastFocus = lastOverlay.lastFocus;\n // Focus the first element in the overlay wrapper\n focusFirstDescendant(lastOverlay, lastOverlay);\n /**\n * If the cached last focused element is the\n * same as the active element, then we need\n * to wrap focus to the last descendant. This happens\n * when the first descendant is focused, and the user\n * presses Shift + Tab. The previous line will focus\n * the same descendant again (the first one), causing\n * last focus to equal the active element.\n */\n if (lastFocus === doc.activeElement) {\n focusLastDescendant(lastOverlay, lastOverlay);\n }\n lastOverlay.lastFocus = doc.activeElement;\n }\n };\n if (lastOverlay.shadowRoot) {\n trapShadowFocus();\n }\n else {\n trapScopedFocus();\n }\n};\nconst connectListeners = (doc) => {\n if (lastId === 0) {\n lastId = 1;\n doc.addEventListener('focus', (ev) => {\n trapKeyboardFocus(ev, doc);\n }, true);\n // handle back-button click\n doc.addEventListener('ionBackButton', (ev) => {\n const lastOverlay = getOverlay(doc);\n if (lastOverlay === null || lastOverlay === void 0 ? void 0 : lastOverlay.backdropDismiss) {\n ev.detail.register(OVERLAY_BACK_BUTTON_PRIORITY, () => {\n return lastOverlay.dismiss(undefined, BACKDROP);\n });\n }\n });\n // handle ESC to close overlay\n doc.addEventListener('keyup', (ev) => {\n if (ev.key === 'Escape') {\n const lastOverlay = getOverlay(doc);\n if (lastOverlay === null || lastOverlay === void 0 ? void 0 : lastOverlay.backdropDismiss) {\n lastOverlay.dismiss(undefined, BACKDROP);\n }\n }\n });\n }\n};\nconst dismissOverlay = (doc, data, role, overlayTag, id) => {\n const overlay = getOverlay(doc, overlayTag, id);\n if (!overlay) {\n return Promise.reject('overlay does not exist');\n }\n return overlay.dismiss(data, role);\n};\nconst getOverlays = (doc, selector) => {\n if (selector === undefined) {\n selector = 'ion-alert,ion-action-sheet,ion-loading,ion-modal,ion-picker,ion-popover,ion-toast';\n }\n return Array.from(doc.querySelectorAll(selector)).filter((c) => c.overlayIndex > 0);\n};\n/**\n * Returns an overlay element\n * @param doc The document to find the element within.\n * @param overlayTag The selector for the overlay, defaults to Ionic overlay components.\n * @param id The unique identifier for the overlay instance.\n * @returns The overlay element or `undefined` if no overlay element is found.\n */\nconst getOverlay = (doc, overlayTag, id) => {\n const overlays = getOverlays(doc, overlayTag).filter((o) => !isOverlayHidden(o));\n return id === undefined ? overlays[overlays.length - 1] : overlays.find((o) => o.id === id);\n};\n/**\n * When an overlay is presented, the main\n * focus is the overlay not the page content.\n * We need to remove the page content from the\n * accessibility tree otherwise when\n * users use \"read screen from top\" gestures with\n * TalkBack and VoiceOver, the screen reader will begin\n * to read the content underneath the overlay.\n *\n * We need a container where all page components\n * exist that is separate from where the overlays\n * are added in the DOM. For most apps, this element\n * is the top most ion-router-outlet. In the event\n * that devs are not using a router,\n * they will need to add the \"ion-view-container-root\"\n * id to the element that contains all of their views.\n *\n * TODO: If Framework supports having multiple top\n * level router outlets we would need to update this.\n * Example: One outlet for side menu and one outlet\n * for main content.\n */\nconst setRootAriaHidden = (hidden = false) => {\n const root = getAppRoot(document);\n const viewContainer = root.querySelector('ion-router-outlet, ion-nav, #ion-view-container-root');\n if (!viewContainer) {\n return;\n }\n if (hidden) {\n viewContainer.setAttribute('aria-hidden', 'true');\n }\n else {\n viewContainer.removeAttribute('aria-hidden');\n }\n};\nconst present = async (overlay, name, iosEnterAnimation, mdEnterAnimation, opts) => {\n var _a, _b;\n if (overlay.presented) {\n return;\n }\n setRootAriaHidden(true);\n overlay.presented = true;\n overlay.willPresent.emit();\n (_a = overlay.willPresentShorthand) === null || _a === void 0 ? void 0 : _a.emit();\n const mode = getIonMode(overlay);\n // get the user's animation fn if one was provided\n const animationBuilder = overlay.enterAnimation\n ? overlay.enterAnimation\n : config.get(name, mode === 'ios' ? iosEnterAnimation : mdEnterAnimation);\n const completed = await overlayAnimation(overlay, animationBuilder, overlay.el, opts);\n if (completed) {\n overlay.didPresent.emit();\n (_b = overlay.didPresentShorthand) === null || _b === void 0 ? void 0 : _b.emit();\n }\n /**\n * When an overlay that steals focus\n * is dismissed, focus should be returned\n * to the element that was focused\n * prior to the overlay opening. Toast\n * does not steal focus and is excluded\n * from returning focus as a result.\n */\n if (overlay.el.tagName !== 'ION-TOAST') {\n focusPreviousElementOnDismiss(overlay.el);\n }\n /**\n * If the focused element is already\n * inside the overlay component then\n * focus should not be moved from that\n * to the overlay container.\n */\n if (overlay.keyboardClose && (document.activeElement === null || !overlay.el.contains(document.activeElement))) {\n overlay.el.focus();\n }\n};\n/**\n * When an overlay component is dismissed,\n * focus should be returned to the element\n * that presented the overlay. Otherwise\n * focus will be set on the body which\n * means that people using screen readers\n * or tabbing will need to re-navigate\n * to where they were before they\n * opened the overlay.\n */\nconst focusPreviousElementOnDismiss = async (overlayEl) => {\n let previousElement = document.activeElement;\n if (!previousElement) {\n return;\n }\n const shadowRoot = previousElement === null || previousElement === void 0 ? void 0 : previousElement.shadowRoot;\n if (shadowRoot) {\n // If there are no inner focusable elements, just focus the host element.\n previousElement = shadowRoot.querySelector(focusableQueryString) || previousElement;\n }\n await overlayEl.onDidDismiss();\n previousElement.focus();\n};\nconst dismiss = async (overlay, data, role, name, iosLeaveAnimation, mdLeaveAnimation, opts) => {\n var _a, _b;\n if (!overlay.presented) {\n return false;\n }\n setRootAriaHidden(false);\n overlay.presented = false;\n try {\n // Overlay contents should not be clickable during dismiss\n overlay.el.style.setProperty('pointer-events', 'none');\n overlay.willDismiss.emit({ data, role });\n (_a = overlay.willDismissShorthand) === null || _a === void 0 ? void 0 : _a.emit({ data, role });\n const mode = getIonMode(overlay);\n const animationBuilder = overlay.leaveAnimation\n ? overlay.leaveAnimation\n : config.get(name, mode === 'ios' ? iosLeaveAnimation : mdLeaveAnimation);\n // If dismissed via gesture, no need to play leaving animation again\n if (role !== 'gesture') {\n await overlayAnimation(overlay, animationBuilder, overlay.el, opts);\n }\n overlay.didDismiss.emit({ data, role });\n (_b = overlay.didDismissShorthand) === null || _b === void 0 ? void 0 : _b.emit({ data, role });\n activeAnimations.delete(overlay);\n /**\n * Make overlay hidden again in case it is being reused.\n * We can safely remove pointer-events: none as\n * overlay-hidden will set display: none.\n */\n overlay.el.classList.add('overlay-hidden');\n overlay.el.style.removeProperty('pointer-events');\n }\n catch (err) {\n console.error(err);\n }\n overlay.el.remove();\n return true;\n};\nconst getAppRoot = (doc) => {\n return doc.querySelector('ion-app') || doc.body;\n};\nconst overlayAnimation = async (overlay, animationBuilder, baseEl, opts) => {\n // Make overlay visible in case it's hidden\n baseEl.classList.remove('overlay-hidden');\n const aniRoot = overlay.el;\n const animation = animationBuilder(aniRoot, opts);\n if (!overlay.animated || !config.getBoolean('animated', true)) {\n animation.duration(0);\n }\n if (overlay.keyboardClose) {\n animation.beforeAddWrite(() => {\n const activeElement = baseEl.ownerDocument.activeElement;\n if (activeElement === null || activeElement === void 0 ? void 0 : activeElement.matches('input,ion-input, ion-textarea')) {\n activeElement.blur();\n }\n });\n }\n const activeAni = activeAnimations.get(overlay) || [];\n activeAnimations.set(overlay, [...activeAni, animation]);\n await animation.play();\n return true;\n};\nconst eventMethod = (element, eventName) => {\n let resolve;\n const promise = new Promise((r) => (resolve = r));\n onceEvent(element, eventName, (event) => {\n resolve(event.detail);\n });\n return promise;\n};\nconst onceEvent = (element, eventName, callback) => {\n const handler = (ev) => {\n removeEventListener(element, eventName, handler);\n callback(ev);\n };\n addEventListener(element, eventName, handler);\n};\nconst isCancel = (role) => {\n return role === 'cancel' || role === BACKDROP;\n};\nconst defaultGate = (h) => h();\n/**\n * Calls a developer provided method while avoiding\n * Angular Zones. Since the handler is provided by\n * the developer, we should throw any errors\n * received so that developer-provided bug\n * tracking software can log it.\n */\nconst safeCall = (handler, arg) => {\n if (typeof handler === 'function') {\n const jmp = config.get('_zoneGate', defaultGate);\n return jmp(() => {\n try {\n return handler(arg);\n }\n catch (e) {\n throw e;\n }\n });\n }\n return undefined;\n};\nconst BACKDROP = 'backdrop';\n\nexport { BACKDROP as B, alertController as a, actionSheetController as b, popoverController as c, present as d, prepareOverlay as e, dismiss as f, eventMethod as g, activeAnimations as h, isCancel as i, focusFirstDescendant as j, getOverlay as k, loadingController as l, modalController as m, pickerController as p, safeCall as s, toastController as t };\n","export function applyPolyfills() {\n var promises = [];\n if (typeof window !== 'undefined') {\n var win = window;\n\n if (!win.customElements ||\n (win.Element && (!win.Element.prototype.closest || !win.Element.prototype.matches || !win.Element.prototype.remove || !win.Element.prototype.getRootNode))) {\n promises.push(import(/* webpackChunkName: \"polyfills-dom\" */ './dom.js'));\n }\n\n var checkIfURLIsSupported = function() {\n try {\n var u = new URL('b', 'http://a');\n u.pathname = 'c%20d';\n return (u.href === 'http://a/c%20d') && u.searchParams;\n } catch (e) {\n return false;\n }\n };\n\n if (\n 'function' !== typeof Object.assign || !Object.entries ||\n !Array.prototype.find || !Array.prototype.includes ||\n !String.prototype.startsWith || !String.prototype.endsWith ||\n (win.NodeList && !win.NodeList.prototype.forEach) ||\n !win.fetch ||\n !checkIfURLIsSupported() ||\n typeof WeakMap == 'undefined'\n ) {\n promises.push(import(/* webpackChunkName: \"polyfills-core-js\" */ './core-js.js'));\n }\n }\n return Promise.all(promises);\n}\n","/*!\n * (C) Ionic http://ionicframework.com - MIT License\n */\nexport * from '../dist/esm/polyfills/index.js';\nexport * from '../dist/esm/loader.js';\n","import { Subject } from './Subject';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nexport class BehaviorSubject extends Subject {\n constructor(_value) {\n super();\n this._value = _value;\n }\n get value() {\n return this.getValue();\n }\n _subscribe(subscriber) {\n const subscription = super._subscribe(subscriber);\n if (subscription && !subscription.closed) {\n subscriber.next(this._value);\n }\n return subscription;\n }\n getValue() {\n if (this.hasError) {\n throw this.thrownError;\n }\n else if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return this._value;\n }\n }\n next(value) {\n super.next(this._value = value);\n }\n}\n","import { Subscriber } from './Subscriber';\nexport class InnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n this.index = 0;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this.index++, this);\n }\n _error(error) {\n this.parent.notifyError(error, this);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\n","import { canReportError } from './util/canReportError';\nimport { toSubscriber } from './util/toSubscriber';\nimport { observable as Symbol_observable } from './symbol/observable';\nimport { pipeFromArray } from './util/pipe';\nimport { config } from './config';\nexport class Observable {\n constructor(subscribe) {\n this._isScalar = false;\n if (subscribe) {\n this._subscribe = subscribe;\n }\n }\n lift(operator) {\n const observable = new Observable();\n observable.source = this;\n observable.operator = operator;\n return observable;\n }\n subscribe(observerOrNext, error, complete) {\n const { operator } = this;\n const sink = toSubscriber(observerOrNext, error, complete);\n if (operator) {\n sink.add(operator.call(sink, this.source));\n }\n else {\n sink.add(this.source || (config.useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ?\n this._subscribe(sink) :\n this._trySubscribe(sink));\n }\n if (config.useDeprecatedSynchronousErrorHandling) {\n if (sink.syncErrorThrowable) {\n sink.syncErrorThrowable = false;\n if (sink.syncErrorThrown) {\n throw sink.syncErrorValue;\n }\n }\n }\n return sink;\n }\n _trySubscribe(sink) {\n try {\n return this._subscribe(sink);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n sink.syncErrorThrown = true;\n sink.syncErrorValue = err;\n }\n if (canReportError(sink)) {\n sink.error(err);\n }\n else {\n console.warn(err);\n }\n }\n }\n forEach(next, promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let subscription;\n subscription = this.subscribe((value) => {\n try {\n next(value);\n }\n catch (err) {\n reject(err);\n if (subscription) {\n subscription.unsubscribe();\n }\n }\n }, reject, resolve);\n });\n }\n _subscribe(subscriber) {\n const { source } = this;\n return source && source.subscribe(subscriber);\n }\n [Symbol_observable]() {\n return this;\n }\n pipe(...operations) {\n if (operations.length === 0) {\n return this;\n }\n return pipeFromArray(operations)(this);\n }\n toPromise(promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let value;\n this.subscribe((x) => value = x, (err) => reject(err), () => resolve(value));\n });\n }\n}\nObservable.create = (subscribe) => {\n return new Observable(subscribe);\n};\nfunction getPromiseCtor(promiseCtor) {\n if (!promiseCtor) {\n promiseCtor = config.Promise || Promise;\n }\n if (!promiseCtor) {\n throw new Error('no Promise impl found');\n }\n return promiseCtor;\n}\n","import { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport const empty = {\n closed: true,\n next(value) { },\n error(err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n },\n complete() { }\n};\n","import { Subscriber } from './Subscriber';\nexport class OuterSubscriber extends Subscriber {\n notifyNext(outerValue, innerValue, outerIndex, innerIndex, innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error, innerSub) {\n this.destination.error(error);\n }\n notifyComplete(innerSub) {\n this.destination.complete();\n }\n}\n","import { Observable } from './Observable';\nimport { Subscriber } from './Subscriber';\nimport { Subscription } from './Subscription';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nexport class SubjectSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n this.destination = destination;\n }\n}\nexport class Subject extends Observable {\n constructor() {\n super();\n this.observers = [];\n this.closed = false;\n this.isStopped = false;\n this.hasError = false;\n this.thrownError = null;\n }\n [rxSubscriberSymbol]() {\n return new SubjectSubscriber(this);\n }\n lift(operator) {\n const subject = new AnonymousSubject(this, this);\n subject.operator = operator;\n return subject;\n }\n next(value) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n if (!this.isStopped) {\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].next(value);\n }\n }\n }\n error(err) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.hasError = true;\n this.thrownError = err;\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].error(err);\n }\n this.observers.length = 0;\n }\n complete() {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].complete();\n }\n this.observers.length = 0;\n }\n unsubscribe() {\n this.isStopped = true;\n this.closed = true;\n this.observers = null;\n }\n _trySubscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return super._trySubscribe(subscriber);\n }\n }\n _subscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.hasError) {\n subscriber.error(this.thrownError);\n return Subscription.EMPTY;\n }\n else if (this.isStopped) {\n subscriber.complete();\n return Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n return new SubjectSubscription(this, subscriber);\n }\n }\n asObservable() {\n const observable = new Observable();\n observable.source = this;\n return observable;\n }\n}\nSubject.create = (destination, source) => {\n return new AnonymousSubject(destination, source);\n};\nexport class AnonymousSubject extends Subject {\n constructor(destination, source) {\n super();\n this.destination = destination;\n this.source = source;\n }\n next(value) {\n const { destination } = this;\n if (destination && destination.next) {\n destination.next(value);\n }\n }\n error(err) {\n const { destination } = this;\n if (destination && destination.error) {\n this.destination.error(err);\n }\n }\n complete() {\n const { destination } = this;\n if (destination && destination.complete) {\n this.destination.complete();\n }\n }\n _subscribe(subscriber) {\n const { source } = this;\n if (source) {\n return this.source.subscribe(subscriber);\n }\n else {\n return Subscription.EMPTY;\n }\n }\n}\n","import { Subscription } from './Subscription';\nexport class SubjectSubscription extends Subscription {\n constructor(subject, subscriber) {\n super();\n this.subject = subject;\n this.subscriber = subscriber;\n this.closed = false;\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.closed = true;\n const subject = this.subject;\n const observers = subject.observers;\n this.subject = null;\n if (!observers || observers.length === 0 || subject.isStopped || subject.closed) {\n return;\n }\n const subscriberIndex = observers.indexOf(this.subscriber);\n if (subscriberIndex !== -1) {\n observers.splice(subscriberIndex, 1);\n }\n }\n}\n","import { isFunction } from './util/isFunction';\nimport { empty as emptyObserver } from './Observer';\nimport { Subscription } from './Subscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nimport { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport class Subscriber extends Subscription {\n constructor(destinationOrNext, error, complete) {\n super();\n this.syncErrorValue = null;\n this.syncErrorThrown = false;\n this.syncErrorThrowable = false;\n this.isStopped = false;\n switch (arguments.length) {\n case 0:\n this.destination = emptyObserver;\n break;\n case 1:\n if (!destinationOrNext) {\n this.destination = emptyObserver;\n break;\n }\n if (typeof destinationOrNext === 'object') {\n if (destinationOrNext instanceof Subscriber) {\n this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;\n this.destination = destinationOrNext;\n destinationOrNext.add(this);\n }\n else {\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext);\n }\n break;\n }\n default:\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext, error, complete);\n break;\n }\n }\n [rxSubscriberSymbol]() { return this; }\n static create(next, error, complete) {\n const subscriber = new Subscriber(next, error, complete);\n subscriber.syncErrorThrowable = false;\n return subscriber;\n }\n next(value) {\n if (!this.isStopped) {\n this._next(value);\n }\n }\n error(err) {\n if (!this.isStopped) {\n this.isStopped = true;\n this._error(err);\n }\n }\n complete() {\n if (!this.isStopped) {\n this.isStopped = true;\n this._complete();\n }\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.isStopped = true;\n super.unsubscribe();\n }\n _next(value) {\n this.destination.next(value);\n }\n _error(err) {\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.destination.complete();\n this.unsubscribe();\n }\n _unsubscribeAndRecycle() {\n const { _parentOrParents } = this;\n this._parentOrParents = null;\n this.unsubscribe();\n this.closed = false;\n this.isStopped = false;\n this._parentOrParents = _parentOrParents;\n return this;\n }\n}\nexport class SafeSubscriber extends Subscriber {\n constructor(_parentSubscriber, observerOrNext, error, complete) {\n super();\n this._parentSubscriber = _parentSubscriber;\n let next;\n let context = this;\n if (isFunction(observerOrNext)) {\n next = observerOrNext;\n }\n else if (observerOrNext) {\n next = observerOrNext.next;\n error = observerOrNext.error;\n complete = observerOrNext.complete;\n if (observerOrNext !== emptyObserver) {\n context = Object.create(observerOrNext);\n if (isFunction(context.unsubscribe)) {\n this.add(context.unsubscribe.bind(context));\n }\n context.unsubscribe = this.unsubscribe.bind(this);\n }\n }\n this._context = context;\n this._next = next;\n this._error = error;\n this._complete = complete;\n }\n next(value) {\n if (!this.isStopped && this._next) {\n const { _parentSubscriber } = this;\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._next, value);\n }\n else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {\n this.unsubscribe();\n }\n }\n }\n error(err) {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n const { useDeprecatedSynchronousErrorHandling } = config;\n if (this._error) {\n if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._error, err);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, this._error, err);\n this.unsubscribe();\n }\n }\n else if (!_parentSubscriber.syncErrorThrowable) {\n this.unsubscribe();\n if (useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n hostReportError(err);\n }\n else {\n if (useDeprecatedSynchronousErrorHandling) {\n _parentSubscriber.syncErrorValue = err;\n _parentSubscriber.syncErrorThrown = true;\n }\n else {\n hostReportError(err);\n }\n this.unsubscribe();\n }\n }\n }\n complete() {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n if (this._complete) {\n const wrappedComplete = () => this._complete.call(this._context);\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(wrappedComplete);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, wrappedComplete);\n this.unsubscribe();\n }\n }\n else {\n this.unsubscribe();\n }\n }\n }\n __tryOrUnsub(fn, value) {\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n this.unsubscribe();\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n }\n }\n __tryOrSetError(parent, fn, value) {\n if (!config.useDeprecatedSynchronousErrorHandling) {\n throw new Error('bad call');\n }\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n parent.syncErrorValue = err;\n parent.syncErrorThrown = true;\n return true;\n }\n else {\n hostReportError(err);\n return true;\n }\n }\n return false;\n }\n _unsubscribe() {\n const { _parentSubscriber } = this;\n this._context = null;\n this._parentSubscriber = null;\n _parentSubscriber.unsubscribe();\n }\n}\n","import { isArray } from './util/isArray';\nimport { isObject } from './util/isObject';\nimport { isFunction } from './util/isFunction';\nimport { UnsubscriptionError } from './util/UnsubscriptionError';\nexport class Subscription {\n constructor(unsubscribe) {\n this.closed = false;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (unsubscribe) {\n this._ctorUnsubscribe = true;\n this._unsubscribe = unsubscribe;\n }\n }\n unsubscribe() {\n let errors;\n if (this.closed) {\n return;\n }\n let { _parentOrParents, _ctorUnsubscribe, _unsubscribe, _subscriptions } = this;\n this.closed = true;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (_parentOrParents instanceof Subscription) {\n _parentOrParents.remove(this);\n }\n else if (_parentOrParents !== null) {\n for (let index = 0; index < _parentOrParents.length; ++index) {\n const parent = _parentOrParents[index];\n parent.remove(this);\n }\n }\n if (isFunction(_unsubscribe)) {\n if (_ctorUnsubscribe) {\n this._unsubscribe = undefined;\n }\n try {\n _unsubscribe.call(this);\n }\n catch (e) {\n errors = e instanceof UnsubscriptionError ? flattenUnsubscriptionErrors(e.errors) : [e];\n }\n }\n if (isArray(_subscriptions)) {\n let index = -1;\n let len = _subscriptions.length;\n while (++index < len) {\n const sub = _subscriptions[index];\n if (isObject(sub)) {\n try {\n sub.unsubscribe();\n }\n catch (e) {\n errors = errors || [];\n if (e instanceof UnsubscriptionError) {\n errors = errors.concat(flattenUnsubscriptionErrors(e.errors));\n }\n else {\n errors.push(e);\n }\n }\n }\n }\n }\n if (errors) {\n throw new UnsubscriptionError(errors);\n }\n }\n add(teardown) {\n let subscription = teardown;\n if (!teardown) {\n return Subscription.EMPTY;\n }\n switch (typeof teardown) {\n case 'function':\n subscription = new Subscription(teardown);\n case 'object':\n if (subscription === this || subscription.closed || typeof subscription.unsubscribe !== 'function') {\n return subscription;\n }\n else if (this.closed) {\n subscription.unsubscribe();\n return subscription;\n }\n else if (!(subscription instanceof Subscription)) {\n const tmp = subscription;\n subscription = new Subscription();\n subscription._subscriptions = [tmp];\n }\n break;\n default: {\n throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.');\n }\n }\n let { _parentOrParents } = subscription;\n if (_parentOrParents === null) {\n subscription._parentOrParents = this;\n }\n else if (_parentOrParents instanceof Subscription) {\n if (_parentOrParents === this) {\n return subscription;\n }\n subscription._parentOrParents = [_parentOrParents, this];\n }\n else if (_parentOrParents.indexOf(this) === -1) {\n _parentOrParents.push(this);\n }\n else {\n return subscription;\n }\n const subscriptions = this._subscriptions;\n if (subscriptions === null) {\n this._subscriptions = [subscription];\n }\n else {\n subscriptions.push(subscription);\n }\n return subscription;\n }\n remove(subscription) {\n const subscriptions = this._subscriptions;\n if (subscriptions) {\n const subscriptionIndex = subscriptions.indexOf(subscription);\n if (subscriptionIndex !== -1) {\n subscriptions.splice(subscriptionIndex, 1);\n }\n }\n }\n}\nSubscription.EMPTY = (function (empty) {\n empty.closed = true;\n return empty;\n}(new Subscription()));\nfunction flattenUnsubscriptionErrors(errors) {\n return errors.reduce((errs, err) => errs.concat((err instanceof UnsubscriptionError) ? err.errors : err), []);\n}\n","let _enable_super_gross_mode_that_will_cause_bad_things = false;\nexport const config = {\n Promise: undefined,\n set useDeprecatedSynchronousErrorHandling(value) {\n if (value) {\n const error = new Error();\n console.warn('DEPRECATED! RxJS was set to use deprecated synchronous error handling behavior by code at: \\n' + error.stack);\n }\n else if (_enable_super_gross_mode_that_will_cause_bad_things) {\n console.log('RxJS: Back to a better error behavior. Thank you. <3');\n }\n _enable_super_gross_mode_that_will_cause_bad_things = value;\n },\n get useDeprecatedSynchronousErrorHandling() {\n return _enable_super_gross_mode_that_will_cause_bad_things;\n },\n};\n","import { Subscriber } from './Subscriber';\nimport { Observable } from './Observable';\nimport { subscribeTo } from './util/subscribeTo';\nexport class SimpleInnerSubscriber extends Subscriber {\n constructor(parent) {\n super();\n this.parent = parent;\n }\n _next(value) {\n this.parent.notifyNext(value);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete();\n this.unsubscribe();\n }\n}\nexport class ComplexInnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\nexport class SimpleOuterSubscriber extends Subscriber {\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyError(err) {\n this.destination.error(err);\n }\n notifyComplete() {\n this.destination.complete();\n }\n}\nexport class ComplexOuterSubscriber extends Subscriber {\n notifyNext(_outerValue, innerValue, _outerIndex, _innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error) {\n this.destination.error(error);\n }\n notifyComplete(_innerSub) {\n this.destination.complete();\n }\n}\nexport function innerSubscribe(result, innerSubscriber) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n let subscription;\n try {\n subscription = subscribeTo(result)(innerSubscriber);\n }\n catch (error) {\n innerSubscriber.error(error);\n }\n return subscription;\n}\n","import { SubjectSubscriber } from '../Subject';\nimport { Observable } from '../Observable';\nimport { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nimport { refCount as higherOrderRefCount } from '../operators/refCount';\nexport class ConnectableObservable extends Observable {\n constructor(source, subjectFactory) {\n super();\n this.source = source;\n this.subjectFactory = subjectFactory;\n this._refCount = 0;\n this._isComplete = false;\n }\n _subscribe(subscriber) {\n return this.getSubject().subscribe(subscriber);\n }\n getSubject() {\n const subject = this._subject;\n if (!subject || subject.isStopped) {\n this._subject = this.subjectFactory();\n }\n return this._subject;\n }\n connect() {\n let connection = this._connection;\n if (!connection) {\n this._isComplete = false;\n connection = this._connection = new Subscription();\n connection.add(this.source\n .subscribe(new ConnectableSubscriber(this.getSubject(), this)));\n if (connection.closed) {\n this._connection = null;\n connection = Subscription.EMPTY;\n }\n }\n return connection;\n }\n refCount() {\n return higherOrderRefCount()(this);\n }\n}\nexport const connectableObservableDescriptor = (() => {\n const connectableProto = ConnectableObservable.prototype;\n return {\n operator: { value: null },\n _refCount: { value: 0, writable: true },\n _subject: { value: null, writable: true },\n _connection: { value: null, writable: true },\n _subscribe: { value: connectableProto._subscribe },\n _isComplete: { value: connectableProto._isComplete, writable: true },\n getSubject: { value: connectableProto.getSubject },\n connect: { value: connectableProto.connect },\n refCount: { value: connectableProto.refCount }\n };\n})();\nclass ConnectableSubscriber extends SubjectSubscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _error(err) {\n this._unsubscribe();\n super._error(err);\n }\n _complete() {\n this.connectable._isComplete = true;\n this._unsubscribe();\n super._complete();\n }\n _unsubscribe() {\n const connectable = this.connectable;\n if (connectable) {\n this.connectable = null;\n const connection = connectable._connection;\n connectable._refCount = 0;\n connectable._subject = null;\n connectable._connection = null;\n if (connection) {\n connection.unsubscribe();\n }\n }\n }\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { isArray } from '../util/isArray';\nimport { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nimport { fromArray } from './fromArray';\nconst NONE = {};\nexport function combineLatest(...observables) {\n let resultSelector = undefined;\n let scheduler = undefined;\n if (isScheduler(observables[observables.length - 1])) {\n scheduler = observables.pop();\n }\n if (typeof observables[observables.length - 1] === 'function') {\n resultSelector = observables.pop();\n }\n if (observables.length === 1 && isArray(observables[0])) {\n observables = observables[0];\n }\n return fromArray(observables, scheduler).lift(new CombineLatestOperator(resultSelector));\n}\nexport class CombineLatestOperator {\n constructor(resultSelector) {\n this.resultSelector = resultSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new CombineLatestSubscriber(subscriber, this.resultSelector));\n }\n}\nexport class CombineLatestSubscriber extends OuterSubscriber {\n constructor(destination, resultSelector) {\n super(destination);\n this.resultSelector = resultSelector;\n this.active = 0;\n this.values = [];\n this.observables = [];\n }\n _next(observable) {\n this.values.push(NONE);\n this.observables.push(observable);\n }\n _complete() {\n const observables = this.observables;\n const len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n this.active = len;\n this.toRespond = len;\n for (let i = 0; i < len; i++) {\n const observable = observables[i];\n this.add(subscribeToResult(this, observable, undefined, i));\n }\n }\n }\n notifyComplete(unused) {\n if ((this.active -= 1) === 0) {\n this.destination.complete();\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n const values = this.values;\n const oldVal = values[outerIndex];\n const toRespond = !this.toRespond\n ? 0\n : oldVal === NONE ? --this.toRespond : this.toRespond;\n values[outerIndex] = innerValue;\n if (toRespond === 0) {\n if (this.resultSelector) {\n this._tryResultSelector(values);\n }\n else {\n this.destination.next(values.slice());\n }\n }\n }\n _tryResultSelector(values) {\n let result;\n try {\n result = this.resultSelector.apply(this, values);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { of } from './of';\nimport { concatAll } from '../operators/concatAll';\nexport function concat(...observables) {\n return concatAll()(of(...observables));\n}\n","import { Observable } from '../Observable';\nimport { from } from './from';\nimport { empty } from './empty';\nexport function defer(observableFactory) {\n return new Observable(subscriber => {\n let input;\n try {\n input = observableFactory();\n }\n catch (err) {\n subscriber.error(err);\n return undefined;\n }\n const source = input ? from(input) : empty();\n return source.subscribe(subscriber);\n });\n}\n","import { Observable } from '../Observable';\nexport const EMPTY = new Observable(subscriber => subscriber.complete());\nexport function empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : EMPTY;\n}\nfunction emptyScheduled(scheduler) {\n return new Observable(subscriber => scheduler.schedule(() => subscriber.complete()));\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { map } from '../operators/map';\nimport { isObject } from '../util/isObject';\nimport { from } from './from';\nexport function forkJoin(...sources) {\n if (sources.length === 1) {\n const first = sources[0];\n if (isArray(first)) {\n return forkJoinInternal(first, null);\n }\n if (isObject(first) && Object.getPrototypeOf(first) === Object.prototype) {\n const keys = Object.keys(first);\n return forkJoinInternal(keys.map(key => first[key]), keys);\n }\n }\n if (typeof sources[sources.length - 1] === 'function') {\n const resultSelector = sources.pop();\n sources = (sources.length === 1 && isArray(sources[0])) ? sources[0] : sources;\n return forkJoinInternal(sources, null).pipe(map((args) => resultSelector(...args)));\n }\n return forkJoinInternal(sources, null);\n}\nfunction forkJoinInternal(sources, keys) {\n return new Observable(subscriber => {\n const len = sources.length;\n if (len === 0) {\n subscriber.complete();\n return;\n }\n const values = new Array(len);\n let completed = 0;\n let emitted = 0;\n for (let i = 0; i < len; i++) {\n const source = from(sources[i]);\n let hasValue = false;\n subscriber.add(source.subscribe({\n next: value => {\n if (!hasValue) {\n hasValue = true;\n emitted++;\n }\n values[i] = value;\n },\n error: err => subscriber.error(err),\n complete: () => {\n completed++;\n if (completed === len || !hasValue) {\n if (emitted === len) {\n subscriber.next(keys ?\n keys.reduce((result, key, i) => (result[key] = values[i], result), {}) :\n values);\n }\n subscriber.complete();\n }\n }\n }));\n }\n });\n}\n","import { Observable } from '../Observable';\nimport { subscribeTo } from '../util/subscribeTo';\nimport { scheduled } from '../scheduled/scheduled';\nexport function from(input, scheduler) {\n if (!scheduler) {\n if (input instanceof Observable) {\n return input;\n }\n return new Observable(subscribeTo(input));\n }\n else {\n return scheduled(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { subscribeToArray } from '../util/subscribeToArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function fromArray(input, scheduler) {\n if (!scheduler) {\n return new Observable(subscribeToArray(input));\n }\n else {\n return scheduleArray(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { isFunction } from '../util/isFunction';\nimport { map } from '../operators/map';\nconst toString = (() => Object.prototype.toString)();\nexport function fromEvent(target, eventName, options, resultSelector) {\n if (isFunction(options)) {\n resultSelector = options;\n options = undefined;\n }\n if (resultSelector) {\n return fromEvent(target, eventName, options).pipe(map(args => isArray(args) ? resultSelector(...args) : resultSelector(args)));\n }\n return new Observable(subscriber => {\n function handler(e) {\n if (arguments.length > 1) {\n subscriber.next(Array.prototype.slice.call(arguments));\n }\n else {\n subscriber.next(e);\n }\n }\n setupSubscription(target, eventName, handler, subscriber, options);\n });\n}\nfunction setupSubscription(sourceObj, eventName, handler, subscriber, options) {\n let unsubscribe;\n if (isEventTarget(sourceObj)) {\n const source = sourceObj;\n sourceObj.addEventListener(eventName, handler, options);\n unsubscribe = () => source.removeEventListener(eventName, handler, options);\n }\n else if (isJQueryStyleEventEmitter(sourceObj)) {\n const source = sourceObj;\n sourceObj.on(eventName, handler);\n unsubscribe = () => source.off(eventName, handler);\n }\n else if (isNodeStyleEventEmitter(sourceObj)) {\n const source = sourceObj;\n sourceObj.addListener(eventName, handler);\n unsubscribe = () => source.removeListener(eventName, handler);\n }\n else if (sourceObj && sourceObj.length) {\n for (let i = 0, len = sourceObj.length; i < len; i++) {\n setupSubscription(sourceObj[i], eventName, handler, subscriber, options);\n }\n }\n else {\n throw new TypeError('Invalid event target');\n }\n subscriber.add(unsubscribe);\n}\nfunction isNodeStyleEventEmitter(sourceObj) {\n return sourceObj && typeof sourceObj.addListener === 'function' && typeof sourceObj.removeListener === 'function';\n}\nfunction isJQueryStyleEventEmitter(sourceObj) {\n return sourceObj && typeof sourceObj.on === 'function' && typeof sourceObj.off === 'function';\n}\nfunction isEventTarget(sourceObj) {\n return sourceObj && typeof sourceObj.addEventListener === 'function' && typeof sourceObj.removeEventListener === 'function';\n}\n","import { Observable } from '../Observable';\nimport { isScheduler } from '../util/isScheduler';\nimport { mergeAll } from '../operators/mergeAll';\nimport { fromArray } from './fromArray';\nexport function merge(...observables) {\n let concurrent = Number.POSITIVE_INFINITY;\n let scheduler = null;\n let last = observables[observables.length - 1];\n if (isScheduler(last)) {\n scheduler = observables.pop();\n if (observables.length > 1 && typeof observables[observables.length - 1] === 'number') {\n concurrent = observables.pop();\n }\n }\n else if (typeof last === 'number') {\n concurrent = observables.pop();\n }\n if (scheduler === null && observables.length === 1 && observables[0] instanceof Observable) {\n return observables[0];\n }\n return mergeAll(concurrent)(fromArray(observables, scheduler));\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { fromArray } from './fromArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function of(...args) {\n let scheduler = args[args.length - 1];\n if (isScheduler(scheduler)) {\n args.pop();\n return scheduleArray(args, scheduler);\n }\n else {\n return fromArray(args);\n }\n}\n","import { Observable } from '../Observable';\nexport function throwError(error, scheduler) {\n if (!scheduler) {\n return new Observable(subscriber => subscriber.error(error));\n }\n else {\n return new Observable(subscriber => scheduler.schedule(dispatch, 0, { error, subscriber }));\n }\n}\nfunction dispatch({ error, subscriber }) {\n subscriber.error(error);\n}\n","import { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function catchError(selector) {\n return function catchErrorOperatorFunction(source) {\n const operator = new CatchOperator(selector);\n const caught = source.lift(operator);\n return (operator.caught = caught);\n };\n}\nclass CatchOperator {\n constructor(selector) {\n this.selector = selector;\n }\n call(subscriber, source) {\n return source.subscribe(new CatchSubscriber(subscriber, this.selector, this.caught));\n }\n}\nclass CatchSubscriber extends SimpleOuterSubscriber {\n constructor(destination, selector, caught) {\n super(destination);\n this.selector = selector;\n this.caught = caught;\n }\n error(err) {\n if (!this.isStopped) {\n let result;\n try {\n result = this.selector(err, this.caught);\n }\n catch (err2) {\n super.error(err2);\n return;\n }\n this._unsubscribeAndRecycle();\n const innerSubscriber = new SimpleInnerSubscriber(this);\n this.add(innerSubscriber);\n const innerSubscription = innerSubscribe(result, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n this.add(innerSubscription);\n }\n }\n }\n}\n","import { mergeAll } from './mergeAll';\nexport function concatAll() {\n return mergeAll(1);\n}\n","import { mergeMap } from './mergeMap';\nexport function concatMap(project, resultSelector) {\n return mergeMap(project, resultSelector, 1);\n}\n","import { Subscriber } from '../Subscriber';\nexport function defaultIfEmpty(defaultValue = null) {\n return (source) => source.lift(new DefaultIfEmptyOperator(defaultValue));\n}\nclass DefaultIfEmptyOperator {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n call(subscriber, source) {\n return source.subscribe(new DefaultIfEmptySubscriber(subscriber, this.defaultValue));\n }\n}\nclass DefaultIfEmptySubscriber extends Subscriber {\n constructor(destination, defaultValue) {\n super(destination);\n this.defaultValue = defaultValue;\n this.isEmpty = true;\n }\n _next(value) {\n this.isEmpty = false;\n this.destination.next(value);\n }\n _complete() {\n if (this.isEmpty) {\n this.destination.next(this.defaultValue);\n }\n this.destination.complete();\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function distinctUntilChanged(compare, keySelector) {\n return (source) => source.lift(new DistinctUntilChangedOperator(compare, keySelector));\n}\nclass DistinctUntilChangedOperator {\n constructor(compare, keySelector) {\n this.compare = compare;\n this.keySelector = keySelector;\n }\n call(subscriber, source) {\n return source.subscribe(new DistinctUntilChangedSubscriber(subscriber, this.compare, this.keySelector));\n }\n}\nclass DistinctUntilChangedSubscriber extends Subscriber {\n constructor(destination, compare, keySelector) {\n super(destination);\n this.keySelector = keySelector;\n this.hasKey = false;\n if (typeof compare === 'function') {\n this.compare = compare;\n }\n }\n compare(x, y) {\n return x === y;\n }\n _next(value) {\n let key;\n try {\n const { keySelector } = this;\n key = keySelector ? keySelector(value) : value;\n }\n catch (err) {\n return this.destination.error(err);\n }\n let result = false;\n if (this.hasKey) {\n try {\n const { compare } = this;\n result = compare(this.key, key);\n }\n catch (err) {\n return this.destination.error(err);\n }\n }\n else {\n this.hasKey = true;\n }\n if (!result) {\n this.key = key;\n this.destination.next(value);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function filter(predicate, thisArg) {\n return function filterOperatorFunction(source) {\n return source.lift(new FilterOperator(predicate, thisArg));\n };\n}\nclass FilterOperator {\n constructor(predicate, thisArg) {\n this.predicate = predicate;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new FilterSubscriber(subscriber, this.predicate, this.thisArg));\n }\n}\nclass FilterSubscriber extends Subscriber {\n constructor(destination, predicate, thisArg) {\n super(destination);\n this.predicate = predicate;\n this.thisArg = thisArg;\n this.count = 0;\n }\n _next(value) {\n let result;\n try {\n result = this.predicate.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n if (result) {\n this.destination.next(value);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nexport function finalize(callback) {\n return (source) => source.lift(new FinallyOperator(callback));\n}\nclass FinallyOperator {\n constructor(callback) {\n this.callback = callback;\n }\n call(subscriber, source) {\n return source.subscribe(new FinallySubscriber(subscriber, this.callback));\n }\n}\nclass FinallySubscriber extends Subscriber {\n constructor(destination, callback) {\n super(destination);\n this.add(new Subscription(callback));\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { take } from './take';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { identity } from '../util/identity';\nexport function first(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, take(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { takeLast } from './takeLast';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { identity } from '../util/identity';\nexport function last(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, takeLast(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { Subscriber } from '../Subscriber';\nexport function map(project, thisArg) {\n return function mapOperation(source) {\n if (typeof project !== 'function') {\n throw new TypeError('argument is not a function. Are you looking for `mapTo()`?');\n }\n return source.lift(new MapOperator(project, thisArg));\n };\n}\nexport class MapOperator {\n constructor(project, thisArg) {\n this.project = project;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new MapSubscriber(subscriber, this.project, this.thisArg));\n }\n}\nclass MapSubscriber extends Subscriber {\n constructor(destination, project, thisArg) {\n super(destination);\n this.project = project;\n this.count = 0;\n this.thisArg = thisArg || this;\n }\n _next(value) {\n let result;\n try {\n result = this.project.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function mapTo(value) {\n return (source) => source.lift(new MapToOperator(value));\n}\nclass MapToOperator {\n constructor(value) {\n this.value = value;\n }\n call(subscriber, source) {\n return source.subscribe(new MapToSubscriber(subscriber, this.value));\n }\n}\nclass MapToSubscriber extends Subscriber {\n constructor(destination, value) {\n super(destination);\n this.value = value;\n }\n _next(x) {\n this.destination.next(this.value);\n }\n}\n","import { mergeMap } from './mergeMap';\nimport { identity } from '../util/identity';\nexport function mergeAll(concurrent = Number.POSITIVE_INFINITY) {\n return mergeMap(identity, concurrent);\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function mergeMap(project, resultSelector, concurrent = Number.POSITIVE_INFINITY) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(mergeMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii))), concurrent));\n }\n else if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return (source) => source.lift(new MergeMapOperator(project, concurrent));\n}\nexport class MergeMapOperator {\n constructor(project, concurrent = Number.POSITIVE_INFINITY) {\n this.project = project;\n this.concurrent = concurrent;\n }\n call(observer, source) {\n return source.subscribe(new MergeMapSubscriber(observer, this.project, this.concurrent));\n }\n}\nexport class MergeMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project, concurrent = Number.POSITIVE_INFINITY) {\n super(destination);\n this.project = project;\n this.concurrent = concurrent;\n this.hasCompleted = false;\n this.buffer = [];\n this.active = 0;\n this.index = 0;\n }\n _next(value) {\n if (this.active < this.concurrent) {\n this._tryNext(value);\n }\n else {\n this.buffer.push(value);\n }\n }\n _tryNext(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.active++;\n this._innerSub(result);\n }\n _innerSub(ish) {\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n const innerSubscription = innerSubscribe(ish, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n }\n _complete() {\n this.hasCompleted = true;\n if (this.active === 0 && this.buffer.length === 0) {\n this.destination.complete();\n }\n this.unsubscribe();\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyComplete() {\n const buffer = this.buffer;\n this.active--;\n if (buffer.length > 0) {\n this._next(buffer.shift());\n }\n else if (this.active === 0 && this.hasCompleted) {\n this.destination.complete();\n }\n }\n}\nexport const flatMap = mergeMap;\n","import { connectableObservableDescriptor } from '../observable/ConnectableObservable';\nexport function multicast(subjectOrSubjectFactory, selector) {\n return function multicastOperatorFunction(source) {\n let subjectFactory;\n if (typeof subjectOrSubjectFactory === 'function') {\n subjectFactory = subjectOrSubjectFactory;\n }\n else {\n subjectFactory = function subjectFactory() {\n return subjectOrSubjectFactory;\n };\n }\n if (typeof selector === 'function') {\n return source.lift(new MulticastOperator(subjectFactory, selector));\n }\n const connectable = Object.create(source, connectableObservableDescriptor);\n connectable.source = source;\n connectable.subjectFactory = subjectFactory;\n return connectable;\n };\n}\nexport class MulticastOperator {\n constructor(subjectFactory, selector) {\n this.subjectFactory = subjectFactory;\n this.selector = selector;\n }\n call(subscriber, source) {\n const { selector } = this;\n const subject = this.subjectFactory();\n const subscription = selector(subject).subscribe(subscriber);\n subscription.add(source.subscribe(subject));\n return subscription;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function refCount() {\n return function refCountOperatorFunction(source) {\n return source.lift(new RefCountOperator(source));\n };\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function scan(accumulator, seed) {\n let hasSeed = false;\n if (arguments.length >= 2) {\n hasSeed = true;\n }\n return function scanOperatorFunction(source) {\n return source.lift(new ScanOperator(accumulator, seed, hasSeed));\n };\n}\nclass ScanOperator {\n constructor(accumulator, seed, hasSeed = false) {\n this.accumulator = accumulator;\n this.seed = seed;\n this.hasSeed = hasSeed;\n }\n call(subscriber, source) {\n return source.subscribe(new ScanSubscriber(subscriber, this.accumulator, this.seed, this.hasSeed));\n }\n}\nclass ScanSubscriber extends Subscriber {\n constructor(destination, accumulator, _seed, hasSeed) {\n super(destination);\n this.accumulator = accumulator;\n this._seed = _seed;\n this.hasSeed = hasSeed;\n this.index = 0;\n }\n get seed() {\n return this._seed;\n }\n set seed(value) {\n this.hasSeed = true;\n this._seed = value;\n }\n _next(value) {\n if (!this.hasSeed) {\n this.seed = value;\n this.destination.next(value);\n }\n else {\n return this._tryNext(value);\n }\n }\n _tryNext(value) {\n const index = this.index++;\n let result;\n try {\n result = this.accumulator(this.seed, value, index);\n }\n catch (err) {\n this.destination.error(err);\n }\n this.seed = result;\n this.destination.next(result);\n }\n}\n","import { multicast } from './multicast';\nimport { refCount } from './refCount';\nimport { Subject } from '../Subject';\nfunction shareSubjectFactory() {\n return new Subject();\n}\nexport function share() {\n return (source) => refCount()(multicast(shareSubjectFactory)(source));\n}\n","import { concat } from '../observable/concat';\nimport { isScheduler } from '../util/isScheduler';\nexport function startWith(...array) {\n const scheduler = array[array.length - 1];\n if (isScheduler(scheduler)) {\n array.pop();\n return (source) => concat(array, source, scheduler);\n }\n else {\n return (source) => concat(array, source);\n }\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function switchMap(project, resultSelector) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(switchMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii)))));\n }\n return (source) => source.lift(new SwitchMapOperator(project));\n}\nclass SwitchMapOperator {\n constructor(project) {\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new SwitchMapSubscriber(subscriber, this.project));\n }\n}\nclass SwitchMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project) {\n super(destination);\n this.project = project;\n this.index = 0;\n }\n _next(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (error) {\n this.destination.error(error);\n return;\n }\n this._innerSub(result);\n }\n _innerSub(result) {\n const innerSubscription = this.innerSubscription;\n if (innerSubscription) {\n innerSubscription.unsubscribe();\n }\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n this.innerSubscription = innerSubscribe(result, innerSubscriber);\n if (this.innerSubscription !== innerSubscriber) {\n destination.add(this.innerSubscription);\n }\n }\n _complete() {\n const { innerSubscription } = this;\n if (!innerSubscription || innerSubscription.closed) {\n super._complete();\n }\n this.unsubscribe();\n }\n _unsubscribe() {\n this.innerSubscription = undefined;\n }\n notifyComplete() {\n this.innerSubscription = undefined;\n if (this.isStopped) {\n super._complete();\n }\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function take(count) {\n return (source) => {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeOperator(count));\n }\n };\n}\nclass TakeOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeSubscriber(subscriber, this.total));\n }\n}\nclass TakeSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.count = 0;\n }\n _next(value) {\n const total = this.total;\n const count = ++this.count;\n if (count <= total) {\n this.destination.next(value);\n if (count === total) {\n this.destination.complete();\n this.unsubscribe();\n }\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function takeLast(count) {\n return function takeLastOperatorFunction(source) {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeLastOperator(count));\n }\n };\n}\nclass TakeLastOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeLastSubscriber(subscriber, this.total));\n }\n}\nclass TakeLastSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.ring = new Array();\n this.count = 0;\n }\n _next(value) {\n const ring = this.ring;\n const total = this.total;\n const count = this.count++;\n if (ring.length < total) {\n ring.push(value);\n }\n else {\n const index = count % total;\n ring[index] = value;\n }\n }\n _complete() {\n const destination = this.destination;\n let count = this.count;\n if (count > 0) {\n const total = this.count >= this.total ? this.total : this.count;\n const ring = this.ring;\n for (let i = 0; i < total; i++) {\n const idx = (count++) % total;\n destination.next(ring[idx]);\n }\n }\n destination.complete();\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function takeWhile(predicate, inclusive = false) {\n return (source) => source.lift(new TakeWhileOperator(predicate, inclusive));\n}\nclass TakeWhileOperator {\n constructor(predicate, inclusive) {\n this.predicate = predicate;\n this.inclusive = inclusive;\n }\n call(subscriber, source) {\n return source.subscribe(new TakeWhileSubscriber(subscriber, this.predicate, this.inclusive));\n }\n}\nclass TakeWhileSubscriber extends Subscriber {\n constructor(destination, predicate, inclusive) {\n super(destination);\n this.predicate = predicate;\n this.inclusive = inclusive;\n this.index = 0;\n }\n _next(value) {\n const destination = this.destination;\n let result;\n try {\n result = this.predicate(value, this.index++);\n }\n catch (err) {\n destination.error(err);\n return;\n }\n this.nextOrComplete(value, result);\n }\n nextOrComplete(value, predicateResult) {\n const destination = this.destination;\n if (Boolean(predicateResult)) {\n destination.next(value);\n }\n else {\n if (this.inclusive) {\n destination.next(value);\n }\n destination.complete();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { noop } from '../util/noop';\nimport { isFunction } from '../util/isFunction';\nexport function tap(nextOrObserver, error, complete) {\n return function tapOperatorFunction(source) {\n return source.lift(new DoOperator(nextOrObserver, error, complete));\n };\n}\nclass DoOperator {\n constructor(nextOrObserver, error, complete) {\n this.nextOrObserver = nextOrObserver;\n this.error = error;\n this.complete = complete;\n }\n call(subscriber, source) {\n return source.subscribe(new TapSubscriber(subscriber, this.nextOrObserver, this.error, this.complete));\n }\n}\nclass TapSubscriber extends Subscriber {\n constructor(destination, observerOrNext, error, complete) {\n super(destination);\n this._tapNext = noop;\n this._tapError = noop;\n this._tapComplete = noop;\n this._tapError = error || noop;\n this._tapComplete = complete || noop;\n if (isFunction(observerOrNext)) {\n this._context = this;\n this._tapNext = observerOrNext;\n }\n else if (observerOrNext) {\n this._context = observerOrNext;\n this._tapNext = observerOrNext.next || noop;\n this._tapError = observerOrNext.error || noop;\n this._tapComplete = observerOrNext.complete || noop;\n }\n }\n _next(value) {\n try {\n this._tapNext.call(this._context, value);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(value);\n }\n _error(err) {\n try {\n this._tapError.call(this._context, err);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.error(err);\n }\n _complete() {\n try {\n this._tapComplete.call(this._context);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n return this.destination.complete();\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { Subscriber } from '../Subscriber';\nexport function throwIfEmpty(errorFactory = defaultErrorFactory) {\n return (source) => {\n return source.lift(new ThrowIfEmptyOperator(errorFactory));\n };\n}\nclass ThrowIfEmptyOperator {\n constructor(errorFactory) {\n this.errorFactory = errorFactory;\n }\n call(subscriber, source) {\n return source.subscribe(new ThrowIfEmptySubscriber(subscriber, this.errorFactory));\n }\n}\nclass ThrowIfEmptySubscriber extends Subscriber {\n constructor(destination, errorFactory) {\n super(destination);\n this.errorFactory = errorFactory;\n this.hasValue = false;\n }\n _next(value) {\n this.hasValue = true;\n this.destination.next(value);\n }\n _complete() {\n if (!this.hasValue) {\n let err;\n try {\n err = this.errorFactory();\n }\n catch (e) {\n err = e;\n }\n this.destination.error(err);\n }\n else {\n return this.destination.complete();\n }\n }\n}\nfunction defaultErrorFactory() {\n return new EmptyError();\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function scheduleArray(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n let i = 0;\n sub.add(scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n return;\n }\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n sub.add(this.schedule());\n }\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function scheduleIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable(subscriber => {\n const sub = new Subscription();\n let iterator;\n sub.add(() => {\n if (iterator && typeof iterator.return === 'function') {\n iterator.return();\n }\n });\n sub.add(scheduler.schedule(() => {\n iterator = input[Symbol_iterator]();\n sub.add(scheduler.schedule(function () {\n if (subscriber.closed) {\n return;\n }\n let value;\n let done;\n try {\n const result = iterator.next();\n value = result.value;\n done = result.done;\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n this.schedule();\n }\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport function scheduleObservable(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => {\n const observable = input[Symbol_observable]();\n sub.add(observable.subscribe({\n next(value) { sub.add(scheduler.schedule(() => subscriber.next(value))); },\n error(err) { sub.add(scheduler.schedule(() => subscriber.error(err))); },\n complete() { sub.add(scheduler.schedule(() => subscriber.complete())); },\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function schedulePromise(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => input.then(value => {\n sub.add(scheduler.schedule(() => {\n subscriber.next(value);\n sub.add(scheduler.schedule(() => subscriber.complete()));\n }));\n }, err => {\n sub.add(scheduler.schedule(() => subscriber.error(err)));\n })));\n return sub;\n });\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n else if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n else if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n else if (isIterable(input) || typeof input === 'string') {\n return scheduleIterable(input, scheduler);\n }\n }\n throw new TypeError((input !== null && typeof input || input) + ' is not observable');\n}\n","export function getSymbolIterator() {\n if (typeof Symbol !== 'function' || !Symbol.iterator) {\n return '@@iterator';\n }\n return Symbol.iterator;\n}\nexport const iterator = getSymbolIterator();\nexport const $$iterator = iterator;\n","export const observable = (() => typeof Symbol === 'function' && Symbol.observable || '@@observable')();\n","export const rxSubscriber = (() => typeof Symbol === 'function'\n ? Symbol('rxSubscriber')\n : '@@rxSubscriber_' + Math.random())();\nexport const $$rxSubscriber = rxSubscriber;\n","const ArgumentOutOfRangeErrorImpl = (() => {\n function ArgumentOutOfRangeErrorImpl() {\n Error.call(this);\n this.message = 'argument out of range';\n this.name = 'ArgumentOutOfRangeError';\n return this;\n }\n ArgumentOutOfRangeErrorImpl.prototype = Object.create(Error.prototype);\n return ArgumentOutOfRangeErrorImpl;\n})();\nexport const ArgumentOutOfRangeError = ArgumentOutOfRangeErrorImpl;\n","const EmptyErrorImpl = (() => {\n function EmptyErrorImpl() {\n Error.call(this);\n this.message = 'no elements in sequence';\n this.name = 'EmptyError';\n return this;\n }\n EmptyErrorImpl.prototype = Object.create(Error.prototype);\n return EmptyErrorImpl;\n})();\nexport const EmptyError = EmptyErrorImpl;\n","const ObjectUnsubscribedErrorImpl = (() => {\n function ObjectUnsubscribedErrorImpl() {\n Error.call(this);\n this.message = 'object unsubscribed';\n this.name = 'ObjectUnsubscribedError';\n return this;\n }\n ObjectUnsubscribedErrorImpl.prototype = Object.create(Error.prototype);\n return ObjectUnsubscribedErrorImpl;\n})();\nexport const ObjectUnsubscribedError = ObjectUnsubscribedErrorImpl;\n","const UnsubscriptionErrorImpl = (() => {\n function UnsubscriptionErrorImpl(errors) {\n Error.call(this);\n this.message = errors ?\n `${errors.length} errors occurred during unsubscription:\n${errors.map((err, i) => `${i + 1}) ${err.toString()}`).join('\\n ')}` : '';\n this.name = 'UnsubscriptionError';\n this.errors = errors;\n return this;\n }\n UnsubscriptionErrorImpl.prototype = Object.create(Error.prototype);\n return UnsubscriptionErrorImpl;\n})();\nexport const UnsubscriptionError = UnsubscriptionErrorImpl;\n","import { Subscriber } from '../Subscriber';\nexport function canReportError(observer) {\n while (observer) {\n const { closed, destination, isStopped } = observer;\n if (closed || isStopped) {\n return false;\n }\n else if (destination && destination instanceof Subscriber) {\n observer = destination;\n }\n else {\n observer = null;\n }\n }\n return true;\n}\n","export function hostReportError(err) {\n setTimeout(() => { throw err; }, 0);\n}\n","export function identity(x) {\n return x;\n}\n","export const isArray = (() => Array.isArray || ((x) => x && typeof x.length === 'number'))();\n","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","export function isFunction(x) {\n return typeof x === 'function';\n}\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport function isInteropObservable(input) {\n return input && typeof input[Symbol_observable] === 'function';\n}\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function isIterable(input) {\n return input && typeof input[Symbol_iterator] === 'function';\n}\n","export function isObject(x) {\n return x !== null && typeof x === 'object';\n}\n","export function isPromise(value) {\n return !!value && typeof value.subscribe !== 'function' && typeof value.then === 'function';\n}\n","export function isScheduler(value) {\n return value && typeof value.schedule === 'function';\n}\n","export function noop() { }\n","import { identity } from './identity';\nexport function pipe(...fns) {\n return pipeFromArray(fns);\n}\nexport function pipeFromArray(fns) {\n if (fns.length === 0) {\n return identity;\n }\n if (fns.length === 1) {\n return fns[0];\n }\n return function piped(input) {\n return fns.reduce((prev, fn) => fn(prev), input);\n };\n}\n","import { subscribeToArray } from './subscribeToArray';\nimport { subscribeToPromise } from './subscribeToPromise';\nimport { subscribeToIterable } from './subscribeToIterable';\nimport { subscribeToObservable } from './subscribeToObservable';\nimport { isArrayLike } from './isArrayLike';\nimport { isPromise } from './isPromise';\nimport { isObject } from './isObject';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeTo = (result) => {\n if (!!result && typeof result[Symbol_observable] === 'function') {\n return subscribeToObservable(result);\n }\n else if (isArrayLike(result)) {\n return subscribeToArray(result);\n }\n else if (isPromise(result)) {\n return subscribeToPromise(result);\n }\n else if (!!result && typeof result[Symbol_iterator] === 'function') {\n return subscribeToIterable(result);\n }\n else {\n const value = isObject(result) ? 'an invalid object' : `'${result}'`;\n const msg = `You provided ${value} where a stream was expected.`\n + ' You can provide an Observable, Promise, Array, or Iterable.';\n throw new TypeError(msg);\n }\n};\n","export const subscribeToArray = (array) => (subscriber) => {\n for (let i = 0, len = array.length; i < len && !subscriber.closed; i++) {\n subscriber.next(array[i]);\n }\n subscriber.complete();\n};\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport const subscribeToIterable = (iterable) => (subscriber) => {\n const iterator = iterable[Symbol_iterator]();\n do {\n let item;\n try {\n item = iterator.next();\n }\n catch (err) {\n subscriber.error(err);\n return subscriber;\n }\n if (item.done) {\n subscriber.complete();\n break;\n }\n subscriber.next(item.value);\n if (subscriber.closed) {\n break;\n }\n } while (true);\n if (typeof iterator.return === 'function') {\n subscriber.add(() => {\n if (iterator.return) {\n iterator.return();\n }\n });\n }\n return subscriber;\n};\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeToObservable = (obj) => (subscriber) => {\n const obs = obj[Symbol_observable]();\n if (typeof obs.subscribe !== 'function') {\n throw new TypeError('Provided object does not correctly implement Symbol.observable');\n }\n else {\n return obs.subscribe(subscriber);\n }\n};\n","import { hostReportError } from './hostReportError';\nexport const subscribeToPromise = (promise) => (subscriber) => {\n promise.then((value) => {\n if (!subscriber.closed) {\n subscriber.next(value);\n subscriber.complete();\n }\n }, (err) => subscriber.error(err))\n .then(null, hostReportError);\n return subscriber;\n};\n","import { InnerSubscriber } from '../InnerSubscriber';\nimport { subscribeTo } from './subscribeTo';\nimport { Observable } from '../Observable';\nexport function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, innerSubscriber = new InnerSubscriber(outerSubscriber, outerValue, outerIndex)) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n return subscribeTo(result)(innerSubscriber);\n}\n","import { Subscriber } from '../Subscriber';\nimport { rxSubscriber as rxSubscriberSymbol } from '../symbol/rxSubscriber';\nimport { empty as emptyObserver } from '../Observer';\nexport function toSubscriber(nextOrObserver, error, complete) {\n if (nextOrObserver) {\n if (nextOrObserver instanceof Subscriber) {\n return nextOrObserver;\n }\n if (nextOrObserver[rxSubscriberSymbol]) {\n return nextOrObserver[rxSubscriberSymbol]();\n }\n }\n if (!nextOrObserver && !error && !complete) {\n return new Subscriber(emptyObserver);\n }\n return new Subscriber(nextOrObserver, error, complete);\n}\n","/******************************************************************************\r\nCopyright (c) Microsoft Corporation.\r\n\r\nPermission to use, copy, modify, and/or distribute this software for any\r\npurpose with or without fee is hereby granted.\r\n\r\nTHE SOFTWARE IS PROVIDED \"AS IS\" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH\r\nREGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY\r\nAND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,\r\nINDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM\r\nLOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR\r\nOTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR\r\nPERFORMANCE OF THIS SOFTWARE.\r\n***************************************************************************** */\r\n/* global Reflect, Promise */\r\n\r\nvar extendStatics = function(d, b) {\r\n extendStatics = Object.setPrototypeOf ||\r\n ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||\r\n function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };\r\n return extendStatics(d, b);\r\n};\r\n\r\nexport function __extends(d, b) {\r\n if (typeof b !== \"function\" && b !== null)\r\n throw new TypeError(\"Class extends value \" + String(b) + \" is not a constructor or null\");\r\n extendStatics(d, b);\r\n function __() { this.constructor = d; }\r\n d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());\r\n}\r\n\r\nexport var __assign = function() {\r\n __assign = Object.assign || function __assign(t) {\r\n for (var s, i = 1, n = arguments.length; i < n; i++) {\r\n s = arguments[i];\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];\r\n }\r\n return t;\r\n }\r\n return __assign.apply(this, arguments);\r\n}\r\n\r\nexport function __rest(s, e) {\r\n var t = {};\r\n for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)\r\n t[p] = s[p];\r\n if (s != null && typeof Object.getOwnPropertySymbols === \"function\")\r\n for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {\r\n if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))\r\n t[p[i]] = s[p[i]];\r\n }\r\n return t;\r\n}\r\n\r\nexport function __decorate(decorators, target, key, desc) {\r\n var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;\r\n if (typeof Reflect === \"object\" && typeof Reflect.decorate === \"function\") r = Reflect.decorate(decorators, target, key, desc);\r\n else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;\r\n return c > 3 && r && Object.defineProperty(target, key, r), r;\r\n}\r\n\r\nexport function __param(paramIndex, decorator) {\r\n return function (target, key) { decorator(target, key, paramIndex); }\r\n}\r\n\r\nexport function __metadata(metadataKey, metadataValue) {\r\n if (typeof Reflect === \"object\" && typeof Reflect.metadata === \"function\") return Reflect.metadata(metadataKey, metadataValue);\r\n}\r\n\r\nexport function __awaiter(thisArg, _arguments, P, generator) {\r\n function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }\r\n return new (P || (P = Promise))(function (resolve, reject) {\r\n function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }\r\n function rejected(value) { try { step(generator[\"throw\"](value)); } catch (e) { reject(e); } }\r\n function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }\r\n step((generator = generator.apply(thisArg, _arguments || [])).next());\r\n });\r\n}\r\n\r\nexport function __generator(thisArg, body) {\r\n var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;\r\n return g = { next: verb(0), \"throw\": verb(1), \"return\": verb(2) }, typeof Symbol === \"function\" && (g[Symbol.iterator] = function() { return this; }), g;\r\n function verb(n) { return function (v) { return step([n, v]); }; }\r\n function step(op) {\r\n if (f) throw new TypeError(\"Generator is already executing.\");\r\n while (_) try {\r\n if (f = 1, y && (t = op[0] & 2 ? y[\"return\"] : op[0] ? y[\"throw\"] || ((t = y[\"return\"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;\r\n if (y = 0, t) op = [op[0] & 2, t.value];\r\n switch (op[0]) {\r\n case 0: case 1: t = op; break;\r\n case 4: _.label++; return { value: op[1], done: false };\r\n case 5: _.label++; y = op[1]; op = [0]; continue;\r\n case 7: op = _.ops.pop(); _.trys.pop(); continue;\r\n default:\r\n if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }\r\n if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }\r\n if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }\r\n if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }\r\n if (t[2]) _.ops.pop();\r\n _.trys.pop(); continue;\r\n }\r\n op = body.call(thisArg, _);\r\n } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }\r\n if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };\r\n }\r\n}\r\n\r\nexport var __createBinding = Object.create ? (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n var desc = Object.getOwnPropertyDescriptor(m, k);\r\n if (!desc || (\"get\" in desc ? !m.__esModule : desc.writable || desc.configurable)) {\r\n desc = { enumerable: true, get: function() { return m[k]; } };\r\n }\r\n Object.defineProperty(o, k2, desc);\r\n}) : (function(o, m, k, k2) {\r\n if (k2 === undefined) k2 = k;\r\n o[k2] = m[k];\r\n});\r\n\r\nexport function __exportStar(m, o) {\r\n for (var p in m) if (p !== \"default\" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);\r\n}\r\n\r\nexport function __values(o) {\r\n var s = typeof Symbol === \"function\" && Symbol.iterator, m = s && o[s], i = 0;\r\n if (m) return m.call(o);\r\n if (o && typeof o.length === \"number\") return {\r\n next: function () {\r\n if (o && i >= o.length) o = void 0;\r\n return { value: o && o[i++], done: !o };\r\n }\r\n };\r\n throw new TypeError(s ? \"Object is not iterable.\" : \"Symbol.iterator is not defined.\");\r\n}\r\n\r\nexport function __read(o, n) {\r\n var m = typeof Symbol === \"function\" && o[Symbol.iterator];\r\n if (!m) return o;\r\n var i = m.call(o), r, ar = [], e;\r\n try {\r\n while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);\r\n }\r\n catch (error) { e = { error: error }; }\r\n finally {\r\n try {\r\n if (r && !r.done && (m = i[\"return\"])) m.call(i);\r\n }\r\n finally { if (e) throw e.error; }\r\n }\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spread() {\r\n for (var ar = [], i = 0; i < arguments.length; i++)\r\n ar = ar.concat(__read(arguments[i]));\r\n return ar;\r\n}\r\n\r\n/** @deprecated */\r\nexport function __spreadArrays() {\r\n for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;\r\n for (var r = Array(s), k = 0, i = 0; i < il; i++)\r\n for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)\r\n r[k] = a[j];\r\n return r;\r\n}\r\n\r\nexport function __spreadArray(to, from, pack) {\r\n if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {\r\n if (ar || !(i in from)) {\r\n if (!ar) ar = Array.prototype.slice.call(from, 0, i);\r\n ar[i] = from[i];\r\n }\r\n }\r\n return to.concat(ar || Array.prototype.slice.call(from));\r\n}\r\n\r\nexport function __await(v) {\r\n return this instanceof __await ? (this.v = v, this) : new __await(v);\r\n}\r\n\r\nexport function __asyncGenerator(thisArg, _arguments, generator) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var g = generator.apply(thisArg, _arguments || []), i, q = [];\r\n return i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i;\r\n function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }\r\n function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }\r\n function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }\r\n function fulfill(value) { resume(\"next\", value); }\r\n function reject(value) { resume(\"throw\", value); }\r\n function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }\r\n}\r\n\r\nexport function __asyncDelegator(o) {\r\n var i, p;\r\n return i = {}, verb(\"next\"), verb(\"throw\", function (e) { throw e; }), verb(\"return\"), i[Symbol.iterator] = function () { return this; }, i;\r\n function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === \"return\" } : f ? f(v) : v; } : f; }\r\n}\r\n\r\nexport function __asyncValues(o) {\r\n if (!Symbol.asyncIterator) throw new TypeError(\"Symbol.asyncIterator is not defined.\");\r\n var m = o[Symbol.asyncIterator], i;\r\n return m ? m.call(o) : (o = typeof __values === \"function\" ? __values(o) : o[Symbol.iterator](), i = {}, verb(\"next\"), verb(\"throw\"), verb(\"return\"), i[Symbol.asyncIterator] = function () { return this; }, i);\r\n function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }\r\n function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }\r\n}\r\n\r\nexport function __makeTemplateObject(cooked, raw) {\r\n if (Object.defineProperty) { Object.defineProperty(cooked, \"raw\", { value: raw }); } else { cooked.raw = raw; }\r\n return cooked;\r\n};\r\n\r\nvar __setModuleDefault = Object.create ? (function(o, v) {\r\n Object.defineProperty(o, \"default\", { enumerable: true, value: v });\r\n}) : function(o, v) {\r\n o[\"default\"] = v;\r\n};\r\n\r\nexport function __importStar(mod) {\r\n if (mod && mod.__esModule) return mod;\r\n var result = {};\r\n if (mod != null) for (var k in mod) if (k !== \"default\" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);\r\n __setModuleDefault(result, mod);\r\n return result;\r\n}\r\n\r\nexport function __importDefault(mod) {\r\n return (mod && mod.__esModule) ? mod : { default: mod };\r\n}\r\n\r\nexport function __classPrivateFieldGet(receiver, state, kind, f) {\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a getter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot read private member from an object whose class did not declare it\");\r\n return kind === \"m\" ? f : kind === \"a\" ? f.call(receiver) : f ? f.value : state.get(receiver);\r\n}\r\n\r\nexport function __classPrivateFieldSet(receiver, state, value, kind, f) {\r\n if (kind === \"m\") throw new TypeError(\"Private method is not writable\");\r\n if (kind === \"a\" && !f) throw new TypeError(\"Private accessor was defined without a setter\");\r\n if (typeof state === \"function\" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError(\"Cannot write private member to an object whose class did not declare it\");\r\n return (kind === \"a\" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;\r\n}\r\n\r\nexport function __classPrivateFieldIn(state, receiver) {\r\n if (receiver === null || (typeof receiver !== \"object\" && typeof receiver !== \"function\")) throw new TypeError(\"Cannot use 'in' operator on non-object\");\r\n return typeof state === \"function\" ? receiver === state : state.has(receiver);\r\n}\r\n","/**\n * @license Angular v14.2.5\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Injectable, ɵɵinject, Inject, inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵisListLikeIterable, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, ɵformatRuntimeError, Renderer2, ElementRef, Injector, NgZone } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setDOM(adapter) {\n _DOM = adapter;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A DI Token representing the main rendering context. In a browser this is the DOM Document.\n *\n * Note: Document might not be available in the Application Context when Application and Rendering\n * Contexts are not the same (e.g. when running the application in a Web Worker).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: useBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }] });\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._init();\n }\n // This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it\n /** @internal */\n _init() {\n this.location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this.location.href;\n }\n get protocol() {\n return this.location.protocol;\n }\n get hostname() {\n return this.location.hostname;\n }\n get port() {\n return this.location.port;\n }\n get pathname() {\n return this.location.pathname;\n }\n get search() {\n return this.location.search;\n }\n get hash() {\n return this.location.hash;\n }\n set pathname(newPath) {\n this.location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this.location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: BrowserPlatformLocation, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBrowserPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: createBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }];\n } });\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n *
http://example.com#/foo,\n * and `PathLocationStrategy` produces\n *
http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a `
` element to the document to override the default.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `
` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `
` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `
` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n var _a, _b, _c;\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n this._baseHref = (_c = (_a = href !== null && href !== void 0 ? href : this._platformLocation.getBaseHrefFromDOM()) !== null && _a !== void 0 ? _a : (_b = inject(DOCUMENT).location) === null || _b === void 0 ? void 0 : _b.origin) !== null && _c !== void 0 ? _c : '';\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n}\nPathLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nPathLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PathLocationStrategy, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () {\n return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n}\nHashLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nHashLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: HashLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () {\n return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n *
\n *\n * @publicApi\n */\nclass Location {\n constructor(locationStrategy) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n /** @internal */\n this._urlChangeSubscription = null;\n this._locationStrategy = locationStrategy;\n const browserBaseHref = this._locationStrategy.getBaseHref();\n this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref));\n this._locationStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n var _a;\n (_a = this._urlChangeSubscription) === null || _a === void 0 ? void 0 : _a.unsubscribe();\n this._urlChangeListeners = [];\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._locationStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._locationStrategy.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._locationStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._locationStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._locationStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._locationStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._locationStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n var _a, _b;\n (_b = (_a = this._locationStrategy).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n * @returns A function that, when executed, unregisters a URL change listener.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n return () => {\n var _a;\n const fnIndex = this._urlChangeListeners.indexOf(fn);\n this._urlChangeListeners.splice(fnIndex, 1);\n if (this._urlChangeListeners.length === 0) {\n (_a = this._urlChangeSubscription) === null || _a === void 0 ? void 0 : _a.unsubscribe();\n this._urlChangeSubscription = null;\n }\n };\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }], target: i0.ɵɵFactoryTarget.Injectable });\nLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: function () { return [{ type: LocationStrategy }]; } });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy));\n}\nfunction _stripBaseHref(baseHref, url) {\n return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, undefined, 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLE\": [undefined, undefined, 2], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()`\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n *
Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' :\n value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\nNgLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocaleLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgLocaleLocalization });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n-common-format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n *
...\n *\n *
...\n *\n *
...\n *\n *
...\n *\n *
...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._initialClasses = [];\n this._rawClass = null;\n }\n set klass(value) {\n this._removeClasses(this._initialClasses);\n this._initialClasses = typeof value === 'string' ? value.split(/\\s+/) : [];\n this._applyClasses(this._initialClasses);\n this._applyClasses(this._rawClass);\n }\n set ngClass(value) {\n this._removeClasses(this._rawClass);\n this._applyClasses(this._initialClasses);\n this._iterableDiffer = null;\n this._keyValueDiffer = null;\n this._rawClass = typeof value === 'string' ? value.split(/\\s+/) : value;\n if (this._rawClass) {\n if (ɵisListLikeIterable(this._rawClass)) {\n this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create();\n }\n else {\n this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create();\n }\n }\n }\n ngDoCheck() {\n if (this._iterableDiffer) {\n const iterableChanges = this._iterableDiffer.diff(this._rawClass);\n if (iterableChanges) {\n this._applyIterableChanges(iterableChanges);\n }\n }\n else if (this._keyValueDiffer) {\n const keyValueChanges = this._keyValueDiffer.diff(this._rawClass);\n if (keyValueChanges) {\n this._applyKeyValueChanges(keyValueChanges);\n }\n }\n }\n _applyKeyValueChanges(changes) {\n changes.forEachAddedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._toggleClass(record.key, record.currentValue));\n changes.forEachRemovedItem((record) => {\n if (record.previousValue) {\n this._toggleClass(record.key, false);\n }\n });\n }\n _applyIterableChanges(changes) {\n changes.forEachAddedItem((record) => {\n if (typeof record.item === 'string') {\n this._toggleClass(record.item, true);\n }\n else {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(record.item)}`);\n }\n });\n changes.forEachRemovedItem((record) => this._toggleClass(record.item, false));\n }\n /**\n * Applies a collection of CSS classes to the DOM element.\n *\n * For argument of type Set and Array CSS class names contained in those collections are always\n * added.\n * For argument of type Map CSS class name in the map's key is toggled based on the value (added\n * for truthy and removed for falsy).\n */\n _applyClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, true));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, !!rawClassVal[klass]));\n }\n }\n }\n /**\n * Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup\n * purposes.\n */\n _removeClasses(rawClassVal) {\n if (rawClassVal) {\n if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {\n rawClassVal.forEach((klass) => this._toggleClass(klass, false));\n }\n else {\n Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, false));\n }\n }\n }\n _toggleClass(klass, enabled) {\n klass = klass.trim();\n if (klass) {\n klass.split(/\\s+/g).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgClass, deps: [{ token: i0.IterableDiffers }, { token: i0.KeyValueDiffers }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgClass.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.IterableDiffers }, { type: i0.KeyValueDiffers }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```\n *
\n * ```\n *\n * Customized injector/content\n * ```\n *
\n * \n * ```\n *\n * Customized NgModule reference\n * ```\n *
\n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this.ngComponentOutlet = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n const { _viewContainerRef: viewContainerRef, ngComponentOutletNgModule: ngModule, ngComponentOutletNgModuleFactory: ngModuleFactory, } = this;\n viewContainerRef.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModule'] || changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (ngModule) {\n this._moduleRef = createNgModule(ngModule, getParentInjector(injector));\n }\n else if (ngModuleFactory) {\n this._moduleRef = ngModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = viewContainerRef.createComponent(this.ngComponentOutlet, {\n index: viewContainerRef.length,\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgComponentOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NG_DEV_MODE = typeof ngDevMode === 'undefined' || !!ngDevMode;\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `
` element.\n *\n * ```\n * ...\n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `
` element.\n * The content of the `` element is the `` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n * ...\n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n * \n * {{i}}/{{users.length}}. {{user}} default\n * \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see `TrackByFunction`\n */\n set ngForTrackBy(fn) {\n if (NG_DEV_MODE && fn != null && typeof fn !== 'function') {\n // TODO(vicb): use a log service once there is a public one available\n if (console && console.warn) {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (NG_DEV_MODE) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch (_a) {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\nNgForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }]; }, propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n * Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n * Content to render when condition is\n * true.
\n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n * Content to render when condition is true.
\n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n * \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n * {{value}}
\n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n * \n * ...\n *
\n *\n * \n * Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n * \n * ...\n *
\n * \n *\n * \n * Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgIf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }]; }, propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n if (!this._defaultViews) {\n this._defaultViews = [];\n }\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (let i = 0; i < this._defaultViews.length; i++) {\n const defaultView = this._defaultViews[i];\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitch.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n standalone: true,\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }];\n }, propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchDefault.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }];\n } });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._switchValue = value;\n this._updateView();\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView() {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(this._switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\nNgPlural.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; }, propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgPluralCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }];\n } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgStyle.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }]; }, propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n /** Injector to be used within the embedded view. */\n this.ngTemplateOutletInjector = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet'] || changes['ngTemplateOutletInjector']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n if (this.ngTemplateOutlet) {\n const { ngTemplateOutlet: template, ngTemplateOutletContext: context, ngTemplateOutletInjector: injector } = this;\n this._viewRef = viewContainerRef.createEmbeddedView(template, context, injector ? { injector } : undefined);\n }\n else {\n this._viewRef = null;\n }\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n}\nNgTemplateOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgTemplateOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgTemplateOutlet, isStandalone: true, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\", ngTemplateOutletInjector: \"ngTemplateOutletInjector\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngTemplateOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }], ngTemplateOutletInjector: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction invalidPipeArgumentError(type, value) {\n return new ɵRuntimeError(2100 /* RuntimeErrorCode.INVALID_PIPE_ARGUMENT */, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(ref) {\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n // Assign `ref` into `this._ref` manually instead of declaring `_ref` in the constructor\n // parameter list, as the type of `this._ref` includes `null` unlike the type of `ref`.\n this._ref = ref;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n // Clear the `ChangeDetectorRef` and its association with the view data, to mitigate\n // potential memory leaks in Observables that could otherwise cause the view data to\n // be retained.\n // https://github.com/angular/angular/issues/17624\n this._ref = null;\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n // Note: `dispose` is only called if a subscription has been initialized before, indicating\n // that `this._strategy` is also available.\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n // Note: `this._ref` is only cleared in `ngOnDestroy` so is known to be available when a\n // value is being updated.\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe });\nAsyncPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: AsyncPipe, isStandalone: true, name: \"async\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'async',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nLowerCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: LowerCasePipe, isStandalone: true, name: \"lowercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'lowercase',\n standalone: true,\n }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.slice(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nTitleCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: TitleCasePipe, isStandalone: true, name: \"titlecase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'titlecase',\n standalone: true,\n }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nUpperCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: UpperCasePipe, isStandalone: true, name: \"uppercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'uppercase',\n standalone: true,\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken('DATE_PIPE_DEFAULT_TIMEZONE');\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n-common-format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_TIMEZONE`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `\n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
\n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n-common-locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nDecimalPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: DecimalPipe, isStandalone: true, name: \"number\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'number',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nPercentPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }];\n } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n * {@a currency-code-deprecation}\n * \n *\n * **Deprecation notice:**\n *\n * The default currency code is currently always `USD` but this is deprecated from v9.\n *\n * **In v11 the default currency code will be taken from the current locale identified by\n * the `LOCALE_ID` token. See the [i18n guide](guide/i18n-common-locale-id) for\n * more information.**\n *\n * If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in\n * your application `NgModule`:\n *\n * ```ts\n * {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'}\n * ```\n *\n *
\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\nCurrencyPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n standalone: true,\n }]\n }], ctorParameters: function () {\n return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }];\n } });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n * b\n * c\n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nSlicePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"14.2.5\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\nCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: CommonModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('14.2.5');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch (_a) {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch (_a) {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n (document.body.createShadowRoot || document.body.attachShadow)) {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* RuntimeErrorCode.UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(ngSrc, includeNgSrc = true) {\n const ngSrcInfo = includeNgSrc ? `(activated on an ![]()
element with the \\`ngSrc=\"${ngSrc}\"\\`) ` : '';\n return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? (new URL(url)).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch (_a) {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Multi-provider injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, multi: true, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, multi: true,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n * @developerPreview\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken('PRECONNECT_CHECK_BLOCKLIST');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding `` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n constructor() {\n this.document = inject(DOCUMENT);\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n this.preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n this.alreadySeen = new Set();\n this.window = null;\n this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n assertDevMode('preconnect link checker');\n const win = this.document.defaultView;\n if (typeof win !== 'undefined') {\n this.window = win;\n }\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, { optional: true });\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, origin => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n throw new ɵRuntimeError(2957 /* RuntimeErrorCode.INVALID_PRECONNECT_CHECK_BLOCKLIST */, `The blocklist for the preconnect check was not provided as an array. ` +\n `Check that the \\`PRECONNECT_CHECK_BLOCKLIST\\` token is configured as a \\`multi: true\\` provider.`);\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head fo rthe\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param originalNgSrc ngSrc value\n */\n assertPreconnect(rewrittenSrc, originalNgSrc) {\n if (!this.window)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n if (!this.preconnectLinks) {\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks = this.queryPreconnectLinks();\n }\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* RuntimeErrorCode.PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this ` +\n `image. Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(this.document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n var _a;\n (_a = this.preconnectLinks) === null || _a === void 0 ? void 0 : _a.clear();\n this.alreadySeen.clear();\n }\n}\nPreconnectLinkChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreconnectLinkChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n * @publicApi\n * @developerPreview\n */\nconst IMAGE_LOADER = new InjectionToken('ImageLoader', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path, options = { ensurePreconnect: true }) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, Object.assign(Object.assign({}, config), { src: normalizeSrc(config.src) }));\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n if (ngDevMode && options.ensurePreconnect === false) {\n providers.push({ provide: PRECONNECT_CHECK_BLOCKLIST, useValue: [path], multi: true });\n }\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`![]()
\\` tag with an invalid \\`ngSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`ngSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`ngSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @param options An object with extra configuration:\n * - `ensurePreconnect`: boolean flag indicating whether the NgOptimizedImage directive\n * should verify that there is a corresponding ``\n * present in the document's ``.\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n * @developerPreview\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @param options An object with extra configuration:\n * - `ensurePreconnect`: boolean flag indicating whether the NgOptimizedImage directive\n * should verify that there is a corresponding ``\n * present in the document's ``.\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n * @developerPreview\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ?\n [\n 'https://res.cloudinary.com/mysite', 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com'\n ] :\n undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n let params = `f_auto,q_auto`; // sets image format and quality to \"auto\"\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @param options An object with extra configuration:\n * - `ensurePreconnect`: boolean flag indicating whether the NgOptimizedImage directive\n * should verify that there is a corresponding ``\n * present in the document's ``.\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n * @developerPreview\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n let params = `tr:q-auto`; // applies the \"auto quality\" transformation\n if (config.width) {\n params += `,w-${config.width}`;\n }\n return `${path}/${params}/${config.src}`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @param options An object with extra configuration:\n * - `ensurePreconnect`: boolean flag indicating whether the NgOptimizedImage directive\n * should verify that there is a corresponding ``\n * present in the document's ``.\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n * @developerPreview\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n return url.href;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n constructor() {\n // Map of full image URLs -> original `ngSrc` values.\n this.images = new Map();\n // Keep track of images for which `console.warn` was produced.\n this.alreadyWarned = new Set();\n this.window = null;\n this.observer = null;\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (typeof win !== 'undefined' && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n var _a, _b;\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = (_b = (_a = lcpElement.element) === null || _a === void 0 ? void 0 : _a.src) !== null && _b !== void 0 ? _b : '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const imgNgSrc = this.images.get(imgSrc);\n if (imgNgSrc && !this.alreadyWarned.has(imgSrc)) {\n this.alreadyWarned.add(imgSrc);\n logMissingPriorityWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, originalNgSrc) {\n if (!this.observer)\n return;\n this.images.set(getUrl(rewrittenSrc, this.window).href, originalNgSrc);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n this.alreadyWarned.clear();\n }\n}\nLCPImageObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLCPImageObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\nfunction logMissingPriorityWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2955 /* RuntimeErrorCode.LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = .1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the `![]()
` tag\n * - Lazy loading non-priority images by default\n * - Asserting that there is a corresponding preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n * The `NgOptimizedImage` directive is marked as [standalone](guide/standalone-components) and can\n * be imported directly.\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule or a standalone Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary `![]()
` tags in templates and replace `src` attributes with `ngSrc`.\n * Using a `ngSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```typescript\n * import { NgOptimizedImage } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImage],\n * })\n * class AppModule {}\n *\n * // ... or a standalone Component\n * @Component({\n * standalone: true\n * imports: [NgOptimizedImage],\n * })\n * class MyStandaloneComponent {}\n * ```\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `ngSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```typescript\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```typescript\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg}`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update `![]()
` tags in templates to use `ngSrc` instead of `src`.\n *\n * ```\n * ![]()
\n * ```\n *\n * @publicApi\n * @developerPreview\n */\nclass NgOptimizedImage {\n constructor() {\n this.imageLoader = inject(IMAGE_LOADER);\n this.renderer = inject(Renderer2);\n this.imgElement = inject(ElementRef).nativeElement;\n this.injector = inject(Injector);\n // a LCP image observer - should be injected only in the dev mode\n this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n this._renderedSrc = null;\n this._priority = false;\n }\n /**\n * Previously, the `rawSrc` attribute was used to activate the directive.\n * The attribute was renamed to `ngSrc` and this input just produces an error,\n * suggesting to switch to `ngSrc` instead.\n *\n * This error should be removed in v15.\n *\n * @nodoc\n * @deprecated Use `ngSrc` instead.\n */\n set rawSrc(value) {\n if (ngDevMode) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(value, false)} the \\`rawSrc\\` attribute was used ` +\n `to activate the directive. Newer version of the directive uses the \\`ngSrc\\` ` +\n `attribute instead. Please replace \\`rawSrc\\` with \\`ngSrc\\` and ` +\n `\\`rawSrcset\\` with \\`ngSrcset\\` attributes in the template to ` +\n `enable image optimizations.`);\n }\n }\n /**\n * The intrinsic width of the image in pixels.\n */\n set width(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'width');\n this._width = inputToInteger(value);\n }\n get width() {\n return this._width;\n }\n /**\n * The intrinsic height of the image in pixels.\n */\n set height(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'height');\n this._height = inputToInteger(value);\n }\n get height() {\n return this._height;\n }\n /**\n * Indicates whether this image should have a high priority.\n */\n set priority(value) {\n this._priority = inputToBoolean(value);\n }\n get priority() {\n return this._priority;\n }\n ngOnInit() {\n if (ngDevMode) {\n assertNonEmptyInput(this, 'ngSrc', this.ngSrc);\n assertValidNgSrcset(this, this.ngSrcset);\n assertNoConflictingSrc(this);\n assertNoConflictingSrcset(this);\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n assertNonEmptyWidthAndHeight(this);\n assertValidLoadingInput(this);\n assertNoImageDistortion(this, this.imgElement, this.renderer);\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);\n }\n else {\n // Monitor whether an image is an LCP element only in case\n // the `priority` attribute is missing. Otherwise, an image\n // has the necessary settings and no extra checks are required.\n if (this.lcpObserver !== null) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc);\n });\n }\n }\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n this.setHostAttribute('src', this.getRewrittenSrc());\n if (this.ngSrcset) {\n this.setHostAttribute('srcset', this.getRewrittenSrcset());\n }\n }\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, ['ngSrc', 'ngSrcset', 'width', 'height', 'priority']);\n }\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.ngSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.imageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);\n const finalSrcs = this.ngSrcset.split(',').filter(src => src !== '').map(srcStr => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.imageLoader({ src: this.ngSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n ngOnDestroy() {\n if (ngDevMode) {\n if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n }\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n}\nNgOptimizedImage.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgOptimizedImage, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgOptimizedImage.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"14.2.5\", type: NgOptimizedImage, isStandalone: true, selector: \"img[ngSrc],img[rawSrc]\", inputs: { rawSrc: \"rawSrc\", ngSrc: \"ngSrc\", ngSrcset: \"ngSrcset\", width: \"width\", height: \"height\", loading: \"loading\", priority: \"priority\", src: \"src\", srcset: \"srcset\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"14.2.5\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{\n standalone: true,\n selector: 'img[ngSrc],img[rawSrc]',\n }]\n }], propDecorators: { rawSrc: [{\n type: Input\n }], ngSrc: [{\n type: Input\n }], ngSrcset: [{\n type: Input\n }], width: [{\n type: Input\n }], height: [{\n type: Input\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Convert input value to integer.\n */\nfunction inputToInteger(value) {\n return typeof value === 'string' ? parseInt(value, 10) : value;\n}\n/**\n * Convert input value to boolean.\n */\nfunction inputToBoolean(value) {\n return value != null && `${value}` !== 'false';\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* RuntimeErrorCode.UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`src\\` and \\`ngSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`ngSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* RuntimeErrorCode.UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`srcset\\` and \\`ngSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`ngSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('data:')) {\n if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`ngSrc\\` is a Base64-encoded string ` +\n `(${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrc\\` was set to a blob URL (${ngSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `ngSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidNgSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'ngSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`ngSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value.split(',').every(num => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n return new ɵRuntimeError(2953 /* RuntimeErrorCode.UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ` +\n `To fix this, switch \\`${inputName}\\` a static value or wrap the image element ` +\n `in an *ngIf that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach(input => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'ngSrc') {\n // When the `ngSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `ngSrc` is already set. We use\n // `ngSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { ngSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` has an invalid value ` +\n `(\\`${inputValue}\\`). To fix this, provide \\`${inputName}\\` ` +\n `as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n // TODO: `clientWidth`, `clientHeight`, `naturalWidth` and `naturalHeight`\n // are typed as number, but we run `parseFloat` (which accepts strings only).\n // Verify whether `parseFloat` is needed in the cases below.\n const renderedWidth = parseFloat(img.clientWidth);\n const renderedHeight = parseFloat(img.clientHeight);\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = parseFloat(img.naturalWidth);\n const intrinsicHeight = parseFloat(img.naturalHeight);\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nSupplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${suppliedAspectRatio}). ` +\n `\\nTo fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nRendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${renderedAspectRatio}). \\nThis issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.ngSrcset && nonZeroRenderedDimensions) {\n // If `ngSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = (intrinsicWidth - recommendedWidth) >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = (intrinsicHeight - recommendedHeight) >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* RuntimeErrorCode.OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"ngSrcset\" and \"sizes\" attributes.`));\n }\n }\n });\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* RuntimeErrorCode.REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.ngSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map(attr => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag.`);\n }\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf as NgFor, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, registerLocaleData, BrowserPlatformLocation as ɵBrowserPlatformLocation, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v14.2.5\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nvar TagContentType;\n(function (TagContentType) {\n TagContentType[TagContentType[\"RAW_TEXT\"] = 0] = \"RAW_TEXT\";\n TagContentType[TagContentType[\"ESCAPABLE_RAW_TEXT\"] = 1] = \"ESCAPABLE_RAW_TEXT\";\n TagContentType[TagContentType[\"PARSABLE_DATA\"] = 2] = \"PARSABLE_DATA\";\n})(TagContentType || (TagContentType = {}));\nfunction splitNsName(elementName) {\n if (elementName[0] != ':') {\n return [null, elementName];\n }\n const colonIndex = elementName.indexOf(':', 1);\n if (colonIndex === -1) {\n throw new Error(`Unsupported format \"${elementName}\" expecting \":namespace:name\"`);\n }\n return [elementName.slice(1, colonIndex), elementName.slice(colonIndex + 1)];\n}\n// `` tags work the same regardless the namespace\nfunction isNgContainer(tagName) {\n return splitNsName(tagName)[1] === 'ng-container';\n}\n// `` tags work the same regardless the namespace\nfunction isNgContent(tagName) {\n return splitNsName(tagName)[1] === 'ng-content';\n}\n// `` tags work the same regardless the namespace\nfunction isNgTemplate(tagName) {\n return splitNsName(tagName)[1] === 'ng-template';\n}\nfunction getNsPrefix(fullName) {\n return fullName === null ? null : splitNsName(fullName)[0];\n}\nfunction mergeNsAndName(prefix, localName) {\n return prefix ? `:${prefix}:${localName}` : localName;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass HtmlTagDefinition {\n constructor({ closedByChildren, implicitNamespacePrefix, contentType = TagContentType.PARSABLE_DATA, closedByParent = false, isVoid = false, ignoreFirstLf = false, preventNamespaceInheritance = false } = {}) {\n this.closedByChildren = {};\n this.closedByParent = false;\n this.canSelfClose = false;\n if (closedByChildren && closedByChildren.length > 0) {\n closedByChildren.forEach(tagName => this.closedByChildren[tagName] = true);\n }\n this.isVoid = isVoid;\n this.closedByParent = closedByParent || isVoid;\n this.implicitNamespacePrefix = implicitNamespacePrefix || null;\n this.contentType = contentType;\n this.ignoreFirstLf = ignoreFirstLf;\n this.preventNamespaceInheritance = preventNamespaceInheritance;\n }\n isClosedByChild(name) {\n return this.isVoid || name.toLowerCase() in this.closedByChildren;\n }\n getContentType(prefix) {\n if (typeof this.contentType === 'object') {\n const overrideType = prefix === undefined ? undefined : this.contentType[prefix];\n return overrideType !== null && overrideType !== void 0 ? overrideType : this.contentType.default;\n }\n return this.contentType;\n }\n}\nlet _DEFAULT_TAG_DEFINITION;\n// see https://www.w3.org/TR/html51/syntax.html#optional-tags\n// This implementation does not fully conform to the HTML5 spec.\nlet TAG_DEFINITIONS;\nfunction getHtmlTagDefinition(tagName) {\n var _a, _b;\n if (!TAG_DEFINITIONS) {\n _DEFAULT_TAG_DEFINITION = new HtmlTagDefinition();\n TAG_DEFINITIONS = {\n 'base': new HtmlTagDefinition({ isVoid: true }),\n 'meta': new HtmlTagDefinition({ isVoid: true }),\n 'area': new HtmlTagDefinition({ isVoid: true }),\n 'embed': new HtmlTagDefinition({ isVoid: true }),\n 'link': new HtmlTagDefinition({ isVoid: true }),\n 'img': new HtmlTagDefinition({ isVoid: true }),\n 'input': new HtmlTagDefinition({ isVoid: true }),\n 'param': new HtmlTagDefinition({ isVoid: true }),\n 'hr': new HtmlTagDefinition({ isVoid: true }),\n 'br': new HtmlTagDefinition({ isVoid: true }),\n 'source': new HtmlTagDefinition({ isVoid: true }),\n 'track': new HtmlTagDefinition({ isVoid: true }),\n 'wbr': new HtmlTagDefinition({ isVoid: true }),\n 'p': new HtmlTagDefinition({\n closedByChildren: [\n 'address', 'article', 'aside', 'blockquote', 'div', 'dl', 'fieldset',\n 'footer', 'form', 'h1', 'h2', 'h3', 'h4', 'h5',\n 'h6', 'header', 'hgroup', 'hr', 'main', 'nav', 'ol',\n 'p', 'pre', 'section', 'table', 'ul'\n ],\n closedByParent: true\n }),\n 'thead': new HtmlTagDefinition({ closedByChildren: ['tbody', 'tfoot'] }),\n 'tbody': new HtmlTagDefinition({ closedByChildren: ['tbody', 'tfoot'], closedByParent: true }),\n 'tfoot': new HtmlTagDefinition({ closedByChildren: ['tbody'], closedByParent: true }),\n 'tr': new HtmlTagDefinition({ closedByChildren: ['tr'], closedByParent: true }),\n 'td': new HtmlTagDefinition({ closedByChildren: ['td', 'th'], closedByParent: true }),\n 'th': new HtmlTagDefinition({ closedByChildren: ['td', 'th'], closedByParent: true }),\n 'col': new HtmlTagDefinition({ isVoid: true }),\n 'svg': new HtmlTagDefinition({ implicitNamespacePrefix: 'svg' }),\n 'foreignObject': new HtmlTagDefinition({\n // Usually the implicit namespace here would be redundant since it will be inherited from\n // the parent `svg`, but we have to do it for `foreignObject`, because the way the parser\n // works is that the parent node of an end tag is its own start tag which means that\n // the `preventNamespaceInheritance` on `foreignObject` would have it default to the\n // implicit namespace which is `html`, unless specified otherwise.\n implicitNamespacePrefix: 'svg',\n // We want to prevent children of foreignObject from inheriting its namespace, because\n // the point of the element is to allow nodes from other namespaces to be inserted.\n preventNamespaceInheritance: true,\n }),\n 'math': new HtmlTagDefinition({ implicitNamespacePrefix: 'math' }),\n 'li': new HtmlTagDefinition({ closedByChildren: ['li'], closedByParent: true }),\n 'dt': new HtmlTagDefinition({ closedByChildren: ['dt', 'dd'] }),\n 'dd': new HtmlTagDefinition({ closedByChildren: ['dt', 'dd'], closedByParent: true }),\n 'rb': new HtmlTagDefinition({ closedByChildren: ['rb', 'rt', 'rtc', 'rp'], closedByParent: true }),\n 'rt': new HtmlTagDefinition({ closedByChildren: ['rb', 'rt', 'rtc', 'rp'], closedByParent: true }),\n 'rtc': new HtmlTagDefinition({ closedByChildren: ['rb', 'rtc', 'rp'], closedByParent: true }),\n 'rp': new HtmlTagDefinition({ closedByChildren: ['rb', 'rt', 'rtc', 'rp'], closedByParent: true }),\n 'optgroup': new HtmlTagDefinition({ closedByChildren: ['optgroup'], closedByParent: true }),\n 'option': new HtmlTagDefinition({ closedByChildren: ['option', 'optgroup'], closedByParent: true }),\n 'pre': new HtmlTagDefinition({ ignoreFirstLf: true }),\n 'listing': new HtmlTagDefinition({ ignoreFirstLf: true }),\n 'style': new HtmlTagDefinition({ contentType: TagContentType.RAW_TEXT }),\n 'script': new HtmlTagDefinition({ contentType: TagContentType.RAW_TEXT }),\n 'title': new HtmlTagDefinition({\n // The browser supports two separate `title` tags which have to use\n // a different content type: `HTMLTitleElement` and `SVGTitleElement`\n contentType: { default: TagContentType.ESCAPABLE_RAW_TEXT, svg: TagContentType.PARSABLE_DATA }\n }),\n 'textarea': new HtmlTagDefinition({ contentType: TagContentType.ESCAPABLE_RAW_TEXT, ignoreFirstLf: true }),\n };\n }\n // We have to make both a case-sensitive and a case-insensitive lookup, because\n // HTML tag names are case insensitive, whereas some SVG tags are case sensitive.\n return (_b = (_a = TAG_DEFINITIONS[tagName]) !== null && _a !== void 0 ? _a : TAG_DEFINITIONS[tagName.toLowerCase()]) !== null && _b !== void 0 ? _b : _DEFAULT_TAG_DEFINITION;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst _SELECTOR_REGEXP = new RegExp('(\\\\:not\\\\()|' + // 1: \":not(\"\n '(([\\\\.\\\\#]?)[-\\\\w]+)|' + // 2: \"tag\"; 3: \".\"/\"#\";\n // \"-\" should appear first in the regexp below as FF31 parses \"[.-\\w]\" as a range\n // 4: attribute; 5: attribute_string; 6: attribute_value\n '(?:\\\\[([-.\\\\w*\\\\\\\\$]+)(?:=([\\\"\\']?)([^\\\\]\\\"\\']*)\\\\5)?\\\\])|' + // \"[name]\", \"[name=value]\",\n // \"[name=\"value\"]\",\n // \"[name='value']\"\n '(\\\\))|' + // 7: \")\"\n '(\\\\s*,\\\\s*)', // 8: \",\"\n'g');\n/**\n * A css selector contains an element name,\n * css classes and attribute/value pairs with the purpose\n * of selecting subsets out of them.\n */\nclass CssSelector {\n constructor() {\n this.element = null;\n this.classNames = [];\n /**\n * The selectors are encoded in pairs where:\n * - even locations are attribute names\n * - odd locations are attribute values.\n *\n * Example:\n * Selector: `[key1=value1][key2]` would parse to:\n * ```\n * ['key1', 'value1', 'key2', '']\n * ```\n */\n this.attrs = [];\n this.notSelectors = [];\n }\n static parse(selector) {\n const results = [];\n const _addResult = (res, cssSel) => {\n if (cssSel.notSelectors.length > 0 && !cssSel.element && cssSel.classNames.length == 0 &&\n cssSel.attrs.length == 0) {\n cssSel.element = '*';\n }\n res.push(cssSel);\n };\n let cssSelector = new CssSelector();\n let match;\n let current = cssSelector;\n let inNot = false;\n _SELECTOR_REGEXP.lastIndex = 0;\n while (match = _SELECTOR_REGEXP.exec(selector)) {\n if (match[1 /* SelectorRegexp.NOT */]) {\n if (inNot) {\n throw new Error('Nesting :not in a selector is not allowed');\n }\n inNot = true;\n current = new CssSelector();\n cssSelector.notSelectors.push(current);\n }\n const tag = match[2 /* SelectorRegexp.TAG */];\n if (tag) {\n const prefix = match[3 /* SelectorRegexp.PREFIX */];\n if (prefix === '#') {\n // #hash\n current.addAttribute('id', tag.slice(1));\n }\n else if (prefix === '.') {\n // Class\n current.addClassName(tag.slice(1));\n }\n else {\n // Element\n current.setElement(tag);\n }\n }\n const attribute = match[4 /* SelectorRegexp.ATTRIBUTE */];\n if (attribute) {\n current.addAttribute(current.unescapeAttribute(attribute), match[6 /* SelectorRegexp.ATTRIBUTE_VALUE */]);\n }\n if (match[7 /* SelectorRegexp.NOT_END */]) {\n inNot = false;\n current = cssSelector;\n }\n if (match[8 /* SelectorRegexp.SEPARATOR */]) {\n if (inNot) {\n throw new Error('Multiple selectors in :not are not supported');\n }\n _addResult(results, cssSelector);\n cssSelector = current = new CssSelector();\n }\n }\n _addResult(results, cssSelector);\n return results;\n }\n /**\n * Unescape `\\$` sequences from the CSS attribute selector.\n *\n * This is needed because `$` can have a special meaning in CSS selectors,\n * but we might want to match an attribute that contains `$`.\n * [MDN web link for more\n * info](https://developer.mozilla.org/en-US/docs/Web/CSS/Attribute_selectors).\n * @param attr the attribute to unescape.\n * @returns the unescaped string.\n */\n unescapeAttribute(attr) {\n let result = '';\n let escaping = false;\n for (let i = 0; i < attr.length; i++) {\n const char = attr.charAt(i);\n if (char === '\\\\') {\n escaping = true;\n continue;\n }\n if (char === '$' && !escaping) {\n throw new Error(`Error in attribute selector \"${attr}\". ` +\n `Unescaped \"$\" is not supported. Please escape with \"\\\\$\".`);\n }\n escaping = false;\n result += char;\n }\n return result;\n }\n /**\n * Escape `$` sequences from the CSS attribute selector.\n *\n * This is needed because `$` can have a special meaning in CSS selectors,\n * with this method we are escaping `$` with `\\$'.\n * [MDN web link for more\n * info](https://developer.mozilla.org/en-US/docs/Web/CSS/Attribute_selectors).\n * @param attr the attribute to escape.\n * @returns the escaped string.\n */\n escapeAttribute(attr) {\n return attr.replace(/\\\\/g, '\\\\\\\\').replace(/\\$/g, '\\\\$');\n }\n isElementSelector() {\n return this.hasElementSelector() && this.classNames.length == 0 && this.attrs.length == 0 &&\n this.notSelectors.length === 0;\n }\n hasElementSelector() {\n return !!this.element;\n }\n setElement(element = null) {\n this.element = element;\n }\n /** Gets a template string for an element that matches the selector. */\n getMatchingElementTemplate() {\n const tagName = this.element || 'div';\n const classAttr = this.classNames.length > 0 ? ` class=\"${this.classNames.join(' ')}\"` : '';\n let attrs = '';\n for (let i = 0; i < this.attrs.length; i += 2) {\n const attrName = this.attrs[i];\n const attrValue = this.attrs[i + 1] !== '' ? `=\"${this.attrs[i + 1]}\"` : '';\n attrs += ` ${attrName}${attrValue}`;\n }\n return getHtmlTagDefinition(tagName).isVoid ? `<${tagName}${classAttr}${attrs}/>` :\n `<${tagName}${classAttr}${attrs}>`;\n }\n getAttrs() {\n const result = [];\n if (this.classNames.length > 0) {\n result.push('class', this.classNames.join(' '));\n }\n return result.concat(this.attrs);\n }\n addAttribute(name, value = '') {\n this.attrs.push(name, value && value.toLowerCase() || '');\n }\n addClassName(name) {\n this.classNames.push(name.toLowerCase());\n }\n toString() {\n let res = this.element || '';\n if (this.classNames) {\n this.classNames.forEach(klass => res += `.${klass}`);\n }\n if (this.attrs) {\n for (let i = 0; i < this.attrs.length; i += 2) {\n const name = this.escapeAttribute(this.attrs[i]);\n const value = this.attrs[i + 1];\n res += `[${name}${value ? '=' + value : ''}]`;\n }\n }\n this.notSelectors.forEach(notSelector => res += `:not(${notSelector})`);\n return res;\n }\n}\n/**\n * Reads a list of CssSelectors and allows to calculate which ones\n * are contained in a given CssSelector.\n */\nclass SelectorMatcher {\n constructor() {\n this._elementMap = new Map();\n this._elementPartialMap = new Map();\n this._classMap = new Map();\n this._classPartialMap = new Map();\n this._attrValueMap = new Map();\n this._attrValuePartialMap = new Map();\n this._listContexts = [];\n }\n static createNotMatcher(notSelectors) {\n const notMatcher = new SelectorMatcher();\n notMatcher.addSelectables(notSelectors, null);\n return notMatcher;\n }\n addSelectables(cssSelectors, callbackCtxt) {\n let listContext = null;\n if (cssSelectors.length > 1) {\n listContext = new SelectorListContext(cssSelectors);\n this._listContexts.push(listContext);\n }\n for (let i = 0; i < cssSelectors.length; i++) {\n this._addSelectable(cssSelectors[i], callbackCtxt, listContext);\n }\n }\n /**\n * Add an object that can be found later on by calling `match`.\n * @param cssSelector A css selector\n * @param callbackCtxt An opaque object that will be given to the callback of the `match` function\n */\n _addSelectable(cssSelector, callbackCtxt, listContext) {\n let matcher = this;\n const element = cssSelector.element;\n const classNames = cssSelector.classNames;\n const attrs = cssSelector.attrs;\n const selectable = new SelectorContext(cssSelector, callbackCtxt, listContext);\n if (element) {\n const isTerminal = attrs.length === 0 && classNames.length === 0;\n if (isTerminal) {\n this._addTerminal(matcher._elementMap, element, selectable);\n }\n else {\n matcher = this._addPartial(matcher._elementPartialMap, element);\n }\n }\n if (classNames) {\n for (let i = 0; i < classNames.length; i++) {\n const isTerminal = attrs.length === 0 && i === classNames.length - 1;\n const className = classNames[i];\n if (isTerminal) {\n this._addTerminal(matcher._classMap, className, selectable);\n }\n else {\n matcher = this._addPartial(matcher._classPartialMap, className);\n }\n }\n }\n if (attrs) {\n for (let i = 0; i < attrs.length; i += 2) {\n const isTerminal = i === attrs.length - 2;\n const name = attrs[i];\n const value = attrs[i + 1];\n if (isTerminal) {\n const terminalMap = matcher._attrValueMap;\n let terminalValuesMap = terminalMap.get(name);\n if (!terminalValuesMap) {\n terminalValuesMap = new Map();\n terminalMap.set(name, terminalValuesMap);\n }\n this._addTerminal(terminalValuesMap, value, selectable);\n }\n else {\n const partialMap = matcher._attrValuePartialMap;\n let partialValuesMap = partialMap.get(name);\n if (!partialValuesMap) {\n partialValuesMap = new Map();\n partialMap.set(name, partialValuesMap);\n }\n matcher = this._addPartial(partialValuesMap, value);\n }\n }\n }\n }\n _addTerminal(map, name, selectable) {\n let terminalList = map.get(name);\n if (!terminalList) {\n terminalList = [];\n map.set(name, terminalList);\n }\n terminalList.push(selectable);\n }\n _addPartial(map, name) {\n let matcher = map.get(name);\n if (!matcher) {\n matcher = new SelectorMatcher();\n map.set(name, matcher);\n }\n return matcher;\n }\n /**\n * Find the objects that have been added via `addSelectable`\n * whose css selector is contained in the given css selector.\n * @param cssSelector A css selector\n * @param matchedCallback This callback will be called with the object handed into `addSelectable`\n * @return boolean true if a match was found\n */\n match(cssSelector, matchedCallback) {\n let result = false;\n const element = cssSelector.element;\n const classNames = cssSelector.classNames;\n const attrs = cssSelector.attrs;\n for (let i = 0; i < this._listContexts.length; i++) {\n this._listContexts[i].alreadyMatched = false;\n }\n result = this._matchTerminal(this._elementMap, element, cssSelector, matchedCallback) || result;\n result = this._matchPartial(this._elementPartialMap, element, cssSelector, matchedCallback) ||\n result;\n if (classNames) {\n for (let i = 0; i < classNames.length; i++) {\n const className = classNames[i];\n result =\n this._matchTerminal(this._classMap, className, cssSelector, matchedCallback) || result;\n result =\n this._matchPartial(this._classPartialMap, className, cssSelector, matchedCallback) ||\n result;\n }\n }\n if (attrs) {\n for (let i = 0; i < attrs.length; i += 2) {\n const name = attrs[i];\n const value = attrs[i + 1];\n const terminalValuesMap = this._attrValueMap.get(name);\n if (value) {\n result =\n this._matchTerminal(terminalValuesMap, '', cssSelector, matchedCallback) || result;\n }\n result =\n this._matchTerminal(terminalValuesMap, value, cssSelector, matchedCallback) || result;\n const partialValuesMap = this._attrValuePartialMap.get(name);\n if (value) {\n result = this._matchPartial(partialValuesMap, '', cssSelector, matchedCallback) || result;\n }\n result =\n this._matchPartial(partialValuesMap, value, cssSelector, matchedCallback) || result;\n }\n }\n return result;\n }\n /** @internal */\n _matchTerminal(map, name, cssSelector, matchedCallback) {\n if (!map || typeof name !== 'string') {\n return false;\n }\n let selectables = map.get(name) || [];\n const starSelectables = map.get('*');\n if (starSelectables) {\n selectables = selectables.concat(starSelectables);\n }\n if (selectables.length === 0) {\n return false;\n }\n let selectable;\n let result = false;\n for (let i = 0; i < selectables.length; i++) {\n selectable = selectables[i];\n result = selectable.finalize(cssSelector, matchedCallback) || result;\n }\n return result;\n }\n /** @internal */\n _matchPartial(map, name, cssSelector, matchedCallback) {\n if (!map || typeof name !== 'string') {\n return false;\n }\n const nestedSelector = map.get(name);\n if (!nestedSelector) {\n return false;\n }\n // TODO(perf): get rid of recursion and measure again\n // TODO(perf): don't pass the whole selector into the recursion,\n // but only the not processed parts\n return nestedSelector.match(cssSelector, matchedCallback);\n }\n}\nclass SelectorListContext {\n constructor(selectors) {\n this.selectors = selectors;\n this.alreadyMatched = false;\n }\n}\n// Store context to pass back selector and context when a selector is matched\nclass SelectorContext {\n constructor(selector, cbContext, listContext) {\n this.selector = selector;\n this.cbContext = cbContext;\n this.listContext = listContext;\n this.notSelectors = selector.notSelectors;\n }\n finalize(cssSelector, callback) {\n let result = true;\n if (this.notSelectors.length > 0 && (!this.listContext || !this.listContext.alreadyMatched)) {\n const notMatcher = SelectorMatcher.createNotMatcher(this.notSelectors);\n result = !notMatcher.match(cssSelector, null);\n }\n if (result && callback && (!this.listContext || !this.listContext.alreadyMatched)) {\n if (this.listContext) {\n this.listContext.alreadyMatched = true;\n }\n callback(this.selector, this.cbContext);\n }\n return result;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Stores the default value of `emitDistinctChangesOnly` when the `emitDistinctChangesOnly` is not\n// explicitly set.\nconst emitDistinctChangesOnlyDefaultValue = true;\nvar ViewEncapsulation;\n(function (ViewEncapsulation) {\n ViewEncapsulation[ViewEncapsulation[\"Emulated\"] = 0] = \"Emulated\";\n // Historically the 1 value was for `Native` encapsulation which has been removed as of v11.\n ViewEncapsulation[ViewEncapsulation[\"None\"] = 2] = \"None\";\n ViewEncapsulation[ViewEncapsulation[\"ShadowDom\"] = 3] = \"ShadowDom\";\n})(ViewEncapsulation || (ViewEncapsulation = {}));\nvar ChangeDetectionStrategy;\n(function (ChangeDetectionStrategy) {\n ChangeDetectionStrategy[ChangeDetectionStrategy[\"OnPush\"] = 0] = \"OnPush\";\n ChangeDetectionStrategy[ChangeDetectionStrategy[\"Default\"] = 1] = \"Default\";\n})(ChangeDetectionStrategy || (ChangeDetectionStrategy = {}));\nconst CUSTOM_ELEMENTS_SCHEMA = {\n name: 'custom-elements'\n};\nconst NO_ERRORS_SCHEMA = {\n name: 'no-errors-schema'\n};\nconst Type$1 = Function;\nvar SecurityContext;\n(function (SecurityContext) {\n SecurityContext[SecurityContext[\"NONE\"] = 0] = \"NONE\";\n SecurityContext[SecurityContext[\"HTML\"] = 1] = \"HTML\";\n SecurityContext[SecurityContext[\"STYLE\"] = 2] = \"STYLE\";\n SecurityContext[SecurityContext[\"SCRIPT\"] = 3] = \"SCRIPT\";\n SecurityContext[SecurityContext[\"URL\"] = 4] = \"URL\";\n SecurityContext[SecurityContext[\"RESOURCE_URL\"] = 5] = \"RESOURCE_URL\";\n})(SecurityContext || (SecurityContext = {}));\nvar MissingTranslationStrategy;\n(function (MissingTranslationStrategy) {\n MissingTranslationStrategy[MissingTranslationStrategy[\"Error\"] = 0] = \"Error\";\n MissingTranslationStrategy[MissingTranslationStrategy[\"Warning\"] = 1] = \"Warning\";\n MissingTranslationStrategy[MissingTranslationStrategy[\"Ignore\"] = 2] = \"Ignore\";\n})(MissingTranslationStrategy || (MissingTranslationStrategy = {}));\nfunction parserSelectorToSimpleSelector(selector) {\n const classes = selector.classNames && selector.classNames.length ?\n [8 /* SelectorFlags.CLASS */, ...selector.classNames] :\n [];\n const elementName = selector.element && selector.element !== '*' ? selector.element : '';\n return [elementName, ...selector.attrs, ...classes];\n}\nfunction parserSelectorToNegativeSelector(selector) {\n const classes = selector.classNames && selector.classNames.length ?\n [8 /* SelectorFlags.CLASS */, ...selector.classNames] :\n [];\n if (selector.element) {\n return [\n 1 /* SelectorFlags.NOT */ | 4 /* SelectorFlags.ELEMENT */, selector.element, ...selector.attrs, ...classes\n ];\n }\n else if (selector.attrs.length) {\n return [1 /* SelectorFlags.NOT */ | 2 /* SelectorFlags.ATTRIBUTE */, ...selector.attrs, ...classes];\n }\n else {\n return selector.classNames && selector.classNames.length ?\n [1 /* SelectorFlags.NOT */ | 8 /* SelectorFlags.CLASS */, ...selector.classNames] :\n [];\n }\n}\nfunction parserSelectorToR3Selector(selector) {\n const positive = parserSelectorToSimpleSelector(selector);\n const negative = selector.notSelectors && selector.notSelectors.length ?\n selector.notSelectors.map(notSelector => parserSelectorToNegativeSelector(notSelector)) :\n [];\n return positive.concat(...negative);\n}\nfunction parseSelectorToR3Selector(selector) {\n return selector ? CssSelector.parse(selector).map(parserSelectorToR3Selector) : [];\n}\n\nvar core = /*#__PURE__*/Object.freeze({\n __proto__: null,\n emitDistinctChangesOnlyDefaultValue: emitDistinctChangesOnlyDefaultValue,\n get ViewEncapsulation () { return ViewEncapsulation; },\n get ChangeDetectionStrategy () { return ChangeDetectionStrategy; },\n CUSTOM_ELEMENTS_SCHEMA: CUSTOM_ELEMENTS_SCHEMA,\n NO_ERRORS_SCHEMA: NO_ERRORS_SCHEMA,\n Type: Type$1,\n get SecurityContext () { return SecurityContext; },\n get MissingTranslationStrategy () { return MissingTranslationStrategy; },\n parseSelectorToR3Selector: parseSelectorToR3Selector\n});\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst DASH_CASE_REGEXP = /-+([a-z0-9])/g;\nfunction dashCaseToCamelCase(input) {\n return input.replace(DASH_CASE_REGEXP, (...m) => m[1].toUpperCase());\n}\nfunction splitAtColon(input, defaultValues) {\n return _splitAt(input, ':', defaultValues);\n}\nfunction splitAtPeriod(input, defaultValues) {\n return _splitAt(input, '.', defaultValues);\n}\nfunction _splitAt(input, character, defaultValues) {\n const characterIndex = input.indexOf(character);\n if (characterIndex == -1)\n return defaultValues;\n return [input.slice(0, characterIndex).trim(), input.slice(characterIndex + 1).trim()];\n}\nfunction noUndefined(val) {\n return val === undefined ? null : val;\n}\nfunction error(msg) {\n throw new Error(`Internal Error: ${msg}`);\n}\n// Escape characters that have a special meaning in Regular Expressions\nfunction escapeRegExp(s) {\n return s.replace(/([.*+?^=!:${}()|[\\]\\/\\\\])/g, '\\\\$1');\n}\nfunction utf8Encode(str) {\n let encoded = [];\n for (let index = 0; index < str.length; index++) {\n let codePoint = str.charCodeAt(index);\n // decode surrogate\n // see https://mathiasbynens.be/notes/javascript-encoding#surrogate-formulae\n if (codePoint >= 0xd800 && codePoint <= 0xdbff && str.length > (index + 1)) {\n const low = str.charCodeAt(index + 1);\n if (low >= 0xdc00 && low <= 0xdfff) {\n index++;\n codePoint = ((codePoint - 0xd800) << 10) + low - 0xdc00 + 0x10000;\n }\n }\n if (codePoint <= 0x7f) {\n encoded.push(codePoint);\n }\n else if (codePoint <= 0x7ff) {\n encoded.push(((codePoint >> 6) & 0x1F) | 0xc0, (codePoint & 0x3f) | 0x80);\n }\n else if (codePoint <= 0xffff) {\n encoded.push((codePoint >> 12) | 0xe0, ((codePoint >> 6) & 0x3f) | 0x80, (codePoint & 0x3f) | 0x80);\n }\n else if (codePoint <= 0x1fffff) {\n encoded.push(((codePoint >> 18) & 0x07) | 0xf0, ((codePoint >> 12) & 0x3f) | 0x80, ((codePoint >> 6) & 0x3f) | 0x80, (codePoint & 0x3f) | 0x80);\n }\n }\n return encoded;\n}\nfunction stringify(token) {\n if (typeof token === 'string') {\n return token;\n }\n if (Array.isArray(token)) {\n return '[' + token.map(stringify).join(', ') + ']';\n }\n if (token == null) {\n return '' + token;\n }\n if (token.overriddenName) {\n return `${token.overriddenName}`;\n }\n if (token.name) {\n return `${token.name}`;\n }\n if (!token.toString) {\n return 'object';\n }\n // WARNING: do not try to `JSON.stringify(token)` here\n // see https://github.com/angular/angular/issues/23440\n const res = token.toString();\n if (res == null) {\n return '' + res;\n }\n const newLineIndex = res.indexOf('\\n');\n return newLineIndex === -1 ? res : res.substring(0, newLineIndex);\n}\nclass Version {\n constructor(full) {\n this.full = full;\n const splits = full.split('.');\n this.major = splits[0];\n this.minor = splits[1];\n this.patch = splits.slice(2).join('.');\n }\n}\n// Check `global` first, because in Node tests both `global` and `window` may be defined and our\n// `_global` variable should point to the NodeJS `global` in that case. Note: Typeof/Instanceof\n// checks are considered side-effects in Terser. We explicitly mark this as side-effect free:\n// https://github.com/terser/terser/issues/250.\nconst _global = ( /* @__PURE__ */(() => (typeof global !== 'undefined' && global) || (typeof window !== 'undefined' && window) ||\n (typeof self !== 'undefined' && typeof WorkerGlobalScope !== 'undefined' &&\n self instanceof WorkerGlobalScope && self))());\nfunction newArray(size, value) {\n const list = [];\n for (let i = 0; i < size; i++) {\n list.push(value);\n }\n return list;\n}\n/**\n * Partitions a given array into 2 arrays, based on a boolean value returned by the condition\n * function.\n *\n * @param arr Input array that should be partitioned\n * @param conditionFn Condition function that is called for each item in a given array and returns a\n * boolean value.\n */\nfunction partitionArray(arr, conditionFn) {\n const truthy = [];\n const falsy = [];\n for (const item of arr) {\n (conditionFn(item) ? truthy : falsy).push(item);\n }\n return [truthy, falsy];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Represents a big integer using a buffer of its individual digits, with the least significant\n * digit stored at the beginning of the array (little endian).\n *\n * For performance reasons, each instance is mutable. The addition operation can be done in-place\n * to reduce memory pressure of allocation for the digits array.\n */\nclass BigInteger {\n /**\n * Creates a big integer using its individual digits in little endian storage.\n */\n constructor(digits) {\n this.digits = digits;\n }\n static zero() {\n return new BigInteger([0]);\n }\n static one() {\n return new BigInteger([1]);\n }\n /**\n * Creates a clone of this instance.\n */\n clone() {\n return new BigInteger(this.digits.slice());\n }\n /**\n * Returns a new big integer with the sum of `this` and `other` as its value. This does not mutate\n * `this` but instead returns a new instance, unlike `addToSelf`.\n */\n add(other) {\n const result = this.clone();\n result.addToSelf(other);\n return result;\n }\n /**\n * Adds `other` to the instance itself, thereby mutating its value.\n */\n addToSelf(other) {\n const maxNrOfDigits = Math.max(this.digits.length, other.digits.length);\n let carry = 0;\n for (let i = 0; i < maxNrOfDigits; i++) {\n let digitSum = carry;\n if (i < this.digits.length) {\n digitSum += this.digits[i];\n }\n if (i < other.digits.length) {\n digitSum += other.digits[i];\n }\n if (digitSum >= 10) {\n this.digits[i] = digitSum - 10;\n carry = 1;\n }\n else {\n this.digits[i] = digitSum;\n carry = 0;\n }\n }\n // Apply a remaining carry if needed.\n if (carry > 0) {\n this.digits[maxNrOfDigits] = 1;\n }\n }\n /**\n * Builds the decimal string representation of the big integer. As this is stored in\n * little endian, the digits are concatenated in reverse order.\n */\n toString() {\n let res = '';\n for (let i = this.digits.length - 1; i >= 0; i--) {\n res += this.digits[i];\n }\n return res;\n }\n}\n/**\n * Represents a big integer which is optimized for multiplication operations, as its power-of-twos\n * are memoized. See `multiplyBy()` for details on the multiplication algorithm.\n */\nclass BigIntForMultiplication {\n constructor(value) {\n this.powerOfTwos = [value];\n }\n /**\n * Returns the big integer itself.\n */\n getValue() {\n return this.powerOfTwos[0];\n }\n /**\n * Computes the value for `num * b`, where `num` is a JS number and `b` is a big integer. The\n * value for `b` is represented by a storage model that is optimized for this computation.\n *\n * This operation is implemented in N(log2(num)) by continuous halving of the number, where the\n * least-significant bit (LSB) is tested in each iteration. If the bit is set, the bit's index is\n * used as exponent into the power-of-two multiplication of `b`.\n *\n * As an example, consider the multiplication num=42, b=1337. In binary 42 is 0b00101010 and the\n * algorithm unrolls into the following iterations:\n *\n * Iteration | num | LSB | b * 2^iter | Add? | product\n * -----------|------------|------|------------|------|--------\n * 0 | 0b00101010 | 0 | 1337 | No | 0\n * 1 | 0b00010101 | 1 | 2674 | Yes | 2674\n * 2 | 0b00001010 | 0 | 5348 | No | 2674\n * 3 | 0b00000101 | 1 | 10696 | Yes | 13370\n * 4 | 0b00000010 | 0 | 21392 | No | 13370\n * 5 | 0b00000001 | 1 | 42784 | Yes | 56154\n * 6 | 0b00000000 | 0 | 85568 | No | 56154\n *\n * The computed product of 56154 is indeed the correct result.\n *\n * The `BigIntForMultiplication` representation for a big integer provides memoized access to the\n * power-of-two values to reduce the workload in computing those values.\n */\n multiplyBy(num) {\n const product = BigInteger.zero();\n this.multiplyByAndAddTo(num, product);\n return product;\n }\n /**\n * See `multiplyBy()` for details. This function allows for the computed product to be added\n * directly to the provided result big integer.\n */\n multiplyByAndAddTo(num, result) {\n for (let exponent = 0; num !== 0; num = num >>> 1, exponent++) {\n if (num & 1) {\n const value = this.getMultipliedByPowerOfTwo(exponent);\n result.addToSelf(value);\n }\n }\n }\n /**\n * Computes and memoizes the big integer value for `this.number * 2^exponent`.\n */\n getMultipliedByPowerOfTwo(exponent) {\n // Compute the powers up until the requested exponent, where each value is computed from its\n // predecessor. This is simple as `this.number * 2^(exponent - 1)` only has to be doubled (i.e.\n // added to itself) to reach `this.number * 2^exponent`.\n for (let i = this.powerOfTwos.length; i <= exponent; i++) {\n const previousPower = this.powerOfTwos[i - 1];\n this.powerOfTwos[i] = previousPower.add(previousPower);\n }\n return this.powerOfTwos[exponent];\n }\n}\n/**\n * Represents an exponentiation operation for the provided base, of which exponents are computed and\n * memoized. The results are represented by a `BigIntForMultiplication` which is tailored for\n * multiplication operations by memoizing the power-of-twos. This effectively results in a matrix\n * representation that is lazily computed upon request.\n */\nclass BigIntExponentiation {\n constructor(base) {\n this.base = base;\n this.exponents = [new BigIntForMultiplication(BigInteger.one())];\n }\n /**\n * Compute the value for `this.base^exponent`, resulting in a big integer that is optimized for\n * further multiplication operations.\n */\n toThePowerOf(exponent) {\n // Compute the results up until the requested exponent, where every value is computed from its\n // predecessor. This is because `this.base^(exponent - 1)` only has to be multiplied by `base`\n // to reach `this.base^exponent`.\n for (let i = this.exponents.length; i <= exponent; i++) {\n const value = this.exponents[i - 1].multiplyBy(this.base);\n this.exponents[i] = new BigIntForMultiplication(value);\n }\n return this.exponents[exponent];\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Return the message id or compute it using the XLIFF1 digest.\n */\nfunction digest$1(message) {\n return message.id || computeDigest(message);\n}\n/**\n * Compute the message id using the XLIFF1 digest.\n */\nfunction computeDigest(message) {\n return sha1(serializeNodes(message.nodes).join('') + `[${message.meaning}]`);\n}\n/**\n * Return the message id or compute it using the XLIFF2/XMB/$localize digest.\n */\nfunction decimalDigest(message) {\n return message.id || computeDecimalDigest(message);\n}\n/**\n * Compute the message id using the XLIFF2/XMB/$localize digest.\n */\nfunction computeDecimalDigest(message) {\n const visitor = new _SerializerIgnoreIcuExpVisitor();\n const parts = message.nodes.map(a => a.visit(visitor, null));\n return computeMsgId(parts.join(''), message.meaning);\n}\n/**\n * Serialize the i18n ast to something xml-like in order to generate an UID.\n *\n * The visitor is also used in the i18n parser tests\n *\n * @internal\n */\nclass _SerializerVisitor {\n visitText(text, context) {\n return text.value;\n }\n visitContainer(container, context) {\n return `[${container.children.map(child => child.visit(this)).join(', ')}]`;\n }\n visitIcu(icu, context) {\n const strCases = Object.keys(icu.cases).map((k) => `${k} {${icu.cases[k].visit(this)}}`);\n return `{${icu.expression}, ${icu.type}, ${strCases.join(', ')}}`;\n }\n visitTagPlaceholder(ph, context) {\n return ph.isVoid ?\n `` :\n `${ph.children.map(child => child.visit(this)).join(', ')}`;\n }\n visitPlaceholder(ph, context) {\n return ph.value ? `${ph.value}` : ``;\n }\n visitIcuPlaceholder(ph, context) {\n return `${ph.value.visit(this)}`;\n }\n}\nconst serializerVisitor$1 = new _SerializerVisitor();\nfunction serializeNodes(nodes) {\n return nodes.map(a => a.visit(serializerVisitor$1, null));\n}\n/**\n * Serialize the i18n ast to something xml-like in order to generate an UID.\n *\n * Ignore the ICU expressions so that message IDs stays identical if only the expression changes.\n *\n * @internal\n */\nclass _SerializerIgnoreIcuExpVisitor extends _SerializerVisitor {\n visitIcu(icu, context) {\n let strCases = Object.keys(icu.cases).map((k) => `${k} {${icu.cases[k].visit(this)}}`);\n // Do not take the expression into account\n return `{${icu.type}, ${strCases.join(', ')}}`;\n }\n}\n/**\n * Compute the SHA1 of the given string\n *\n * see https://csrc.nist.gov/publications/fips/fips180-4/fips-180-4.pdf\n *\n * WARNING: this function has not been designed not tested with security in mind.\n * DO NOT USE IT IN A SECURITY SENSITIVE CONTEXT.\n */\nfunction sha1(str) {\n const utf8 = utf8Encode(str);\n const words32 = bytesToWords32(utf8, Endian.Big);\n const len = utf8.length * 8;\n const w = newArray(80);\n let a = 0x67452301, b = 0xefcdab89, c = 0x98badcfe, d = 0x10325476, e = 0xc3d2e1f0;\n words32[len >> 5] |= 0x80 << (24 - len % 32);\n words32[((len + 64 >> 9) << 4) + 15] = len;\n for (let i = 0; i < words32.length; i += 16) {\n const h0 = a, h1 = b, h2 = c, h3 = d, h4 = e;\n for (let j = 0; j < 80; j++) {\n if (j < 16) {\n w[j] = words32[i + j];\n }\n else {\n w[j] = rol32(w[j - 3] ^ w[j - 8] ^ w[j - 14] ^ w[j - 16], 1);\n }\n const fkVal = fk(j, b, c, d);\n const f = fkVal[0];\n const k = fkVal[1];\n const temp = [rol32(a, 5), f, e, k, w[j]].reduce(add32);\n e = d;\n d = c;\n c = rol32(b, 30);\n b = a;\n a = temp;\n }\n a = add32(a, h0);\n b = add32(b, h1);\n c = add32(c, h2);\n d = add32(d, h3);\n e = add32(e, h4);\n }\n return bytesToHexString(words32ToByteString([a, b, c, d, e]));\n}\nfunction fk(index, b, c, d) {\n if (index < 20) {\n return [(b & c) | (~b & d), 0x5a827999];\n }\n if (index < 40) {\n return [b ^ c ^ d, 0x6ed9eba1];\n }\n if (index < 60) {\n return [(b & c) | (b & d) | (c & d), 0x8f1bbcdc];\n }\n return [b ^ c ^ d, 0xca62c1d6];\n}\n/**\n * Compute the fingerprint of the given string\n *\n * The output is 64 bit number encoded as a decimal string\n *\n * based on:\n * https://github.com/google/closure-compiler/blob/master/src/com/google/javascript/jscomp/GoogleJsMessageIdGenerator.java\n */\nfunction fingerprint(str) {\n const utf8 = utf8Encode(str);\n let hi = hash32(utf8, 0);\n let lo = hash32(utf8, 102072);\n if (hi == 0 && (lo == 0 || lo == 1)) {\n hi = hi ^ 0x130f9bef;\n lo = lo ^ -0x6b5f56d8;\n }\n return [hi, lo];\n}\nfunction computeMsgId(msg, meaning = '') {\n let msgFingerprint = fingerprint(msg);\n if (meaning) {\n const meaningFingerprint = fingerprint(meaning);\n msgFingerprint = add64(rol64(msgFingerprint, 1), meaningFingerprint);\n }\n const hi = msgFingerprint[0];\n const lo = msgFingerprint[1];\n return wordsToDecimalString(hi & 0x7fffffff, lo);\n}\nfunction hash32(bytes, c) {\n let a = 0x9e3779b9, b = 0x9e3779b9;\n let i;\n const len = bytes.length;\n for (i = 0; i + 12 <= len; i += 12) {\n a = add32(a, wordAt(bytes, i, Endian.Little));\n b = add32(b, wordAt(bytes, i + 4, Endian.Little));\n c = add32(c, wordAt(bytes, i + 8, Endian.Little));\n const res = mix(a, b, c);\n a = res[0], b = res[1], c = res[2];\n }\n a = add32(a, wordAt(bytes, i, Endian.Little));\n b = add32(b, wordAt(bytes, i + 4, Endian.Little));\n // the first byte of c is reserved for the length\n c = add32(c, len);\n c = add32(c, wordAt(bytes, i + 8, Endian.Little) << 8);\n return mix(a, b, c)[2];\n}\n// clang-format off\nfunction mix(a, b, c) {\n a = sub32(a, b);\n a = sub32(a, c);\n a ^= c >>> 13;\n b = sub32(b, c);\n b = sub32(b, a);\n b ^= a << 8;\n c = sub32(c, a);\n c = sub32(c, b);\n c ^= b >>> 13;\n a = sub32(a, b);\n a = sub32(a, c);\n a ^= c >>> 12;\n b = sub32(b, c);\n b = sub32(b, a);\n b ^= a << 16;\n c = sub32(c, a);\n c = sub32(c, b);\n c ^= b >>> 5;\n a = sub32(a, b);\n a = sub32(a, c);\n a ^= c >>> 3;\n b = sub32(b, c);\n b = sub32(b, a);\n b ^= a << 10;\n c = sub32(c, a);\n c = sub32(c, b);\n c ^= b >>> 15;\n return [a, b, c];\n}\n// clang-format on\n// Utils\nvar Endian;\n(function (Endian) {\n Endian[Endian[\"Little\"] = 0] = \"Little\";\n Endian[Endian[\"Big\"] = 1] = \"Big\";\n})(Endian || (Endian = {}));\nfunction add32(a, b) {\n return add32to64(a, b)[1];\n}\nfunction add32to64(a, b) {\n const low = (a & 0xffff) + (b & 0xffff);\n const high = (a >>> 16) + (b >>> 16) + (low >>> 16);\n return [high >>> 16, (high << 16) | (low & 0xffff)];\n}\nfunction add64(a, b) {\n const ah = a[0], al = a[1];\n const bh = b[0], bl = b[1];\n const result = add32to64(al, bl);\n const carry = result[0];\n const l = result[1];\n const h = add32(add32(ah, bh), carry);\n return [h, l];\n}\nfunction sub32(a, b) {\n const low = (a & 0xffff) - (b & 0xffff);\n const high = (a >> 16) - (b >> 16) + (low >> 16);\n return (high << 16) | (low & 0xffff);\n}\n// Rotate a 32b number left `count` position\nfunction rol32(a, count) {\n return (a << count) | (a >>> (32 - count));\n}\n// Rotate a 64b number left `count` position\nfunction rol64(num, count) {\n const hi = num[0], lo = num[1];\n const h = (hi << count) | (lo >>> (32 - count));\n const l = (lo << count) | (hi >>> (32 - count));\n return [h, l];\n}\nfunction bytesToWords32(bytes, endian) {\n const size = (bytes.length + 3) >>> 2;\n const words32 = [];\n for (let i = 0; i < size; i++) {\n words32[i] = wordAt(bytes, i * 4, endian);\n }\n return words32;\n}\nfunction byteAt(bytes, index) {\n return index >= bytes.length ? 0 : bytes[index];\n}\nfunction wordAt(bytes, index, endian) {\n let word = 0;\n if (endian === Endian.Big) {\n for (let i = 0; i < 4; i++) {\n word += byteAt(bytes, index + i) << (24 - 8 * i);\n }\n }\n else {\n for (let i = 0; i < 4; i++) {\n word += byteAt(bytes, index + i) << 8 * i;\n }\n }\n return word;\n}\nfunction words32ToByteString(words32) {\n return words32.reduce((bytes, word) => bytes.concat(word32ToByteString(word)), []);\n}\nfunction word32ToByteString(word) {\n let bytes = [];\n for (let i = 0; i < 4; i++) {\n bytes.push((word >>> 8 * (3 - i)) & 0xff);\n }\n return bytes;\n}\nfunction bytesToHexString(bytes) {\n let hex = '';\n for (let i = 0; i < bytes.length; i++) {\n const b = byteAt(bytes, i);\n hex += (b >>> 4).toString(16) + (b & 0x0f).toString(16);\n }\n return hex.toLowerCase();\n}\n/**\n * Create a shared exponentiation pool for base-256 computations. This shared pool provides memoized\n * power-of-256 results with memoized power-of-two computations for efficient multiplication.\n *\n * For our purposes, this can be safely stored as a global without memory concerns. The reason is\n * that we encode two words, so only need the 0th (for the low word) and 4th (for the high word)\n * exponent.\n */\nconst base256 = new BigIntExponentiation(256);\n/**\n * Represents two 32-bit words as a single decimal number. This requires a big integer storage\n * model as JS numbers are not accurate enough to represent the 64-bit number.\n *\n * Based on https://www.danvk.org/hex2dec.html\n */\nfunction wordsToDecimalString(hi, lo) {\n // Encode the four bytes in lo in the lower digits of the decimal number.\n // Note: the multiplication results in lo itself but represented by a big integer using its\n // decimal digits.\n const decimal = base256.toThePowerOf(0).multiplyBy(lo);\n // Encode the four bytes in hi above the four lo bytes. lo is a maximum of (2^8)^4, which is why\n // this multiplication factor is applied.\n base256.toThePowerOf(4).multiplyByAndAddTo(hi, decimal);\n return decimal.toString();\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n//// Types\nvar TypeModifier;\n(function (TypeModifier) {\n TypeModifier[TypeModifier[\"None\"] = 0] = \"None\";\n TypeModifier[TypeModifier[\"Const\"] = 1] = \"Const\";\n})(TypeModifier || (TypeModifier = {}));\nclass Type {\n constructor(modifiers = TypeModifier.None) {\n this.modifiers = modifiers;\n }\n hasModifier(modifier) {\n return (this.modifiers & modifier) !== 0;\n }\n}\nvar BuiltinTypeName;\n(function (BuiltinTypeName) {\n BuiltinTypeName[BuiltinTypeName[\"Dynamic\"] = 0] = \"Dynamic\";\n BuiltinTypeName[BuiltinTypeName[\"Bool\"] = 1] = \"Bool\";\n BuiltinTypeName[BuiltinTypeName[\"String\"] = 2] = \"String\";\n BuiltinTypeName[BuiltinTypeName[\"Int\"] = 3] = \"Int\";\n BuiltinTypeName[BuiltinTypeName[\"Number\"] = 4] = \"Number\";\n BuiltinTypeName[BuiltinTypeName[\"Function\"] = 5] = \"Function\";\n BuiltinTypeName[BuiltinTypeName[\"Inferred\"] = 6] = \"Inferred\";\n BuiltinTypeName[BuiltinTypeName[\"None\"] = 7] = \"None\";\n})(BuiltinTypeName || (BuiltinTypeName = {}));\nclass BuiltinType extends Type {\n constructor(name, modifiers) {\n super(modifiers);\n this.name = name;\n }\n visitType(visitor, context) {\n return visitor.visitBuiltinType(this, context);\n }\n}\nclass ExpressionType extends Type {\n constructor(value, modifiers, typeParams = null) {\n super(modifiers);\n this.value = value;\n this.typeParams = typeParams;\n }\n visitType(visitor, context) {\n return visitor.visitExpressionType(this, context);\n }\n}\nclass ArrayType extends Type {\n constructor(of, modifiers) {\n super(modifiers);\n this.of = of;\n }\n visitType(visitor, context) {\n return visitor.visitArrayType(this, context);\n }\n}\nclass MapType extends Type {\n constructor(valueType, modifiers) {\n super(modifiers);\n this.valueType = valueType || null;\n }\n visitType(visitor, context) {\n return visitor.visitMapType(this, context);\n }\n}\nconst DYNAMIC_TYPE = new BuiltinType(BuiltinTypeName.Dynamic);\nconst INFERRED_TYPE = new BuiltinType(BuiltinTypeName.Inferred);\nconst BOOL_TYPE = new BuiltinType(BuiltinTypeName.Bool);\nconst INT_TYPE = new BuiltinType(BuiltinTypeName.Int);\nconst NUMBER_TYPE = new BuiltinType(BuiltinTypeName.Number);\nconst STRING_TYPE = new BuiltinType(BuiltinTypeName.String);\nconst FUNCTION_TYPE = new BuiltinType(BuiltinTypeName.Function);\nconst NONE_TYPE = new BuiltinType(BuiltinTypeName.None);\n///// Expressions\nvar UnaryOperator;\n(function (UnaryOperator) {\n UnaryOperator[UnaryOperator[\"Minus\"] = 0] = \"Minus\";\n UnaryOperator[UnaryOperator[\"Plus\"] = 1] = \"Plus\";\n})(UnaryOperator || (UnaryOperator = {}));\nvar BinaryOperator;\n(function (BinaryOperator) {\n BinaryOperator[BinaryOperator[\"Equals\"] = 0] = \"Equals\";\n BinaryOperator[BinaryOperator[\"NotEquals\"] = 1] = \"NotEquals\";\n BinaryOperator[BinaryOperator[\"Identical\"] = 2] = \"Identical\";\n BinaryOperator[BinaryOperator[\"NotIdentical\"] = 3] = \"NotIdentical\";\n BinaryOperator[BinaryOperator[\"Minus\"] = 4] = \"Minus\";\n BinaryOperator[BinaryOperator[\"Plus\"] = 5] = \"Plus\";\n BinaryOperator[BinaryOperator[\"Divide\"] = 6] = \"Divide\";\n BinaryOperator[BinaryOperator[\"Multiply\"] = 7] = \"Multiply\";\n BinaryOperator[BinaryOperator[\"Modulo\"] = 8] = \"Modulo\";\n BinaryOperator[BinaryOperator[\"And\"] = 9] = \"And\";\n BinaryOperator[BinaryOperator[\"Or\"] = 10] = \"Or\";\n BinaryOperator[BinaryOperator[\"BitwiseAnd\"] = 11] = \"BitwiseAnd\";\n BinaryOperator[BinaryOperator[\"Lower\"] = 12] = \"Lower\";\n BinaryOperator[BinaryOperator[\"LowerEquals\"] = 13] = \"LowerEquals\";\n BinaryOperator[BinaryOperator[\"Bigger\"] = 14] = \"Bigger\";\n BinaryOperator[BinaryOperator[\"BiggerEquals\"] = 15] = \"BiggerEquals\";\n BinaryOperator[BinaryOperator[\"NullishCoalesce\"] = 16] = \"NullishCoalesce\";\n})(BinaryOperator || (BinaryOperator = {}));\nfunction nullSafeIsEquivalent(base, other) {\n if (base == null || other == null) {\n return base == other;\n }\n return base.isEquivalent(other);\n}\nfunction areAllEquivalentPredicate(base, other, equivalentPredicate) {\n const len = base.length;\n if (len !== other.length) {\n return false;\n }\n for (let i = 0; i < len; i++) {\n if (!equivalentPredicate(base[i], other[i])) {\n return false;\n }\n }\n return true;\n}\nfunction areAllEquivalent(base, other) {\n return areAllEquivalentPredicate(base, other, (baseElement, otherElement) => baseElement.isEquivalent(otherElement));\n}\nclass Expression {\n constructor(type, sourceSpan) {\n this.type = type || null;\n this.sourceSpan = sourceSpan || null;\n }\n prop(name, sourceSpan) {\n return new ReadPropExpr(this, name, null, sourceSpan);\n }\n key(index, type, sourceSpan) {\n return new ReadKeyExpr(this, index, type, sourceSpan);\n }\n callFn(params, sourceSpan, pure) {\n return new InvokeFunctionExpr(this, params, null, sourceSpan, pure);\n }\n instantiate(params, type, sourceSpan) {\n return new InstantiateExpr(this, params, type, sourceSpan);\n }\n conditional(trueCase, falseCase = null, sourceSpan) {\n return new ConditionalExpr(this, trueCase, falseCase, null, sourceSpan);\n }\n equals(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Equals, this, rhs, null, sourceSpan);\n }\n notEquals(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.NotEquals, this, rhs, null, sourceSpan);\n }\n identical(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Identical, this, rhs, null, sourceSpan);\n }\n notIdentical(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.NotIdentical, this, rhs, null, sourceSpan);\n }\n minus(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Minus, this, rhs, null, sourceSpan);\n }\n plus(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Plus, this, rhs, null, sourceSpan);\n }\n divide(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Divide, this, rhs, null, sourceSpan);\n }\n multiply(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Multiply, this, rhs, null, sourceSpan);\n }\n modulo(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Modulo, this, rhs, null, sourceSpan);\n }\n and(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.And, this, rhs, null, sourceSpan);\n }\n bitwiseAnd(rhs, sourceSpan, parens = true) {\n return new BinaryOperatorExpr(BinaryOperator.BitwiseAnd, this, rhs, null, sourceSpan, parens);\n }\n or(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Or, this, rhs, null, sourceSpan);\n }\n lower(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Lower, this, rhs, null, sourceSpan);\n }\n lowerEquals(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.LowerEquals, this, rhs, null, sourceSpan);\n }\n bigger(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.Bigger, this, rhs, null, sourceSpan);\n }\n biggerEquals(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.BiggerEquals, this, rhs, null, sourceSpan);\n }\n isBlank(sourceSpan) {\n // Note: We use equals by purpose here to compare to null and undefined in JS.\n // We use the typed null to allow strictNullChecks to narrow types.\n return this.equals(TYPED_NULL_EXPR, sourceSpan);\n }\n nullishCoalesce(rhs, sourceSpan) {\n return new BinaryOperatorExpr(BinaryOperator.NullishCoalesce, this, rhs, null, sourceSpan);\n }\n toStmt() {\n return new ExpressionStatement(this, null);\n }\n}\nclass ReadVarExpr extends Expression {\n constructor(name, type, sourceSpan) {\n super(type, sourceSpan);\n this.name = name;\n }\n isEquivalent(e) {\n return e instanceof ReadVarExpr && this.name === e.name;\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitReadVarExpr(this, context);\n }\n set(value) {\n return new WriteVarExpr(this.name, value, null, this.sourceSpan);\n }\n}\nclass TypeofExpr extends Expression {\n constructor(expr, type, sourceSpan) {\n super(type, sourceSpan);\n this.expr = expr;\n }\n visitExpression(visitor, context) {\n return visitor.visitTypeofExpr(this, context);\n }\n isEquivalent(e) {\n return e instanceof TypeofExpr && e.expr.isEquivalent(this.expr);\n }\n isConstant() {\n return this.expr.isConstant();\n }\n}\nclass WrappedNodeExpr extends Expression {\n constructor(node, type, sourceSpan) {\n super(type, sourceSpan);\n this.node = node;\n }\n isEquivalent(e) {\n return e instanceof WrappedNodeExpr && this.node === e.node;\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitWrappedNodeExpr(this, context);\n }\n}\nclass WriteVarExpr extends Expression {\n constructor(name, value, type, sourceSpan) {\n super(type || value.type, sourceSpan);\n this.name = name;\n this.value = value;\n }\n isEquivalent(e) {\n return e instanceof WriteVarExpr && this.name === e.name && this.value.isEquivalent(e.value);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitWriteVarExpr(this, context);\n }\n toDeclStmt(type, modifiers) {\n return new DeclareVarStmt(this.name, this.value, type, modifiers, this.sourceSpan);\n }\n toConstDecl() {\n return this.toDeclStmt(INFERRED_TYPE, StmtModifier.Final);\n }\n}\nclass WriteKeyExpr extends Expression {\n constructor(receiver, index, value, type, sourceSpan) {\n super(type || value.type, sourceSpan);\n this.receiver = receiver;\n this.index = index;\n this.value = value;\n }\n isEquivalent(e) {\n return e instanceof WriteKeyExpr && this.receiver.isEquivalent(e.receiver) &&\n this.index.isEquivalent(e.index) && this.value.isEquivalent(e.value);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitWriteKeyExpr(this, context);\n }\n}\nclass WritePropExpr extends Expression {\n constructor(receiver, name, value, type, sourceSpan) {\n super(type || value.type, sourceSpan);\n this.receiver = receiver;\n this.name = name;\n this.value = value;\n }\n isEquivalent(e) {\n return e instanceof WritePropExpr && this.receiver.isEquivalent(e.receiver) &&\n this.name === e.name && this.value.isEquivalent(e.value);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitWritePropExpr(this, context);\n }\n}\nclass InvokeFunctionExpr extends Expression {\n constructor(fn, args, type, sourceSpan, pure = false) {\n super(type, sourceSpan);\n this.fn = fn;\n this.args = args;\n this.pure = pure;\n }\n isEquivalent(e) {\n return e instanceof InvokeFunctionExpr && this.fn.isEquivalent(e.fn) &&\n areAllEquivalent(this.args, e.args) && this.pure === e.pure;\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitInvokeFunctionExpr(this, context);\n }\n}\nclass TaggedTemplateExpr extends Expression {\n constructor(tag, template, type, sourceSpan) {\n super(type, sourceSpan);\n this.tag = tag;\n this.template = template;\n }\n isEquivalent(e) {\n return e instanceof TaggedTemplateExpr && this.tag.isEquivalent(e.tag) &&\n areAllEquivalentPredicate(this.template.elements, e.template.elements, (a, b) => a.text === b.text) &&\n areAllEquivalent(this.template.expressions, e.template.expressions);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitTaggedTemplateExpr(this, context);\n }\n}\nclass InstantiateExpr extends Expression {\n constructor(classExpr, args, type, sourceSpan) {\n super(type, sourceSpan);\n this.classExpr = classExpr;\n this.args = args;\n }\n isEquivalent(e) {\n return e instanceof InstantiateExpr && this.classExpr.isEquivalent(e.classExpr) &&\n areAllEquivalent(this.args, e.args);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitInstantiateExpr(this, context);\n }\n}\nclass LiteralExpr extends Expression {\n constructor(value, type, sourceSpan) {\n super(type, sourceSpan);\n this.value = value;\n }\n isEquivalent(e) {\n return e instanceof LiteralExpr && this.value === e.value;\n }\n isConstant() {\n return true;\n }\n visitExpression(visitor, context) {\n return visitor.visitLiteralExpr(this, context);\n }\n}\nclass TemplateLiteral {\n constructor(elements, expressions) {\n this.elements = elements;\n this.expressions = expressions;\n }\n}\nclass TemplateLiteralElement {\n constructor(text, sourceSpan, rawText) {\n var _a;\n this.text = text;\n this.sourceSpan = sourceSpan;\n // If `rawText` is not provided, try to extract the raw string from its\n // associated `sourceSpan`. If that is also not available, \"fake\" the raw\n // string instead by escaping the following control sequences:\n // - \"\\\" would otherwise indicate that the next character is a control character.\n // - \"`\" and \"${\" are template string control sequences that would otherwise prematurely\n // indicate the end of the template literal element.\n this.rawText =\n (_a = rawText !== null && rawText !== void 0 ? rawText : sourceSpan === null || sourceSpan === void 0 ? void 0 : sourceSpan.toString()) !== null && _a !== void 0 ? _a : escapeForTemplateLiteral(escapeSlashes(text));\n }\n}\nclass LiteralPiece {\n constructor(text, sourceSpan) {\n this.text = text;\n this.sourceSpan = sourceSpan;\n }\n}\nclass PlaceholderPiece {\n /**\n * Create a new instance of a `PlaceholderPiece`.\n *\n * @param text the name of this placeholder (e.g. `PH_1`).\n * @param sourceSpan the location of this placeholder in its localized message the source code.\n * @param associatedMessage reference to another message that this placeholder is associated with.\n * The `associatedMessage` is mainly used to provide a relationship to an ICU message that has\n * been extracted out from the message containing the placeholder.\n */\n constructor(text, sourceSpan, associatedMessage) {\n this.text = text;\n this.sourceSpan = sourceSpan;\n this.associatedMessage = associatedMessage;\n }\n}\nconst MEANING_SEPARATOR$1 = '|';\nconst ID_SEPARATOR$1 = '@@';\nconst LEGACY_ID_INDICATOR = '␟';\nclass LocalizedString extends Expression {\n constructor(metaBlock, messageParts, placeHolderNames, expressions, sourceSpan) {\n super(STRING_TYPE, sourceSpan);\n this.metaBlock = metaBlock;\n this.messageParts = messageParts;\n this.placeHolderNames = placeHolderNames;\n this.expressions = expressions;\n }\n isEquivalent(e) {\n // return e instanceof LocalizedString && this.message === e.message;\n return false;\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitLocalizedString(this, context);\n }\n /**\n * Serialize the given `meta` and `messagePart` into \"cooked\" and \"raw\" strings that can be used\n * in a `$localize` tagged string. The format of the metadata is the same as that parsed by\n * `parseI18nMeta()`.\n *\n * @param meta The metadata to serialize\n * @param messagePart The first part of the tagged string\n */\n serializeI18nHead() {\n let metaBlock = this.metaBlock.description || '';\n if (this.metaBlock.meaning) {\n metaBlock = `${this.metaBlock.meaning}${MEANING_SEPARATOR$1}${metaBlock}`;\n }\n if (this.metaBlock.customId) {\n metaBlock = `${metaBlock}${ID_SEPARATOR$1}${this.metaBlock.customId}`;\n }\n if (this.metaBlock.legacyIds) {\n this.metaBlock.legacyIds.forEach(legacyId => {\n metaBlock = `${metaBlock}${LEGACY_ID_INDICATOR}${legacyId}`;\n });\n }\n return createCookedRawString(metaBlock, this.messageParts[0].text, this.getMessagePartSourceSpan(0));\n }\n getMessagePartSourceSpan(i) {\n var _a, _b;\n return (_b = (_a = this.messageParts[i]) === null || _a === void 0 ? void 0 : _a.sourceSpan) !== null && _b !== void 0 ? _b : this.sourceSpan;\n }\n getPlaceholderSourceSpan(i) {\n var _a, _b, _c, _d;\n return (_d = (_b = (_a = this.placeHolderNames[i]) === null || _a === void 0 ? void 0 : _a.sourceSpan) !== null && _b !== void 0 ? _b : (_c = this.expressions[i]) === null || _c === void 0 ? void 0 : _c.sourceSpan) !== null && _d !== void 0 ? _d : this.sourceSpan;\n }\n /**\n * Serialize the given `placeholderName` and `messagePart` into \"cooked\" and \"raw\" strings that\n * can be used in a `$localize` tagged string.\n *\n * The format is `:[@@]:`.\n *\n * The `associated-id` is the message id of the (usually an ICU) message to which this placeholder\n * refers.\n *\n * @param partIndex The index of the message part to serialize.\n */\n serializeI18nTemplatePart(partIndex) {\n var _a;\n const placeholder = this.placeHolderNames[partIndex - 1];\n const messagePart = this.messageParts[partIndex];\n let metaBlock = placeholder.text;\n if (((_a = placeholder.associatedMessage) === null || _a === void 0 ? void 0 : _a.legacyIds.length) === 0) {\n metaBlock += `${ID_SEPARATOR$1}${computeMsgId(placeholder.associatedMessage.messageString, placeholder.associatedMessage.meaning)}`;\n }\n return createCookedRawString(metaBlock, messagePart.text, this.getMessagePartSourceSpan(partIndex));\n }\n}\nconst escapeSlashes = (str) => str.replace(/\\\\/g, '\\\\\\\\');\nconst escapeStartingColon = (str) => str.replace(/^:/, '\\\\:');\nconst escapeColons = (str) => str.replace(/:/g, '\\\\:');\nconst escapeForTemplateLiteral = (str) => str.replace(/`/g, '\\\\`').replace(/\\${/g, '$\\\\{');\n/**\n * Creates a `{cooked, raw}` object from the `metaBlock` and `messagePart`.\n *\n * The `raw` text must have various character sequences escaped:\n * * \"\\\" would otherwise indicate that the next character is a control character.\n * * \"`\" and \"${\" are template string control sequences that would otherwise prematurely indicate\n * the end of a message part.\n * * \":\" inside a metablock would prematurely indicate the end of the metablock.\n * * \":\" at the start of a messagePart with no metablock would erroneously indicate the start of a\n * metablock.\n *\n * @param metaBlock Any metadata that should be prepended to the string\n * @param messagePart The message part of the string\n */\nfunction createCookedRawString(metaBlock, messagePart, range) {\n if (metaBlock === '') {\n return {\n cooked: messagePart,\n raw: escapeForTemplateLiteral(escapeStartingColon(escapeSlashes(messagePart))),\n range,\n };\n }\n else {\n return {\n cooked: `:${metaBlock}:${messagePart}`,\n raw: escapeForTemplateLiteral(`:${escapeColons(escapeSlashes(metaBlock))}:${escapeSlashes(messagePart)}`),\n range,\n };\n }\n}\nclass ExternalExpr extends Expression {\n constructor(value, type, typeParams = null, sourceSpan) {\n super(type, sourceSpan);\n this.value = value;\n this.typeParams = typeParams;\n }\n isEquivalent(e) {\n return e instanceof ExternalExpr && this.value.name === e.value.name &&\n this.value.moduleName === e.value.moduleName && this.value.runtime === e.value.runtime;\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitExternalExpr(this, context);\n }\n}\nclass ExternalReference {\n constructor(moduleName, name, runtime) {\n this.moduleName = moduleName;\n this.name = name;\n this.runtime = runtime;\n }\n}\nclass ConditionalExpr extends Expression {\n constructor(condition, trueCase, falseCase = null, type, sourceSpan) {\n super(type || trueCase.type, sourceSpan);\n this.condition = condition;\n this.falseCase = falseCase;\n this.trueCase = trueCase;\n }\n isEquivalent(e) {\n return e instanceof ConditionalExpr && this.condition.isEquivalent(e.condition) &&\n this.trueCase.isEquivalent(e.trueCase) && nullSafeIsEquivalent(this.falseCase, e.falseCase);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitConditionalExpr(this, context);\n }\n}\nclass NotExpr extends Expression {\n constructor(condition, sourceSpan) {\n super(BOOL_TYPE, sourceSpan);\n this.condition = condition;\n }\n isEquivalent(e) {\n return e instanceof NotExpr && this.condition.isEquivalent(e.condition);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitNotExpr(this, context);\n }\n}\nclass FnParam {\n constructor(name, type = null) {\n this.name = name;\n this.type = type;\n }\n isEquivalent(param) {\n return this.name === param.name;\n }\n}\nclass FunctionExpr extends Expression {\n constructor(params, statements, type, sourceSpan, name) {\n super(type, sourceSpan);\n this.params = params;\n this.statements = statements;\n this.name = name;\n }\n isEquivalent(e) {\n return e instanceof FunctionExpr && areAllEquivalent(this.params, e.params) &&\n areAllEquivalent(this.statements, e.statements);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitFunctionExpr(this, context);\n }\n toDeclStmt(name, modifiers) {\n return new DeclareFunctionStmt(name, this.params, this.statements, this.type, modifiers, this.sourceSpan);\n }\n}\nclass UnaryOperatorExpr extends Expression {\n constructor(operator, expr, type, sourceSpan, parens = true) {\n super(type || NUMBER_TYPE, sourceSpan);\n this.operator = operator;\n this.expr = expr;\n this.parens = parens;\n }\n isEquivalent(e) {\n return e instanceof UnaryOperatorExpr && this.operator === e.operator &&\n this.expr.isEquivalent(e.expr);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitUnaryOperatorExpr(this, context);\n }\n}\nclass BinaryOperatorExpr extends Expression {\n constructor(operator, lhs, rhs, type, sourceSpan, parens = true) {\n super(type || lhs.type, sourceSpan);\n this.operator = operator;\n this.rhs = rhs;\n this.parens = parens;\n this.lhs = lhs;\n }\n isEquivalent(e) {\n return e instanceof BinaryOperatorExpr && this.operator === e.operator &&\n this.lhs.isEquivalent(e.lhs) && this.rhs.isEquivalent(e.rhs);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitBinaryOperatorExpr(this, context);\n }\n}\nclass ReadPropExpr extends Expression {\n constructor(receiver, name, type, sourceSpan) {\n super(type, sourceSpan);\n this.receiver = receiver;\n this.name = name;\n }\n isEquivalent(e) {\n return e instanceof ReadPropExpr && this.receiver.isEquivalent(e.receiver) &&\n this.name === e.name;\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitReadPropExpr(this, context);\n }\n set(value) {\n return new WritePropExpr(this.receiver, this.name, value, null, this.sourceSpan);\n }\n}\nclass ReadKeyExpr extends Expression {\n constructor(receiver, index, type, sourceSpan) {\n super(type, sourceSpan);\n this.receiver = receiver;\n this.index = index;\n }\n isEquivalent(e) {\n return e instanceof ReadKeyExpr && this.receiver.isEquivalent(e.receiver) &&\n this.index.isEquivalent(e.index);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitReadKeyExpr(this, context);\n }\n set(value) {\n return new WriteKeyExpr(this.receiver, this.index, value, null, this.sourceSpan);\n }\n}\nclass LiteralArrayExpr extends Expression {\n constructor(entries, type, sourceSpan) {\n super(type, sourceSpan);\n this.entries = entries;\n }\n isConstant() {\n return this.entries.every(e => e.isConstant());\n }\n isEquivalent(e) {\n return e instanceof LiteralArrayExpr && areAllEquivalent(this.entries, e.entries);\n }\n visitExpression(visitor, context) {\n return visitor.visitLiteralArrayExpr(this, context);\n }\n}\nclass LiteralMapEntry {\n constructor(key, value, quoted) {\n this.key = key;\n this.value = value;\n this.quoted = quoted;\n }\n isEquivalent(e) {\n return this.key === e.key && this.value.isEquivalent(e.value);\n }\n}\nclass LiteralMapExpr extends Expression {\n constructor(entries, type, sourceSpan) {\n super(type, sourceSpan);\n this.entries = entries;\n this.valueType = null;\n if (type) {\n this.valueType = type.valueType;\n }\n }\n isEquivalent(e) {\n return e instanceof LiteralMapExpr && areAllEquivalent(this.entries, e.entries);\n }\n isConstant() {\n return this.entries.every(e => e.value.isConstant());\n }\n visitExpression(visitor, context) {\n return visitor.visitLiteralMapExpr(this, context);\n }\n}\nclass CommaExpr extends Expression {\n constructor(parts, sourceSpan) {\n super(parts[parts.length - 1].type, sourceSpan);\n this.parts = parts;\n }\n isEquivalent(e) {\n return e instanceof CommaExpr && areAllEquivalent(this.parts, e.parts);\n }\n isConstant() {\n return false;\n }\n visitExpression(visitor, context) {\n return visitor.visitCommaExpr(this, context);\n }\n}\nconst NULL_EXPR = new LiteralExpr(null, null, null);\nconst TYPED_NULL_EXPR = new LiteralExpr(null, INFERRED_TYPE, null);\n//// Statements\nvar StmtModifier;\n(function (StmtModifier) {\n StmtModifier[StmtModifier[\"None\"] = 0] = \"None\";\n StmtModifier[StmtModifier[\"Final\"] = 1] = \"Final\";\n StmtModifier[StmtModifier[\"Private\"] = 2] = \"Private\";\n StmtModifier[StmtModifier[\"Exported\"] = 4] = \"Exported\";\n StmtModifier[StmtModifier[\"Static\"] = 8] = \"Static\";\n})(StmtModifier || (StmtModifier = {}));\nclass LeadingComment {\n constructor(text, multiline, trailingNewline) {\n this.text = text;\n this.multiline = multiline;\n this.trailingNewline = trailingNewline;\n }\n toString() {\n return this.multiline ? ` ${this.text} ` : this.text;\n }\n}\nclass JSDocComment extends LeadingComment {\n constructor(tags) {\n super('', /* multiline */ true, /* trailingNewline */ true);\n this.tags = tags;\n }\n toString() {\n return serializeTags(this.tags);\n }\n}\nclass Statement {\n constructor(modifiers = StmtModifier.None, sourceSpan = null, leadingComments) {\n this.modifiers = modifiers;\n this.sourceSpan = sourceSpan;\n this.leadingComments = leadingComments;\n }\n hasModifier(modifier) {\n return (this.modifiers & modifier) !== 0;\n }\n addLeadingComment(leadingComment) {\n var _a;\n this.leadingComments = (_a = this.leadingComments) !== null && _a !== void 0 ? _a : [];\n this.leadingComments.push(leadingComment);\n }\n}\nclass DeclareVarStmt extends Statement {\n constructor(name, value, type, modifiers, sourceSpan, leadingComments) {\n super(modifiers, sourceSpan, leadingComments);\n this.name = name;\n this.value = value;\n this.type = type || (value && value.type) || null;\n }\n isEquivalent(stmt) {\n return stmt instanceof DeclareVarStmt && this.name === stmt.name &&\n (this.value ? !!stmt.value && this.value.isEquivalent(stmt.value) : !stmt.value);\n }\n visitStatement(visitor, context) {\n return visitor.visitDeclareVarStmt(this, context);\n }\n}\nclass DeclareFunctionStmt extends Statement {\n constructor(name, params, statements, type, modifiers, sourceSpan, leadingComments) {\n super(modifiers, sourceSpan, leadingComments);\n this.name = name;\n this.params = params;\n this.statements = statements;\n this.type = type || null;\n }\n isEquivalent(stmt) {\n return stmt instanceof DeclareFunctionStmt && areAllEquivalent(this.params, stmt.params) &&\n areAllEquivalent(this.statements, stmt.statements);\n }\n visitStatement(visitor, context) {\n return visitor.visitDeclareFunctionStmt(this, context);\n }\n}\nclass ExpressionStatement extends Statement {\n constructor(expr, sourceSpan, leadingComments) {\n super(StmtModifier.None, sourceSpan, leadingComments);\n this.expr = expr;\n }\n isEquivalent(stmt) {\n return stmt instanceof ExpressionStatement && this.expr.isEquivalent(stmt.expr);\n }\n visitStatement(visitor, context) {\n return visitor.visitExpressionStmt(this, context);\n }\n}\nclass ReturnStatement extends Statement {\n constructor(value, sourceSpan = null, leadingComments) {\n super(StmtModifier.None, sourceSpan, leadingComments);\n this.value = value;\n }\n isEquivalent(stmt) {\n return stmt instanceof ReturnStatement && this.value.isEquivalent(stmt.value);\n }\n visitStatement(visitor, context) {\n return visitor.visitReturnStmt(this, context);\n }\n}\nclass IfStmt extends Statement {\n constructor(condition, trueCase, falseCase = [], sourceSpan, leadingComments) {\n super(StmtModifier.None, sourceSpan, leadingComments);\n this.condition = condition;\n this.trueCase = trueCase;\n this.falseCase = falseCase;\n }\n isEquivalent(stmt) {\n return stmt instanceof IfStmt && this.condition.isEquivalent(stmt.condition) &&\n areAllEquivalent(this.trueCase, stmt.trueCase) &&\n areAllEquivalent(this.falseCase, stmt.falseCase);\n }\n visitStatement(visitor, context) {\n return visitor.visitIfStmt(this, context);\n }\n}\nclass RecursiveAstVisitor$1 {\n visitType(ast, context) {\n return ast;\n }\n visitExpression(ast, context) {\n if (ast.type) {\n ast.type.visitType(this, context);\n }\n return ast;\n }\n visitBuiltinType(type, context) {\n return this.visitType(type, context);\n }\n visitExpressionType(type, context) {\n type.value.visitExpression(this, context);\n if (type.typeParams !== null) {\n type.typeParams.forEach(param => this.visitType(param, context));\n }\n return this.visitType(type, context);\n }\n visitArrayType(type, context) {\n return this.visitType(type, context);\n }\n visitMapType(type, context) {\n return this.visitType(type, context);\n }\n visitWrappedNodeExpr(ast, context) {\n return ast;\n }\n visitTypeofExpr(ast, context) {\n return this.visitExpression(ast, context);\n }\n visitReadVarExpr(ast, context) {\n return this.visitExpression(ast, context);\n }\n visitWriteVarExpr(ast, context) {\n ast.value.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitWriteKeyExpr(ast, context) {\n ast.receiver.visitExpression(this, context);\n ast.index.visitExpression(this, context);\n ast.value.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitWritePropExpr(ast, context) {\n ast.receiver.visitExpression(this, context);\n ast.value.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitInvokeFunctionExpr(ast, context) {\n ast.fn.visitExpression(this, context);\n this.visitAllExpressions(ast.args, context);\n return this.visitExpression(ast, context);\n }\n visitTaggedTemplateExpr(ast, context) {\n ast.tag.visitExpression(this, context);\n this.visitAllExpressions(ast.template.expressions, context);\n return this.visitExpression(ast, context);\n }\n visitInstantiateExpr(ast, context) {\n ast.classExpr.visitExpression(this, context);\n this.visitAllExpressions(ast.args, context);\n return this.visitExpression(ast, context);\n }\n visitLiteralExpr(ast, context) {\n return this.visitExpression(ast, context);\n }\n visitLocalizedString(ast, context) {\n return this.visitExpression(ast, context);\n }\n visitExternalExpr(ast, context) {\n if (ast.typeParams) {\n ast.typeParams.forEach(type => type.visitType(this, context));\n }\n return this.visitExpression(ast, context);\n }\n visitConditionalExpr(ast, context) {\n ast.condition.visitExpression(this, context);\n ast.trueCase.visitExpression(this, context);\n ast.falseCase.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitNotExpr(ast, context) {\n ast.condition.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitFunctionExpr(ast, context) {\n this.visitAllStatements(ast.statements, context);\n return this.visitExpression(ast, context);\n }\n visitUnaryOperatorExpr(ast, context) {\n ast.expr.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitBinaryOperatorExpr(ast, context) {\n ast.lhs.visitExpression(this, context);\n ast.rhs.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitReadPropExpr(ast, context) {\n ast.receiver.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitReadKeyExpr(ast, context) {\n ast.receiver.visitExpression(this, context);\n ast.index.visitExpression(this, context);\n return this.visitExpression(ast, context);\n }\n visitLiteralArrayExpr(ast, context) {\n this.visitAllExpressions(ast.entries, context);\n return this.visitExpression(ast, context);\n }\n visitLiteralMapExpr(ast, context) {\n ast.entries.forEach((entry) => entry.value.visitExpression(this, context));\n return this.visitExpression(ast, context);\n }\n visitCommaExpr(ast, context) {\n this.visitAllExpressions(ast.parts, context);\n return this.visitExpression(ast, context);\n }\n visitAllExpressions(exprs, context) {\n exprs.forEach(expr => expr.visitExpression(this, context));\n }\n visitDeclareVarStmt(stmt, context) {\n if (stmt.value) {\n stmt.value.visitExpression(this, context);\n }\n if (stmt.type) {\n stmt.type.visitType(this, context);\n }\n return stmt;\n }\n visitDeclareFunctionStmt(stmt, context) {\n this.visitAllStatements(stmt.statements, context);\n if (stmt.type) {\n stmt.type.visitType(this, context);\n }\n return stmt;\n }\n visitExpressionStmt(stmt, context) {\n stmt.expr.visitExpression(this, context);\n return stmt;\n }\n visitReturnStmt(stmt, context) {\n stmt.value.visitExpression(this, context);\n return stmt;\n }\n visitIfStmt(stmt, context) {\n stmt.condition.visitExpression(this, context);\n this.visitAllStatements(stmt.trueCase, context);\n this.visitAllStatements(stmt.falseCase, context);\n return stmt;\n }\n visitAllStatements(stmts, context) {\n stmts.forEach(stmt => stmt.visitStatement(this, context));\n }\n}\nfunction leadingComment(text, multiline = false, trailingNewline = true) {\n return new LeadingComment(text, multiline, trailingNewline);\n}\nfunction jsDocComment(tags = []) {\n return new JSDocComment(tags);\n}\nfunction variable(name, type, sourceSpan) {\n return new ReadVarExpr(name, type, sourceSpan);\n}\nfunction importExpr(id, typeParams = null, sourceSpan) {\n return new ExternalExpr(id, null, typeParams, sourceSpan);\n}\nfunction importType(id, typeParams, typeModifiers) {\n return id != null ? expressionType(importExpr(id, typeParams, null), typeModifiers) : null;\n}\nfunction expressionType(expr, typeModifiers, typeParams) {\n return new ExpressionType(expr, typeModifiers, typeParams);\n}\nfunction typeofExpr(expr) {\n return new TypeofExpr(expr);\n}\nfunction literalArr(values, type, sourceSpan) {\n return new LiteralArrayExpr(values, type, sourceSpan);\n}\nfunction literalMap(values, type = null) {\n return new LiteralMapExpr(values.map(e => new LiteralMapEntry(e.key, e.value, e.quoted)), type, null);\n}\nfunction unary(operator, expr, type, sourceSpan) {\n return new UnaryOperatorExpr(operator, expr, type, sourceSpan);\n}\nfunction not(expr, sourceSpan) {\n return new NotExpr(expr, sourceSpan);\n}\nfunction fn(params, body, type, sourceSpan, name) {\n return new FunctionExpr(params, body, type, sourceSpan, name);\n}\nfunction ifStmt(condition, thenClause, elseClause, sourceSpan, leadingComments) {\n return new IfStmt(condition, thenClause, elseClause, sourceSpan, leadingComments);\n}\nfunction taggedTemplate(tag, template, type, sourceSpan) {\n return new TaggedTemplateExpr(tag, template, type, sourceSpan);\n}\nfunction literal(value, type, sourceSpan) {\n return new LiteralExpr(value, type, sourceSpan);\n}\nfunction localizedString(metaBlock, messageParts, placeholderNames, expressions, sourceSpan) {\n return new LocalizedString(metaBlock, messageParts, placeholderNames, expressions, sourceSpan);\n}\nfunction isNull(exp) {\n return exp instanceof LiteralExpr && exp.value === null;\n}\n/*\n * Serializes a `Tag` into a string.\n * Returns a string like \" @foo {bar} baz\" (note the leading whitespace before `@foo`).\n */\nfunction tagToString(tag) {\n let out = '';\n if (tag.tagName) {\n out += ` @${tag.tagName}`;\n }\n if (tag.text) {\n if (tag.text.match(/\\/\\*|\\*\\//)) {\n throw new Error('JSDoc text cannot contain \"/*\" and \"*/\"');\n }\n out += ' ' + tag.text.replace(/@/g, '\\\\@');\n }\n return out;\n}\nfunction serializeTags(tags) {\n if (tags.length === 0)\n return '';\n if (tags.length === 1 && tags[0].tagName && !tags[0].text) {\n // The JSDOC comment is a single simple tag: e.g `/** @tagname */`.\n return `*${tagToString(tags[0])} `;\n }\n let out = '*\\n';\n for (const tag of tags) {\n out += ' *';\n // If the tagToString is multi-line, insert \" * \" prefixes on lines.\n out += tagToString(tag).replace(/\\n/g, '\\n * ');\n out += '\\n';\n }\n out += ' ';\n return out;\n}\n\nvar output_ast = /*#__PURE__*/Object.freeze({\n __proto__: null,\n get TypeModifier () { return TypeModifier; },\n Type: Type,\n get BuiltinTypeName () { return BuiltinTypeName; },\n BuiltinType: BuiltinType,\n ExpressionType: ExpressionType,\n ArrayType: ArrayType,\n MapType: MapType,\n DYNAMIC_TYPE: DYNAMIC_TYPE,\n INFERRED_TYPE: INFERRED_TYPE,\n BOOL_TYPE: BOOL_TYPE,\n INT_TYPE: INT_TYPE,\n NUMBER_TYPE: NUMBER_TYPE,\n STRING_TYPE: STRING_TYPE,\n FUNCTION_TYPE: FUNCTION_TYPE,\n NONE_TYPE: NONE_TYPE,\n get UnaryOperator () { return UnaryOperator; },\n get BinaryOperator () { return BinaryOperator; },\n nullSafeIsEquivalent: nullSafeIsEquivalent,\n areAllEquivalent: areAllEquivalent,\n Expression: Expression,\n ReadVarExpr: ReadVarExpr,\n TypeofExpr: TypeofExpr,\n WrappedNodeExpr: WrappedNodeExpr,\n WriteVarExpr: WriteVarExpr,\n WriteKeyExpr: WriteKeyExpr,\n WritePropExpr: WritePropExpr,\n InvokeFunctionExpr: InvokeFunctionExpr,\n TaggedTemplateExpr: TaggedTemplateExpr,\n InstantiateExpr: InstantiateExpr,\n LiteralExpr: LiteralExpr,\n TemplateLiteral: TemplateLiteral,\n TemplateLiteralElement: TemplateLiteralElement,\n LiteralPiece: LiteralPiece,\n PlaceholderPiece: PlaceholderPiece,\n LocalizedString: LocalizedString,\n ExternalExpr: ExternalExpr,\n ExternalReference: ExternalReference,\n ConditionalExpr: ConditionalExpr,\n NotExpr: NotExpr,\n FnParam: FnParam,\n FunctionExpr: FunctionExpr,\n UnaryOperatorExpr: UnaryOperatorExpr,\n BinaryOperatorExpr: BinaryOperatorExpr,\n ReadPropExpr: ReadPropExpr,\n ReadKeyExpr: ReadKeyExpr,\n LiteralArrayExpr: LiteralArrayExpr,\n LiteralMapEntry: LiteralMapEntry,\n LiteralMapExpr: LiteralMapExpr,\n CommaExpr: CommaExpr,\n NULL_EXPR: NULL_EXPR,\n TYPED_NULL_EXPR: TYPED_NULL_EXPR,\n get StmtModifier () { return StmtModifier; },\n LeadingComment: LeadingComment,\n JSDocComment: JSDocComment,\n Statement: Statement,\n DeclareVarStmt: DeclareVarStmt,\n DeclareFunctionStmt: DeclareFunctionStmt,\n ExpressionStatement: ExpressionStatement,\n ReturnStatement: ReturnStatement,\n IfStmt: IfStmt,\n RecursiveAstVisitor: RecursiveAstVisitor$1,\n leadingComment: leadingComment,\n jsDocComment: jsDocComment,\n variable: variable,\n importExpr: importExpr,\n importType: importType,\n expressionType: expressionType,\n typeofExpr: typeofExpr,\n literalArr: literalArr,\n literalMap: literalMap,\n unary: unary,\n not: not,\n fn: fn,\n ifStmt: ifStmt,\n taggedTemplate: taggedTemplate,\n literal: literal,\n localizedString: localizedString,\n isNull: isNull\n});\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst CONSTANT_PREFIX = '_c';\n/**\n * `ConstantPool` tries to reuse literal factories when two or more literals are identical.\n * We determine whether literals are identical by creating a key out of their AST using the\n * `KeyVisitor`. This constant is used to replace dynamic expressions which can't be safely\n * converted into a key. E.g. given an expression `{foo: bar()}`, since we don't know what\n * the result of `bar` will be, we create a key that looks like `{foo: }`. Note\n * that we use a variable, rather than something like `null` in order to avoid collisions.\n */\nconst UNKNOWN_VALUE_KEY = variable('');\n/**\n * Context to use when producing a key.\n *\n * This ensures we see the constant not the reference variable when producing\n * a key.\n */\nconst KEY_CONTEXT = {};\n/**\n * Generally all primitive values are excluded from the `ConstantPool`, but there is an exclusion\n * for strings that reach a certain length threshold. This constant defines the length threshold for\n * strings.\n */\nconst POOL_INCLUSION_LENGTH_THRESHOLD_FOR_STRINGS = 50;\n/**\n * A node that is a place-holder that allows the node to be replaced when the actual\n * node is known.\n *\n * This allows the constant pool to change an expression from a direct reference to\n * a constant to a shared constant. It returns a fix-up node that is later allowed to\n * change the referenced expression.\n */\nclass FixupExpression extends Expression {\n constructor(resolved) {\n super(resolved.type);\n this.resolved = resolved;\n this.original = resolved;\n }\n visitExpression(visitor, context) {\n if (context === KEY_CONTEXT) {\n // When producing a key we want to traverse the constant not the\n // variable used to refer to it.\n return this.original.visitExpression(visitor, context);\n }\n else {\n return this.resolved.visitExpression(visitor, context);\n }\n }\n isEquivalent(e) {\n return e instanceof FixupExpression && this.resolved.isEquivalent(e.resolved);\n }\n isConstant() {\n return true;\n }\n fixup(expression) {\n this.resolved = expression;\n this.shared = true;\n }\n}\n/**\n * A constant pool allows a code emitter to share constant in an output context.\n *\n * The constant pool also supports sharing access to ivy definitions references.\n */\nclass ConstantPool {\n constructor(isClosureCompilerEnabled = false) {\n this.isClosureCompilerEnabled = isClosureCompilerEnabled;\n this.statements = [];\n this.literals = new Map();\n this.literalFactories = new Map();\n this.nextNameIndex = 0;\n }\n getConstLiteral(literal, forceShared) {\n if ((literal instanceof LiteralExpr && !isLongStringLiteral(literal)) ||\n literal instanceof FixupExpression) {\n // Do no put simple literals into the constant pool or try to produce a constant for a\n // reference to a constant.\n return literal;\n }\n const key = this.keyOf(literal);\n let fixup = this.literals.get(key);\n let newValue = false;\n if (!fixup) {\n fixup = new FixupExpression(literal);\n this.literals.set(key, fixup);\n newValue = true;\n }\n if ((!newValue && !fixup.shared) || (newValue && forceShared)) {\n // Replace the expression with a variable\n const name = this.freshName();\n let definition;\n let usage;\n if (this.isClosureCompilerEnabled && isLongStringLiteral(literal)) {\n // For string literals, Closure will **always** inline the string at\n // **all** usages, duplicating it each time. For large strings, this\n // unnecessarily bloats bundle size. To work around this restriction, we\n // wrap the string in a function, and call that function for each usage.\n // This tricks Closure into using inline logic for functions instead of\n // string literals. Function calls are only inlined if the body is small\n // enough to be worth it. By doing this, very large strings will be\n // shared across multiple usages, rather than duplicating the string at\n // each usage site.\n //\n // const myStr = function() { return \"very very very long string\"; };\n // const usage1 = myStr();\n // const usage2 = myStr();\n definition = variable(name).set(new FunctionExpr([], // Params.\n [\n // Statements.\n new ReturnStatement(literal),\n ]));\n usage = variable(name).callFn([]);\n }\n else {\n // Just declare and use the variable directly, without a function call\n // indirection. This saves a few bytes and avoids an unnecessary call.\n definition = variable(name).set(literal);\n usage = variable(name);\n }\n this.statements.push(definition.toDeclStmt(INFERRED_TYPE, StmtModifier.Final));\n fixup.fixup(usage);\n }\n return fixup;\n }\n getLiteralFactory(literal) {\n // Create a pure function that builds an array of a mix of constant and variable expressions\n if (literal instanceof LiteralArrayExpr) {\n const argumentsForKey = literal.entries.map(e => e.isConstant() ? e : UNKNOWN_VALUE_KEY);\n const key = this.keyOf(literalArr(argumentsForKey));\n return this._getLiteralFactory(key, literal.entries, entries => literalArr(entries));\n }\n else {\n const expressionForKey = literalMap(literal.entries.map(e => ({\n key: e.key,\n value: e.value.isConstant() ? e.value : UNKNOWN_VALUE_KEY,\n quoted: e.quoted\n })));\n const key = this.keyOf(expressionForKey);\n return this._getLiteralFactory(key, literal.entries.map(e => e.value), entries => literalMap(entries.map((value, index) => ({\n key: literal.entries[index].key,\n value,\n quoted: literal.entries[index].quoted\n }))));\n }\n }\n _getLiteralFactory(key, values, resultMap) {\n let literalFactory = this.literalFactories.get(key);\n const literalFactoryArguments = values.filter((e => !e.isConstant()));\n if (!literalFactory) {\n const resultExpressions = values.map((e, index) => e.isConstant() ? this.getConstLiteral(e, true) : variable(`a${index}`));\n const parameters = resultExpressions.filter(isVariable).map(e => new FnParam(e.name, DYNAMIC_TYPE));\n const pureFunctionDeclaration = fn(parameters, [new ReturnStatement(resultMap(resultExpressions))], INFERRED_TYPE);\n const name = this.freshName();\n this.statements.push(variable(name)\n .set(pureFunctionDeclaration)\n .toDeclStmt(INFERRED_TYPE, StmtModifier.Final));\n literalFactory = variable(name);\n this.literalFactories.set(key, literalFactory);\n }\n return { literalFactory, literalFactoryArguments };\n }\n /**\n * Produce a unique name.\n *\n * The name might be unique among different prefixes if any of the prefixes end in\n * a digit so the prefix should be a constant string (not based on user input) and\n * must not end in a digit.\n */\n uniqueName(prefix) {\n return `${prefix}${this.nextNameIndex++}`;\n }\n freshName() {\n return this.uniqueName(CONSTANT_PREFIX);\n }\n keyOf(expression) {\n return expression.visitExpression(new KeyVisitor(), KEY_CONTEXT);\n }\n}\n/**\n * Visitor used to determine if 2 expressions are equivalent and can be shared in the\n * `ConstantPool`.\n *\n * When the id (string) generated by the visitor is equal, expressions are considered equivalent.\n */\nclass KeyVisitor {\n constructor() {\n this.visitWrappedNodeExpr = invalid$1;\n this.visitWriteVarExpr = invalid$1;\n this.visitWriteKeyExpr = invalid$1;\n this.visitWritePropExpr = invalid$1;\n this.visitInvokeFunctionExpr = invalid$1;\n this.visitTaggedTemplateExpr = invalid$1;\n this.visitInstantiateExpr = invalid$1;\n this.visitConditionalExpr = invalid$1;\n this.visitNotExpr = invalid$1;\n this.visitAssertNotNullExpr = invalid$1;\n this.visitCastExpr = invalid$1;\n this.visitFunctionExpr = invalid$1;\n this.visitUnaryOperatorExpr = invalid$1;\n this.visitBinaryOperatorExpr = invalid$1;\n this.visitReadPropExpr = invalid$1;\n this.visitReadKeyExpr = invalid$1;\n this.visitCommaExpr = invalid$1;\n this.visitLocalizedString = invalid$1;\n }\n visitLiteralExpr(ast) {\n return `${typeof ast.value === 'string' ? '\"' + ast.value + '\"' : ast.value}`;\n }\n visitLiteralArrayExpr(ast, context) {\n return `[${ast.entries.map(entry => entry.visitExpression(this, context)).join(',')}]`;\n }\n visitLiteralMapExpr(ast, context) {\n const mapKey = (entry) => {\n const quote = entry.quoted ? '\"' : '';\n return `${quote}${entry.key}${quote}`;\n };\n const mapEntry = (entry) => `${mapKey(entry)}:${entry.value.visitExpression(this, context)}`;\n return `{${ast.entries.map(mapEntry).join(',')}`;\n }\n visitExternalExpr(ast) {\n return ast.value.moduleName ? `EX:${ast.value.moduleName}:${ast.value.name}` :\n `EX:${ast.value.runtime.name}`;\n }\n visitReadVarExpr(node) {\n return `VAR:${node.name}`;\n }\n visitTypeofExpr(node, context) {\n return `TYPEOF:${node.expr.visitExpression(this, context)}`;\n }\n}\nfunction invalid$1(arg) {\n throw new Error(`Invalid state: Visitor ${this.constructor.name} doesn't handle ${arg.constructor.name}`);\n}\nfunction isVariable(e) {\n return e instanceof ReadVarExpr;\n}\nfunction isLongStringLiteral(expr) {\n return expr instanceof LiteralExpr && typeof expr.value === 'string' &&\n expr.value.length >= POOL_INCLUSION_LENGTH_THRESHOLD_FOR_STRINGS;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst CORE = '@angular/core';\nclass Identifiers {\n}\n/* Methods */\nIdentifiers.NEW_METHOD = 'factory';\nIdentifiers.TRANSFORM_METHOD = 'transform';\nIdentifiers.PATCH_DEPS = 'patchedDeps';\nIdentifiers.core = { name: null, moduleName: CORE };\n/* Instructions */\nIdentifiers.namespaceHTML = { name: 'ɵɵnamespaceHTML', moduleName: CORE };\nIdentifiers.namespaceMathML = { name: 'ɵɵnamespaceMathML', moduleName: CORE };\nIdentifiers.namespaceSVG = { name: 'ɵɵnamespaceSVG', moduleName: CORE };\nIdentifiers.element = { name: 'ɵɵelement', moduleName: CORE };\nIdentifiers.elementStart = { name: 'ɵɵelementStart', moduleName: CORE };\nIdentifiers.elementEnd = { name: 'ɵɵelementEnd', moduleName: CORE };\nIdentifiers.advance = { name: 'ɵɵadvance', moduleName: CORE };\nIdentifiers.syntheticHostProperty = { name: 'ɵɵsyntheticHostProperty', moduleName: CORE };\nIdentifiers.syntheticHostListener = { name: 'ɵɵsyntheticHostListener', moduleName: CORE };\nIdentifiers.attribute = { name: 'ɵɵattribute', moduleName: CORE };\nIdentifiers.attributeInterpolate1 = { name: 'ɵɵattributeInterpolate1', moduleName: CORE };\nIdentifiers.attributeInterpolate2 = { name: 'ɵɵattributeInterpolate2', moduleName: CORE };\nIdentifiers.attributeInterpolate3 = { name: 'ɵɵattributeInterpolate3', moduleName: CORE };\nIdentifiers.attributeInterpolate4 = { name: 'ɵɵattributeInterpolate4', moduleName: CORE };\nIdentifiers.attributeInterpolate5 = { name: 'ɵɵattributeInterpolate5', moduleName: CORE };\nIdentifiers.attributeInterpolate6 = { name: 'ɵɵattributeInterpolate6', moduleName: CORE };\nIdentifiers.attributeInterpolate7 = { name: 'ɵɵattributeInterpolate7', moduleName: CORE };\nIdentifiers.attributeInterpolate8 = { name: 'ɵɵattributeInterpolate8', moduleName: CORE };\nIdentifiers.attributeInterpolateV = { name: 'ɵɵattributeInterpolateV', moduleName: CORE };\nIdentifiers.classProp = { name: 'ɵɵclassProp', moduleName: CORE };\nIdentifiers.elementContainerStart = { name: 'ɵɵelementContainerStart', moduleName: CORE };\nIdentifiers.elementContainerEnd = { name: 'ɵɵelementContainerEnd', moduleName: CORE };\nIdentifiers.elementContainer = { name: 'ɵɵelementContainer', moduleName: CORE };\nIdentifiers.styleMap = { name: 'ɵɵstyleMap', moduleName: CORE };\nIdentifiers.styleMapInterpolate1 = { name: 'ɵɵstyleMapInterpolate1', moduleName: CORE };\nIdentifiers.styleMapInterpolate2 = { name: 'ɵɵstyleMapInterpolate2', moduleName: CORE };\nIdentifiers.styleMapInterpolate3 = { name: 'ɵɵstyleMapInterpolate3', moduleName: CORE };\nIdentifiers.styleMapInterpolate4 = { name: 'ɵɵstyleMapInterpolate4', moduleName: CORE };\nIdentifiers.styleMapInterpolate5 = { name: 'ɵɵstyleMapInterpolate5', moduleName: CORE };\nIdentifiers.styleMapInterpolate6 = { name: 'ɵɵstyleMapInterpolate6', moduleName: CORE };\nIdentifiers.styleMapInterpolate7 = { name: 'ɵɵstyleMapInterpolate7', moduleName: CORE };\nIdentifiers.styleMapInterpolate8 = { name: 'ɵɵstyleMapInterpolate8', moduleName: CORE };\nIdentifiers.styleMapInterpolateV = { name: 'ɵɵstyleMapInterpolateV', moduleName: CORE };\nIdentifiers.classMap = { name: 'ɵɵclassMap', moduleName: CORE };\nIdentifiers.classMapInterpolate1 = { name: 'ɵɵclassMapInterpolate1', moduleName: CORE };\nIdentifiers.classMapInterpolate2 = { name: 'ɵɵclassMapInterpolate2', moduleName: CORE };\nIdentifiers.classMapInterpolate3 = { name: 'ɵɵclassMapInterpolate3', moduleName: CORE };\nIdentifiers.classMapInterpolate4 = { name: 'ɵɵclassMapInterpolate4', moduleName: CORE };\nIdentifiers.classMapInterpolate5 = { name: 'ɵɵclassMapInterpolate5', moduleName: CORE };\nIdentifiers.classMapInterpolate6 = { name: 'ɵɵclassMapInterpolate6', moduleName: CORE };\nIdentifiers.classMapInterpolate7 = { name: 'ɵɵclassMapInterpolate7', moduleName: CORE };\nIdentifiers.classMapInterpolate8 = { name: 'ɵɵclassMapInterpolate8', moduleName: CORE };\nIdentifiers.classMapInterpolateV = { name: 'ɵɵclassMapInterpolateV', moduleName: CORE };\nIdentifiers.styleProp = { name: 'ɵɵstyleProp', moduleName: CORE };\nIdentifiers.stylePropInterpolate1 = { name: 'ɵɵstylePropInterpolate1', moduleName: CORE };\nIdentifiers.stylePropInterpolate2 = { name: 'ɵɵstylePropInterpolate2', moduleName: CORE };\nIdentifiers.stylePropInterpolate3 = { name: 'ɵɵstylePropInterpolate3', moduleName: CORE };\nIdentifiers.stylePropInterpolate4 = { name: 'ɵɵstylePropInterpolate4', moduleName: CORE };\nIdentifiers.stylePropInterpolate5 = { name: 'ɵɵstylePropInterpolate5', moduleName: CORE };\nIdentifiers.stylePropInterpolate6 = { name: 'ɵɵstylePropInterpolate6', moduleName: CORE };\nIdentifiers.stylePropInterpolate7 = { name: 'ɵɵstylePropInterpolate7', moduleName: CORE };\nIdentifiers.stylePropInterpolate8 = { name: 'ɵɵstylePropInterpolate8', moduleName: CORE };\nIdentifiers.stylePropInterpolateV = { name: 'ɵɵstylePropInterpolateV', moduleName: CORE };\nIdentifiers.nextContext = { name: 'ɵɵnextContext', moduleName: CORE };\nIdentifiers.resetView = { name: 'ɵɵresetView', moduleName: CORE };\nIdentifiers.templateCreate = { name: 'ɵɵtemplate', moduleName: CORE };\nIdentifiers.text = { name: 'ɵɵtext', moduleName: CORE };\nIdentifiers.enableBindings = { name: 'ɵɵenableBindings', moduleName: CORE };\nIdentifiers.disableBindings = { name: 'ɵɵdisableBindings', moduleName: CORE };\nIdentifiers.getCurrentView = { name: 'ɵɵgetCurrentView', moduleName: CORE };\nIdentifiers.textInterpolate = { name: 'ɵɵtextInterpolate', moduleName: CORE };\nIdentifiers.textInterpolate1 = { name: 'ɵɵtextInterpolate1', moduleName: CORE };\nIdentifiers.textInterpolate2 = { name: 'ɵɵtextInterpolate2', moduleName: CORE };\nIdentifiers.textInterpolate3 = { name: 'ɵɵtextInterpolate3', moduleName: CORE };\nIdentifiers.textInterpolate4 = { name: 'ɵɵtextInterpolate4', moduleName: CORE };\nIdentifiers.textInterpolate5 = { name: 'ɵɵtextInterpolate5', moduleName: CORE };\nIdentifiers.textInterpolate6 = { name: 'ɵɵtextInterpolate6', moduleName: CORE };\nIdentifiers.textInterpolate7 = { name: 'ɵɵtextInterpolate7', moduleName: CORE };\nIdentifiers.textInterpolate8 = { name: 'ɵɵtextInterpolate8', moduleName: CORE };\nIdentifiers.textInterpolateV = { name: 'ɵɵtextInterpolateV', moduleName: CORE };\nIdentifiers.restoreView = { name: 'ɵɵrestoreView', moduleName: CORE };\nIdentifiers.pureFunction0 = { name: 'ɵɵpureFunction0', moduleName: CORE };\nIdentifiers.pureFunction1 = { name: 'ɵɵpureFunction1', moduleName: CORE };\nIdentifiers.pureFunction2 = { name: 'ɵɵpureFunction2', moduleName: CORE };\nIdentifiers.pureFunction3 = { name: 'ɵɵpureFunction3', moduleName: CORE };\nIdentifiers.pureFunction4 = { name: 'ɵɵpureFunction4', moduleName: CORE };\nIdentifiers.pureFunction5 = { name: 'ɵɵpureFunction5', moduleName: CORE };\nIdentifiers.pureFunction6 = { name: 'ɵɵpureFunction6', moduleName: CORE };\nIdentifiers.pureFunction7 = { name: 'ɵɵpureFunction7', moduleName: CORE };\nIdentifiers.pureFunction8 = { name: 'ɵɵpureFunction8', moduleName: CORE };\nIdentifiers.pureFunctionV = { name: 'ɵɵpureFunctionV', moduleName: CORE };\nIdentifiers.pipeBind1 = { name: 'ɵɵpipeBind1', moduleName: CORE };\nIdentifiers.pipeBind2 = { name: 'ɵɵpipeBind2', moduleName: CORE };\nIdentifiers.pipeBind3 = { name: 'ɵɵpipeBind3', moduleName: CORE };\nIdentifiers.pipeBind4 = { name: 'ɵɵpipeBind4', moduleName: CORE };\nIdentifiers.pipeBindV = { name: 'ɵɵpipeBindV', moduleName: CORE };\nIdentifiers.hostProperty = { name: 'ɵɵhostProperty', moduleName: CORE };\nIdentifiers.property = { name: 'ɵɵproperty', moduleName: CORE };\nIdentifiers.propertyInterpolate = { name: 'ɵɵpropertyInterpolate', moduleName: CORE };\nIdentifiers.propertyInterpolate1 = { name: 'ɵɵpropertyInterpolate1', moduleName: CORE };\nIdentifiers.propertyInterpolate2 = { name: 'ɵɵpropertyInterpolate2', moduleName: CORE };\nIdentifiers.propertyInterpolate3 = { name: 'ɵɵpropertyInterpolate3', moduleName: CORE };\nIdentifiers.propertyInterpolate4 = { name: 'ɵɵpropertyInterpolate4', moduleName: CORE };\nIdentifiers.propertyInterpolate5 = { name: 'ɵɵpropertyInterpolate5', moduleName: CORE };\nIdentifiers.propertyInterpolate6 = { name: 'ɵɵpropertyInterpolate6', moduleName: CORE };\nIdentifiers.propertyInterpolate7 = { name: 'ɵɵpropertyInterpolate7', moduleName: CORE };\nIdentifiers.propertyInterpolate8 = { name: 'ɵɵpropertyInterpolate8', moduleName: CORE };\nIdentifiers.propertyInterpolateV = { name: 'ɵɵpropertyInterpolateV', moduleName: CORE };\nIdentifiers.i18n = { name: 'ɵɵi18n', moduleName: CORE };\nIdentifiers.i18nAttributes = { name: 'ɵɵi18nAttributes', moduleName: CORE };\nIdentifiers.i18nExp = { name: 'ɵɵi18nExp', moduleName: CORE };\nIdentifiers.i18nStart = { name: 'ɵɵi18nStart', moduleName: CORE };\nIdentifiers.i18nEnd = { name: 'ɵɵi18nEnd', moduleName: CORE };\nIdentifiers.i18nApply = { name: 'ɵɵi18nApply', moduleName: CORE };\nIdentifiers.i18nPostprocess = { name: 'ɵɵi18nPostprocess', moduleName: CORE };\nIdentifiers.pipe = { name: 'ɵɵpipe', moduleName: CORE };\nIdentifiers.projection = { name: 'ɵɵprojection', moduleName: CORE };\nIdentifiers.projectionDef = { name: 'ɵɵprojectionDef', moduleName: CORE };\nIdentifiers.reference = { name: 'ɵɵreference', moduleName: CORE };\nIdentifiers.inject = { name: 'ɵɵinject', moduleName: CORE };\nIdentifiers.injectAttribute = { name: 'ɵɵinjectAttribute', moduleName: CORE };\nIdentifiers.directiveInject = { name: 'ɵɵdirectiveInject', moduleName: CORE };\nIdentifiers.invalidFactory = { name: 'ɵɵinvalidFactory', moduleName: CORE };\nIdentifiers.invalidFactoryDep = { name: 'ɵɵinvalidFactoryDep', moduleName: CORE };\nIdentifiers.templateRefExtractor = { name: 'ɵɵtemplateRefExtractor', moduleName: CORE };\nIdentifiers.forwardRef = { name: 'forwardRef', moduleName: CORE };\nIdentifiers.resolveForwardRef = { name: 'resolveForwardRef', moduleName: CORE };\nIdentifiers.ɵɵdefineInjectable = { name: 'ɵɵdefineInjectable', moduleName: CORE };\nIdentifiers.declareInjectable = { name: 'ɵɵngDeclareInjectable', moduleName: CORE };\nIdentifiers.InjectableDeclaration = { name: 'ɵɵInjectableDeclaration', moduleName: CORE };\nIdentifiers.resolveWindow = { name: 'ɵɵresolveWindow', moduleName: CORE };\nIdentifiers.resolveDocument = { name: 'ɵɵresolveDocument', moduleName: CORE };\nIdentifiers.resolveBody = { name: 'ɵɵresolveBody', moduleName: CORE };\nIdentifiers.defineComponent = { name: 'ɵɵdefineComponent', moduleName: CORE };\nIdentifiers.declareComponent = { name: 'ɵɵngDeclareComponent', moduleName: CORE };\nIdentifiers.setComponentScope = { name: 'ɵɵsetComponentScope', moduleName: CORE };\nIdentifiers.ChangeDetectionStrategy = {\n name: 'ChangeDetectionStrategy',\n moduleName: CORE,\n};\nIdentifiers.ViewEncapsulation = {\n name: 'ViewEncapsulation',\n moduleName: CORE,\n};\nIdentifiers.ComponentDeclaration = {\n name: 'ɵɵComponentDeclaration',\n moduleName: CORE,\n};\nIdentifiers.FactoryDeclaration = {\n name: 'ɵɵFactoryDeclaration',\n moduleName: CORE,\n};\nIdentifiers.declareFactory = { name: 'ɵɵngDeclareFactory', moduleName: CORE };\nIdentifiers.FactoryTarget = { name: 'ɵɵFactoryTarget', moduleName: CORE };\nIdentifiers.defineDirective = { name: 'ɵɵdefineDirective', moduleName: CORE };\nIdentifiers.declareDirective = { name: 'ɵɵngDeclareDirective', moduleName: CORE };\nIdentifiers.DirectiveDeclaration = {\n name: 'ɵɵDirectiveDeclaration',\n moduleName: CORE,\n};\nIdentifiers.InjectorDef = { name: 'ɵɵInjectorDef', moduleName: CORE };\nIdentifiers.InjectorDeclaration = { name: 'ɵɵInjectorDeclaration', moduleName: CORE };\nIdentifiers.defineInjector = { name: 'ɵɵdefineInjector', moduleName: CORE };\nIdentifiers.declareInjector = { name: 'ɵɵngDeclareInjector', moduleName: CORE };\nIdentifiers.NgModuleDeclaration = {\n name: 'ɵɵNgModuleDeclaration',\n moduleName: CORE,\n};\nIdentifiers.ModuleWithProviders = {\n name: 'ModuleWithProviders',\n moduleName: CORE,\n};\nIdentifiers.defineNgModule = { name: 'ɵɵdefineNgModule', moduleName: CORE };\nIdentifiers.declareNgModule = { name: 'ɵɵngDeclareNgModule', moduleName: CORE };\nIdentifiers.setNgModuleScope = { name: 'ɵɵsetNgModuleScope', moduleName: CORE };\nIdentifiers.registerNgModuleType = { name: 'ɵɵregisterNgModuleType', moduleName: CORE };\nIdentifiers.PipeDeclaration = { name: 'ɵɵPipeDeclaration', moduleName: CORE };\nIdentifiers.definePipe = { name: 'ɵɵdefinePipe', moduleName: CORE };\nIdentifiers.declarePipe = { name: 'ɵɵngDeclarePipe', moduleName: CORE };\nIdentifiers.declareClassMetadata = { name: 'ɵɵngDeclareClassMetadata', moduleName: CORE };\nIdentifiers.setClassMetadata = { name: 'ɵsetClassMetadata', moduleName: CORE };\nIdentifiers.queryRefresh = { name: 'ɵɵqueryRefresh', moduleName: CORE };\nIdentifiers.viewQuery = { name: 'ɵɵviewQuery', moduleName: CORE };\nIdentifiers.loadQuery = { name: 'ɵɵloadQuery', moduleName: CORE };\nIdentifiers.contentQuery = { name: 'ɵɵcontentQuery', moduleName: CORE };\nIdentifiers.NgOnChangesFeature = { name: 'ɵɵNgOnChangesFeature', moduleName: CORE };\nIdentifiers.InheritDefinitionFeature = { name: 'ɵɵInheritDefinitionFeature', moduleName: CORE };\nIdentifiers.CopyDefinitionFeature = { name: 'ɵɵCopyDefinitionFeature', moduleName: CORE };\nIdentifiers.StandaloneFeature = { name: 'ɵɵStandaloneFeature', moduleName: CORE };\nIdentifiers.ProvidersFeature = { name: 'ɵɵProvidersFeature', moduleName: CORE };\nIdentifiers.listener = { name: 'ɵɵlistener', moduleName: CORE };\nIdentifiers.getInheritedFactory = {\n name: 'ɵɵgetInheritedFactory',\n moduleName: CORE,\n};\n// sanitization-related functions\nIdentifiers.sanitizeHtml = { name: 'ɵɵsanitizeHtml', moduleName: CORE };\nIdentifiers.sanitizeStyle = { name: 'ɵɵsanitizeStyle', moduleName: CORE };\nIdentifiers.sanitizeResourceUrl = { name: 'ɵɵsanitizeResourceUrl', moduleName: CORE };\nIdentifiers.sanitizeScript = { name: 'ɵɵsanitizeScript', moduleName: CORE };\nIdentifiers.sanitizeUrl = { name: 'ɵɵsanitizeUrl', moduleName: CORE };\nIdentifiers.sanitizeUrlOrResourceUrl = { name: 'ɵɵsanitizeUrlOrResourceUrl', moduleName: CORE };\nIdentifiers.trustConstantHtml = { name: 'ɵɵtrustConstantHtml', moduleName: CORE };\nIdentifiers.trustConstantResourceUrl = { name: 'ɵɵtrustConstantResourceUrl', moduleName: CORE };\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit\nconst VERSION$1 = 3;\nconst JS_B64_PREFIX = '# sourceMappingURL=data:application/json;base64,';\nclass SourceMapGenerator {\n constructor(file = null) {\n this.file = file;\n this.sourcesContent = new Map();\n this.lines = [];\n this.lastCol0 = 0;\n this.hasMappings = false;\n }\n // The content is `null` when the content is expected to be loaded using the URL\n addSource(url, content = null) {\n if (!this.sourcesContent.has(url)) {\n this.sourcesContent.set(url, content);\n }\n return this;\n }\n addLine() {\n this.lines.push([]);\n this.lastCol0 = 0;\n return this;\n }\n addMapping(col0, sourceUrl, sourceLine0, sourceCol0) {\n if (!this.currentLine) {\n throw new Error(`A line must be added before mappings can be added`);\n }\n if (sourceUrl != null && !this.sourcesContent.has(sourceUrl)) {\n throw new Error(`Unknown source file \"${sourceUrl}\"`);\n }\n if (col0 == null) {\n throw new Error(`The column in the generated code must be provided`);\n }\n if (col0 < this.lastCol0) {\n throw new Error(`Mapping should be added in output order`);\n }\n if (sourceUrl && (sourceLine0 == null || sourceCol0 == null)) {\n throw new Error(`The source location must be provided when a source url is provided`);\n }\n this.hasMappings = true;\n this.lastCol0 = col0;\n this.currentLine.push({ col0, sourceUrl, sourceLine0, sourceCol0 });\n return this;\n }\n /**\n * @internal strip this from published d.ts files due to\n * https://github.com/microsoft/TypeScript/issues/36216\n */\n get currentLine() {\n return this.lines.slice(-1)[0];\n }\n toJSON() {\n if (!this.hasMappings) {\n return null;\n }\n const sourcesIndex = new Map();\n const sources = [];\n const sourcesContent = [];\n Array.from(this.sourcesContent.keys()).forEach((url, i) => {\n sourcesIndex.set(url, i);\n sources.push(url);\n sourcesContent.push(this.sourcesContent.get(url) || null);\n });\n let mappings = '';\n let lastCol0 = 0;\n let lastSourceIndex = 0;\n let lastSourceLine0 = 0;\n let lastSourceCol0 = 0;\n this.lines.forEach(segments => {\n lastCol0 = 0;\n mappings += segments\n .map(segment => {\n // zero-based starting column of the line in the generated code\n let segAsStr = toBase64VLQ(segment.col0 - lastCol0);\n lastCol0 = segment.col0;\n if (segment.sourceUrl != null) {\n // zero-based index into the “sources” list\n segAsStr +=\n toBase64VLQ(sourcesIndex.get(segment.sourceUrl) - lastSourceIndex);\n lastSourceIndex = sourcesIndex.get(segment.sourceUrl);\n // the zero-based starting line in the original source\n segAsStr += toBase64VLQ(segment.sourceLine0 - lastSourceLine0);\n lastSourceLine0 = segment.sourceLine0;\n // the zero-based starting column in the original source\n segAsStr += toBase64VLQ(segment.sourceCol0 - lastSourceCol0);\n lastSourceCol0 = segment.sourceCol0;\n }\n return segAsStr;\n })\n .join(',');\n mappings += ';';\n });\n mappings = mappings.slice(0, -1);\n return {\n 'file': this.file || '',\n 'version': VERSION$1,\n 'sourceRoot': '',\n 'sources': sources,\n 'sourcesContent': sourcesContent,\n 'mappings': mappings,\n };\n }\n toJsComment() {\n return this.hasMappings ? '//' + JS_B64_PREFIX + toBase64String(JSON.stringify(this, null, 0)) :\n '';\n }\n}\nfunction toBase64String(value) {\n let b64 = '';\n const encoded = utf8Encode(value);\n for (let i = 0; i < encoded.length;) {\n const i1 = encoded[i++];\n const i2 = i < encoded.length ? encoded[i++] : null;\n const i3 = i < encoded.length ? encoded[i++] : null;\n b64 += toBase64Digit(i1 >> 2);\n b64 += toBase64Digit(((i1 & 3) << 4) | (i2 === null ? 0 : i2 >> 4));\n b64 += i2 === null ? '=' : toBase64Digit(((i2 & 15) << 2) | (i3 === null ? 0 : i3 >> 6));\n b64 += i2 === null || i3 === null ? '=' : toBase64Digit(i3 & 63);\n }\n return b64;\n}\nfunction toBase64VLQ(value) {\n value = value < 0 ? ((-value) << 1) + 1 : value << 1;\n let out = '';\n do {\n let digit = value & 31;\n value = value >> 5;\n if (value > 0) {\n digit = digit | 32;\n }\n out += toBase64Digit(digit);\n } while (value > 0);\n return out;\n}\nconst B64_DIGITS = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';\nfunction toBase64Digit(value) {\n if (value < 0 || value >= 64) {\n throw new Error(`Can only encode value in the range [0, 63]`);\n }\n return B64_DIGITS[value];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst _SINGLE_QUOTE_ESCAPE_STRING_RE = /'|\\\\|\\n|\\r|\\$/g;\nconst _LEGAL_IDENTIFIER_RE = /^[$A-Z_][0-9A-Z_$]*$/i;\nconst _INDENT_WITH = ' ';\nclass _EmittedLine {\n constructor(indent) {\n this.indent = indent;\n this.partsLength = 0;\n this.parts = [];\n this.srcSpans = [];\n }\n}\nclass EmitterVisitorContext {\n constructor(_indent) {\n this._indent = _indent;\n this._lines = [new _EmittedLine(_indent)];\n }\n static createRoot() {\n return new EmitterVisitorContext(0);\n }\n /**\n * @internal strip this from published d.ts files due to\n * https://github.com/microsoft/TypeScript/issues/36216\n */\n get _currentLine() {\n return this._lines[this._lines.length - 1];\n }\n println(from, lastPart = '') {\n this.print(from || null, lastPart, true);\n }\n lineIsEmpty() {\n return this._currentLine.parts.length === 0;\n }\n lineLength() {\n return this._currentLine.indent * _INDENT_WITH.length + this._currentLine.partsLength;\n }\n print(from, part, newLine = false) {\n if (part.length > 0) {\n this._currentLine.parts.push(part);\n this._currentLine.partsLength += part.length;\n this._currentLine.srcSpans.push(from && from.sourceSpan || null);\n }\n if (newLine) {\n this._lines.push(new _EmittedLine(this._indent));\n }\n }\n removeEmptyLastLine() {\n if (this.lineIsEmpty()) {\n this._lines.pop();\n }\n }\n incIndent() {\n this._indent++;\n if (this.lineIsEmpty()) {\n this._currentLine.indent = this._indent;\n }\n }\n decIndent() {\n this._indent--;\n if (this.lineIsEmpty()) {\n this._currentLine.indent = this._indent;\n }\n }\n toSource() {\n return this.sourceLines\n .map(l => l.parts.length > 0 ? _createIndent(l.indent) + l.parts.join('') : '')\n .join('\\n');\n }\n toSourceMapGenerator(genFilePath, startsAtLine = 0) {\n const map = new SourceMapGenerator(genFilePath);\n let firstOffsetMapped = false;\n const mapFirstOffsetIfNeeded = () => {\n if (!firstOffsetMapped) {\n // Add a single space so that tools won't try to load the file from disk.\n // Note: We are using virtual urls like `ng:///`, so we have to\n // provide a content here.\n map.addSource(genFilePath, ' ').addMapping(0, genFilePath, 0, 0);\n firstOffsetMapped = true;\n }\n };\n for (let i = 0; i < startsAtLine; i++) {\n map.addLine();\n mapFirstOffsetIfNeeded();\n }\n this.sourceLines.forEach((line, lineIdx) => {\n map.addLine();\n const spans = line.srcSpans;\n const parts = line.parts;\n let col0 = line.indent * _INDENT_WITH.length;\n let spanIdx = 0;\n // skip leading parts without source spans\n while (spanIdx < spans.length && !spans[spanIdx]) {\n col0 += parts[spanIdx].length;\n spanIdx++;\n }\n if (spanIdx < spans.length && lineIdx === 0 && col0 === 0) {\n firstOffsetMapped = true;\n }\n else {\n mapFirstOffsetIfNeeded();\n }\n while (spanIdx < spans.length) {\n const span = spans[spanIdx];\n const source = span.start.file;\n const sourceLine = span.start.line;\n const sourceCol = span.start.col;\n map.addSource(source.url, source.content)\n .addMapping(col0, source.url, sourceLine, sourceCol);\n col0 += parts[spanIdx].length;\n spanIdx++;\n // assign parts without span or the same span to the previous segment\n while (spanIdx < spans.length && (span === spans[spanIdx] || !spans[spanIdx])) {\n col0 += parts[spanIdx].length;\n spanIdx++;\n }\n }\n });\n return map;\n }\n spanOf(line, column) {\n const emittedLine = this._lines[line];\n if (emittedLine) {\n let columnsLeft = column - _createIndent(emittedLine.indent).length;\n for (let partIndex = 0; partIndex < emittedLine.parts.length; partIndex++) {\n const part = emittedLine.parts[partIndex];\n if (part.length > columnsLeft) {\n return emittedLine.srcSpans[partIndex];\n }\n columnsLeft -= part.length;\n }\n }\n return null;\n }\n /**\n * @internal strip this from published d.ts files due to\n * https://github.com/microsoft/TypeScript/issues/36216\n */\n get sourceLines() {\n if (this._lines.length && this._lines[this._lines.length - 1].parts.length === 0) {\n return this._lines.slice(0, -1);\n }\n return this._lines;\n }\n}\nclass AbstractEmitterVisitor {\n constructor(_escapeDollarInStrings) {\n this._escapeDollarInStrings = _escapeDollarInStrings;\n }\n printLeadingComments(stmt, ctx) {\n if (stmt.leadingComments === undefined) {\n return;\n }\n for (const comment of stmt.leadingComments) {\n if (comment instanceof JSDocComment) {\n ctx.print(stmt, `/*${comment.toString()}*/`, comment.trailingNewline);\n }\n else {\n if (comment.multiline) {\n ctx.print(stmt, `/* ${comment.text} */`, comment.trailingNewline);\n }\n else {\n comment.text.split('\\n').forEach((line) => {\n ctx.println(stmt, `// ${line}`);\n });\n }\n }\n }\n }\n visitExpressionStmt(stmt, ctx) {\n this.printLeadingComments(stmt, ctx);\n stmt.expr.visitExpression(this, ctx);\n ctx.println(stmt, ';');\n return null;\n }\n visitReturnStmt(stmt, ctx) {\n this.printLeadingComments(stmt, ctx);\n ctx.print(stmt, `return `);\n stmt.value.visitExpression(this, ctx);\n ctx.println(stmt, ';');\n return null;\n }\n visitIfStmt(stmt, ctx) {\n this.printLeadingComments(stmt, ctx);\n ctx.print(stmt, `if (`);\n stmt.condition.visitExpression(this, ctx);\n ctx.print(stmt, `) {`);\n const hasElseCase = stmt.falseCase != null && stmt.falseCase.length > 0;\n if (stmt.trueCase.length <= 1 && !hasElseCase) {\n ctx.print(stmt, ` `);\n this.visitAllStatements(stmt.trueCase, ctx);\n ctx.removeEmptyLastLine();\n ctx.print(stmt, ` `);\n }\n else {\n ctx.println();\n ctx.incIndent();\n this.visitAllStatements(stmt.trueCase, ctx);\n ctx.decIndent();\n if (hasElseCase) {\n ctx.println(stmt, `} else {`);\n ctx.incIndent();\n this.visitAllStatements(stmt.falseCase, ctx);\n ctx.decIndent();\n }\n }\n ctx.println(stmt, `}`);\n return null;\n }\n visitWriteVarExpr(expr, ctx) {\n const lineWasEmpty = ctx.lineIsEmpty();\n if (!lineWasEmpty) {\n ctx.print(expr, '(');\n }\n ctx.print(expr, `${expr.name} = `);\n expr.value.visitExpression(this, ctx);\n if (!lineWasEmpty) {\n ctx.print(expr, ')');\n }\n return null;\n }\n visitWriteKeyExpr(expr, ctx) {\n const lineWasEmpty = ctx.lineIsEmpty();\n if (!lineWasEmpty) {\n ctx.print(expr, '(');\n }\n expr.receiver.visitExpression(this, ctx);\n ctx.print(expr, `[`);\n expr.index.visitExpression(this, ctx);\n ctx.print(expr, `] = `);\n expr.value.visitExpression(this, ctx);\n if (!lineWasEmpty) {\n ctx.print(expr, ')');\n }\n return null;\n }\n visitWritePropExpr(expr, ctx) {\n const lineWasEmpty = ctx.lineIsEmpty();\n if (!lineWasEmpty) {\n ctx.print(expr, '(');\n }\n expr.receiver.visitExpression(this, ctx);\n ctx.print(expr, `.${expr.name} = `);\n expr.value.visitExpression(this, ctx);\n if (!lineWasEmpty) {\n ctx.print(expr, ')');\n }\n return null;\n }\n visitInvokeFunctionExpr(expr, ctx) {\n expr.fn.visitExpression(this, ctx);\n ctx.print(expr, `(`);\n this.visitAllExpressions(expr.args, ctx, ',');\n ctx.print(expr, `)`);\n return null;\n }\n visitTaggedTemplateExpr(expr, ctx) {\n expr.tag.visitExpression(this, ctx);\n ctx.print(expr, '`' + expr.template.elements[0].rawText);\n for (let i = 1; i < expr.template.elements.length; i++) {\n ctx.print(expr, '${');\n expr.template.expressions[i - 1].visitExpression(this, ctx);\n ctx.print(expr, `}${expr.template.elements[i].rawText}`);\n }\n ctx.print(expr, '`');\n return null;\n }\n visitWrappedNodeExpr(ast, ctx) {\n throw new Error('Abstract emitter cannot visit WrappedNodeExpr.');\n }\n visitTypeofExpr(expr, ctx) {\n ctx.print(expr, 'typeof ');\n expr.expr.visitExpression(this, ctx);\n }\n visitReadVarExpr(ast, ctx) {\n ctx.print(ast, ast.name);\n return null;\n }\n visitInstantiateExpr(ast, ctx) {\n ctx.print(ast, `new `);\n ast.classExpr.visitExpression(this, ctx);\n ctx.print(ast, `(`);\n this.visitAllExpressions(ast.args, ctx, ',');\n ctx.print(ast, `)`);\n return null;\n }\n visitLiteralExpr(ast, ctx) {\n const value = ast.value;\n if (typeof value === 'string') {\n ctx.print(ast, escapeIdentifier(value, this._escapeDollarInStrings));\n }\n else {\n ctx.print(ast, `${value}`);\n }\n return null;\n }\n visitLocalizedString(ast, ctx) {\n const head = ast.serializeI18nHead();\n ctx.print(ast, '$localize `' + head.raw);\n for (let i = 1; i < ast.messageParts.length; i++) {\n ctx.print(ast, '${');\n ast.expressions[i - 1].visitExpression(this, ctx);\n ctx.print(ast, `}${ast.serializeI18nTemplatePart(i).raw}`);\n }\n ctx.print(ast, '`');\n return null;\n }\n visitConditionalExpr(ast, ctx) {\n ctx.print(ast, `(`);\n ast.condition.visitExpression(this, ctx);\n ctx.print(ast, '? ');\n ast.trueCase.visitExpression(this, ctx);\n ctx.print(ast, ': ');\n ast.falseCase.visitExpression(this, ctx);\n ctx.print(ast, `)`);\n return null;\n }\n visitNotExpr(ast, ctx) {\n ctx.print(ast, '!');\n ast.condition.visitExpression(this, ctx);\n return null;\n }\n visitUnaryOperatorExpr(ast, ctx) {\n let opStr;\n switch (ast.operator) {\n case UnaryOperator.Plus:\n opStr = '+';\n break;\n case UnaryOperator.Minus:\n opStr = '-';\n break;\n default:\n throw new Error(`Unknown operator ${ast.operator}`);\n }\n if (ast.parens)\n ctx.print(ast, `(`);\n ctx.print(ast, opStr);\n ast.expr.visitExpression(this, ctx);\n if (ast.parens)\n ctx.print(ast, `)`);\n return null;\n }\n visitBinaryOperatorExpr(ast, ctx) {\n let opStr;\n switch (ast.operator) {\n case BinaryOperator.Equals:\n opStr = '==';\n break;\n case BinaryOperator.Identical:\n opStr = '===';\n break;\n case BinaryOperator.NotEquals:\n opStr = '!=';\n break;\n case BinaryOperator.NotIdentical:\n opStr = '!==';\n break;\n case BinaryOperator.And:\n opStr = '&&';\n break;\n case BinaryOperator.BitwiseAnd:\n opStr = '&';\n break;\n case BinaryOperator.Or:\n opStr = '||';\n break;\n case BinaryOperator.Plus:\n opStr = '+';\n break;\n case BinaryOperator.Minus:\n opStr = '-';\n break;\n case BinaryOperator.Divide:\n opStr = '/';\n break;\n case BinaryOperator.Multiply:\n opStr = '*';\n break;\n case BinaryOperator.Modulo:\n opStr = '%';\n break;\n case BinaryOperator.Lower:\n opStr = '<';\n break;\n case BinaryOperator.LowerEquals:\n opStr = '<=';\n break;\n case BinaryOperator.Bigger:\n opStr = '>';\n break;\n case BinaryOperator.BiggerEquals:\n opStr = '>=';\n break;\n case BinaryOperator.NullishCoalesce:\n opStr = '??';\n break;\n default:\n throw new Error(`Unknown operator ${ast.operator}`);\n }\n if (ast.parens)\n ctx.print(ast, `(`);\n ast.lhs.visitExpression(this, ctx);\n ctx.print(ast, ` ${opStr} `);\n ast.rhs.visitExpression(this, ctx);\n if (ast.parens)\n ctx.print(ast, `)`);\n return null;\n }\n visitReadPropExpr(ast, ctx) {\n ast.receiver.visitExpression(this, ctx);\n ctx.print(ast, `.`);\n ctx.print(ast, ast.name);\n return null;\n }\n visitReadKeyExpr(ast, ctx) {\n ast.receiver.visitExpression(this, ctx);\n ctx.print(ast, `[`);\n ast.index.visitExpression(this, ctx);\n ctx.print(ast, `]`);\n return null;\n }\n visitLiteralArrayExpr(ast, ctx) {\n ctx.print(ast, `[`);\n this.visitAllExpressions(ast.entries, ctx, ',');\n ctx.print(ast, `]`);\n return null;\n }\n visitLiteralMapExpr(ast, ctx) {\n ctx.print(ast, `{`);\n this.visitAllObjects(entry => {\n ctx.print(ast, `${escapeIdentifier(entry.key, this._escapeDollarInStrings, entry.quoted)}:`);\n entry.value.visitExpression(this, ctx);\n }, ast.entries, ctx, ',');\n ctx.print(ast, `}`);\n return null;\n }\n visitCommaExpr(ast, ctx) {\n ctx.print(ast, '(');\n this.visitAllExpressions(ast.parts, ctx, ',');\n ctx.print(ast, ')');\n return null;\n }\n visitAllExpressions(expressions, ctx, separator) {\n this.visitAllObjects(expr => expr.visitExpression(this, ctx), expressions, ctx, separator);\n }\n visitAllObjects(handler, expressions, ctx, separator) {\n let incrementedIndent = false;\n for (let i = 0; i < expressions.length; i++) {\n if (i > 0) {\n if (ctx.lineLength() > 80) {\n ctx.print(null, separator, true);\n if (!incrementedIndent) {\n // continuation are marked with double indent.\n ctx.incIndent();\n ctx.incIndent();\n incrementedIndent = true;\n }\n }\n else {\n ctx.print(null, separator, false);\n }\n }\n handler(expressions[i]);\n }\n if (incrementedIndent) {\n // continuation are marked with double indent.\n ctx.decIndent();\n ctx.decIndent();\n }\n }\n visitAllStatements(statements, ctx) {\n statements.forEach((stmt) => stmt.visitStatement(this, ctx));\n }\n}\nfunction escapeIdentifier(input, escapeDollar, alwaysQuote = true) {\n if (input == null) {\n return null;\n }\n const body = input.replace(_SINGLE_QUOTE_ESCAPE_STRING_RE, (...match) => {\n if (match[0] == '$') {\n return escapeDollar ? '\\\\$' : '$';\n }\n else if (match[0] == '\\n') {\n return '\\\\n';\n }\n else if (match[0] == '\\r') {\n return '\\\\r';\n }\n else {\n return `\\\\${match[0]}`;\n }\n });\n const requiresQuotes = alwaysQuote || !_LEGAL_IDENTIFIER_RE.test(body);\n return requiresQuotes ? `'${body}'` : body;\n}\nfunction _createIndent(count) {\n let res = '';\n for (let i = 0; i < count; i++) {\n res += _INDENT_WITH;\n }\n return res;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction typeWithParameters(type, numParams) {\n if (numParams === 0) {\n return expressionType(type);\n }\n const params = [];\n for (let i = 0; i < numParams; i++) {\n params.push(DYNAMIC_TYPE);\n }\n return expressionType(type, undefined, params);\n}\nconst ANIMATE_SYMBOL_PREFIX = '@';\nfunction prepareSyntheticPropertyName(name) {\n return `${ANIMATE_SYMBOL_PREFIX}${name}`;\n}\nfunction prepareSyntheticListenerName(name, phase) {\n return `${ANIMATE_SYMBOL_PREFIX}${name}.${phase}`;\n}\nfunction getSafePropertyAccessString(accessor, name) {\n const escapedName = escapeIdentifier(name, false, false);\n return escapedName !== name ? `${accessor}[${escapedName}]` : `${accessor}.${name}`;\n}\nfunction prepareSyntheticListenerFunctionName(name, phase) {\n return `animation_${name}_${phase}`;\n}\nfunction jitOnlyGuardedExpression(expr) {\n return guardedExpression('ngJitMode', expr);\n}\nfunction devOnlyGuardedExpression(expr) {\n return guardedExpression('ngDevMode', expr);\n}\nfunction guardedExpression(guard, expr) {\n const guardExpr = new ExternalExpr({ name: guard, moduleName: null });\n const guardNotDefined = new BinaryOperatorExpr(BinaryOperator.Identical, new TypeofExpr(guardExpr), literal('undefined'));\n const guardUndefinedOrTrue = new BinaryOperatorExpr(BinaryOperator.Or, guardNotDefined, guardExpr, /* type */ undefined, \n /* sourceSpan */ undefined, true);\n return new BinaryOperatorExpr(BinaryOperator.And, guardUndefinedOrTrue, expr);\n}\nfunction wrapReference(value) {\n const wrapped = new WrappedNodeExpr(value);\n return { value: wrapped, type: wrapped };\n}\nfunction refsToArray(refs, shouldForwardDeclare) {\n const values = literalArr(refs.map(ref => ref.value));\n return shouldForwardDeclare ? fn([], [new ReturnStatement(values)]) : values;\n}\nfunction createMayBeForwardRefExpression(expression, forwardRef) {\n return { expression, forwardRef };\n}\n/**\n * Convert a `MaybeForwardRefExpression` to an `Expression`, possibly wrapping its expression in a\n * `forwardRef()` call.\n *\n * If `MaybeForwardRefExpression.forwardRef` is `ForwardRefHandling.Unwrapped` then the expression\n * was originally wrapped in a `forwardRef()` call to prevent the value from being eagerly evaluated\n * in the code.\n *\n * See `packages/compiler-cli/src/ngtsc/annotations/src/injectable.ts` and\n * `packages/compiler/src/jit_compiler_facade.ts` for more information.\n */\nfunction convertFromMaybeForwardRefExpression({ expression, forwardRef }) {\n switch (forwardRef) {\n case 0 /* ForwardRefHandling.None */:\n case 1 /* ForwardRefHandling.Wrapped */:\n return expression;\n case 2 /* ForwardRefHandling.Unwrapped */:\n return generateForwardRef(expression);\n }\n}\n/**\n * Generate an expression that has the given `expr` wrapped in the following form:\n *\n * ```\n * forwardRef(() => expr)\n * ```\n */\nfunction generateForwardRef(expr) {\n return importExpr(Identifiers.forwardRef).callFn([fn([], [new ReturnStatement(expr)])]);\n}\n\nvar R3FactoryDelegateType;\n(function (R3FactoryDelegateType) {\n R3FactoryDelegateType[R3FactoryDelegateType[\"Class\"] = 0] = \"Class\";\n R3FactoryDelegateType[R3FactoryDelegateType[\"Function\"] = 1] = \"Function\";\n})(R3FactoryDelegateType || (R3FactoryDelegateType = {}));\nvar FactoryTarget$1;\n(function (FactoryTarget) {\n FactoryTarget[FactoryTarget[\"Directive\"] = 0] = \"Directive\";\n FactoryTarget[FactoryTarget[\"Component\"] = 1] = \"Component\";\n FactoryTarget[FactoryTarget[\"Injectable\"] = 2] = \"Injectable\";\n FactoryTarget[FactoryTarget[\"Pipe\"] = 3] = \"Pipe\";\n FactoryTarget[FactoryTarget[\"NgModule\"] = 4] = \"NgModule\";\n})(FactoryTarget$1 || (FactoryTarget$1 = {}));\n/**\n * Construct a factory function expression for the given `R3FactoryMetadata`.\n */\nfunction compileFactoryFunction(meta) {\n const t = variable('t');\n let baseFactoryVar = null;\n // The type to instantiate via constructor invocation. If there is no delegated factory, meaning\n // this type is always created by constructor invocation, then this is the type-to-create\n // parameter provided by the user (t) if specified, or the current type if not. If there is a\n // delegated factory (which is used to create the current type) then this is only the type-to-\n // create parameter (t).\n const typeForCtor = !isDelegatedFactoryMetadata(meta) ?\n new BinaryOperatorExpr(BinaryOperator.Or, t, meta.internalType) :\n t;\n let ctorExpr = null;\n if (meta.deps !== null) {\n // There is a constructor (either explicitly or implicitly defined).\n if (meta.deps !== 'invalid') {\n ctorExpr = new InstantiateExpr(typeForCtor, injectDependencies(meta.deps, meta.target));\n }\n }\n else {\n // There is no constructor, use the base class' factory to construct typeForCtor.\n baseFactoryVar = variable(`ɵ${meta.name}_BaseFactory`);\n ctorExpr = baseFactoryVar.callFn([typeForCtor]);\n }\n const body = [];\n let retExpr = null;\n function makeConditionalFactory(nonCtorExpr) {\n const r = variable('r');\n body.push(r.set(NULL_EXPR).toDeclStmt());\n const ctorStmt = ctorExpr !== null ? r.set(ctorExpr).toStmt() :\n importExpr(Identifiers.invalidFactory).callFn([]).toStmt();\n body.push(ifStmt(t, [ctorStmt], [r.set(nonCtorExpr).toStmt()]));\n return r;\n }\n if (isDelegatedFactoryMetadata(meta)) {\n // This type is created with a delegated factory. If a type parameter is not specified, call\n // the factory instead.\n const delegateArgs = injectDependencies(meta.delegateDeps, meta.target);\n // Either call `new delegate(...)` or `delegate(...)` depending on meta.delegateType.\n const factoryExpr = new (meta.delegateType === R3FactoryDelegateType.Class ?\n InstantiateExpr :\n InvokeFunctionExpr)(meta.delegate, delegateArgs);\n retExpr = makeConditionalFactory(factoryExpr);\n }\n else if (isExpressionFactoryMetadata(meta)) {\n // TODO(alxhub): decide whether to lower the value here or in the caller\n retExpr = makeConditionalFactory(meta.expression);\n }\n else {\n retExpr = ctorExpr;\n }\n if (retExpr === null) {\n // The expression cannot be formed so render an `ɵɵinvalidFactory()` call.\n body.push(importExpr(Identifiers.invalidFactory).callFn([]).toStmt());\n }\n else if (baseFactoryVar !== null) {\n // This factory uses a base factory, so call `ɵɵgetInheritedFactory()` to compute it.\n const getInheritedFactoryCall = importExpr(Identifiers.getInheritedFactory).callFn([meta.internalType]);\n // Memoize the base factoryFn: `baseFactory || (baseFactory = ɵɵgetInheritedFactory(...))`\n const baseFactory = new BinaryOperatorExpr(BinaryOperator.Or, baseFactoryVar, baseFactoryVar.set(getInheritedFactoryCall));\n body.push(new ReturnStatement(baseFactory.callFn([typeForCtor])));\n }\n else {\n // This is straightforward factory, just return it.\n body.push(new ReturnStatement(retExpr));\n }\n let factoryFn = fn([new FnParam('t', DYNAMIC_TYPE)], body, INFERRED_TYPE, undefined, `${meta.name}_Factory`);\n if (baseFactoryVar !== null) {\n // There is a base factory variable so wrap its declaration along with the factory function into\n // an IIFE.\n factoryFn = fn([], [\n new DeclareVarStmt(baseFactoryVar.name), new ReturnStatement(factoryFn)\n ]).callFn([], /* sourceSpan */ undefined, /* pure */ true);\n }\n return {\n expression: factoryFn,\n statements: [],\n type: createFactoryType(meta),\n };\n}\nfunction createFactoryType(meta) {\n const ctorDepsType = meta.deps !== null && meta.deps !== 'invalid' ? createCtorDepsType(meta.deps) : NONE_TYPE;\n return expressionType(importExpr(Identifiers.FactoryDeclaration, [typeWithParameters(meta.type.type, meta.typeArgumentCount), ctorDepsType]));\n}\nfunction injectDependencies(deps, target) {\n return deps.map((dep, index) => compileInjectDependency(dep, target, index));\n}\nfunction compileInjectDependency(dep, target, index) {\n // Interpret the dependency according to its resolved type.\n if (dep.token === null) {\n return importExpr(Identifiers.invalidFactoryDep).callFn([literal(index)]);\n }\n else if (dep.attributeNameType === null) {\n // Build up the injection flags according to the metadata.\n const flags = 0 /* InjectFlags.Default */ | (dep.self ? 2 /* InjectFlags.Self */ : 0) |\n (dep.skipSelf ? 4 /* InjectFlags.SkipSelf */ : 0) | (dep.host ? 1 /* InjectFlags.Host */ : 0) |\n (dep.optional ? 8 /* InjectFlags.Optional */ : 0) |\n (target === FactoryTarget$1.Pipe ? 16 /* InjectFlags.ForPipe */ : 0);\n // If this dependency is optional or otherwise has non-default flags, then additional\n // parameters describing how to inject the dependency must be passed to the inject function\n // that's being used.\n let flagsParam = (flags !== 0 /* InjectFlags.Default */ || dep.optional) ? literal(flags) : null;\n // Build up the arguments to the injectFn call.\n const injectArgs = [dep.token];\n if (flagsParam) {\n injectArgs.push(flagsParam);\n }\n const injectFn = getInjectFn(target);\n return importExpr(injectFn).callFn(injectArgs);\n }\n else {\n // The `dep.attributeTypeName` value is defined, which indicates that this is an `@Attribute()`\n // type dependency. For the generated JS we still want to use the `dep.token` value in case the\n // name given for the attribute is not a string literal. For example given `@Attribute(foo())`,\n // we want to generate `ɵɵinjectAttribute(foo())`.\n //\n // The `dep.attributeTypeName` is only actually used (in `createCtorDepType()`) to generate\n // typings.\n return importExpr(Identifiers.injectAttribute).callFn([dep.token]);\n }\n}\nfunction createCtorDepsType(deps) {\n let hasTypes = false;\n const attributeTypes = deps.map(dep => {\n const type = createCtorDepType(dep);\n if (type !== null) {\n hasTypes = true;\n return type;\n }\n else {\n return literal(null);\n }\n });\n if (hasTypes) {\n return expressionType(literalArr(attributeTypes));\n }\n else {\n return NONE_TYPE;\n }\n}\nfunction createCtorDepType(dep) {\n const entries = [];\n if (dep.attributeNameType !== null) {\n entries.push({ key: 'attribute', value: dep.attributeNameType, quoted: false });\n }\n if (dep.optional) {\n entries.push({ key: 'optional', value: literal(true), quoted: false });\n }\n if (dep.host) {\n entries.push({ key: 'host', value: literal(true), quoted: false });\n }\n if (dep.self) {\n entries.push({ key: 'self', value: literal(true), quoted: false });\n }\n if (dep.skipSelf) {\n entries.push({ key: 'skipSelf', value: literal(true), quoted: false });\n }\n return entries.length > 0 ? literalMap(entries) : null;\n}\nfunction isDelegatedFactoryMetadata(meta) {\n return meta.delegateType !== undefined;\n}\nfunction isExpressionFactoryMetadata(meta) {\n return meta.expression !== undefined;\n}\nfunction getInjectFn(target) {\n switch (target) {\n case FactoryTarget$1.Component:\n case FactoryTarget$1.Directive:\n case FactoryTarget$1.Pipe:\n return Identifiers.directiveInject;\n case FactoryTarget$1.NgModule:\n case FactoryTarget$1.Injectable:\n default:\n return Identifiers.inject;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This is an R3 `Node`-like wrapper for a raw `html.Comment` node. We do not currently\n * require the implementation of a visitor for Comments as they are only collected at\n * the top-level of the R3 AST, and only if `Render3ParseOptions['collectCommentNodes']`\n * is true.\n */\nclass Comment$1 {\n constructor(value, sourceSpan) {\n this.value = value;\n this.sourceSpan = sourceSpan;\n }\n visit(_visitor) {\n throw new Error('visit() not implemented for Comment');\n }\n}\nclass Text$3 {\n constructor(value, sourceSpan) {\n this.value = value;\n this.sourceSpan = sourceSpan;\n }\n visit(visitor) {\n return visitor.visitText(this);\n }\n}\nclass BoundText {\n constructor(value, sourceSpan, i18n) {\n this.value = value;\n this.sourceSpan = sourceSpan;\n this.i18n = i18n;\n }\n visit(visitor) {\n return visitor.visitBoundText(this);\n }\n}\n/**\n * Represents a text attribute in the template.\n *\n * `valueSpan` may not be present in cases where there is no value ``.\n * `keySpan` may also not be present for synthetic attributes from ICU expansions.\n */\nclass TextAttribute {\n constructor(name, value, sourceSpan, keySpan, valueSpan, i18n) {\n this.name = name;\n this.value = value;\n this.sourceSpan = sourceSpan;\n this.keySpan = keySpan;\n this.valueSpan = valueSpan;\n this.i18n = i18n;\n }\n visit(visitor) {\n return visitor.visitTextAttribute(this);\n }\n}\nclass BoundAttribute {\n constructor(name, type, securityContext, value, unit, sourceSpan, keySpan, valueSpan, i18n) {\n this.name = name;\n this.type = type;\n this.securityContext = securityContext;\n this.value = value;\n this.unit = unit;\n this.sourceSpan = sourceSpan;\n this.keySpan = keySpan;\n this.valueSpan = valueSpan;\n this.i18n = i18n;\n }\n static fromBoundElementProperty(prop, i18n) {\n if (prop.keySpan === undefined) {\n throw new Error(`Unexpected state: keySpan must be defined for bound attributes but was not for ${prop.name}: ${prop.sourceSpan}`);\n }\n return new BoundAttribute(prop.name, prop.type, prop.securityContext, prop.value, prop.unit, prop.sourceSpan, prop.keySpan, prop.valueSpan, i18n);\n }\n visit(visitor) {\n return visitor.visitBoundAttribute(this);\n }\n}\nclass BoundEvent {\n constructor(name, type, handler, target, phase, sourceSpan, handlerSpan, keySpan) {\n this.name = name;\n this.type = type;\n this.handler = handler;\n this.target = target;\n this.phase = phase;\n this.sourceSpan = sourceSpan;\n this.handlerSpan = handlerSpan;\n this.keySpan = keySpan;\n }\n static fromParsedEvent(event) {\n const target = event.type === 0 /* ParsedEventType.Regular */ ? event.targetOrPhase : null;\n const phase = event.type === 1 /* ParsedEventType.Animation */ ? event.targetOrPhase : null;\n if (event.keySpan === undefined) {\n throw new Error(`Unexpected state: keySpan must be defined for bound event but was not for ${event.name}: ${event.sourceSpan}`);\n }\n return new BoundEvent(event.name, event.type, event.handler, target, phase, event.sourceSpan, event.handlerSpan, event.keySpan);\n }\n visit(visitor) {\n return visitor.visitBoundEvent(this);\n }\n}\nclass Element$1 {\n constructor(name, attributes, inputs, outputs, children, references, sourceSpan, startSourceSpan, endSourceSpan, i18n) {\n this.name = name;\n this.attributes = attributes;\n this.inputs = inputs;\n this.outputs = outputs;\n this.children = children;\n this.references = references;\n this.sourceSpan = sourceSpan;\n this.startSourceSpan = startSourceSpan;\n this.endSourceSpan = endSourceSpan;\n this.i18n = i18n;\n }\n visit(visitor) {\n return visitor.visitElement(this);\n }\n}\nclass Template {\n constructor(\n // tagName is the name of the container element, if applicable.\n // `null` is a special case for when there is a structural directive on an `ng-template` so\n // the renderer can differentiate between the synthetic template and the one written in the\n // file.\n tagName, attributes, inputs, outputs, templateAttrs, children, references, variables, sourceSpan, startSourceSpan, endSourceSpan, i18n) {\n this.tagName = tagName;\n this.attributes = attributes;\n this.inputs = inputs;\n this.outputs = outputs;\n this.templateAttrs = templateAttrs;\n this.children = children;\n this.references = references;\n this.variables = variables;\n this.sourceSpan = sourceSpan;\n this.startSourceSpan = startSourceSpan;\n this.endSourceSpan = endSourceSpan;\n this.i18n = i18n;\n }\n visit(visitor) {\n return visitor.visitTemplate(this);\n }\n}\nclass Content {\n constructor(selector, attributes, sourceSpan, i18n) {\n this.selector = selector;\n this.attributes = attributes;\n this.sourceSpan = sourceSpan;\n this.i18n = i18n;\n this.name = 'ng-content';\n }\n visit(visitor) {\n return visitor.visitContent(this);\n }\n}\nclass Variable {\n constructor(name, value, sourceSpan, keySpan, valueSpan) {\n this.name = name;\n this.value = value;\n this.sourceSpan = sourceSpan;\n this.keySpan = keySpan;\n this.valueSpan = valueSpan;\n }\n visit(visitor) {\n return visitor.visitVariable(this);\n }\n}\nclass Reference {\n constructor(name, value, sourceSpan, keySpan, valueSpan) {\n this.name = name;\n this.value = value;\n this.sourceSpan = sourceSpan;\n this.keySpan = keySpan;\n this.valueSpan = valueSpan;\n }\n visit(visitor) {\n return visitor.visitReference(this);\n }\n}\nclass Icu$1 {\n constructor(vars, placeholders, sourceSpan, i18n) {\n this.vars = vars;\n this.placeholders = placeholders;\n this.sourceSpan = sourceSpan;\n this.i18n = i18n;\n }\n visit(visitor) {\n return visitor.visitIcu(this);\n }\n}\nclass NullVisitor {\n visitElement(element) { }\n visitTemplate(template) { }\n visitContent(content) { }\n visitVariable(variable) { }\n visitReference(reference) { }\n visitTextAttribute(attribute) { }\n visitBoundAttribute(attribute) { }\n visitBoundEvent(attribute) { }\n visitText(text) { }\n visitBoundText(text) { }\n visitIcu(icu) { }\n}\nclass RecursiveVisitor$1 {\n visitElement(element) {\n visitAll$1(this, element.attributes);\n visitAll$1(this, element.inputs);\n visitAll$1(this, element.outputs);\n visitAll$1(this, element.children);\n visitAll$1(this, element.references);\n }\n visitTemplate(template) {\n visitAll$1(this, template.attributes);\n visitAll$1(this, template.inputs);\n visitAll$1(this, template.outputs);\n visitAll$1(this, template.children);\n visitAll$1(this, template.references);\n visitAll$1(this, template.variables);\n }\n visitContent(content) { }\n visitVariable(variable) { }\n visitReference(reference) { }\n visitTextAttribute(attribute) { }\n visitBoundAttribute(attribute) { }\n visitBoundEvent(attribute) { }\n visitText(text) { }\n visitBoundText(text) { }\n visitIcu(icu) { }\n}\nclass TransformVisitor {\n visitElement(element) {\n const newAttributes = transformAll(this, element.attributes);\n const newInputs = transformAll(this, element.inputs);\n const newOutputs = transformAll(this, element.outputs);\n const newChildren = transformAll(this, element.children);\n const newReferences = transformAll(this, element.references);\n if (newAttributes != element.attributes || newInputs != element.inputs ||\n newOutputs != element.outputs || newChildren != element.children ||\n newReferences != element.references) {\n return new Element$1(element.name, newAttributes, newInputs, newOutputs, newChildren, newReferences, element.sourceSpan, element.startSourceSpan, element.endSourceSpan);\n }\n return element;\n }\n visitTemplate(template) {\n const newAttributes = transformAll(this, template.attributes);\n const newInputs = transformAll(this, template.inputs);\n const newOutputs = transformAll(this, template.outputs);\n const newTemplateAttrs = transformAll(this, template.templateAttrs);\n const newChildren = transformAll(this, template.children);\n const newReferences = transformAll(this, template.references);\n const newVariables = transformAll(this, template.variables);\n if (newAttributes != template.attributes || newInputs != template.inputs ||\n newOutputs != template.outputs || newTemplateAttrs != template.templateAttrs ||\n newChildren != template.children || newReferences != template.references ||\n newVariables != template.variables) {\n return new Template(template.tagName, newAttributes, newInputs, newOutputs, newTemplateAttrs, newChildren, newReferences, newVariables, template.sourceSpan, template.startSourceSpan, template.endSourceSpan);\n }\n return template;\n }\n visitContent(content) {\n return content;\n }\n visitVariable(variable) {\n return variable;\n }\n visitReference(reference) {\n return reference;\n }\n visitTextAttribute(attribute) {\n return attribute;\n }\n visitBoundAttribute(attribute) {\n return attribute;\n }\n visitBoundEvent(attribute) {\n return attribute;\n }\n visitText(text) {\n return text;\n }\n visitBoundText(text) {\n return text;\n }\n visitIcu(icu) {\n return icu;\n }\n}\nfunction visitAll$1(visitor, nodes) {\n const result = [];\n if (visitor.visit) {\n for (const node of nodes) {\n const newNode = visitor.visit(node) || node.visit(visitor);\n }\n }\n else {\n for (const node of nodes) {\n const newNode = node.visit(visitor);\n if (newNode) {\n result.push(newNode);\n }\n }\n }\n return result;\n}\nfunction transformAll(visitor, nodes) {\n const result = [];\n let changed = false;\n for (const node of nodes) {\n const newNode = node.visit(visitor);\n if (newNode) {\n result.push(newNode);\n }\n changed = changed || newNode != node;\n }\n return changed ? result : nodes;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass Message {\n /**\n * @param nodes message AST\n * @param placeholders maps placeholder names to static content and their source spans\n * @param placeholderToMessage maps placeholder names to messages (used for nested ICU messages)\n * @param meaning\n * @param description\n * @param customId\n */\n constructor(nodes, placeholders, placeholderToMessage, meaning, description, customId) {\n this.nodes = nodes;\n this.placeholders = placeholders;\n this.placeholderToMessage = placeholderToMessage;\n this.meaning = meaning;\n this.description = description;\n this.customId = customId;\n this.id = this.customId;\n /** The ids to use if there are no custom id and if `i18nLegacyMessageIdFormat` is not empty */\n this.legacyIds = [];\n this.messageString = serializeMessage(this.nodes);\n if (nodes.length) {\n this.sources = [{\n filePath: nodes[0].sourceSpan.start.file.url,\n startLine: nodes[0].sourceSpan.start.line + 1,\n startCol: nodes[0].sourceSpan.start.col + 1,\n endLine: nodes[nodes.length - 1].sourceSpan.end.line + 1,\n endCol: nodes[0].sourceSpan.start.col + 1\n }];\n }\n else {\n this.sources = [];\n }\n }\n}\nclass Text$2 {\n constructor(value, sourceSpan) {\n this.value = value;\n this.sourceSpan = sourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitText(this, context);\n }\n}\n// TODO(vicb): do we really need this node (vs an array) ?\nclass Container {\n constructor(children, sourceSpan) {\n this.children = children;\n this.sourceSpan = sourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitContainer(this, context);\n }\n}\nclass Icu {\n constructor(expression, type, cases, sourceSpan) {\n this.expression = expression;\n this.type = type;\n this.cases = cases;\n this.sourceSpan = sourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitIcu(this, context);\n }\n}\nclass TagPlaceholder {\n constructor(tag, attrs, startName, closeName, children, isVoid, \n // TODO sourceSpan should cover all (we need a startSourceSpan and endSourceSpan)\n sourceSpan, startSourceSpan, endSourceSpan) {\n this.tag = tag;\n this.attrs = attrs;\n this.startName = startName;\n this.closeName = closeName;\n this.children = children;\n this.isVoid = isVoid;\n this.sourceSpan = sourceSpan;\n this.startSourceSpan = startSourceSpan;\n this.endSourceSpan = endSourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitTagPlaceholder(this, context);\n }\n}\nclass Placeholder {\n constructor(value, name, sourceSpan) {\n this.value = value;\n this.name = name;\n this.sourceSpan = sourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitPlaceholder(this, context);\n }\n}\nclass IcuPlaceholder {\n constructor(value, name, sourceSpan) {\n this.value = value;\n this.name = name;\n this.sourceSpan = sourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitIcuPlaceholder(this, context);\n }\n}\n// Clone the AST\nclass CloneVisitor {\n visitText(text, context) {\n return new Text$2(text.value, text.sourceSpan);\n }\n visitContainer(container, context) {\n const children = container.children.map(n => n.visit(this, context));\n return new Container(children, container.sourceSpan);\n }\n visitIcu(icu, context) {\n const cases = {};\n Object.keys(icu.cases).forEach(key => cases[key] = icu.cases[key].visit(this, context));\n const msg = new Icu(icu.expression, icu.type, cases, icu.sourceSpan);\n msg.expressionPlaceholder = icu.expressionPlaceholder;\n return msg;\n }\n visitTagPlaceholder(ph, context) {\n const children = ph.children.map(n => n.visit(this, context));\n return new TagPlaceholder(ph.tag, ph.attrs, ph.startName, ph.closeName, children, ph.isVoid, ph.sourceSpan, ph.startSourceSpan, ph.endSourceSpan);\n }\n visitPlaceholder(ph, context) {\n return new Placeholder(ph.value, ph.name, ph.sourceSpan);\n }\n visitIcuPlaceholder(ph, context) {\n return new IcuPlaceholder(ph.value, ph.name, ph.sourceSpan);\n }\n}\n// Visit all the nodes recursively\nclass RecurseVisitor {\n visitText(text, context) { }\n visitContainer(container, context) {\n container.children.forEach(child => child.visit(this));\n }\n visitIcu(icu, context) {\n Object.keys(icu.cases).forEach(k => {\n icu.cases[k].visit(this);\n });\n }\n visitTagPlaceholder(ph, context) {\n ph.children.forEach(child => child.visit(this));\n }\n visitPlaceholder(ph, context) { }\n visitIcuPlaceholder(ph, context) { }\n}\n/**\n * Serialize the message to the Localize backtick string format that would appear in compiled code.\n */\nfunction serializeMessage(messageNodes) {\n const visitor = new LocalizeMessageStringVisitor();\n const str = messageNodes.map(n => n.visit(visitor)).join('');\n return str;\n}\nclass LocalizeMessageStringVisitor {\n visitText(text) {\n return text.value;\n }\n visitContainer(container) {\n return container.children.map(child => child.visit(this)).join('');\n }\n visitIcu(icu) {\n const strCases = Object.keys(icu.cases).map((k) => `${k} {${icu.cases[k].visit(this)}}`);\n return `{${icu.expressionPlaceholder}, ${icu.type}, ${strCases.join(' ')}}`;\n }\n visitTagPlaceholder(ph) {\n const children = ph.children.map(child => child.visit(this)).join('');\n return `{$${ph.startName}}${children}{$${ph.closeName}}`;\n }\n visitPlaceholder(ph) {\n return `{$${ph.name}}`;\n }\n visitIcuPlaceholder(ph) {\n return `{$${ph.name}}`;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass Serializer {\n // Creates a name mapper, see `PlaceholderMapper`\n // Returning `null` means that no name mapping is used.\n createNameMapper(message) {\n return null;\n }\n}\n/**\n * A simple mapper that take a function to transform an internal name to a public name\n */\nclass SimplePlaceholderMapper extends RecurseVisitor {\n // create a mapping from the message\n constructor(message, mapName) {\n super();\n this.mapName = mapName;\n this.internalToPublic = {};\n this.publicToNextId = {};\n this.publicToInternal = {};\n message.nodes.forEach(node => node.visit(this));\n }\n toPublicName(internalName) {\n return this.internalToPublic.hasOwnProperty(internalName) ?\n this.internalToPublic[internalName] :\n null;\n }\n toInternalName(publicName) {\n return this.publicToInternal.hasOwnProperty(publicName) ? this.publicToInternal[publicName] :\n null;\n }\n visitText(text, context) {\n return null;\n }\n visitTagPlaceholder(ph, context) {\n this.visitPlaceholderName(ph.startName);\n super.visitTagPlaceholder(ph, context);\n this.visitPlaceholderName(ph.closeName);\n }\n visitPlaceholder(ph, context) {\n this.visitPlaceholderName(ph.name);\n }\n visitIcuPlaceholder(ph, context) {\n this.visitPlaceholderName(ph.name);\n }\n // XMB placeholders could only contains A-Z, 0-9 and _\n visitPlaceholderName(internalName) {\n if (!internalName || this.internalToPublic.hasOwnProperty(internalName)) {\n return;\n }\n let publicName = this.mapName(internalName);\n if (this.publicToInternal.hasOwnProperty(publicName)) {\n // Create a new XMB when it has already been used\n const nextId = this.publicToNextId[publicName];\n this.publicToNextId[publicName] = nextId + 1;\n publicName = `${publicName}_${nextId}`;\n }\n else {\n this.publicToNextId[publicName] = 1;\n }\n this.internalToPublic[internalName] = publicName;\n this.publicToInternal[publicName] = internalName;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass _Visitor$2 {\n visitTag(tag) {\n const strAttrs = this._serializeAttributes(tag.attrs);\n if (tag.children.length == 0) {\n return `<${tag.name}${strAttrs}/>`;\n }\n const strChildren = tag.children.map(node => node.visit(this));\n return `<${tag.name}${strAttrs}>${strChildren.join('')}`;\n }\n visitText(text) {\n return text.value;\n }\n visitDeclaration(decl) {\n return ``;\n }\n _serializeAttributes(attrs) {\n const strAttrs = Object.keys(attrs).map((name) => `${name}=\"${attrs[name]}\"`).join(' ');\n return strAttrs.length > 0 ? ' ' + strAttrs : '';\n }\n visitDoctype(doctype) {\n return ``;\n }\n}\nconst _visitor = new _Visitor$2();\nfunction serialize(nodes) {\n return nodes.map((node) => node.visit(_visitor)).join('');\n}\nclass Declaration {\n constructor(unescapedAttrs) {\n this.attrs = {};\n Object.keys(unescapedAttrs).forEach((k) => {\n this.attrs[k] = escapeXml(unescapedAttrs[k]);\n });\n }\n visit(visitor) {\n return visitor.visitDeclaration(this);\n }\n}\nclass Doctype {\n constructor(rootTag, dtd) {\n this.rootTag = rootTag;\n this.dtd = dtd;\n }\n visit(visitor) {\n return visitor.visitDoctype(this);\n }\n}\nclass Tag {\n constructor(name, unescapedAttrs = {}, children = []) {\n this.name = name;\n this.children = children;\n this.attrs = {};\n Object.keys(unescapedAttrs).forEach((k) => {\n this.attrs[k] = escapeXml(unescapedAttrs[k]);\n });\n }\n visit(visitor) {\n return visitor.visitTag(this);\n }\n}\nclass Text$1 {\n constructor(unescapedValue) {\n this.value = escapeXml(unescapedValue);\n }\n visit(visitor) {\n return visitor.visitText(this);\n }\n}\nclass CR extends Text$1 {\n constructor(ws = 0) {\n super(`\\n${new Array(ws + 1).join(' ')}`);\n }\n}\nconst _ESCAPED_CHARS = [\n [/&/g, '&'],\n [/\"/g, '"'],\n [/'/g, '''],\n [//g, '>'],\n];\n// Escape `_ESCAPED_CHARS` characters in the given text with encoded entities\nfunction escapeXml(text) {\n return _ESCAPED_CHARS.reduce((text, entry) => text.replace(entry[0], entry[1]), text);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst _MESSAGES_TAG = 'messagebundle';\nconst _MESSAGE_TAG = 'msg';\nconst _PLACEHOLDER_TAG$3 = 'ph';\nconst _EXAMPLE_TAG = 'ex';\nconst _SOURCE_TAG$2 = 'source';\nconst _DOCTYPE = `\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n`;\nclass Xmb extends Serializer {\n write(messages, locale) {\n const exampleVisitor = new ExampleVisitor();\n const visitor = new _Visitor$1();\n let rootNode = new Tag(_MESSAGES_TAG);\n messages.forEach(message => {\n const attrs = { id: message.id };\n if (message.description) {\n attrs['desc'] = message.description;\n }\n if (message.meaning) {\n attrs['meaning'] = message.meaning;\n }\n let sourceTags = [];\n message.sources.forEach((source) => {\n sourceTags.push(new Tag(_SOURCE_TAG$2, {}, [new Text$1(`${source.filePath}:${source.startLine}${source.endLine !== source.startLine ? ',' + source.endLine : ''}`)]));\n });\n rootNode.children.push(new CR(2), new Tag(_MESSAGE_TAG, attrs, [...sourceTags, ...visitor.serialize(message.nodes)]));\n });\n rootNode.children.push(new CR());\n return serialize([\n new Declaration({ version: '1.0', encoding: 'UTF-8' }),\n new CR(),\n new Doctype(_MESSAGES_TAG, _DOCTYPE),\n new CR(),\n exampleVisitor.addDefaultExamples(rootNode),\n new CR(),\n ]);\n }\n load(content, url) {\n throw new Error('Unsupported');\n }\n digest(message) {\n return digest(message);\n }\n createNameMapper(message) {\n return new SimplePlaceholderMapper(message, toPublicName);\n }\n}\nclass _Visitor$1 {\n visitText(text, context) {\n return [new Text$1(text.value)];\n }\n visitContainer(container, context) {\n const nodes = [];\n container.children.forEach((node) => nodes.push(...node.visit(this)));\n return nodes;\n }\n visitIcu(icu, context) {\n const nodes = [new Text$1(`{${icu.expressionPlaceholder}, ${icu.type}, `)];\n Object.keys(icu.cases).forEach((c) => {\n nodes.push(new Text$1(`${c} {`), ...icu.cases[c].visit(this), new Text$1(`} `));\n });\n nodes.push(new Text$1(`}`));\n return nodes;\n }\n visitTagPlaceholder(ph, context) {\n const startTagAsText = new Text$1(`<${ph.tag}>`);\n const startEx = new Tag(_EXAMPLE_TAG, {}, [startTagAsText]);\n // TC requires PH to have a non empty EX, and uses the text node to show the \"original\" value.\n const startTagPh = new Tag(_PLACEHOLDER_TAG$3, { name: ph.startName }, [startEx, startTagAsText]);\n if (ph.isVoid) {\n // void tags have no children nor closing tags\n return [startTagPh];\n }\n const closeTagAsText = new Text$1(``);\n const closeEx = new Tag(_EXAMPLE_TAG, {}, [closeTagAsText]);\n // TC requires PH to have a non empty EX, and uses the text node to show the \"original\" value.\n const closeTagPh = new Tag(_PLACEHOLDER_TAG$3, { name: ph.closeName }, [closeEx, closeTagAsText]);\n return [startTagPh, ...this.serialize(ph.children), closeTagPh];\n }\n visitPlaceholder(ph, context) {\n const interpolationAsText = new Text$1(`{{${ph.value}}}`);\n // Example tag needs to be not-empty for TC.\n const exTag = new Tag(_EXAMPLE_TAG, {}, [interpolationAsText]);\n return [\n // TC requires PH to have a non empty EX, and uses the text node to show the \"original\" value.\n new Tag(_PLACEHOLDER_TAG$3, { name: ph.name }, [exTag, interpolationAsText])\n ];\n }\n visitIcuPlaceholder(ph, context) {\n const icuExpression = ph.value.expression;\n const icuType = ph.value.type;\n const icuCases = Object.keys(ph.value.cases).map((value) => value + ' {...}').join(' ');\n const icuAsText = new Text$1(`{${icuExpression}, ${icuType}, ${icuCases}}`);\n const exTag = new Tag(_EXAMPLE_TAG, {}, [icuAsText]);\n return [\n // TC requires PH to have a non empty EX, and uses the text node to show the \"original\" value.\n new Tag(_PLACEHOLDER_TAG$3, { name: ph.name }, [exTag, icuAsText])\n ];\n }\n serialize(nodes) {\n return [].concat(...nodes.map(node => node.visit(this)));\n }\n}\nfunction digest(message) {\n return decimalDigest(message);\n}\n// TC requires at least one non-empty example on placeholders\nclass ExampleVisitor {\n addDefaultExamples(node) {\n node.visit(this);\n return node;\n }\n visitTag(tag) {\n if (tag.name === _PLACEHOLDER_TAG$3) {\n if (!tag.children || tag.children.length == 0) {\n const exText = new Text$1(tag.attrs['name'] || '...');\n tag.children = [new Tag(_EXAMPLE_TAG, {}, [exText])];\n }\n }\n else if (tag.children) {\n tag.children.forEach(node => node.visit(this));\n }\n }\n visitText(text) { }\n visitDeclaration(decl) { }\n visitDoctype(doctype) { }\n}\n// XMB/XTB placeholders can only contain A-Z, 0-9 and _\nfunction toPublicName(internalName) {\n return internalName.toUpperCase().replace(/[^A-Z0-9_]/g, '_');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/* Closure variables holding messages must be named `MSG_[A-Z0-9]+` */\nconst CLOSURE_TRANSLATION_VAR_PREFIX = 'MSG_';\n/**\n * Prefix for non-`goog.getMsg` i18n-related vars.\n * Note: the prefix uses lowercase characters intentionally due to a Closure behavior that\n * considers variables like `I18N_0` as constants and throws an error when their value changes.\n */\nconst TRANSLATION_VAR_PREFIX = 'i18n_';\n/** Name of the i18n attributes **/\nconst I18N_ATTR = 'i18n';\nconst I18N_ATTR_PREFIX = 'i18n-';\n/** Prefix of var expressions used in ICUs */\nconst I18N_ICU_VAR_PREFIX = 'VAR_';\n/** Prefix of ICU expressions for post processing */\nconst I18N_ICU_MAPPING_PREFIX = 'I18N_EXP_';\n/** Placeholder wrapper for i18n expressions **/\nconst I18N_PLACEHOLDER_SYMBOL = '�';\nfunction isI18nAttribute(name) {\n return name === I18N_ATTR || name.startsWith(I18N_ATTR_PREFIX);\n}\nfunction isI18nRootNode(meta) {\n return meta instanceof Message;\n}\nfunction isSingleI18nIcu(meta) {\n return isI18nRootNode(meta) && meta.nodes.length === 1 && meta.nodes[0] instanceof Icu;\n}\nfunction hasI18nMeta(node) {\n return !!node.i18n;\n}\nfunction hasI18nAttrs(element) {\n return element.attrs.some((attr) => isI18nAttribute(attr.name));\n}\nfunction icuFromI18nMessage(message) {\n return message.nodes[0];\n}\nfunction wrapI18nPlaceholder(content, contextId = 0) {\n const blockId = contextId > 0 ? `:${contextId}` : '';\n return `${I18N_PLACEHOLDER_SYMBOL}${content}${blockId}${I18N_PLACEHOLDER_SYMBOL}`;\n}\nfunction assembleI18nBoundString(strings, bindingStartIndex = 0, contextId = 0) {\n if (!strings.length)\n return '';\n let acc = '';\n const lastIdx = strings.length - 1;\n for (let i = 0; i < lastIdx; i++) {\n acc += `${strings[i]}${wrapI18nPlaceholder(bindingStartIndex + i, contextId)}`;\n }\n acc += strings[lastIdx];\n return acc;\n}\nfunction getSeqNumberGenerator(startsAt = 0) {\n let current = startsAt;\n return () => current++;\n}\nfunction placeholdersToParams(placeholders) {\n const params = {};\n placeholders.forEach((values, key) => {\n params[key] = literal(values.length > 1 ? `[${values.join('|')}]` : values[0]);\n });\n return params;\n}\nfunction updatePlaceholderMap(map, name, ...values) {\n const current = map.get(name) || [];\n current.push(...values);\n map.set(name, current);\n}\nfunction assembleBoundTextPlaceholders(meta, bindingStartIndex = 0, contextId = 0) {\n const startIdx = bindingStartIndex;\n const placeholders = new Map();\n const node = meta instanceof Message ? meta.nodes.find(node => node instanceof Container) : meta;\n if (node) {\n node\n .children\n .filter((child) => child instanceof Placeholder)\n .forEach((child, idx) => {\n const content = wrapI18nPlaceholder(startIdx + idx, contextId);\n updatePlaceholderMap(placeholders, child.name, content);\n });\n }\n return placeholders;\n}\n/**\n * Format the placeholder names in a map of placeholders to expressions.\n *\n * The placeholder names are converted from \"internal\" format (e.g. `START_TAG_DIV_1`) to \"external\"\n * format (e.g. `startTagDiv_1`).\n *\n * @param params A map of placeholder names to expressions.\n * @param useCamelCase whether to camelCase the placeholder name when formatting.\n * @returns A new map of formatted placeholder names to expressions.\n */\nfunction formatI18nPlaceholderNamesInMap(params = {}, useCamelCase) {\n const _params = {};\n if (params && Object.keys(params).length) {\n Object.keys(params).forEach(key => _params[formatI18nPlaceholderName(key, useCamelCase)] = params[key]);\n }\n return _params;\n}\n/**\n * Converts internal placeholder names to public-facing format\n * (for example to use in goog.getMsg call).\n * Example: `START_TAG_DIV_1` is converted to `startTagDiv_1`.\n *\n * @param name The placeholder name that should be formatted\n * @returns Formatted placeholder name\n */\nfunction formatI18nPlaceholderName(name, useCamelCase = true) {\n const publicName = toPublicName(name);\n if (!useCamelCase) {\n return publicName;\n }\n const chunks = publicName.split('_');\n if (chunks.length === 1) {\n // if no \"_\" found - just lowercase the value\n return name.toLowerCase();\n }\n let postfix;\n // eject last element if it's a number\n if (/^\\d+$/.test(chunks[chunks.length - 1])) {\n postfix = chunks.pop();\n }\n let raw = chunks.shift().toLowerCase();\n if (chunks.length) {\n raw += chunks.map(c => c.charAt(0).toUpperCase() + c.slice(1).toLowerCase()).join('');\n }\n return postfix ? `${raw}_${postfix}` : raw;\n}\n/**\n * Generates a prefix for translation const name.\n *\n * @param extra Additional local prefix that should be injected into translation var name\n * @returns Complete translation const prefix\n */\nfunction getTranslationConstPrefix(extra) {\n return `${CLOSURE_TRANSLATION_VAR_PREFIX}${extra}`.toUpperCase();\n}\n/**\n * Generate AST to declare a variable. E.g. `var I18N_1;`.\n * @param variable the name of the variable to declare.\n */\nfunction declareI18nVariable(variable) {\n return new DeclareVarStmt(variable.name, undefined, INFERRED_TYPE, undefined, variable.sourceSpan);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Checks whether an object key contains potentially unsafe chars, thus the key should be wrapped in\n * quotes. Note: we do not wrap all keys into quotes, as it may have impact on minification and may\n * bot work in some cases when object keys are mangled by minifier.\n *\n * TODO(FW-1136): this is a temporary solution, we need to come up with a better way of working with\n * inputs that contain potentially unsafe chars.\n */\nconst UNSAFE_OBJECT_KEY_NAME_REGEXP = /[-.]/;\n/** Name of the temporary to use during data binding */\nconst TEMPORARY_NAME = '_t';\n/** Name of the context parameter passed into a template function */\nconst CONTEXT_NAME = 'ctx';\n/** Name of the RenderFlag passed into a template function */\nconst RENDER_FLAGS = 'rf';\n/** The prefix reference variables */\nconst REFERENCE_PREFIX = '_r';\n/** The name of the implicit context reference */\nconst IMPLICIT_REFERENCE = '$implicit';\n/** Non bindable attribute name **/\nconst NON_BINDABLE_ATTR = 'ngNonBindable';\n/** Name for the variable keeping track of the context returned by `ɵɵrestoreView`. */\nconst RESTORED_VIEW_CONTEXT_NAME = 'restoredCtx';\n/**\n * Maximum length of a single instruction chain. Because our output AST uses recursion, we're\n * limited in how many expressions we can nest before we reach the call stack limit. This\n * length is set very conservatively in order to reduce the chance of problems.\n */\nconst MAX_CHAIN_LENGTH = 500;\n/** Instructions that support chaining. */\nconst CHAINABLE_INSTRUCTIONS = new Set([\n Identifiers.element,\n Identifiers.elementStart,\n Identifiers.elementEnd,\n Identifiers.elementContainer,\n Identifiers.elementContainerStart,\n Identifiers.elementContainerEnd,\n Identifiers.i18nExp,\n Identifiers.listener,\n Identifiers.classProp,\n Identifiers.syntheticHostListener,\n Identifiers.hostProperty,\n Identifiers.syntheticHostProperty,\n Identifiers.property,\n Identifiers.propertyInterpolate1,\n Identifiers.propertyInterpolate2,\n Identifiers.propertyInterpolate3,\n Identifiers.propertyInterpolate4,\n Identifiers.propertyInterpolate5,\n Identifiers.propertyInterpolate6,\n Identifiers.propertyInterpolate7,\n Identifiers.propertyInterpolate8,\n Identifiers.propertyInterpolateV,\n Identifiers.attribute,\n Identifiers.attributeInterpolate1,\n Identifiers.attributeInterpolate2,\n Identifiers.attributeInterpolate3,\n Identifiers.attributeInterpolate4,\n Identifiers.attributeInterpolate5,\n Identifiers.attributeInterpolate6,\n Identifiers.attributeInterpolate7,\n Identifiers.attributeInterpolate8,\n Identifiers.attributeInterpolateV,\n Identifiers.styleProp,\n Identifiers.stylePropInterpolate1,\n Identifiers.stylePropInterpolate2,\n Identifiers.stylePropInterpolate3,\n Identifiers.stylePropInterpolate4,\n Identifiers.stylePropInterpolate5,\n Identifiers.stylePropInterpolate6,\n Identifiers.stylePropInterpolate7,\n Identifiers.stylePropInterpolate8,\n Identifiers.stylePropInterpolateV,\n Identifiers.textInterpolate,\n Identifiers.textInterpolate1,\n Identifiers.textInterpolate2,\n Identifiers.textInterpolate3,\n Identifiers.textInterpolate4,\n Identifiers.textInterpolate5,\n Identifiers.textInterpolate6,\n Identifiers.textInterpolate7,\n Identifiers.textInterpolate8,\n Identifiers.textInterpolateV,\n]);\n/** Generates a call to a single instruction. */\nfunction invokeInstruction(span, reference, params) {\n return importExpr(reference, null, span).callFn(params, span);\n}\n/**\n * Creates an allocator for a temporary variable.\n *\n * A variable declaration is added to the statements the first time the allocator is invoked.\n */\nfunction temporaryAllocator(statements, name) {\n let temp = null;\n return () => {\n if (!temp) {\n statements.push(new DeclareVarStmt(TEMPORARY_NAME, undefined, DYNAMIC_TYPE));\n temp = variable(name);\n }\n return temp;\n };\n}\nfunction invalid(arg) {\n throw new Error(`Invalid state: Visitor ${this.constructor.name} doesn't handle ${arg.constructor.name}`);\n}\nfunction asLiteral(value) {\n if (Array.isArray(value)) {\n return literalArr(value.map(asLiteral));\n }\n return literal(value, INFERRED_TYPE);\n}\nfunction conditionallyCreateMapObjectLiteral(keys, keepDeclared) {\n if (Object.getOwnPropertyNames(keys).length > 0) {\n return mapToExpression(keys, keepDeclared);\n }\n return null;\n}\nfunction mapToExpression(map, keepDeclared) {\n return literalMap(Object.getOwnPropertyNames(map).map(key => {\n // canonical syntax: `dirProp: publicProp`\n const value = map[key];\n let declaredName;\n let publicName;\n let minifiedName;\n let needsDeclaredName;\n if (Array.isArray(value)) {\n [publicName, declaredName] = value;\n minifiedName = key;\n needsDeclaredName = publicName !== declaredName;\n }\n else {\n minifiedName = declaredName = key;\n publicName = value;\n needsDeclaredName = false;\n }\n return {\n key: minifiedName,\n // put quotes around keys that contain potentially unsafe characters\n quoted: UNSAFE_OBJECT_KEY_NAME_REGEXP.test(minifiedName),\n value: (keepDeclared && needsDeclaredName) ?\n literalArr([asLiteral(publicName), asLiteral(declaredName)]) :\n asLiteral(publicName)\n };\n }));\n}\n/**\n * Remove trailing null nodes as they are implied.\n */\nfunction trimTrailingNulls(parameters) {\n while (isNull(parameters[parameters.length - 1])) {\n parameters.pop();\n }\n return parameters;\n}\nfunction getQueryPredicate(query, constantPool) {\n if (Array.isArray(query.predicate)) {\n let predicate = [];\n query.predicate.forEach((selector) => {\n // Each item in predicates array may contain strings with comma-separated refs\n // (for ex. 'ref, ref1, ..., refN'), thus we extract individual refs and store them\n // as separate array entities\n const selectors = selector.split(',').map(token => literal(token.trim()));\n predicate.push(...selectors);\n });\n return constantPool.getConstLiteral(literalArr(predicate), true);\n }\n else {\n // The original predicate may have been wrapped in a `forwardRef()` call.\n switch (query.predicate.forwardRef) {\n case 0 /* ForwardRefHandling.None */:\n case 2 /* ForwardRefHandling.Unwrapped */:\n return query.predicate.expression;\n case 1 /* ForwardRefHandling.Wrapped */:\n return importExpr(Identifiers.resolveForwardRef).callFn([query.predicate.expression]);\n }\n }\n}\n/**\n * A representation for an object literal used during codegen of definition objects. The generic\n * type `T` allows to reference a documented type of the generated structure, such that the\n * property names that are set can be resolved to their documented declaration.\n */\nclass DefinitionMap {\n constructor() {\n this.values = [];\n }\n set(key, value) {\n if (value) {\n this.values.push({ key: key, value, quoted: false });\n }\n }\n toLiteralMap() {\n return literalMap(this.values);\n }\n}\n/**\n * Extract a map of properties to values for a given element or template node, which can be used\n * by the directive matching machinery.\n *\n * @param elOrTpl the element or template in question\n * @return an object set up for directive matching. For attributes on the element/template, this\n * object maps a property name to its (static) value. For any bindings, this map simply maps the\n * property name to an empty string.\n */\nfunction getAttrsForDirectiveMatching(elOrTpl) {\n const attributesMap = {};\n if (elOrTpl instanceof Template && elOrTpl.tagName !== 'ng-template') {\n elOrTpl.templateAttrs.forEach(a => attributesMap[a.name] = '');\n }\n else {\n elOrTpl.attributes.forEach(a => {\n if (!isI18nAttribute(a.name)) {\n attributesMap[a.name] = a.value;\n }\n });\n elOrTpl.inputs.forEach(i => {\n attributesMap[i.name] = '';\n });\n elOrTpl.outputs.forEach(o => {\n attributesMap[o.name] = '';\n });\n }\n return attributesMap;\n}\n/**\n * Gets the number of arguments expected to be passed to a generated instruction in the case of\n * interpolation instructions.\n * @param interpolation An interpolation ast\n */\nfunction getInterpolationArgsLength(interpolation) {\n const { expressions, strings } = interpolation;\n if (expressions.length === 1 && strings.length === 2 && strings[0] === '' && strings[1] === '') {\n // If the interpolation has one interpolated value, but the prefix and suffix are both empty\n // strings, we only pass one argument, to a special instruction like `propertyInterpolate` or\n // `textInterpolate`.\n return 1;\n }\n else {\n return expressions.length + strings.length;\n }\n}\n/**\n * Generates the final instruction call statements based on the passed in configuration.\n * Will try to chain instructions as much as possible, if chaining is supported.\n */\nfunction getInstructionStatements(instructions) {\n var _a;\n const statements = [];\n let pendingExpression = null;\n let pendingExpressionType = null;\n let chainLength = 0;\n for (const current of instructions) {\n const resolvedParams = (_a = (typeof current.paramsOrFn === 'function' ? current.paramsOrFn() : current.paramsOrFn)) !== null && _a !== void 0 ? _a : [];\n const params = Array.isArray(resolvedParams) ? resolvedParams : [resolvedParams];\n // If the current instruction is the same as the previous one\n // and it can be chained, add another call to the chain.\n if (chainLength < MAX_CHAIN_LENGTH && pendingExpressionType === current.reference &&\n CHAINABLE_INSTRUCTIONS.has(pendingExpressionType)) {\n // We'll always have a pending expression when there's a pending expression type.\n pendingExpression = pendingExpression.callFn(params, pendingExpression.sourceSpan);\n chainLength++;\n }\n else {\n if (pendingExpression !== null) {\n statements.push(pendingExpression.toStmt());\n }\n pendingExpression = invokeInstruction(current.span, current.reference, params);\n pendingExpressionType = current.reference;\n chainLength = 0;\n }\n }\n // Since the current instruction adds the previous one to the statements,\n // we may be left with the final one at the end that is still pending.\n if (pendingExpression !== null) {\n statements.push(pendingExpression.toStmt());\n }\n return statements;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction compileInjectable(meta, resolveForwardRefs) {\n let result = null;\n const factoryMeta = {\n name: meta.name,\n type: meta.type,\n internalType: meta.internalType,\n typeArgumentCount: meta.typeArgumentCount,\n deps: [],\n target: FactoryTarget$1.Injectable,\n };\n if (meta.useClass !== undefined) {\n // meta.useClass has two modes of operation. Either deps are specified, in which case `new` is\n // used to instantiate the class with dependencies injected, or deps are not specified and\n // the factory of the class is used to instantiate it.\n //\n // A special case exists for useClass: Type where Type is the injectable type itself and no\n // deps are specified, in which case 'useClass' is effectively ignored.\n const useClassOnSelf = meta.useClass.expression.isEquivalent(meta.internalType);\n let deps = undefined;\n if (meta.deps !== undefined) {\n deps = meta.deps;\n }\n if (deps !== undefined) {\n // factory: () => new meta.useClass(...deps)\n result = compileFactoryFunction(Object.assign(Object.assign({}, factoryMeta), { delegate: meta.useClass.expression, delegateDeps: deps, delegateType: R3FactoryDelegateType.Class }));\n }\n else if (useClassOnSelf) {\n result = compileFactoryFunction(factoryMeta);\n }\n else {\n result = {\n statements: [],\n expression: delegateToFactory(meta.type.value, meta.useClass.expression, resolveForwardRefs)\n };\n }\n }\n else if (meta.useFactory !== undefined) {\n if (meta.deps !== undefined) {\n result = compileFactoryFunction(Object.assign(Object.assign({}, factoryMeta), { delegate: meta.useFactory, delegateDeps: meta.deps || [], delegateType: R3FactoryDelegateType.Function }));\n }\n else {\n result = {\n statements: [],\n expression: fn([], [new ReturnStatement(meta.useFactory.callFn([]))])\n };\n }\n }\n else if (meta.useValue !== undefined) {\n // Note: it's safe to use `meta.useValue` instead of the `USE_VALUE in meta` check used for\n // client code because meta.useValue is an Expression which will be defined even if the actual\n // value is undefined.\n result = compileFactoryFunction(Object.assign(Object.assign({}, factoryMeta), { expression: meta.useValue.expression }));\n }\n else if (meta.useExisting !== undefined) {\n // useExisting is an `inject` call on the existing token.\n result = compileFactoryFunction(Object.assign(Object.assign({}, factoryMeta), { expression: importExpr(Identifiers.inject).callFn([meta.useExisting.expression]) }));\n }\n else {\n result = {\n statements: [],\n expression: delegateToFactory(meta.type.value, meta.internalType, resolveForwardRefs)\n };\n }\n const token = meta.internalType;\n const injectableProps = new DefinitionMap();\n injectableProps.set('token', token);\n injectableProps.set('factory', result.expression);\n // Only generate providedIn property if it has a non-null value\n if (meta.providedIn.expression.value !== null) {\n injectableProps.set('providedIn', convertFromMaybeForwardRefExpression(meta.providedIn));\n }\n const expression = importExpr(Identifiers.ɵɵdefineInjectable)\n .callFn([injectableProps.toLiteralMap()], undefined, true);\n return {\n expression,\n type: createInjectableType(meta),\n statements: result.statements,\n };\n}\nfunction createInjectableType(meta) {\n return new ExpressionType(importExpr(Identifiers.InjectableDeclaration, [typeWithParameters(meta.type.type, meta.typeArgumentCount)]));\n}\nfunction delegateToFactory(type, internalType, unwrapForwardRefs) {\n if (type.node === internalType.node) {\n // The types are the same, so we can simply delegate directly to the type's factory.\n // ```\n // factory: type.ɵfac\n // ```\n return internalType.prop('ɵfac');\n }\n if (!unwrapForwardRefs) {\n // The type is not wrapped in a `forwardRef()`, so we create a simple factory function that\n // accepts a sub-type as an argument.\n // ```\n // factory: function(t) { return internalType.ɵfac(t); }\n // ```\n return createFactoryFunction(internalType);\n }\n // The internalType is actually wrapped in a `forwardRef()` so we need to resolve that before\n // calling its factory.\n // ```\n // factory: function(t) { return core.resolveForwardRef(type).ɵfac(t); }\n // ```\n const unwrappedType = importExpr(Identifiers.resolveForwardRef).callFn([internalType]);\n return createFactoryFunction(unwrappedType);\n}\nfunction createFactoryFunction(type) {\n return fn([new FnParam('t', DYNAMIC_TYPE)], [new ReturnStatement(type.prop('ɵfac').callFn([variable('t')]))]);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst UNUSABLE_INTERPOLATION_REGEXPS = [\n /^\\s*$/,\n /[<>]/,\n /^[{}]$/,\n /&(#|[a-z])/i,\n /^\\/\\//, // comment\n];\nfunction assertInterpolationSymbols(identifier, value) {\n if (value != null && !(Array.isArray(value) && value.length == 2)) {\n throw new Error(`Expected '${identifier}' to be an array, [start, end].`);\n }\n else if (value != null) {\n const start = value[0];\n const end = value[1];\n // Check for unusable interpolation symbols\n UNUSABLE_INTERPOLATION_REGEXPS.forEach(regexp => {\n if (regexp.test(start) || regexp.test(end)) {\n throw new Error(`['${start}', '${end}'] contains unusable interpolation symbol.`);\n }\n });\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass InterpolationConfig {\n constructor(start, end) {\n this.start = start;\n this.end = end;\n }\n static fromArray(markers) {\n if (!markers) {\n return DEFAULT_INTERPOLATION_CONFIG;\n }\n assertInterpolationSymbols('interpolation', markers);\n return new InterpolationConfig(markers[0], markers[1]);\n }\n}\nconst DEFAULT_INTERPOLATION_CONFIG = new InterpolationConfig('{{', '}}');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst $EOF = 0;\nconst $BSPACE = 8;\nconst $TAB = 9;\nconst $LF = 10;\nconst $VTAB = 11;\nconst $FF = 12;\nconst $CR = 13;\nconst $SPACE = 32;\nconst $BANG = 33;\nconst $DQ = 34;\nconst $HASH = 35;\nconst $$ = 36;\nconst $PERCENT = 37;\nconst $AMPERSAND = 38;\nconst $SQ = 39;\nconst $LPAREN = 40;\nconst $RPAREN = 41;\nconst $STAR = 42;\nconst $PLUS = 43;\nconst $COMMA = 44;\nconst $MINUS = 45;\nconst $PERIOD = 46;\nconst $SLASH = 47;\nconst $COLON = 58;\nconst $SEMICOLON = 59;\nconst $LT = 60;\nconst $EQ = 61;\nconst $GT = 62;\nconst $QUESTION = 63;\nconst $0 = 48;\nconst $7 = 55;\nconst $9 = 57;\nconst $A = 65;\nconst $E = 69;\nconst $F = 70;\nconst $X = 88;\nconst $Z = 90;\nconst $LBRACKET = 91;\nconst $BACKSLASH = 92;\nconst $RBRACKET = 93;\nconst $CARET = 94;\nconst $_ = 95;\nconst $a = 97;\nconst $b = 98;\nconst $e = 101;\nconst $f = 102;\nconst $n = 110;\nconst $r = 114;\nconst $t = 116;\nconst $u = 117;\nconst $v = 118;\nconst $x = 120;\nconst $z = 122;\nconst $LBRACE = 123;\nconst $BAR = 124;\nconst $RBRACE = 125;\nconst $NBSP = 160;\nconst $PIPE = 124;\nconst $TILDA = 126;\nconst $AT = 64;\nconst $BT = 96;\nfunction isWhitespace(code) {\n return (code >= $TAB && code <= $SPACE) || (code == $NBSP);\n}\nfunction isDigit(code) {\n return $0 <= code && code <= $9;\n}\nfunction isAsciiLetter(code) {\n return code >= $a && code <= $z || code >= $A && code <= $Z;\n}\nfunction isAsciiHexDigit(code) {\n return code >= $a && code <= $f || code >= $A && code <= $F || isDigit(code);\n}\nfunction isNewLine(code) {\n return code === $LF || code === $CR;\n}\nfunction isOctalDigit(code) {\n return $0 <= code && code <= $7;\n}\nfunction isQuote(code) {\n return code === $SQ || code === $DQ || code === $BT;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ParseLocation {\n constructor(file, offset, line, col) {\n this.file = file;\n this.offset = offset;\n this.line = line;\n this.col = col;\n }\n toString() {\n return this.offset != null ? `${this.file.url}@${this.line}:${this.col}` : this.file.url;\n }\n moveBy(delta) {\n const source = this.file.content;\n const len = source.length;\n let offset = this.offset;\n let line = this.line;\n let col = this.col;\n while (offset > 0 && delta < 0) {\n offset--;\n delta++;\n const ch = source.charCodeAt(offset);\n if (ch == $LF) {\n line--;\n const priorLine = source.substring(0, offset - 1).lastIndexOf(String.fromCharCode($LF));\n col = priorLine > 0 ? offset - priorLine : offset;\n }\n else {\n col--;\n }\n }\n while (offset < len && delta > 0) {\n const ch = source.charCodeAt(offset);\n offset++;\n delta--;\n if (ch == $LF) {\n line++;\n col = 0;\n }\n else {\n col++;\n }\n }\n return new ParseLocation(this.file, offset, line, col);\n }\n // Return the source around the location\n // Up to `maxChars` or `maxLines` on each side of the location\n getContext(maxChars, maxLines) {\n const content = this.file.content;\n let startOffset = this.offset;\n if (startOffset != null) {\n if (startOffset > content.length - 1) {\n startOffset = content.length - 1;\n }\n let endOffset = startOffset;\n let ctxChars = 0;\n let ctxLines = 0;\n while (ctxChars < maxChars && startOffset > 0) {\n startOffset--;\n ctxChars++;\n if (content[startOffset] == '\\n') {\n if (++ctxLines == maxLines) {\n break;\n }\n }\n }\n ctxChars = 0;\n ctxLines = 0;\n while (ctxChars < maxChars && endOffset < content.length - 1) {\n endOffset++;\n ctxChars++;\n if (content[endOffset] == '\\n') {\n if (++ctxLines == maxLines) {\n break;\n }\n }\n }\n return {\n before: content.substring(startOffset, this.offset),\n after: content.substring(this.offset, endOffset + 1),\n };\n }\n return null;\n }\n}\nclass ParseSourceFile {\n constructor(content, url) {\n this.content = content;\n this.url = url;\n }\n}\nclass ParseSourceSpan {\n /**\n * Create an object that holds information about spans of tokens/nodes captured during\n * lexing/parsing of text.\n *\n * @param start\n * The location of the start of the span (having skipped leading trivia).\n * Skipping leading trivia makes source-spans more \"user friendly\", since things like HTML\n * elements will appear to begin at the start of the opening tag, rather than at the start of any\n * leading trivia, which could include newlines.\n *\n * @param end\n * The location of the end of the span.\n *\n * @param fullStart\n * The start of the token without skipping the leading trivia.\n * This is used by tooling that splits tokens further, such as extracting Angular interpolations\n * from text tokens. Such tooling creates new source-spans relative to the original token's\n * source-span. If leading trivia characters have been skipped then the new source-spans may be\n * incorrectly offset.\n *\n * @param details\n * Additional information (such as identifier names) that should be associated with the span.\n */\n constructor(start, end, fullStart = start, details = null) {\n this.start = start;\n this.end = end;\n this.fullStart = fullStart;\n this.details = details;\n }\n toString() {\n return this.start.file.content.substring(this.start.offset, this.end.offset);\n }\n}\nvar ParseErrorLevel;\n(function (ParseErrorLevel) {\n ParseErrorLevel[ParseErrorLevel[\"WARNING\"] = 0] = \"WARNING\";\n ParseErrorLevel[ParseErrorLevel[\"ERROR\"] = 1] = \"ERROR\";\n})(ParseErrorLevel || (ParseErrorLevel = {}));\nclass ParseError {\n constructor(span, msg, level = ParseErrorLevel.ERROR) {\n this.span = span;\n this.msg = msg;\n this.level = level;\n }\n contextualMessage() {\n const ctx = this.span.start.getContext(100, 3);\n return ctx ? `${this.msg} (\"${ctx.before}[${ParseErrorLevel[this.level]} ->]${ctx.after}\")` :\n this.msg;\n }\n toString() {\n const details = this.span.details ? `, ${this.span.details}` : '';\n return `${this.contextualMessage()}: ${this.span.start}${details}`;\n }\n}\n/**\n * Generates Source Span object for a given R3 Type for JIT mode.\n *\n * @param kind Component or Directive.\n * @param typeName name of the Component or Directive.\n * @param sourceUrl reference to Component or Directive source.\n * @returns instance of ParseSourceSpan that represent a given Component or Directive.\n */\nfunction r3JitTypeSourceSpan(kind, typeName, sourceUrl) {\n const sourceFileName = `in ${kind} ${typeName} in ${sourceUrl}`;\n const sourceFile = new ParseSourceFile('', sourceFileName);\n return new ParseSourceSpan(new ParseLocation(sourceFile, -1, -1, -1), new ParseLocation(sourceFile, -1, -1, -1));\n}\nlet _anonymousTypeIndex = 0;\nfunction identifierName(compileIdentifier) {\n if (!compileIdentifier || !compileIdentifier.reference) {\n return null;\n }\n const ref = compileIdentifier.reference;\n if (ref['__anonymousType']) {\n return ref['__anonymousType'];\n }\n if (ref['__forward_ref__']) {\n // We do not want to try to stringify a `forwardRef()` function because that would cause the\n // inner function to be evaluated too early, defeating the whole point of the `forwardRef`.\n return '__forward_ref__';\n }\n let identifier = stringify(ref);\n if (identifier.indexOf('(') >= 0) {\n // case: anonymous functions!\n identifier = `anonymous_${_anonymousTypeIndex++}`;\n ref['__anonymousType'] = identifier;\n }\n else {\n identifier = sanitizeIdentifier(identifier);\n }\n return identifier;\n}\nfunction sanitizeIdentifier(name) {\n return name.replace(/\\W/g, '_');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * In TypeScript, tagged template functions expect a \"template object\", which is an array of\n * \"cooked\" strings plus a `raw` property that contains an array of \"raw\" strings. This is\n * typically constructed with a function called `__makeTemplateObject(cooked, raw)`, but it may not\n * be available in all environments.\n *\n * This is a JavaScript polyfill that uses __makeTemplateObject when it's available, but otherwise\n * creates an inline helper with the same functionality.\n *\n * In the inline function, if `Object.defineProperty` is available we use that to attach the `raw`\n * array.\n */\nconst makeTemplateObjectPolyfill = '(this&&this.__makeTemplateObject||function(e,t){return Object.defineProperty?Object.defineProperty(e,\"raw\",{value:t}):e.raw=t,e})';\nclass AbstractJsEmitterVisitor extends AbstractEmitterVisitor {\n constructor() {\n super(false);\n }\n visitWrappedNodeExpr(ast, ctx) {\n throw new Error('Cannot emit a WrappedNodeExpr in Javascript.');\n }\n visitDeclareVarStmt(stmt, ctx) {\n ctx.print(stmt, `var ${stmt.name}`);\n if (stmt.value) {\n ctx.print(stmt, ' = ');\n stmt.value.visitExpression(this, ctx);\n }\n ctx.println(stmt, `;`);\n return null;\n }\n visitTaggedTemplateExpr(ast, ctx) {\n // The following convoluted piece of code is effectively the downlevelled equivalent of\n // ```\n // tag`...`\n // ```\n // which is effectively like:\n // ```\n // tag(__makeTemplateObject(cooked, raw), expression1, expression2, ...);\n // ```\n const elements = ast.template.elements;\n ast.tag.visitExpression(this, ctx);\n ctx.print(ast, `(${makeTemplateObjectPolyfill}(`);\n ctx.print(ast, `[${elements.map(part => escapeIdentifier(part.text, false)).join(', ')}], `);\n ctx.print(ast, `[${elements.map(part => escapeIdentifier(part.rawText, false)).join(', ')}])`);\n ast.template.expressions.forEach(expression => {\n ctx.print(ast, ', ');\n expression.visitExpression(this, ctx);\n });\n ctx.print(ast, ')');\n return null;\n }\n visitFunctionExpr(ast, ctx) {\n ctx.print(ast, `function${ast.name ? ' ' + ast.name : ''}(`);\n this._visitParams(ast.params, ctx);\n ctx.println(ast, `) {`);\n ctx.incIndent();\n this.visitAllStatements(ast.statements, ctx);\n ctx.decIndent();\n ctx.print(ast, `}`);\n return null;\n }\n visitDeclareFunctionStmt(stmt, ctx) {\n ctx.print(stmt, `function ${stmt.name}(`);\n this._visitParams(stmt.params, ctx);\n ctx.println(stmt, `) {`);\n ctx.incIndent();\n this.visitAllStatements(stmt.statements, ctx);\n ctx.decIndent();\n ctx.println(stmt, `}`);\n return null;\n }\n visitLocalizedString(ast, ctx) {\n // The following convoluted piece of code is effectively the downlevelled equivalent of\n // ```\n // $localize `...`\n // ```\n // which is effectively like:\n // ```\n // $localize(__makeTemplateObject(cooked, raw), expression1, expression2, ...);\n // ```\n ctx.print(ast, `$localize(${makeTemplateObjectPolyfill}(`);\n const parts = [ast.serializeI18nHead()];\n for (let i = 1; i < ast.messageParts.length; i++) {\n parts.push(ast.serializeI18nTemplatePart(i));\n }\n ctx.print(ast, `[${parts.map(part => escapeIdentifier(part.cooked, false)).join(', ')}], `);\n ctx.print(ast, `[${parts.map(part => escapeIdentifier(part.raw, false)).join(', ')}])`);\n ast.expressions.forEach(expression => {\n ctx.print(ast, ', ');\n expression.visitExpression(this, ctx);\n });\n ctx.print(ast, ')');\n return null;\n }\n _visitParams(params, ctx) {\n this.visitAllObjects(param => ctx.print(null, param.name), params, ctx, ',');\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * The Trusted Types policy, or null if Trusted Types are not\n * enabled/supported, or undefined if the policy has not been created yet.\n */\nlet policy;\n/**\n * Returns the Trusted Types policy, or null if Trusted Types are not\n * enabled/supported. The first call to this function will create the policy.\n */\nfunction getPolicy() {\n if (policy === undefined) {\n policy = null;\n if (_global.trustedTypes) {\n try {\n policy =\n _global.trustedTypes.createPolicy('angular#unsafe-jit', {\n createScript: (s) => s,\n });\n }\n catch (_a) {\n // trustedTypes.createPolicy throws if called with a name that is\n // already registered, even in report-only mode. Until the API changes,\n // catch the error not to break the applications functionally. In such\n // cases, the code will fall back to using strings.\n }\n }\n }\n return policy;\n}\n/**\n * Unsafely promote a string to a TrustedScript, falling back to strings when\n * Trusted Types are not available.\n * @security In particular, it must be assured that the provided string will\n * never cause an XSS vulnerability if used in a context that will be\n * interpreted and executed as a script by a browser, e.g. when calling eval.\n */\nfunction trustedScriptFromString(script) {\n var _a;\n return ((_a = getPolicy()) === null || _a === void 0 ? void 0 : _a.createScript(script)) || script;\n}\n/**\n * Unsafely call the Function constructor with the given string arguments.\n * @security This is a security-sensitive function; any use of this function\n * must go through security review. In particular, it must be assured that it\n * is only called from the JIT compiler, as use in other code can lead to XSS\n * vulnerabilities.\n */\nfunction newTrustedFunctionForJIT(...args) {\n if (!_global.trustedTypes) {\n // In environments that don't support Trusted Types, fall back to the most\n // straightforward implementation:\n return new Function(...args);\n }\n // Chrome currently does not support passing TrustedScript to the Function\n // constructor. The following implements the workaround proposed on the page\n // below, where the Chromium bug is also referenced:\n // https://github.com/w3c/webappsec-trusted-types/wiki/Trusted-Types-for-function-constructor\n const fnArgs = args.slice(0, -1).join(',');\n const fnBody = args[args.length - 1];\n const body = `(function anonymous(${fnArgs}\n) { ${fnBody}\n})`;\n // Using eval directly confuses the compiler and prevents this module from\n // being stripped out of JS binaries even if not used. The global['eval']\n // indirection fixes that.\n const fn = _global['eval'](trustedScriptFromString(body));\n if (fn.bind === undefined) {\n // Workaround for a browser bug that only exists in Chrome 83, where passing\n // a TrustedScript to eval just returns the TrustedScript back without\n // evaluating it. In that case, fall back to the most straightforward\n // implementation:\n return new Function(...args);\n }\n // To completely mimic the behavior of calling \"new Function\", two more\n // things need to happen:\n // 1. Stringifying the resulting function should return its source code\n fn.toString = () => body;\n // 2. When calling the resulting function, `this` should refer to `global`\n return fn.bind(_global);\n // When Trusted Types support in Function constructors is widely available,\n // the implementation of this function can be simplified to:\n // return new Function(...args.map(a => trustedScriptFromString(a)));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A helper class to manage the evaluation of JIT generated code.\n */\nclass JitEvaluator {\n /**\n *\n * @param sourceUrl The URL of the generated code.\n * @param statements An array of Angular statement AST nodes to be evaluated.\n * @param refResolver Resolves `o.ExternalReference`s into values.\n * @param createSourceMaps If true then create a source-map for the generated code and include it\n * inline as a source-map comment.\n * @returns A map of all the variables in the generated code.\n */\n evaluateStatements(sourceUrl, statements, refResolver, createSourceMaps) {\n const converter = new JitEmitterVisitor(refResolver);\n const ctx = EmitterVisitorContext.createRoot();\n // Ensure generated code is in strict mode\n if (statements.length > 0 && !isUseStrictStatement(statements[0])) {\n statements = [\n literal('use strict').toStmt(),\n ...statements,\n ];\n }\n converter.visitAllStatements(statements, ctx);\n converter.createReturnStmt(ctx);\n return this.evaluateCode(sourceUrl, ctx, converter.getArgs(), createSourceMaps);\n }\n /**\n * Evaluate a piece of JIT generated code.\n * @param sourceUrl The URL of this generated code.\n * @param ctx A context object that contains an AST of the code to be evaluated.\n * @param vars A map containing the names and values of variables that the evaluated code might\n * reference.\n * @param createSourceMap If true then create a source-map for the generated code and include it\n * inline as a source-map comment.\n * @returns The result of evaluating the code.\n */\n evaluateCode(sourceUrl, ctx, vars, createSourceMap) {\n let fnBody = `\"use strict\";${ctx.toSource()}\\n//# sourceURL=${sourceUrl}`;\n const fnArgNames = [];\n const fnArgValues = [];\n for (const argName in vars) {\n fnArgValues.push(vars[argName]);\n fnArgNames.push(argName);\n }\n if (createSourceMap) {\n // using `new Function(...)` generates a header, 1 line of no arguments, 2 lines otherwise\n // E.g. ```\n // function anonymous(a,b,c\n // /**/) { ... }```\n // We don't want to hard code this fact, so we auto detect it via an empty function first.\n const emptyFn = newTrustedFunctionForJIT(...fnArgNames.concat('return null;')).toString();\n const headerLines = emptyFn.slice(0, emptyFn.indexOf('return null;')).split('\\n').length - 1;\n fnBody += `\\n${ctx.toSourceMapGenerator(sourceUrl, headerLines).toJsComment()}`;\n }\n const fn = newTrustedFunctionForJIT(...fnArgNames.concat(fnBody));\n return this.executeFunction(fn, fnArgValues);\n }\n /**\n * Execute a JIT generated function by calling it.\n *\n * This method can be overridden in tests to capture the functions that are generated\n * by this `JitEvaluator` class.\n *\n * @param fn A function to execute.\n * @param args The arguments to pass to the function being executed.\n * @returns The return value of the executed function.\n */\n executeFunction(fn, args) {\n return fn(...args);\n }\n}\n/**\n * An Angular AST visitor that converts AST nodes into executable JavaScript code.\n */\nclass JitEmitterVisitor extends AbstractJsEmitterVisitor {\n constructor(refResolver) {\n super();\n this.refResolver = refResolver;\n this._evalArgNames = [];\n this._evalArgValues = [];\n this._evalExportedVars = [];\n }\n createReturnStmt(ctx) {\n const stmt = new ReturnStatement(new LiteralMapExpr(this._evalExportedVars.map(resultVar => new LiteralMapEntry(resultVar, variable(resultVar), false))));\n stmt.visitStatement(this, ctx);\n }\n getArgs() {\n const result = {};\n for (let i = 0; i < this._evalArgNames.length; i++) {\n result[this._evalArgNames[i]] = this._evalArgValues[i];\n }\n return result;\n }\n visitExternalExpr(ast, ctx) {\n this._emitReferenceToExternal(ast, this.refResolver.resolveExternalReference(ast.value), ctx);\n return null;\n }\n visitWrappedNodeExpr(ast, ctx) {\n this._emitReferenceToExternal(ast, ast.node, ctx);\n return null;\n }\n visitDeclareVarStmt(stmt, ctx) {\n if (stmt.hasModifier(StmtModifier.Exported)) {\n this._evalExportedVars.push(stmt.name);\n }\n return super.visitDeclareVarStmt(stmt, ctx);\n }\n visitDeclareFunctionStmt(stmt, ctx) {\n if (stmt.hasModifier(StmtModifier.Exported)) {\n this._evalExportedVars.push(stmt.name);\n }\n return super.visitDeclareFunctionStmt(stmt, ctx);\n }\n _emitReferenceToExternal(ast, value, ctx) {\n let id = this._evalArgValues.indexOf(value);\n if (id === -1) {\n id = this._evalArgValues.length;\n this._evalArgValues.push(value);\n const name = identifierName({ reference: value }) || 'val';\n this._evalArgNames.push(`jit_${name}_${id}`);\n }\n ctx.print(ast, this._evalArgNames[id]);\n }\n}\nfunction isUseStrictStatement(statement) {\n return statement.isEquivalent(literal('use strict').toStmt());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction compileInjector(meta) {\n const definitionMap = new DefinitionMap();\n if (meta.providers !== null) {\n definitionMap.set('providers', meta.providers);\n }\n if (meta.imports.length > 0) {\n definitionMap.set('imports', literalArr(meta.imports));\n }\n const expression = importExpr(Identifiers.defineInjector).callFn([definitionMap.toLiteralMap()], undefined, true);\n const type = createInjectorType(meta);\n return { expression, type, statements: [] };\n}\nfunction createInjectorType(meta) {\n return new ExpressionType(importExpr(Identifiers.InjectorDeclaration, [new ExpressionType(meta.type.type)]));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Implementation of `CompileReflector` which resolves references to @angular/core\n * symbols at runtime, according to a consumer-provided mapping.\n *\n * Only supports `resolveExternalReference`, all other methods throw.\n */\nclass R3JitReflector {\n constructor(context) {\n this.context = context;\n }\n resolveExternalReference(ref) {\n // This reflector only handles @angular/core imports.\n if (ref.moduleName !== '@angular/core') {\n throw new Error(`Cannot resolve external reference to ${ref.moduleName}, only references to @angular/core are supported.`);\n }\n if (!this.context.hasOwnProperty(ref.name)) {\n throw new Error(`No value provided for @angular/core symbol '${ref.name}'.`);\n }\n return this.context[ref.name];\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * How the selector scope of an NgModule (its declarations, imports, and exports) should be emitted\n * as a part of the NgModule definition.\n */\nvar R3SelectorScopeMode;\n(function (R3SelectorScopeMode) {\n /**\n * Emit the declarations inline into the module definition.\n *\n * This option is useful in certain contexts where it's known that JIT support is required. The\n * tradeoff here is that this emit style prevents directives and pipes from being tree-shaken if\n * they are unused, but the NgModule is used.\n */\n R3SelectorScopeMode[R3SelectorScopeMode[\"Inline\"] = 0] = \"Inline\";\n /**\n * Emit the declarations using a side effectful function call, `ɵɵsetNgModuleScope`, that is\n * guarded with the `ngJitMode` flag.\n *\n * This form of emit supports JIT and can be optimized away if the `ngJitMode` flag is set to\n * false, which allows unused directives and pipes to be tree-shaken.\n */\n R3SelectorScopeMode[R3SelectorScopeMode[\"SideEffect\"] = 1] = \"SideEffect\";\n /**\n * Don't generate selector scopes at all.\n *\n * This is useful for contexts where JIT support is known to be unnecessary.\n */\n R3SelectorScopeMode[R3SelectorScopeMode[\"Omit\"] = 2] = \"Omit\";\n})(R3SelectorScopeMode || (R3SelectorScopeMode = {}));\n/**\n * Construct an `R3NgModuleDef` for the given `R3NgModuleMetadata`.\n */\nfunction compileNgModule(meta) {\n const { adjacentType, internalType, bootstrap, declarations, imports, exports, schemas, containsForwardDecls, selectorScopeMode, id } = meta;\n const statements = [];\n const definitionMap = new DefinitionMap();\n definitionMap.set('type', internalType);\n if (bootstrap.length > 0) {\n definitionMap.set('bootstrap', refsToArray(bootstrap, containsForwardDecls));\n }\n if (selectorScopeMode === R3SelectorScopeMode.Inline) {\n // If requested to emit scope information inline, pass the `declarations`, `imports` and\n // `exports` to the `ɵɵdefineNgModule()` call directly.\n if (declarations.length > 0) {\n definitionMap.set('declarations', refsToArray(declarations, containsForwardDecls));\n }\n if (imports.length > 0) {\n definitionMap.set('imports', refsToArray(imports, containsForwardDecls));\n }\n if (exports.length > 0) {\n definitionMap.set('exports', refsToArray(exports, containsForwardDecls));\n }\n }\n else if (selectorScopeMode === R3SelectorScopeMode.SideEffect) {\n // In this mode, scope information is not passed into `ɵɵdefineNgModule` as it\n // would prevent tree-shaking of the declarations, imports and exports references. Instead, it's\n // patched onto the NgModule definition with a `ɵɵsetNgModuleScope` call that's guarded by the\n // `ngJitMode` flag.\n const setNgModuleScopeCall = generateSetNgModuleScopeCall(meta);\n if (setNgModuleScopeCall !== null) {\n statements.push(setNgModuleScopeCall);\n }\n }\n else {\n // Selector scope emit was not requested, so skip it.\n }\n if (schemas !== null && schemas.length > 0) {\n definitionMap.set('schemas', literalArr(schemas.map(ref => ref.value)));\n }\n if (id !== null) {\n definitionMap.set('id', id);\n // Generate a side-effectful call to register this NgModule by its id, as per the semantics of\n // NgModule ids.\n statements.push(importExpr(Identifiers.registerNgModuleType).callFn([adjacentType, id]).toStmt());\n }\n const expression = importExpr(Identifiers.defineNgModule).callFn([definitionMap.toLiteralMap()], undefined, true);\n const type = createNgModuleType(meta);\n return { expression, type, statements };\n}\n/**\n * This function is used in JIT mode to generate the call to `ɵɵdefineNgModule()` from a call to\n * `ɵɵngDeclareNgModule()`.\n */\nfunction compileNgModuleDeclarationExpression(meta) {\n const definitionMap = new DefinitionMap();\n definitionMap.set('type', new WrappedNodeExpr(meta.type));\n if (meta.bootstrap !== undefined) {\n definitionMap.set('bootstrap', new WrappedNodeExpr(meta.bootstrap));\n }\n if (meta.declarations !== undefined) {\n definitionMap.set('declarations', new WrappedNodeExpr(meta.declarations));\n }\n if (meta.imports !== undefined) {\n definitionMap.set('imports', new WrappedNodeExpr(meta.imports));\n }\n if (meta.exports !== undefined) {\n definitionMap.set('exports', new WrappedNodeExpr(meta.exports));\n }\n if (meta.schemas !== undefined) {\n definitionMap.set('schemas', new WrappedNodeExpr(meta.schemas));\n }\n if (meta.id !== undefined) {\n definitionMap.set('id', new WrappedNodeExpr(meta.id));\n }\n return importExpr(Identifiers.defineNgModule).callFn([definitionMap.toLiteralMap()]);\n}\nfunction createNgModuleType({ type: moduleType, declarations, exports, imports, includeImportTypes, publicDeclarationTypes }) {\n return new ExpressionType(importExpr(Identifiers.NgModuleDeclaration, [\n new ExpressionType(moduleType.type),\n publicDeclarationTypes === null ? tupleTypeOf(declarations) :\n tupleOfTypes(publicDeclarationTypes),\n includeImportTypes ? tupleTypeOf(imports) : NONE_TYPE,\n tupleTypeOf(exports),\n ]));\n}\n/**\n * Generates a function call to `ɵɵsetNgModuleScope` with all necessary information so that the\n * transitive module scope can be computed during runtime in JIT mode. This call is marked pure\n * such that the references to declarations, imports and exports may be elided causing these\n * symbols to become tree-shakeable.\n */\nfunction generateSetNgModuleScopeCall(meta) {\n const { adjacentType: moduleType, declarations, imports, exports, containsForwardDecls } = meta;\n const scopeMap = new DefinitionMap();\n if (declarations.length > 0) {\n scopeMap.set('declarations', refsToArray(declarations, containsForwardDecls));\n }\n if (imports.length > 0) {\n scopeMap.set('imports', refsToArray(imports, containsForwardDecls));\n }\n if (exports.length > 0) {\n scopeMap.set('exports', refsToArray(exports, containsForwardDecls));\n }\n if (Object.keys(scopeMap.values).length === 0) {\n return null;\n }\n // setNgModuleScope(...)\n const fnCall = new InvokeFunctionExpr(\n /* fn */ importExpr(Identifiers.setNgModuleScope), \n /* args */ [moduleType, scopeMap.toLiteralMap()]);\n // (ngJitMode guard) && setNgModuleScope(...)\n const guardedCall = jitOnlyGuardedExpression(fnCall);\n // function() { (ngJitMode guard) && setNgModuleScope(...); }\n const iife = new FunctionExpr(\n /* params */ [], \n /* statements */ [guardedCall.toStmt()]);\n // (function() { (ngJitMode guard) && setNgModuleScope(...); })()\n const iifeCall = new InvokeFunctionExpr(\n /* fn */ iife, \n /* args */ []);\n return iifeCall.toStmt();\n}\nfunction tupleTypeOf(exp) {\n const types = exp.map(ref => typeofExpr(ref.type));\n return exp.length > 0 ? expressionType(literalArr(types)) : NONE_TYPE;\n}\nfunction tupleOfTypes(types) {\n const typeofTypes = types.map(type => typeofExpr(type));\n return types.length > 0 ? expressionType(literalArr(typeofTypes)) : NONE_TYPE;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction compilePipeFromMetadata(metadata) {\n const definitionMapValues = [];\n // e.g. `name: 'myPipe'`\n definitionMapValues.push({ key: 'name', value: literal(metadata.pipeName), quoted: false });\n // e.g. `type: MyPipe`\n definitionMapValues.push({ key: 'type', value: metadata.type.value, quoted: false });\n // e.g. `pure: true`\n definitionMapValues.push({ key: 'pure', value: literal(metadata.pure), quoted: false });\n if (metadata.isStandalone) {\n definitionMapValues.push({ key: 'standalone', value: literal(true), quoted: false });\n }\n const expression = importExpr(Identifiers.definePipe).callFn([literalMap(definitionMapValues)], undefined, true);\n const type = createPipeType(metadata);\n return { expression, type, statements: [] };\n}\nfunction createPipeType(metadata) {\n return new ExpressionType(importExpr(Identifiers.PipeDeclaration, [\n typeWithParameters(metadata.type.type, metadata.typeArgumentCount),\n new ExpressionType(new LiteralExpr(metadata.pipeName)),\n new ExpressionType(new LiteralExpr(metadata.isStandalone)),\n ]));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nvar R3TemplateDependencyKind;\n(function (R3TemplateDependencyKind) {\n R3TemplateDependencyKind[R3TemplateDependencyKind[\"Directive\"] = 0] = \"Directive\";\n R3TemplateDependencyKind[R3TemplateDependencyKind[\"Pipe\"] = 1] = \"Pipe\";\n R3TemplateDependencyKind[R3TemplateDependencyKind[\"NgModule\"] = 2] = \"NgModule\";\n})(R3TemplateDependencyKind || (R3TemplateDependencyKind = {}));\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ParserError {\n constructor(message, input, errLocation, ctxLocation) {\n this.input = input;\n this.errLocation = errLocation;\n this.ctxLocation = ctxLocation;\n this.message = `Parser Error: ${message} ${errLocation} [${input}] in ${ctxLocation}`;\n }\n}\nclass ParseSpan {\n constructor(start, end) {\n this.start = start;\n this.end = end;\n }\n toAbsolute(absoluteOffset) {\n return new AbsoluteSourceSpan(absoluteOffset + this.start, absoluteOffset + this.end);\n }\n}\nclass AST {\n constructor(span, \n /**\n * Absolute location of the expression AST in a source code file.\n */\n sourceSpan) {\n this.span = span;\n this.sourceSpan = sourceSpan;\n }\n toString() {\n return 'AST';\n }\n}\nclass ASTWithName extends AST {\n constructor(span, sourceSpan, nameSpan) {\n super(span, sourceSpan);\n this.nameSpan = nameSpan;\n }\n}\nclass EmptyExpr extends AST {\n visit(visitor, context = null) {\n // do nothing\n }\n}\nclass ImplicitReceiver extends AST {\n visit(visitor, context = null) {\n return visitor.visitImplicitReceiver(this, context);\n }\n}\n/**\n * Receiver when something is accessed through `this` (e.g. `this.foo`). Note that this class\n * inherits from `ImplicitReceiver`, because accessing something through `this` is treated the\n * same as accessing it implicitly inside of an Angular template (e.g. `[attr.title]=\"this.title\"`\n * is the same as `[attr.title]=\"title\"`.). Inheriting allows for the `this` accesses to be treated\n * the same as implicit ones, except for a couple of exceptions like `$event` and `$any`.\n * TODO: we should find a way for this class not to extend from `ImplicitReceiver` in the future.\n */\nclass ThisReceiver extends ImplicitReceiver {\n visit(visitor, context = null) {\n var _a;\n return (_a = visitor.visitThisReceiver) === null || _a === void 0 ? void 0 : _a.call(visitor, this, context);\n }\n}\n/**\n * Multiple expressions separated by a semicolon.\n */\nclass Chain extends AST {\n constructor(span, sourceSpan, expressions) {\n super(span, sourceSpan);\n this.expressions = expressions;\n }\n visit(visitor, context = null) {\n return visitor.visitChain(this, context);\n }\n}\nclass Conditional extends AST {\n constructor(span, sourceSpan, condition, trueExp, falseExp) {\n super(span, sourceSpan);\n this.condition = condition;\n this.trueExp = trueExp;\n this.falseExp = falseExp;\n }\n visit(visitor, context = null) {\n return visitor.visitConditional(this, context);\n }\n}\nclass PropertyRead extends ASTWithName {\n constructor(span, sourceSpan, nameSpan, receiver, name) {\n super(span, sourceSpan, nameSpan);\n this.receiver = receiver;\n this.name = name;\n }\n visit(visitor, context = null) {\n return visitor.visitPropertyRead(this, context);\n }\n}\nclass PropertyWrite extends ASTWithName {\n constructor(span, sourceSpan, nameSpan, receiver, name, value) {\n super(span, sourceSpan, nameSpan);\n this.receiver = receiver;\n this.name = name;\n this.value = value;\n }\n visit(visitor, context = null) {\n return visitor.visitPropertyWrite(this, context);\n }\n}\nclass SafePropertyRead extends ASTWithName {\n constructor(span, sourceSpan, nameSpan, receiver, name) {\n super(span, sourceSpan, nameSpan);\n this.receiver = receiver;\n this.name = name;\n }\n visit(visitor, context = null) {\n return visitor.visitSafePropertyRead(this, context);\n }\n}\nclass KeyedRead extends AST {\n constructor(span, sourceSpan, receiver, key) {\n super(span, sourceSpan);\n this.receiver = receiver;\n this.key = key;\n }\n visit(visitor, context = null) {\n return visitor.visitKeyedRead(this, context);\n }\n}\nclass SafeKeyedRead extends AST {\n constructor(span, sourceSpan, receiver, key) {\n super(span, sourceSpan);\n this.receiver = receiver;\n this.key = key;\n }\n visit(visitor, context = null) {\n return visitor.visitSafeKeyedRead(this, context);\n }\n}\nclass KeyedWrite extends AST {\n constructor(span, sourceSpan, receiver, key, value) {\n super(span, sourceSpan);\n this.receiver = receiver;\n this.key = key;\n this.value = value;\n }\n visit(visitor, context = null) {\n return visitor.visitKeyedWrite(this, context);\n }\n}\nclass BindingPipe extends ASTWithName {\n constructor(span, sourceSpan, exp, name, args, nameSpan) {\n super(span, sourceSpan, nameSpan);\n this.exp = exp;\n this.name = name;\n this.args = args;\n }\n visit(visitor, context = null) {\n return visitor.visitPipe(this, context);\n }\n}\nclass LiteralPrimitive extends AST {\n constructor(span, sourceSpan, value) {\n super(span, sourceSpan);\n this.value = value;\n }\n visit(visitor, context = null) {\n return visitor.visitLiteralPrimitive(this, context);\n }\n}\nclass LiteralArray extends AST {\n constructor(span, sourceSpan, expressions) {\n super(span, sourceSpan);\n this.expressions = expressions;\n }\n visit(visitor, context = null) {\n return visitor.visitLiteralArray(this, context);\n }\n}\nclass LiteralMap extends AST {\n constructor(span, sourceSpan, keys, values) {\n super(span, sourceSpan);\n this.keys = keys;\n this.values = values;\n }\n visit(visitor, context = null) {\n return visitor.visitLiteralMap(this, context);\n }\n}\nclass Interpolation extends AST {\n constructor(span, sourceSpan, strings, expressions) {\n super(span, sourceSpan);\n this.strings = strings;\n this.expressions = expressions;\n }\n visit(visitor, context = null) {\n return visitor.visitInterpolation(this, context);\n }\n}\nclass Binary extends AST {\n constructor(span, sourceSpan, operation, left, right) {\n super(span, sourceSpan);\n this.operation = operation;\n this.left = left;\n this.right = right;\n }\n visit(visitor, context = null) {\n return visitor.visitBinary(this, context);\n }\n}\n/**\n * For backwards compatibility reasons, `Unary` inherits from `Binary` and mimics the binary AST\n * node that was originally used. This inheritance relation can be deleted in some future major,\n * after consumers have been given a chance to fully support Unary.\n */\nclass Unary extends Binary {\n /**\n * During the deprecation period this constructor is private, to avoid consumers from creating\n * a `Unary` with the fallback properties for `Binary`.\n */\n constructor(span, sourceSpan, operator, expr, binaryOp, binaryLeft, binaryRight) {\n super(span, sourceSpan, binaryOp, binaryLeft, binaryRight);\n this.operator = operator;\n this.expr = expr;\n // Redeclare the properties that are inherited from `Binary` as `never`, as consumers should not\n // depend on these fields when operating on `Unary`.\n this.left = null;\n this.right = null;\n this.operation = null;\n }\n /**\n * Creates a unary minus expression \"-x\", represented as `Binary` using \"0 - x\".\n */\n static createMinus(span, sourceSpan, expr) {\n return new Unary(span, sourceSpan, '-', expr, '-', new LiteralPrimitive(span, sourceSpan, 0), expr);\n }\n /**\n * Creates a unary plus expression \"+x\", represented as `Binary` using \"x - 0\".\n */\n static createPlus(span, sourceSpan, expr) {\n return new Unary(span, sourceSpan, '+', expr, '-', expr, new LiteralPrimitive(span, sourceSpan, 0));\n }\n visit(visitor, context = null) {\n if (visitor.visitUnary !== undefined) {\n return visitor.visitUnary(this, context);\n }\n return visitor.visitBinary(this, context);\n }\n}\nclass PrefixNot extends AST {\n constructor(span, sourceSpan, expression) {\n super(span, sourceSpan);\n this.expression = expression;\n }\n visit(visitor, context = null) {\n return visitor.visitPrefixNot(this, context);\n }\n}\nclass NonNullAssert extends AST {\n constructor(span, sourceSpan, expression) {\n super(span, sourceSpan);\n this.expression = expression;\n }\n visit(visitor, context = null) {\n return visitor.visitNonNullAssert(this, context);\n }\n}\nclass Call extends AST {\n constructor(span, sourceSpan, receiver, args, argumentSpan) {\n super(span, sourceSpan);\n this.receiver = receiver;\n this.args = args;\n this.argumentSpan = argumentSpan;\n }\n visit(visitor, context = null) {\n return visitor.visitCall(this, context);\n }\n}\nclass SafeCall extends AST {\n constructor(span, sourceSpan, receiver, args, argumentSpan) {\n super(span, sourceSpan);\n this.receiver = receiver;\n this.args = args;\n this.argumentSpan = argumentSpan;\n }\n visit(visitor, context = null) {\n return visitor.visitSafeCall(this, context);\n }\n}\n/**\n * Records the absolute position of a text span in a source file, where `start` and `end` are the\n * starting and ending byte offsets, respectively, of the text span in a source file.\n */\nclass AbsoluteSourceSpan {\n constructor(start, end) {\n this.start = start;\n this.end = end;\n }\n}\nclass ASTWithSource extends AST {\n constructor(ast, source, location, absoluteOffset, errors) {\n super(new ParseSpan(0, source === null ? 0 : source.length), new AbsoluteSourceSpan(absoluteOffset, source === null ? absoluteOffset : absoluteOffset + source.length));\n this.ast = ast;\n this.source = source;\n this.location = location;\n this.errors = errors;\n }\n visit(visitor, context = null) {\n if (visitor.visitASTWithSource) {\n return visitor.visitASTWithSource(this, context);\n }\n return this.ast.visit(visitor, context);\n }\n toString() {\n return `${this.source} in ${this.location}`;\n }\n}\nclass VariableBinding {\n /**\n * @param sourceSpan entire span of the binding.\n * @param key name of the LHS along with its span.\n * @param value optional value for the RHS along with its span.\n */\n constructor(sourceSpan, key, value) {\n this.sourceSpan = sourceSpan;\n this.key = key;\n this.value = value;\n }\n}\nclass ExpressionBinding {\n /**\n * @param sourceSpan entire span of the binding.\n * @param key binding name, like ngForOf, ngForTrackBy, ngIf, along with its\n * span. Note that the length of the span may not be the same as\n * `key.source.length`. For example,\n * 1. key.source = ngFor, key.span is for \"ngFor\"\n * 2. key.source = ngForOf, key.span is for \"of\"\n * 3. key.source = ngForTrackBy, key.span is for \"trackBy\"\n * @param value optional expression for the RHS.\n */\n constructor(sourceSpan, key, value) {\n this.sourceSpan = sourceSpan;\n this.key = key;\n this.value = value;\n }\n}\nclass RecursiveAstVisitor {\n visit(ast, context) {\n // The default implementation just visits every node.\n // Classes that extend RecursiveAstVisitor should override this function\n // to selectively visit the specified node.\n ast.visit(this, context);\n }\n visitUnary(ast, context) {\n this.visit(ast.expr, context);\n }\n visitBinary(ast, context) {\n this.visit(ast.left, context);\n this.visit(ast.right, context);\n }\n visitChain(ast, context) {\n this.visitAll(ast.expressions, context);\n }\n visitConditional(ast, context) {\n this.visit(ast.condition, context);\n this.visit(ast.trueExp, context);\n this.visit(ast.falseExp, context);\n }\n visitPipe(ast, context) {\n this.visit(ast.exp, context);\n this.visitAll(ast.args, context);\n }\n visitImplicitReceiver(ast, context) { }\n visitThisReceiver(ast, context) { }\n visitInterpolation(ast, context) {\n this.visitAll(ast.expressions, context);\n }\n visitKeyedRead(ast, context) {\n this.visit(ast.receiver, context);\n this.visit(ast.key, context);\n }\n visitKeyedWrite(ast, context) {\n this.visit(ast.receiver, context);\n this.visit(ast.key, context);\n this.visit(ast.value, context);\n }\n visitLiteralArray(ast, context) {\n this.visitAll(ast.expressions, context);\n }\n visitLiteralMap(ast, context) {\n this.visitAll(ast.values, context);\n }\n visitLiteralPrimitive(ast, context) { }\n visitPrefixNot(ast, context) {\n this.visit(ast.expression, context);\n }\n visitNonNullAssert(ast, context) {\n this.visit(ast.expression, context);\n }\n visitPropertyRead(ast, context) {\n this.visit(ast.receiver, context);\n }\n visitPropertyWrite(ast, context) {\n this.visit(ast.receiver, context);\n this.visit(ast.value, context);\n }\n visitSafePropertyRead(ast, context) {\n this.visit(ast.receiver, context);\n }\n visitSafeKeyedRead(ast, context) {\n this.visit(ast.receiver, context);\n this.visit(ast.key, context);\n }\n visitCall(ast, context) {\n this.visit(ast.receiver, context);\n this.visitAll(ast.args, context);\n }\n visitSafeCall(ast, context) {\n this.visit(ast.receiver, context);\n this.visitAll(ast.args, context);\n }\n // This is not part of the AstVisitor interface, just a helper method\n visitAll(asts, context) {\n for (const ast of asts) {\n this.visit(ast, context);\n }\n }\n}\nclass AstTransformer {\n visitImplicitReceiver(ast, context) {\n return ast;\n }\n visitThisReceiver(ast, context) {\n return ast;\n }\n visitInterpolation(ast, context) {\n return new Interpolation(ast.span, ast.sourceSpan, ast.strings, this.visitAll(ast.expressions));\n }\n visitLiteralPrimitive(ast, context) {\n return new LiteralPrimitive(ast.span, ast.sourceSpan, ast.value);\n }\n visitPropertyRead(ast, context) {\n return new PropertyRead(ast.span, ast.sourceSpan, ast.nameSpan, ast.receiver.visit(this), ast.name);\n }\n visitPropertyWrite(ast, context) {\n return new PropertyWrite(ast.span, ast.sourceSpan, ast.nameSpan, ast.receiver.visit(this), ast.name, ast.value.visit(this));\n }\n visitSafePropertyRead(ast, context) {\n return new SafePropertyRead(ast.span, ast.sourceSpan, ast.nameSpan, ast.receiver.visit(this), ast.name);\n }\n visitLiteralArray(ast, context) {\n return new LiteralArray(ast.span, ast.sourceSpan, this.visitAll(ast.expressions));\n }\n visitLiteralMap(ast, context) {\n return new LiteralMap(ast.span, ast.sourceSpan, ast.keys, this.visitAll(ast.values));\n }\n visitUnary(ast, context) {\n switch (ast.operator) {\n case '+':\n return Unary.createPlus(ast.span, ast.sourceSpan, ast.expr.visit(this));\n case '-':\n return Unary.createMinus(ast.span, ast.sourceSpan, ast.expr.visit(this));\n default:\n throw new Error(`Unknown unary operator ${ast.operator}`);\n }\n }\n visitBinary(ast, context) {\n return new Binary(ast.span, ast.sourceSpan, ast.operation, ast.left.visit(this), ast.right.visit(this));\n }\n visitPrefixNot(ast, context) {\n return new PrefixNot(ast.span, ast.sourceSpan, ast.expression.visit(this));\n }\n visitNonNullAssert(ast, context) {\n return new NonNullAssert(ast.span, ast.sourceSpan, ast.expression.visit(this));\n }\n visitConditional(ast, context) {\n return new Conditional(ast.span, ast.sourceSpan, ast.condition.visit(this), ast.trueExp.visit(this), ast.falseExp.visit(this));\n }\n visitPipe(ast, context) {\n return new BindingPipe(ast.span, ast.sourceSpan, ast.exp.visit(this), ast.name, this.visitAll(ast.args), ast.nameSpan);\n }\n visitKeyedRead(ast, context) {\n return new KeyedRead(ast.span, ast.sourceSpan, ast.receiver.visit(this), ast.key.visit(this));\n }\n visitKeyedWrite(ast, context) {\n return new KeyedWrite(ast.span, ast.sourceSpan, ast.receiver.visit(this), ast.key.visit(this), ast.value.visit(this));\n }\n visitCall(ast, context) {\n return new Call(ast.span, ast.sourceSpan, ast.receiver.visit(this), this.visitAll(ast.args), ast.argumentSpan);\n }\n visitSafeCall(ast, context) {\n return new SafeCall(ast.span, ast.sourceSpan, ast.receiver.visit(this), this.visitAll(ast.args), ast.argumentSpan);\n }\n visitAll(asts) {\n const res = [];\n for (let i = 0; i < asts.length; ++i) {\n res[i] = asts[i].visit(this);\n }\n return res;\n }\n visitChain(ast, context) {\n return new Chain(ast.span, ast.sourceSpan, this.visitAll(ast.expressions));\n }\n visitSafeKeyedRead(ast, context) {\n return new SafeKeyedRead(ast.span, ast.sourceSpan, ast.receiver.visit(this), ast.key.visit(this));\n }\n}\n// A transformer that only creates new nodes if the transformer makes a change or\n// a change is made a child node.\nclass AstMemoryEfficientTransformer {\n visitImplicitReceiver(ast, context) {\n return ast;\n }\n visitThisReceiver(ast, context) {\n return ast;\n }\n visitInterpolation(ast, context) {\n const expressions = this.visitAll(ast.expressions);\n if (expressions !== ast.expressions)\n return new Interpolation(ast.span, ast.sourceSpan, ast.strings, expressions);\n return ast;\n }\n visitLiteralPrimitive(ast, context) {\n return ast;\n }\n visitPropertyRead(ast, context) {\n const receiver = ast.receiver.visit(this);\n if (receiver !== ast.receiver) {\n return new PropertyRead(ast.span, ast.sourceSpan, ast.nameSpan, receiver, ast.name);\n }\n return ast;\n }\n visitPropertyWrite(ast, context) {\n const receiver = ast.receiver.visit(this);\n const value = ast.value.visit(this);\n if (receiver !== ast.receiver || value !== ast.value) {\n return new PropertyWrite(ast.span, ast.sourceSpan, ast.nameSpan, receiver, ast.name, value);\n }\n return ast;\n }\n visitSafePropertyRead(ast, context) {\n const receiver = ast.receiver.visit(this);\n if (receiver !== ast.receiver) {\n return new SafePropertyRead(ast.span, ast.sourceSpan, ast.nameSpan, receiver, ast.name);\n }\n return ast;\n }\n visitLiteralArray(ast, context) {\n const expressions = this.visitAll(ast.expressions);\n if (expressions !== ast.expressions) {\n return new LiteralArray(ast.span, ast.sourceSpan, expressions);\n }\n return ast;\n }\n visitLiteralMap(ast, context) {\n const values = this.visitAll(ast.values);\n if (values !== ast.values) {\n return new LiteralMap(ast.span, ast.sourceSpan, ast.keys, values);\n }\n return ast;\n }\n visitUnary(ast, context) {\n const expr = ast.expr.visit(this);\n if (expr !== ast.expr) {\n switch (ast.operator) {\n case '+':\n return Unary.createPlus(ast.span, ast.sourceSpan, expr);\n case '-':\n return Unary.createMinus(ast.span, ast.sourceSpan, expr);\n default:\n throw new Error(`Unknown unary operator ${ast.operator}`);\n }\n }\n return ast;\n }\n visitBinary(ast, context) {\n const left = ast.left.visit(this);\n const right = ast.right.visit(this);\n if (left !== ast.left || right !== ast.right) {\n return new Binary(ast.span, ast.sourceSpan, ast.operation, left, right);\n }\n return ast;\n }\n visitPrefixNot(ast, context) {\n const expression = ast.expression.visit(this);\n if (expression !== ast.expression) {\n return new PrefixNot(ast.span, ast.sourceSpan, expression);\n }\n return ast;\n }\n visitNonNullAssert(ast, context) {\n const expression = ast.expression.visit(this);\n if (expression !== ast.expression) {\n return new NonNullAssert(ast.span, ast.sourceSpan, expression);\n }\n return ast;\n }\n visitConditional(ast, context) {\n const condition = ast.condition.visit(this);\n const trueExp = ast.trueExp.visit(this);\n const falseExp = ast.falseExp.visit(this);\n if (condition !== ast.condition || trueExp !== ast.trueExp || falseExp !== ast.falseExp) {\n return new Conditional(ast.span, ast.sourceSpan, condition, trueExp, falseExp);\n }\n return ast;\n }\n visitPipe(ast, context) {\n const exp = ast.exp.visit(this);\n const args = this.visitAll(ast.args);\n if (exp !== ast.exp || args !== ast.args) {\n return new BindingPipe(ast.span, ast.sourceSpan, exp, ast.name, args, ast.nameSpan);\n }\n return ast;\n }\n visitKeyedRead(ast, context) {\n const obj = ast.receiver.visit(this);\n const key = ast.key.visit(this);\n if (obj !== ast.receiver || key !== ast.key) {\n return new KeyedRead(ast.span, ast.sourceSpan, obj, key);\n }\n return ast;\n }\n visitKeyedWrite(ast, context) {\n const obj = ast.receiver.visit(this);\n const key = ast.key.visit(this);\n const value = ast.value.visit(this);\n if (obj !== ast.receiver || key !== ast.key || value !== ast.value) {\n return new KeyedWrite(ast.span, ast.sourceSpan, obj, key, value);\n }\n return ast;\n }\n visitAll(asts) {\n const res = [];\n let modified = false;\n for (let i = 0; i < asts.length; ++i) {\n const original = asts[i];\n const value = original.visit(this);\n res[i] = value;\n modified = modified || value !== original;\n }\n return modified ? res : asts;\n }\n visitChain(ast, context) {\n const expressions = this.visitAll(ast.expressions);\n if (expressions !== ast.expressions) {\n return new Chain(ast.span, ast.sourceSpan, expressions);\n }\n return ast;\n }\n visitCall(ast, context) {\n const receiver = ast.receiver.visit(this);\n const args = this.visitAll(ast.args);\n if (receiver !== ast.receiver || args !== ast.args) {\n return new Call(ast.span, ast.sourceSpan, receiver, args, ast.argumentSpan);\n }\n return ast;\n }\n visitSafeCall(ast, context) {\n const receiver = ast.receiver.visit(this);\n const args = this.visitAll(ast.args);\n if (receiver !== ast.receiver || args !== ast.args) {\n return new SafeCall(ast.span, ast.sourceSpan, receiver, args, ast.argumentSpan);\n }\n return ast;\n }\n visitSafeKeyedRead(ast, context) {\n const obj = ast.receiver.visit(this);\n const key = ast.key.visit(this);\n if (obj !== ast.receiver || key !== ast.key) {\n return new SafeKeyedRead(ast.span, ast.sourceSpan, obj, key);\n }\n return ast;\n }\n}\n// Bindings\nclass ParsedProperty {\n constructor(name, expression, type, sourceSpan, keySpan, valueSpan) {\n this.name = name;\n this.expression = expression;\n this.type = type;\n this.sourceSpan = sourceSpan;\n this.keySpan = keySpan;\n this.valueSpan = valueSpan;\n this.isLiteral = this.type === ParsedPropertyType.LITERAL_ATTR;\n this.isAnimation = this.type === ParsedPropertyType.ANIMATION;\n }\n}\nvar ParsedPropertyType;\n(function (ParsedPropertyType) {\n ParsedPropertyType[ParsedPropertyType[\"DEFAULT\"] = 0] = \"DEFAULT\";\n ParsedPropertyType[ParsedPropertyType[\"LITERAL_ATTR\"] = 1] = \"LITERAL_ATTR\";\n ParsedPropertyType[ParsedPropertyType[\"ANIMATION\"] = 2] = \"ANIMATION\";\n})(ParsedPropertyType || (ParsedPropertyType = {}));\nclass ParsedEvent {\n // Regular events have a target\n // Animation events have a phase\n constructor(name, targetOrPhase, type, handler, sourceSpan, handlerSpan, keySpan) {\n this.name = name;\n this.targetOrPhase = targetOrPhase;\n this.type = type;\n this.handler = handler;\n this.sourceSpan = sourceSpan;\n this.handlerSpan = handlerSpan;\n this.keySpan = keySpan;\n }\n}\n/**\n * ParsedVariable represents a variable declaration in a microsyntax expression.\n */\nclass ParsedVariable {\n constructor(name, value, sourceSpan, keySpan, valueSpan) {\n this.name = name;\n this.value = value;\n this.sourceSpan = sourceSpan;\n this.keySpan = keySpan;\n this.valueSpan = valueSpan;\n }\n}\nclass BoundElementProperty {\n constructor(name, type, securityContext, value, unit, sourceSpan, keySpan, valueSpan) {\n this.name = name;\n this.type = type;\n this.securityContext = securityContext;\n this.value = value;\n this.unit = unit;\n this.sourceSpan = sourceSpan;\n this.keySpan = keySpan;\n this.valueSpan = valueSpan;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass EventHandlerVars {\n}\nEventHandlerVars.event = variable('$event');\n/**\n * Converts the given expression AST into an executable output AST, assuming the expression is\n * used in an action binding (e.g. an event handler).\n */\nfunction convertActionBinding(localResolver, implicitReceiver, action, bindingId, baseSourceSpan, implicitReceiverAccesses, globals) {\n if (!localResolver) {\n localResolver = new DefaultLocalResolver(globals);\n }\n const actionWithoutBuiltins = convertPropertyBindingBuiltins({\n createLiteralArrayConverter: (argCount) => {\n // Note: no caching for literal arrays in actions.\n return (args) => literalArr(args);\n },\n createLiteralMapConverter: (keys) => {\n // Note: no caching for literal maps in actions.\n return (values) => {\n const entries = keys.map((k, i) => ({\n key: k.key,\n value: values[i],\n quoted: k.quoted,\n }));\n return literalMap(entries);\n };\n },\n createPipeConverter: (name) => {\n throw new Error(`Illegal State: Actions are not allowed to contain pipes. Pipe: ${name}`);\n }\n }, action);\n const visitor = new _AstToIrVisitor(localResolver, implicitReceiver, bindingId, /* supportsInterpolation */ false, baseSourceSpan, implicitReceiverAccesses);\n const actionStmts = [];\n flattenStatements(actionWithoutBuiltins.visit(visitor, _Mode.Statement), actionStmts);\n prependTemporaryDecls(visitor.temporaryCount, bindingId, actionStmts);\n if (visitor.usesImplicitReceiver) {\n localResolver.notifyImplicitReceiverUse();\n }\n const lastIndex = actionStmts.length - 1;\n if (lastIndex >= 0) {\n const lastStatement = actionStmts[lastIndex];\n // Ensure that the value of the last expression statement is returned\n if (lastStatement instanceof ExpressionStatement) {\n actionStmts[lastIndex] = new ReturnStatement(lastStatement.expr);\n }\n }\n return actionStmts;\n}\nfunction convertPropertyBindingBuiltins(converterFactory, ast) {\n return convertBuiltins(converterFactory, ast);\n}\nclass ConvertPropertyBindingResult {\n constructor(stmts, currValExpr) {\n this.stmts = stmts;\n this.currValExpr = currValExpr;\n }\n}\n/**\n * Converts the given expression AST into an executable output AST, assuming the expression\n * is used in property binding. The expression has to be preprocessed via\n * `convertPropertyBindingBuiltins`.\n */\nfunction convertPropertyBinding(localResolver, implicitReceiver, expressionWithoutBuiltins, bindingId) {\n if (!localResolver) {\n localResolver = new DefaultLocalResolver();\n }\n const visitor = new _AstToIrVisitor(localResolver, implicitReceiver, bindingId, /* supportsInterpolation */ false);\n const outputExpr = expressionWithoutBuiltins.visit(visitor, _Mode.Expression);\n const stmts = getStatementsFromVisitor(visitor, bindingId);\n if (visitor.usesImplicitReceiver) {\n localResolver.notifyImplicitReceiverUse();\n }\n return new ConvertPropertyBindingResult(stmts, outputExpr);\n}\n/**\n * Given some expression, such as a binding or interpolation expression, and a context expression to\n * look values up on, visit each facet of the given expression resolving values from the context\n * expression such that a list of arguments can be derived from the found values that can be used as\n * arguments to an external update instruction.\n *\n * @param localResolver The resolver to use to look up expressions by name appropriately\n * @param contextVariableExpression The expression representing the context variable used to create\n * the final argument expressions\n * @param expressionWithArgumentsToExtract The expression to visit to figure out what values need to\n * be resolved and what arguments list to build.\n * @param bindingId A name prefix used to create temporary variable names if they're needed for the\n * arguments generated\n * @returns An array of expressions that can be passed as arguments to instruction expressions like\n * `o.importExpr(R3.propertyInterpolate).callFn(result)`\n */\nfunction convertUpdateArguments(localResolver, contextVariableExpression, expressionWithArgumentsToExtract, bindingId) {\n const visitor = new _AstToIrVisitor(localResolver, contextVariableExpression, bindingId, /* supportsInterpolation */ true);\n const outputExpr = visitor.visitInterpolation(expressionWithArgumentsToExtract, _Mode.Expression);\n if (visitor.usesImplicitReceiver) {\n localResolver.notifyImplicitReceiverUse();\n }\n const stmts = getStatementsFromVisitor(visitor, bindingId);\n const args = outputExpr.args;\n return { stmts, args };\n}\nfunction getStatementsFromVisitor(visitor, bindingId) {\n const stmts = [];\n for (let i = 0; i < visitor.temporaryCount; i++) {\n stmts.push(temporaryDeclaration(bindingId, i));\n }\n return stmts;\n}\nfunction convertBuiltins(converterFactory, ast) {\n const visitor = new _BuiltinAstConverter(converterFactory);\n return ast.visit(visitor);\n}\nfunction temporaryName(bindingId, temporaryNumber) {\n return `tmp_${bindingId}_${temporaryNumber}`;\n}\nfunction temporaryDeclaration(bindingId, temporaryNumber) {\n return new DeclareVarStmt(temporaryName(bindingId, temporaryNumber));\n}\nfunction prependTemporaryDecls(temporaryCount, bindingId, statements) {\n for (let i = temporaryCount - 1; i >= 0; i--) {\n statements.unshift(temporaryDeclaration(bindingId, i));\n }\n}\nvar _Mode;\n(function (_Mode) {\n _Mode[_Mode[\"Statement\"] = 0] = \"Statement\";\n _Mode[_Mode[\"Expression\"] = 1] = \"Expression\";\n})(_Mode || (_Mode = {}));\nfunction ensureStatementMode(mode, ast) {\n if (mode !== _Mode.Statement) {\n throw new Error(`Expected a statement, but saw ${ast}`);\n }\n}\nfunction ensureExpressionMode(mode, ast) {\n if (mode !== _Mode.Expression) {\n throw new Error(`Expected an expression, but saw ${ast}`);\n }\n}\nfunction convertToStatementIfNeeded(mode, expr) {\n if (mode === _Mode.Statement) {\n return expr.toStmt();\n }\n else {\n return expr;\n }\n}\nclass _BuiltinAstConverter extends AstTransformer {\n constructor(_converterFactory) {\n super();\n this._converterFactory = _converterFactory;\n }\n visitPipe(ast, context) {\n const args = [ast.exp, ...ast.args].map(ast => ast.visit(this, context));\n return new BuiltinFunctionCall(ast.span, ast.sourceSpan, args, this._converterFactory.createPipeConverter(ast.name, args.length));\n }\n visitLiteralArray(ast, context) {\n const args = ast.expressions.map(ast => ast.visit(this, context));\n return new BuiltinFunctionCall(ast.span, ast.sourceSpan, args, this._converterFactory.createLiteralArrayConverter(ast.expressions.length));\n }\n visitLiteralMap(ast, context) {\n const args = ast.values.map(ast => ast.visit(this, context));\n return new BuiltinFunctionCall(ast.span, ast.sourceSpan, args, this._converterFactory.createLiteralMapConverter(ast.keys));\n }\n}\nclass _AstToIrVisitor {\n constructor(_localResolver, _implicitReceiver, bindingId, supportsInterpolation, baseSourceSpan, implicitReceiverAccesses) {\n this._localResolver = _localResolver;\n this._implicitReceiver = _implicitReceiver;\n this.bindingId = bindingId;\n this.supportsInterpolation = supportsInterpolation;\n this.baseSourceSpan = baseSourceSpan;\n this.implicitReceiverAccesses = implicitReceiverAccesses;\n this._nodeMap = new Map();\n this._resultMap = new Map();\n this._currentTemporary = 0;\n this.temporaryCount = 0;\n this.usesImplicitReceiver = false;\n }\n visitUnary(ast, mode) {\n let op;\n switch (ast.operator) {\n case '+':\n op = UnaryOperator.Plus;\n break;\n case '-':\n op = UnaryOperator.Minus;\n break;\n default:\n throw new Error(`Unsupported operator ${ast.operator}`);\n }\n return convertToStatementIfNeeded(mode, new UnaryOperatorExpr(op, this._visit(ast.expr, _Mode.Expression), undefined, this.convertSourceSpan(ast.span)));\n }\n visitBinary(ast, mode) {\n let op;\n switch (ast.operation) {\n case '+':\n op = BinaryOperator.Plus;\n break;\n case '-':\n op = BinaryOperator.Minus;\n break;\n case '*':\n op = BinaryOperator.Multiply;\n break;\n case '/':\n op = BinaryOperator.Divide;\n break;\n case '%':\n op = BinaryOperator.Modulo;\n break;\n case '&&':\n op = BinaryOperator.And;\n break;\n case '||':\n op = BinaryOperator.Or;\n break;\n case '==':\n op = BinaryOperator.Equals;\n break;\n case '!=':\n op = BinaryOperator.NotEquals;\n break;\n case '===':\n op = BinaryOperator.Identical;\n break;\n case '!==':\n op = BinaryOperator.NotIdentical;\n break;\n case '<':\n op = BinaryOperator.Lower;\n break;\n case '>':\n op = BinaryOperator.Bigger;\n break;\n case '<=':\n op = BinaryOperator.LowerEquals;\n break;\n case '>=':\n op = BinaryOperator.BiggerEquals;\n break;\n case '??':\n return this.convertNullishCoalesce(ast, mode);\n default:\n throw new Error(`Unsupported operation ${ast.operation}`);\n }\n return convertToStatementIfNeeded(mode, new BinaryOperatorExpr(op, this._visit(ast.left, _Mode.Expression), this._visit(ast.right, _Mode.Expression), undefined, this.convertSourceSpan(ast.span)));\n }\n visitChain(ast, mode) {\n ensureStatementMode(mode, ast);\n return this.visitAll(ast.expressions, mode);\n }\n visitConditional(ast, mode) {\n const value = this._visit(ast.condition, _Mode.Expression);\n return convertToStatementIfNeeded(mode, value.conditional(this._visit(ast.trueExp, _Mode.Expression), this._visit(ast.falseExp, _Mode.Expression), this.convertSourceSpan(ast.span)));\n }\n visitPipe(ast, mode) {\n throw new Error(`Illegal state: Pipes should have been converted into functions. Pipe: ${ast.name}`);\n }\n visitImplicitReceiver(ast, mode) {\n ensureExpressionMode(mode, ast);\n this.usesImplicitReceiver = true;\n return this._implicitReceiver;\n }\n visitThisReceiver(ast, mode) {\n return this.visitImplicitReceiver(ast, mode);\n }\n visitInterpolation(ast, mode) {\n if (!this.supportsInterpolation) {\n throw new Error('Unexpected interpolation');\n }\n ensureExpressionMode(mode, ast);\n let args = [];\n for (let i = 0; i < ast.strings.length - 1; i++) {\n args.push(literal(ast.strings[i]));\n args.push(this._visit(ast.expressions[i], _Mode.Expression));\n }\n args.push(literal(ast.strings[ast.strings.length - 1]));\n // If we're dealing with an interpolation of 1 value with an empty prefix and suffix, reduce the\n // args returned to just the value, because we're going to pass it to a special instruction.\n const strings = ast.strings;\n if (strings.length === 2 && strings[0] === '' && strings[1] === '') {\n // Single argument interpolate instructions.\n args = [args[1]];\n }\n else if (ast.expressions.length >= 9) {\n // 9 or more arguments must be passed to the `interpolateV`-style instructions, which accept\n // an array of arguments\n args = [literalArr(args)];\n }\n return new InterpolationExpression(args);\n }\n visitKeyedRead(ast, mode) {\n const leftMostSafe = this.leftMostSafeNode(ast);\n if (leftMostSafe) {\n return this.convertSafeAccess(ast, leftMostSafe, mode);\n }\n else {\n return convertToStatementIfNeeded(mode, this._visit(ast.receiver, _Mode.Expression).key(this._visit(ast.key, _Mode.Expression)));\n }\n }\n visitKeyedWrite(ast, mode) {\n const obj = this._visit(ast.receiver, _Mode.Expression);\n const key = this._visit(ast.key, _Mode.Expression);\n const value = this._visit(ast.value, _Mode.Expression);\n if (obj === this._implicitReceiver) {\n this._localResolver.maybeRestoreView();\n }\n return convertToStatementIfNeeded(mode, obj.key(key).set(value));\n }\n visitLiteralArray(ast, mode) {\n throw new Error(`Illegal State: literal arrays should have been converted into functions`);\n }\n visitLiteralMap(ast, mode) {\n throw new Error(`Illegal State: literal maps should have been converted into functions`);\n }\n visitLiteralPrimitive(ast, mode) {\n // For literal values of null, undefined, true, or false allow type interference\n // to infer the type.\n const type = ast.value === null || ast.value === undefined || ast.value === true || ast.value === true ?\n INFERRED_TYPE :\n undefined;\n return convertToStatementIfNeeded(mode, literal(ast.value, type, this.convertSourceSpan(ast.span)));\n }\n _getLocal(name, receiver) {\n var _a;\n if (((_a = this._localResolver.globals) === null || _a === void 0 ? void 0 : _a.has(name)) && receiver instanceof ThisReceiver) {\n return null;\n }\n return this._localResolver.getLocal(name);\n }\n visitPrefixNot(ast, mode) {\n return convertToStatementIfNeeded(mode, not(this._visit(ast.expression, _Mode.Expression)));\n }\n visitNonNullAssert(ast, mode) {\n return convertToStatementIfNeeded(mode, this._visit(ast.expression, _Mode.Expression));\n }\n visitPropertyRead(ast, mode) {\n const leftMostSafe = this.leftMostSafeNode(ast);\n if (leftMostSafe) {\n return this.convertSafeAccess(ast, leftMostSafe, mode);\n }\n else {\n let result = null;\n const prevUsesImplicitReceiver = this.usesImplicitReceiver;\n const receiver = this._visit(ast.receiver, _Mode.Expression);\n if (receiver === this._implicitReceiver) {\n result = this._getLocal(ast.name, ast.receiver);\n if (result) {\n // Restore the previous \"usesImplicitReceiver\" state since the implicit\n // receiver has been replaced with a resolved local expression.\n this.usesImplicitReceiver = prevUsesImplicitReceiver;\n this.addImplicitReceiverAccess(ast.name);\n }\n }\n if (result == null) {\n result = receiver.prop(ast.name, this.convertSourceSpan(ast.span));\n }\n return convertToStatementIfNeeded(mode, result);\n }\n }\n visitPropertyWrite(ast, mode) {\n const receiver = this._visit(ast.receiver, _Mode.Expression);\n const prevUsesImplicitReceiver = this.usesImplicitReceiver;\n let varExpr = null;\n if (receiver === this._implicitReceiver) {\n const localExpr = this._getLocal(ast.name, ast.receiver);\n if (localExpr) {\n if (localExpr instanceof ReadPropExpr) {\n // If the local variable is a property read expression, it's a reference\n // to a 'context.property' value and will be used as the target of the\n // write expression.\n varExpr = localExpr;\n // Restore the previous \"usesImplicitReceiver\" state since the implicit\n // receiver has been replaced with a resolved local expression.\n this.usesImplicitReceiver = prevUsesImplicitReceiver;\n this.addImplicitReceiverAccess(ast.name);\n }\n else {\n // Otherwise it's an error.\n const receiver = ast.name;\n const value = (ast.value instanceof PropertyRead) ? ast.value.name : undefined;\n throw new Error(`Cannot assign value \"${value}\" to template variable \"${receiver}\". Template variables are read-only.`);\n }\n }\n }\n // If no local expression could be produced, use the original receiver's\n // property as the target.\n if (varExpr === null) {\n varExpr = receiver.prop(ast.name, this.convertSourceSpan(ast.span));\n }\n return convertToStatementIfNeeded(mode, varExpr.set(this._visit(ast.value, _Mode.Expression)));\n }\n visitSafePropertyRead(ast, mode) {\n return this.convertSafeAccess(ast, this.leftMostSafeNode(ast), mode);\n }\n visitSafeKeyedRead(ast, mode) {\n return this.convertSafeAccess(ast, this.leftMostSafeNode(ast), mode);\n }\n visitAll(asts, mode) {\n return asts.map(ast => this._visit(ast, mode));\n }\n visitCall(ast, mode) {\n const leftMostSafe = this.leftMostSafeNode(ast);\n if (leftMostSafe) {\n return this.convertSafeAccess(ast, leftMostSafe, mode);\n }\n const convertedArgs = this.visitAll(ast.args, _Mode.Expression);\n if (ast instanceof BuiltinFunctionCall) {\n return convertToStatementIfNeeded(mode, ast.converter(convertedArgs));\n }\n const receiver = ast.receiver;\n if (receiver instanceof PropertyRead &&\n receiver.receiver instanceof ImplicitReceiver &&\n !(receiver.receiver instanceof ThisReceiver) && receiver.name === '$any') {\n if (convertedArgs.length !== 1) {\n throw new Error(`Invalid call to $any, expected 1 argument but received ${convertedArgs.length || 'none'}`);\n }\n return convertToStatementIfNeeded(mode, convertedArgs[0]);\n }\n const call = this._visit(receiver, _Mode.Expression)\n .callFn(convertedArgs, this.convertSourceSpan(ast.span));\n return convertToStatementIfNeeded(mode, call);\n }\n visitSafeCall(ast, mode) {\n return this.convertSafeAccess(ast, this.leftMostSafeNode(ast), mode);\n }\n _visit(ast, mode) {\n const result = this._resultMap.get(ast);\n if (result)\n return result;\n return (this._nodeMap.get(ast) || ast).visit(this, mode);\n }\n convertSafeAccess(ast, leftMostSafe, mode) {\n // If the expression contains a safe access node on the left it needs to be converted to\n // an expression that guards the access to the member by checking the receiver for blank. As\n // execution proceeds from left to right, the left most part of the expression must be guarded\n // first but, because member access is left associative, the right side of the expression is at\n // the top of the AST. The desired result requires lifting a copy of the left part of the\n // expression up to test it for blank before generating the unguarded version.\n // Consider, for example the following expression: a?.b.c?.d.e\n // This results in the ast:\n // .\n // / \\\n // ?. e\n // / \\\n // . d\n // / \\\n // ?. c\n // / \\\n // a b\n // The following tree should be generated:\n //\n // /---- ? ----\\\n // / | \\\n // a /--- ? ---\\ null\n // / | \\\n // . . null\n // / \\ / \\\n // . c . e\n // / \\ / \\\n // a b . d\n // / \\\n // . c\n // / \\\n // a b\n //\n // Notice that the first guard condition is the left hand of the left most safe access node\n // which comes in as leftMostSafe to this routine.\n let guardedExpression = this._visit(leftMostSafe.receiver, _Mode.Expression);\n let temporary = undefined;\n if (this.needsTemporaryInSafeAccess(leftMostSafe.receiver)) {\n // If the expression has method calls or pipes then we need to save the result into a\n // temporary variable to avoid calling stateful or impure code more than once.\n temporary = this.allocateTemporary();\n // Preserve the result in the temporary variable\n guardedExpression = temporary.set(guardedExpression);\n // Ensure all further references to the guarded expression refer to the temporary instead.\n this._resultMap.set(leftMostSafe.receiver, temporary);\n }\n const condition = guardedExpression.isBlank();\n // Convert the ast to an unguarded access to the receiver's member. The map will substitute\n // leftMostNode with its unguarded version in the call to `this.visit()`.\n if (leftMostSafe instanceof SafeCall) {\n this._nodeMap.set(leftMostSafe, new Call(leftMostSafe.span, leftMostSafe.sourceSpan, leftMostSafe.receiver, leftMostSafe.args, leftMostSafe.argumentSpan));\n }\n else if (leftMostSafe instanceof SafeKeyedRead) {\n this._nodeMap.set(leftMostSafe, new KeyedRead(leftMostSafe.span, leftMostSafe.sourceSpan, leftMostSafe.receiver, leftMostSafe.key));\n }\n else {\n this._nodeMap.set(leftMostSafe, new PropertyRead(leftMostSafe.span, leftMostSafe.sourceSpan, leftMostSafe.nameSpan, leftMostSafe.receiver, leftMostSafe.name));\n }\n // Recursively convert the node now without the guarded member access.\n const access = this._visit(ast, _Mode.Expression);\n // Remove the mapping. This is not strictly required as the converter only traverses each node\n // once but is safer if the conversion is changed to traverse the nodes more than once.\n this._nodeMap.delete(leftMostSafe);\n // If we allocated a temporary, release it.\n if (temporary) {\n this.releaseTemporary(temporary);\n }\n // Produce the conditional\n return convertToStatementIfNeeded(mode, condition.conditional(NULL_EXPR, access));\n }\n convertNullishCoalesce(ast, mode) {\n const left = this._visit(ast.left, _Mode.Expression);\n const right = this._visit(ast.right, _Mode.Expression);\n const temporary = this.allocateTemporary();\n this.releaseTemporary(temporary);\n // Generate the following expression. It is identical to how TS\n // transpiles binary expressions with a nullish coalescing operator.\n // let temp;\n // (temp = a) !== null && temp !== undefined ? temp : b;\n return convertToStatementIfNeeded(mode, temporary.set(left)\n .notIdentical(NULL_EXPR)\n .and(temporary.notIdentical(literal(undefined)))\n .conditional(temporary, right));\n }\n // Given an expression of the form a?.b.c?.d.e then the left most safe node is\n // the (a?.b). The . and ?. are left associative thus can be rewritten as:\n // ((((a?.c).b).c)?.d).e. This returns the most deeply nested safe read or\n // safe method call as this needs to be transformed initially to:\n // a == null ? null : a.c.b.c?.d.e\n // then to:\n // a == null ? null : a.b.c == null ? null : a.b.c.d.e\n leftMostSafeNode(ast) {\n const visit = (visitor, ast) => {\n return (this._nodeMap.get(ast) || ast).visit(visitor);\n };\n return ast.visit({\n visitUnary(ast) {\n return null;\n },\n visitBinary(ast) {\n return null;\n },\n visitChain(ast) {\n return null;\n },\n visitConditional(ast) {\n return null;\n },\n visitCall(ast) {\n return visit(this, ast.receiver);\n },\n visitSafeCall(ast) {\n return visit(this, ast.receiver) || ast;\n },\n visitImplicitReceiver(ast) {\n return null;\n },\n visitThisReceiver(ast) {\n return null;\n },\n visitInterpolation(ast) {\n return null;\n },\n visitKeyedRead(ast) {\n return visit(this, ast.receiver);\n },\n visitKeyedWrite(ast) {\n return null;\n },\n visitLiteralArray(ast) {\n return null;\n },\n visitLiteralMap(ast) {\n return null;\n },\n visitLiteralPrimitive(ast) {\n return null;\n },\n visitPipe(ast) {\n return null;\n },\n visitPrefixNot(ast) {\n return null;\n },\n visitNonNullAssert(ast) {\n return null;\n },\n visitPropertyRead(ast) {\n return visit(this, ast.receiver);\n },\n visitPropertyWrite(ast) {\n return null;\n },\n visitSafePropertyRead(ast) {\n return visit(this, ast.receiver) || ast;\n },\n visitSafeKeyedRead(ast) {\n return visit(this, ast.receiver) || ast;\n }\n });\n }\n // Returns true of the AST includes a method or a pipe indicating that, if the\n // expression is used as the target of a safe property or method access then\n // the expression should be stored into a temporary variable.\n needsTemporaryInSafeAccess(ast) {\n const visit = (visitor, ast) => {\n return ast && (this._nodeMap.get(ast) || ast).visit(visitor);\n };\n const visitSome = (visitor, ast) => {\n return ast.some(ast => visit(visitor, ast));\n };\n return ast.visit({\n visitUnary(ast) {\n return visit(this, ast.expr);\n },\n visitBinary(ast) {\n return visit(this, ast.left) || visit(this, ast.right);\n },\n visitChain(ast) {\n return false;\n },\n visitConditional(ast) {\n return visit(this, ast.condition) || visit(this, ast.trueExp) || visit(this, ast.falseExp);\n },\n visitCall(ast) {\n return true;\n },\n visitSafeCall(ast) {\n return true;\n },\n visitImplicitReceiver(ast) {\n return false;\n },\n visitThisReceiver(ast) {\n return false;\n },\n visitInterpolation(ast) {\n return visitSome(this, ast.expressions);\n },\n visitKeyedRead(ast) {\n return false;\n },\n visitKeyedWrite(ast) {\n return false;\n },\n visitLiteralArray(ast) {\n return true;\n },\n visitLiteralMap(ast) {\n return true;\n },\n visitLiteralPrimitive(ast) {\n return false;\n },\n visitPipe(ast) {\n return true;\n },\n visitPrefixNot(ast) {\n return visit(this, ast.expression);\n },\n visitNonNullAssert(ast) {\n return visit(this, ast.expression);\n },\n visitPropertyRead(ast) {\n return false;\n },\n visitPropertyWrite(ast) {\n return false;\n },\n visitSafePropertyRead(ast) {\n return false;\n },\n visitSafeKeyedRead(ast) {\n return false;\n }\n });\n }\n allocateTemporary() {\n const tempNumber = this._currentTemporary++;\n this.temporaryCount = Math.max(this._currentTemporary, this.temporaryCount);\n return new ReadVarExpr(temporaryName(this.bindingId, tempNumber));\n }\n releaseTemporary(temporary) {\n this._currentTemporary--;\n if (temporary.name != temporaryName(this.bindingId, this._currentTemporary)) {\n throw new Error(`Temporary ${temporary.name} released out of order`);\n }\n }\n /**\n * Creates an absolute `ParseSourceSpan` from the relative `ParseSpan`.\n *\n * `ParseSpan` objects are relative to the start of the expression.\n * This method converts these to full `ParseSourceSpan` objects that\n * show where the span is within the overall source file.\n *\n * @param span the relative span to convert.\n * @returns a `ParseSourceSpan` for the given span or null if no\n * `baseSourceSpan` was provided to this class.\n */\n convertSourceSpan(span) {\n if (this.baseSourceSpan) {\n const start = this.baseSourceSpan.start.moveBy(span.start);\n const end = this.baseSourceSpan.start.moveBy(span.end);\n const fullStart = this.baseSourceSpan.fullStart.moveBy(span.start);\n return new ParseSourceSpan(start, end, fullStart);\n }\n else {\n return null;\n }\n }\n /** Adds the name of an AST to the list of implicit receiver accesses. */\n addImplicitReceiverAccess(name) {\n if (this.implicitReceiverAccesses) {\n this.implicitReceiverAccesses.add(name);\n }\n }\n}\nfunction flattenStatements(arg, output) {\n if (Array.isArray(arg)) {\n arg.forEach((entry) => flattenStatements(entry, output));\n }\n else {\n output.push(arg);\n }\n}\nfunction unsupported() {\n throw new Error('Unsupported operation');\n}\nclass InterpolationExpression extends Expression {\n constructor(args) {\n super(null, null);\n this.args = args;\n this.isConstant = unsupported;\n this.isEquivalent = unsupported;\n this.visitExpression = unsupported;\n }\n}\nclass DefaultLocalResolver {\n constructor(globals) {\n this.globals = globals;\n }\n notifyImplicitReceiverUse() { }\n maybeRestoreView() { }\n getLocal(name) {\n if (name === EventHandlerVars.event.name) {\n return EventHandlerVars.event;\n }\n return null;\n }\n}\nclass BuiltinFunctionCall extends Call {\n constructor(span, sourceSpan, args, converter) {\n super(span, sourceSpan, new EmptyExpr(span, sourceSpan), args, null);\n this.converter = converter;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This file is a port of shadowCSS from webcomponents.js to TypeScript.\n *\n * Please make sure to keep to edits in sync with the source file.\n *\n * Source:\n * https://github.com/webcomponents/webcomponentsjs/blob/4efecd7e0e/src/ShadowCSS/ShadowCSS.js\n *\n * The original file level comment is reproduced below\n */\n/*\n This is a limited shim for ShadowDOM css styling.\n https://dvcs.w3.org/hg/webcomponents/raw-file/tip/spec/shadow/index.html#styles\n\n The intention here is to support only the styling features which can be\n relatively simply implemented. The goal is to allow users to avoid the\n most obvious pitfalls and do so without compromising performance significantly.\n For ShadowDOM styling that's not covered here, a set of best practices\n can be provided that should allow users to accomplish more complex styling.\n\n The following is a list of specific ShadowDOM styling features and a brief\n discussion of the approach used to shim.\n\n Shimmed features:\n\n * :host, :host-context: ShadowDOM allows styling of the shadowRoot's host\n element using the :host rule. To shim this feature, the :host styles are\n reformatted and prefixed with a given scope name and promoted to a\n document level stylesheet.\n For example, given a scope name of .foo, a rule like this:\n\n :host {\n background: red;\n }\n }\n\n becomes:\n\n .foo {\n background: red;\n }\n\n * encapsulation: Styles defined within ShadowDOM, apply only to\n dom inside the ShadowDOM. Polymer uses one of two techniques to implement\n this feature.\n\n By default, rules are prefixed with the host element tag name\n as a descendant selector. This ensures styling does not leak out of the 'top'\n of the element's ShadowDOM. For example,\n\n div {\n font-weight: bold;\n }\n\n becomes:\n\n x-foo div {\n font-weight: bold;\n }\n\n becomes:\n\n\n Alternatively, if WebComponents.ShadowCSS.strictStyling is set to true then\n selectors are scoped by adding an attribute selector suffix to each\n simple selector that contains the host element tag name. Each element\n in the element's ShadowDOM template is also given the scope attribute.\n Thus, these rules match only elements that have the scope attribute.\n For example, given a scope name of x-foo, a rule like this:\n\n div {\n font-weight: bold;\n }\n\n becomes:\n\n div[x-foo] {\n font-weight: bold;\n }\n\n Note that elements that are dynamically added to a scope must have the scope\n selector added to them manually.\n\n * upper/lower bound encapsulation: Styles which are defined outside a\n shadowRoot should not cross the ShadowDOM boundary and should not apply\n inside a shadowRoot.\n\n This styling behavior is not emulated. Some possible ways to do this that\n were rejected due to complexity and/or performance concerns include: (1) reset\n every possible property for every possible selector for a given scope name;\n (2) re-implement css in javascript.\n\n As an alternative, users should make sure to use selectors\n specific to the scope in which they are working.\n\n * ::distributed: This behavior is not emulated. It's often not necessary\n to style the contents of a specific insertion point and instead, descendants\n of the host element can be styled selectively. Users can also create an\n extra node around an insertion point and style that node's contents\n via descendent selectors. For example, with a shadowRoot like this:\n\n \n \n\n could become:\n\n \n \n \n
\n\n Note the use of @polyfill in the comment above a ShadowDOM specific style\n declaration. This is a directive to the styling shim to use the selector\n in comments in lieu of the next selector when running under polyfill.\n*/\nclass ShadowCss {\n constructor() {\n this.strictStyling = true;\n }\n /*\n * Shim some cssText with the given selector. Returns cssText that can\n * be included in the document via WebComponents.ShadowCSS.addCssToDocument(css).\n *\n * When strictStyling is true:\n * - selector is the attribute added to all elements inside the host,\n * - hostSelector is the attribute added to the host itself.\n */\n shimCssText(cssText, selector, hostSelector = '') {\n const commentsWithHash = extractCommentsWithHash(cssText);\n cssText = stripComments(cssText);\n cssText = this._insertDirectives(cssText);\n const scopedCssText = this._scopeCssText(cssText, selector, hostSelector);\n return [scopedCssText, ...commentsWithHash].join('\\n');\n }\n _insertDirectives(cssText) {\n cssText = this._insertPolyfillDirectivesInCssText(cssText);\n return this._insertPolyfillRulesInCssText(cssText);\n }\n /*\n * Process styles to convert native ShadowDOM rules that will trip\n * up the css parser; we rely on decorating the stylesheet with inert rules.\n *\n * For example, we convert this rule:\n *\n * polyfill-next-selector { content: ':host menu-item'; }\n * ::content menu-item {\n *\n * to this:\n *\n * scopeName menu-item {\n *\n **/\n _insertPolyfillDirectivesInCssText(cssText) {\n // Difference with webcomponents.js: does not handle comments\n return cssText.replace(_cssContentNextSelectorRe, function (...m) {\n return m[2] + '{';\n });\n }\n /*\n * Process styles to add rules which will only apply under the polyfill\n *\n * For example, we convert this rule:\n *\n * polyfill-rule {\n * content: ':host menu-item';\n * ...\n * }\n *\n * to this:\n *\n * scopeName menu-item {...}\n *\n **/\n _insertPolyfillRulesInCssText(cssText) {\n // Difference with webcomponents.js: does not handle comments\n return cssText.replace(_cssContentRuleRe, (...m) => {\n const rule = m[0].replace(m[1], '').replace(m[2], '');\n return m[4] + rule;\n });\n }\n /* Ensure styles are scoped. Pseudo-scoping takes a rule like:\n *\n * .foo {... }\n *\n * and converts this to\n *\n * scopeName .foo { ... }\n */\n _scopeCssText(cssText, scopeSelector, hostSelector) {\n const unscopedRules = this._extractUnscopedRulesFromCssText(cssText);\n // replace :host and :host-context -shadowcsshost and -shadowcsshost respectively\n cssText = this._insertPolyfillHostInCssText(cssText);\n cssText = this._convertColonHost(cssText);\n cssText = this._convertColonHostContext(cssText);\n cssText = this._convertShadowDOMSelectors(cssText);\n if (scopeSelector) {\n cssText = this._scopeSelectors(cssText, scopeSelector, hostSelector);\n }\n cssText = cssText + '\\n' + unscopedRules;\n return cssText.trim();\n }\n /*\n * Process styles to add rules which will only apply under the polyfill\n * and do not process via CSSOM. (CSSOM is destructive to rules on rare\n * occasions, e.g. -webkit-calc on Safari.)\n * For example, we convert this rule:\n *\n * @polyfill-unscoped-rule {\n * content: 'menu-item';\n * ... }\n *\n * to this:\n *\n * menu-item {...}\n *\n **/\n _extractUnscopedRulesFromCssText(cssText) {\n // Difference with webcomponents.js: does not handle comments\n let r = '';\n let m;\n _cssContentUnscopedRuleRe.lastIndex = 0;\n while ((m = _cssContentUnscopedRuleRe.exec(cssText)) !== null) {\n const rule = m[0].replace(m[2], '').replace(m[1], m[4]);\n r += rule + '\\n\\n';\n }\n return r;\n }\n /*\n * convert a rule like :host(.foo) > .bar { }\n *\n * to\n *\n * .foo > .bar\n */\n _convertColonHost(cssText) {\n return cssText.replace(_cssColonHostRe, (_, hostSelectors, otherSelectors) => {\n if (hostSelectors) {\n const convertedSelectors = [];\n const hostSelectorArray = hostSelectors.split(',').map(p => p.trim());\n for (const hostSelector of hostSelectorArray) {\n if (!hostSelector)\n break;\n const convertedSelector = _polyfillHostNoCombinator + hostSelector.replace(_polyfillHost, '') + otherSelectors;\n convertedSelectors.push(convertedSelector);\n }\n return convertedSelectors.join(',');\n }\n else {\n return _polyfillHostNoCombinator + otherSelectors;\n }\n });\n }\n /*\n * convert a rule like :host-context(.foo) > .bar { }\n *\n * to\n *\n * .foo > .bar, .foo > .bar { }\n *\n * and\n *\n * :host-context(.foo:host) .bar { ... }\n *\n * to\n *\n * .foo .bar { ... }\n */\n _convertColonHostContext(cssText) {\n return cssText.replace(_cssColonHostContextReGlobal, selectorText => {\n var _a;\n // We have captured a selector that contains a `:host-context` rule.\n // For backward compatibility `:host-context` may contain a comma separated list of selectors.\n // Each context selector group will contain a list of host-context selectors that must match\n // an ancestor of the host.\n // (Normally `contextSelectorGroups` will only contain a single array of context selectors.)\n const contextSelectorGroups = [[]];\n // There may be more than `:host-context` in this selector so `selectorText` could look like:\n // `:host-context(.one):host-context(.two)`.\n // Execute `_cssColonHostContextRe` over and over until we have extracted all the\n // `:host-context` selectors from this selector.\n let match;\n while (match = _cssColonHostContextRe.exec(selectorText)) {\n // `match` = [':host-context()', , ]\n // The `` could actually be a comma separated list: `:host-context(.one, .two)`.\n const newContextSelectors = ((_a = match[1]) !== null && _a !== void 0 ? _a : '').trim().split(',').map(m => m.trim()).filter(m => m !== '');\n // We must duplicate the current selector group for each of these new selectors.\n // For example if the current groups are:\n // ```\n // [\n // ['a', 'b', 'c'],\n // ['x', 'y', 'z'],\n // ]\n // ```\n // And we have a new set of comma separated selectors: `:host-context(m,n)` then the new\n // groups are:\n // ```\n // [\n // ['a', 'b', 'c', 'm'],\n // ['x', 'y', 'z', 'm'],\n // ['a', 'b', 'c', 'n'],\n // ['x', 'y', 'z', 'n'],\n // ]\n // ```\n const contextSelectorGroupsLength = contextSelectorGroups.length;\n repeatGroups(contextSelectorGroups, newContextSelectors.length);\n for (let i = 0; i < newContextSelectors.length; i++) {\n for (let j = 0; j < contextSelectorGroupsLength; j++) {\n contextSelectorGroups[j + (i * contextSelectorGroupsLength)].push(newContextSelectors[i]);\n }\n }\n // Update the `selectorText` and see repeat to see if there are more `:host-context`s.\n selectorText = match[2];\n }\n // The context selectors now must be combined with each other to capture all the possible\n // selectors that `:host-context` can match. See `combineHostContextSelectors()` for more\n // info about how this is done.\n return contextSelectorGroups\n .map(contextSelectors => combineHostContextSelectors(contextSelectors, selectorText))\n .join(', ');\n });\n }\n /*\n * Convert combinators like ::shadow and pseudo-elements like ::content\n * by replacing with space.\n */\n _convertShadowDOMSelectors(cssText) {\n return _shadowDOMSelectorsRe.reduce((result, pattern) => result.replace(pattern, ' '), cssText);\n }\n // change a selector like 'div' to 'name div'\n _scopeSelectors(cssText, scopeSelector, hostSelector) {\n return processRules(cssText, (rule) => {\n let selector = rule.selector;\n let content = rule.content;\n if (rule.selector[0] !== '@') {\n selector =\n this._scopeSelector(rule.selector, scopeSelector, hostSelector, this.strictStyling);\n }\n else if (rule.selector.startsWith('@media') || rule.selector.startsWith('@supports') ||\n rule.selector.startsWith('@document') || rule.selector.startsWith('@layer')) {\n content = this._scopeSelectors(rule.content, scopeSelector, hostSelector);\n }\n else if (rule.selector.startsWith('@font-face') || rule.selector.startsWith('@page')) {\n content = this._stripScopingSelectors(rule.content);\n }\n return new CssRule(selector, content);\n });\n }\n /**\n * Handle a css text that is within a rule that should not contain scope selectors by simply\n * removing them! An example of such a rule is `@font-face`.\n *\n * `@font-face` rules cannot contain nested selectors. Nor can they be nested under a selector.\n * Normally this would be a syntax error by the author of the styles. But in some rare cases, such\n * as importing styles from a library, and applying `:host ::ng-deep` to the imported styles, we\n * can end up with broken css if the imported styles happen to contain @font-face rules.\n *\n * For example:\n *\n * ```\n * :host ::ng-deep {\n * import 'some/lib/containing/font-face';\n * }\n *\n * Similar logic applies to `@page` rules which can contain a particular set of properties,\n * as well as some specific at-rules. Since they can't be encapsulated, we have to strip\n * any scoping selectors from them. For more information: https://www.w3.org/TR/css-page-3\n * ```\n */\n _stripScopingSelectors(cssText) {\n return processRules(cssText, rule => {\n const selector = rule.selector.replace(_shadowDeepSelectors, ' ')\n .replace(_polyfillHostNoCombinatorRe, ' ');\n return new CssRule(selector, rule.content);\n });\n }\n _scopeSelector(selector, scopeSelector, hostSelector, strict) {\n return selector.split(',')\n .map(part => part.trim().split(_shadowDeepSelectors))\n .map((deepParts) => {\n const [shallowPart, ...otherParts] = deepParts;\n const applyScope = (shallowPart) => {\n if (this._selectorNeedsScoping(shallowPart, scopeSelector)) {\n return strict ?\n this._applyStrictSelectorScope(shallowPart, scopeSelector, hostSelector) :\n this._applySelectorScope(shallowPart, scopeSelector, hostSelector);\n }\n else {\n return shallowPart;\n }\n };\n return [applyScope(shallowPart), ...otherParts].join(' ');\n })\n .join(', ');\n }\n _selectorNeedsScoping(selector, scopeSelector) {\n const re = this._makeScopeMatcher(scopeSelector);\n return !re.test(selector);\n }\n _makeScopeMatcher(scopeSelector) {\n const lre = /\\[/g;\n const rre = /\\]/g;\n scopeSelector = scopeSelector.replace(lre, '\\\\[').replace(rre, '\\\\]');\n return new RegExp('^(' + scopeSelector + ')' + _selectorReSuffix, 'm');\n }\n _applySelectorScope(selector, scopeSelector, hostSelector) {\n // Difference from webcomponents.js: scopeSelector could not be an array\n return this._applySimpleSelectorScope(selector, scopeSelector, hostSelector);\n }\n // scope via name and [is=name]\n _applySimpleSelectorScope(selector, scopeSelector, hostSelector) {\n // In Android browser, the lastIndex is not reset when the regex is used in String.replace()\n _polyfillHostRe.lastIndex = 0;\n if (_polyfillHostRe.test(selector)) {\n const replaceBy = this.strictStyling ? `[${hostSelector}]` : scopeSelector;\n return selector\n .replace(_polyfillHostNoCombinatorRe, (hnc, selector) => {\n return selector.replace(/([^:]*)(:*)(.*)/, (_, before, colon, after) => {\n return before + replaceBy + colon + after;\n });\n })\n .replace(_polyfillHostRe, replaceBy + ' ');\n }\n return scopeSelector + ' ' + selector;\n }\n // return a selector with [name] suffix on each simple selector\n // e.g. .foo.bar > .zot becomes .foo[name].bar[name] > .zot[name] /** @internal */\n _applyStrictSelectorScope(selector, scopeSelector, hostSelector) {\n const isRe = /\\[is=([^\\]]*)\\]/g;\n scopeSelector = scopeSelector.replace(isRe, (_, ...parts) => parts[0]);\n const attrName = '[' + scopeSelector + ']';\n const _scopeSelectorPart = (p) => {\n let scopedP = p.trim();\n if (!scopedP) {\n return '';\n }\n if (p.indexOf(_polyfillHostNoCombinator) > -1) {\n scopedP = this._applySimpleSelectorScope(p, scopeSelector, hostSelector);\n }\n else {\n // remove :host since it should be unnecessary\n const t = p.replace(_polyfillHostRe, '');\n if (t.length > 0) {\n const matches = t.match(/([^:]*)(:*)(.*)/);\n if (matches) {\n scopedP = matches[1] + attrName + matches[2] + matches[3];\n }\n }\n }\n return scopedP;\n };\n const safeContent = new SafeSelector(selector);\n selector = safeContent.content();\n let scopedSelector = '';\n let startIndex = 0;\n let res;\n const sep = /( |>|\\+|~(?!=))\\s*/g;\n // If a selector appears before :host it should not be shimmed as it\n // matches on ancestor elements and not on elements in the host's shadow\n // `:host-context(div)` is transformed to\n // `-shadowcsshost-no-combinatordiv, div -shadowcsshost-no-combinator`\n // the `div` is not part of the component in the 2nd selectors and should not be scoped.\n // Historically `component-tag:host` was matching the component so we also want to preserve\n // this behavior to avoid breaking legacy apps (it should not match).\n // The behavior should be:\n // - `tag:host` -> `tag[h]` (this is to avoid breaking legacy apps, should not match anything)\n // - `tag :host` -> `tag [h]` (`tag` is not scoped because it's considered part of a\n // `:host-context(tag)`)\n const hasHost = selector.indexOf(_polyfillHostNoCombinator) > -1;\n // Only scope parts after the first `-shadowcsshost-no-combinator` when it is present\n let shouldScope = !hasHost;\n while ((res = sep.exec(selector)) !== null) {\n const separator = res[1];\n const part = selector.slice(startIndex, res.index).trim();\n shouldScope = shouldScope || part.indexOf(_polyfillHostNoCombinator) > -1;\n const scopedPart = shouldScope ? _scopeSelectorPart(part) : part;\n scopedSelector += `${scopedPart} ${separator} `;\n startIndex = sep.lastIndex;\n }\n const part = selector.substring(startIndex);\n shouldScope = shouldScope || part.indexOf(_polyfillHostNoCombinator) > -1;\n scopedSelector += shouldScope ? _scopeSelectorPart(part) : part;\n // replace the placeholders with their original values\n return safeContent.restore(scopedSelector);\n }\n _insertPolyfillHostInCssText(selector) {\n return selector.replace(_colonHostContextRe, _polyfillHostContext)\n .replace(_colonHostRe, _polyfillHost);\n }\n}\nclass SafeSelector {\n constructor(selector) {\n this.placeholders = [];\n this.index = 0;\n // Replaces attribute selectors with placeholders.\n // The WS in [attr=\"va lue\"] would otherwise be interpreted as a selector separator.\n selector = this._escapeRegexMatches(selector, /(\\[[^\\]]*\\])/g);\n // CSS allows for certain special characters to be used in selectors if they're escaped.\n // E.g. `.foo:blue` won't match a class called `foo:blue`, because the colon denotes a\n // pseudo-class, but writing `.foo\\:blue` will match, because the colon was escaped.\n // Replace all escape sequences (`\\` followed by a character) with a placeholder so\n // that our handling of pseudo-selectors doesn't mess with them.\n selector = this._escapeRegexMatches(selector, /(\\\\.)/g);\n // Replaces the expression in `:nth-child(2n + 1)` with a placeholder.\n // WS and \"+\" would otherwise be interpreted as selector separators.\n this._content = selector.replace(/(:nth-[-\\w]+)(\\([^)]+\\))/g, (_, pseudo, exp) => {\n const replaceBy = `__ph-${this.index}__`;\n this.placeholders.push(exp);\n this.index++;\n return pseudo + replaceBy;\n });\n }\n restore(content) {\n return content.replace(/__ph-(\\d+)__/g, (_ph, index) => this.placeholders[+index]);\n }\n content() {\n return this._content;\n }\n /**\n * Replaces all of the substrings that match a regex within a\n * special string (e.g. `__ph-0__`, `__ph-1__`, etc).\n */\n _escapeRegexMatches(content, pattern) {\n return content.replace(pattern, (_, keep) => {\n const replaceBy = `__ph-${this.index}__`;\n this.placeholders.push(keep);\n this.index++;\n return replaceBy;\n });\n }\n}\nconst _cssContentNextSelectorRe = /polyfill-next-selector[^}]*content:[\\s]*?(['\"])(.*?)\\1[;\\s]*}([^{]*?){/gim;\nconst _cssContentRuleRe = /(polyfill-rule)[^}]*(content:[\\s]*(['\"])(.*?)\\3)[;\\s]*[^}]*}/gim;\nconst _cssContentUnscopedRuleRe = /(polyfill-unscoped-rule)[^}]*(content:[\\s]*(['\"])(.*?)\\3)[;\\s]*[^}]*}/gim;\nconst _polyfillHost = '-shadowcsshost';\n// note: :host-context pre-processed to -shadowcsshostcontext.\nconst _polyfillHostContext = '-shadowcsscontext';\nconst _parenSuffix = '(?:\\\\((' +\n '(?:\\\\([^)(]*\\\\)|[^)(]*)+?' +\n ')\\\\))?([^,{]*)';\nconst _cssColonHostRe = new RegExp(_polyfillHost + _parenSuffix, 'gim');\nconst _cssColonHostContextReGlobal = new RegExp(_polyfillHostContext + _parenSuffix, 'gim');\nconst _cssColonHostContextRe = new RegExp(_polyfillHostContext + _parenSuffix, 'im');\nconst _polyfillHostNoCombinator = _polyfillHost + '-no-combinator';\nconst _polyfillHostNoCombinatorRe = /-shadowcsshost-no-combinator([^\\s]*)/;\nconst _shadowDOMSelectorsRe = [\n /::shadow/g,\n /::content/g,\n // Deprecated selectors\n /\\/shadow-deep\\//g,\n /\\/shadow\\//g,\n];\n// The deep combinator is deprecated in the CSS spec\n// Support for `>>>`, `deep`, `::ng-deep` is then also deprecated and will be removed in the future.\n// see https://github.com/angular/angular/pull/17677\nconst _shadowDeepSelectors = /(?:>>>)|(?:\\/deep\\/)|(?:::ng-deep)/g;\nconst _selectorReSuffix = '([>\\\\s~+[.,{:][\\\\s\\\\S]*)?$';\nconst _polyfillHostRe = /-shadowcsshost/gim;\nconst _colonHostRe = /:host/gim;\nconst _colonHostContextRe = /:host-context/gim;\nconst _commentRe = /\\/\\*[\\s\\S]*?\\*\\//g;\nfunction stripComments(input) {\n return input.replace(_commentRe, '');\n}\nconst _commentWithHashRe = /\\/\\*\\s*#\\s*source(Mapping)?URL=[\\s\\S]+?\\*\\//g;\nfunction extractCommentsWithHash(input) {\n return input.match(_commentWithHashRe) || [];\n}\nconst BLOCK_PLACEHOLDER = '%BLOCK%';\nconst QUOTE_PLACEHOLDER = '%QUOTED%';\nconst _ruleRe = /(\\s*)([^;\\{\\}]+?)(\\s*)((?:{%BLOCK%}?\\s*;?)|(?:\\s*;))/g;\nconst _quotedRe = /%QUOTED%/g;\nconst CONTENT_PAIRS = new Map([['{', '}']]);\nconst QUOTE_PAIRS = new Map([[`\"`, `\"`], [`'`, `'`]]);\nclass CssRule {\n constructor(selector, content) {\n this.selector = selector;\n this.content = content;\n }\n}\nfunction processRules(input, ruleCallback) {\n const inputWithEscapedQuotes = escapeBlocks(input, QUOTE_PAIRS, QUOTE_PLACEHOLDER);\n const inputWithEscapedBlocks = escapeBlocks(inputWithEscapedQuotes.escapedString, CONTENT_PAIRS, BLOCK_PLACEHOLDER);\n let nextBlockIndex = 0;\n let nextQuoteIndex = 0;\n return inputWithEscapedBlocks.escapedString\n .replace(_ruleRe, (...m) => {\n const selector = m[2];\n let content = '';\n let suffix = m[4];\n let contentPrefix = '';\n if (suffix && suffix.startsWith('{' + BLOCK_PLACEHOLDER)) {\n content = inputWithEscapedBlocks.blocks[nextBlockIndex++];\n suffix = suffix.substring(BLOCK_PLACEHOLDER.length + 1);\n contentPrefix = '{';\n }\n const rule = ruleCallback(new CssRule(selector, content));\n return `${m[1]}${rule.selector}${m[3]}${contentPrefix}${rule.content}${suffix}`;\n })\n .replace(_quotedRe, () => inputWithEscapedQuotes.blocks[nextQuoteIndex++]);\n}\nclass StringWithEscapedBlocks {\n constructor(escapedString, blocks) {\n this.escapedString = escapedString;\n this.blocks = blocks;\n }\n}\nfunction escapeBlocks(input, charPairs, placeholder) {\n const resultParts = [];\n const escapedBlocks = [];\n let openCharCount = 0;\n let nonBlockStartIndex = 0;\n let blockStartIndex = -1;\n let openChar;\n let closeChar;\n for (let i = 0; i < input.length; i++) {\n const char = input[i];\n if (char === '\\\\') {\n i++;\n }\n else if (char === closeChar) {\n openCharCount--;\n if (openCharCount === 0) {\n escapedBlocks.push(input.substring(blockStartIndex, i));\n resultParts.push(placeholder);\n nonBlockStartIndex = i;\n blockStartIndex = -1;\n openChar = closeChar = undefined;\n }\n }\n else if (char === openChar) {\n openCharCount++;\n }\n else if (openCharCount === 0 && charPairs.has(char)) {\n openChar = char;\n closeChar = charPairs.get(char);\n openCharCount = 1;\n blockStartIndex = i + 1;\n resultParts.push(input.substring(nonBlockStartIndex, blockStartIndex));\n }\n }\n if (blockStartIndex !== -1) {\n escapedBlocks.push(input.substring(blockStartIndex));\n resultParts.push(placeholder);\n }\n else {\n resultParts.push(input.substring(nonBlockStartIndex));\n }\n return new StringWithEscapedBlocks(resultParts.join(''), escapedBlocks);\n}\n/**\n * Combine the `contextSelectors` with the `hostMarker` and the `otherSelectors`\n * to create a selector that matches the same as `:host-context()`.\n *\n * Given a single context selector `A` we need to output selectors that match on the host and as an\n * ancestor of the host:\n *\n * ```\n * A , A {}\n * ```\n *\n * When there is more than one context selector we also have to create combinations of those\n * selectors with each other. For example if there are `A` and `B` selectors the output is:\n *\n * ```\n * AB, AB , A B,\n * B A, A B , B A {}\n * ```\n *\n * And so on...\n *\n * @param hostMarker the string that selects the host element.\n * @param contextSelectors an array of context selectors that will be combined.\n * @param otherSelectors the rest of the selectors that are not context selectors.\n */\nfunction combineHostContextSelectors(contextSelectors, otherSelectors) {\n const hostMarker = _polyfillHostNoCombinator;\n _polyfillHostRe.lastIndex = 0; // reset the regex to ensure we get an accurate test\n const otherSelectorsHasHost = _polyfillHostRe.test(otherSelectors);\n // If there are no context selectors then just output a host marker\n if (contextSelectors.length === 0) {\n return hostMarker + otherSelectors;\n }\n const combined = [contextSelectors.pop() || ''];\n while (contextSelectors.length > 0) {\n const length = combined.length;\n const contextSelector = contextSelectors.pop();\n for (let i = 0; i < length; i++) {\n const previousSelectors = combined[i];\n // Add the new selector as a descendant of the previous selectors\n combined[length * 2 + i] = previousSelectors + ' ' + contextSelector;\n // Add the new selector as an ancestor of the previous selectors\n combined[length + i] = contextSelector + ' ' + previousSelectors;\n // Add the new selector to act on the same element as the previous selectors\n combined[i] = contextSelector + previousSelectors;\n }\n }\n // Finally connect the selector to the `hostMarker`s: either acting directly on the host\n // (A) or as an ancestor (A ).\n return combined\n .map(s => otherSelectorsHasHost ?\n `${s}${otherSelectors}` :\n `${s}${hostMarker}${otherSelectors}, ${s} ${hostMarker}${otherSelectors}`)\n .join(',');\n}\n/**\n * Mutate the given `groups` array so that there are `multiples` clones of the original array\n * stored.\n *\n * For example `repeatGroups([a, b], 3)` will result in `[a, b, a, b, a, b]` - but importantly the\n * newly added groups will be clones of the original.\n *\n * @param groups An array of groups of strings that will be repeated. This array is mutated\n * in-place.\n * @param multiples The number of times the current groups should appear.\n */\nfunction repeatGroups(groups, multiples) {\n const length = groups.length;\n for (let i = 1; i < multiples; i++) {\n for (let j = 0; j < length; j++) {\n groups[j + (i * length)] = groups[j].slice(0);\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Parses string representation of a style and converts it into object literal.\n *\n * @param value string representation of style as used in the `style` attribute in HTML.\n * Example: `color: red; height: auto`.\n * @returns An array of style property name and value pairs, e.g. `['color', 'red', 'height',\n * 'auto']`\n */\nfunction parse(value) {\n // we use a string array here instead of a string map\n // because a string-map is not guaranteed to retain the\n // order of the entries whereas a string array can be\n // constructed in a [key, value, key, value] format.\n const styles = [];\n let i = 0;\n let parenDepth = 0;\n let quote = 0 /* Char.QuoteNone */;\n let valueStart = 0;\n let propStart = 0;\n let currentProp = null;\n let valueHasQuotes = false;\n while (i < value.length) {\n const token = value.charCodeAt(i++);\n switch (token) {\n case 40 /* Char.OpenParen */:\n parenDepth++;\n break;\n case 41 /* Char.CloseParen */:\n parenDepth--;\n break;\n case 39 /* Char.QuoteSingle */:\n // valueStart needs to be there since prop values don't\n // have quotes in CSS\n valueHasQuotes = valueHasQuotes || valueStart > 0;\n if (quote === 0 /* Char.QuoteNone */) {\n quote = 39 /* Char.QuoteSingle */;\n }\n else if (quote === 39 /* Char.QuoteSingle */ && value.charCodeAt(i - 1) !== 92 /* Char.BackSlash */) {\n quote = 0 /* Char.QuoteNone */;\n }\n break;\n case 34 /* Char.QuoteDouble */:\n // same logic as above\n valueHasQuotes = valueHasQuotes || valueStart > 0;\n if (quote === 0 /* Char.QuoteNone */) {\n quote = 34 /* Char.QuoteDouble */;\n }\n else if (quote === 34 /* Char.QuoteDouble */ && value.charCodeAt(i - 1) !== 92 /* Char.BackSlash */) {\n quote = 0 /* Char.QuoteNone */;\n }\n break;\n case 58 /* Char.Colon */:\n if (!currentProp && parenDepth === 0 && quote === 0 /* Char.QuoteNone */) {\n currentProp = hyphenate(value.substring(propStart, i - 1).trim());\n valueStart = i;\n }\n break;\n case 59 /* Char.Semicolon */:\n if (currentProp && valueStart > 0 && parenDepth === 0 && quote === 0 /* Char.QuoteNone */) {\n const styleVal = value.substring(valueStart, i - 1).trim();\n styles.push(currentProp, valueHasQuotes ? stripUnnecessaryQuotes(styleVal) : styleVal);\n propStart = i;\n valueStart = 0;\n currentProp = null;\n valueHasQuotes = false;\n }\n break;\n }\n }\n if (currentProp && valueStart) {\n const styleVal = value.slice(valueStart).trim();\n styles.push(currentProp, valueHasQuotes ? stripUnnecessaryQuotes(styleVal) : styleVal);\n }\n return styles;\n}\nfunction stripUnnecessaryQuotes(value) {\n const qS = value.charCodeAt(0);\n const qE = value.charCodeAt(value.length - 1);\n if (qS == qE && (qS == 39 /* Char.QuoteSingle */ || qS == 34 /* Char.QuoteDouble */)) {\n const tempValue = value.substring(1, value.length - 1);\n // special case to avoid using a multi-quoted string that was just chomped\n // (e.g. `font-family: \"Verdana\", \"sans-serif\"`)\n if (tempValue.indexOf('\\'') == -1 && tempValue.indexOf('\"') == -1) {\n value = tempValue;\n }\n }\n return value;\n}\nfunction hyphenate(value) {\n return value\n .replace(/[a-z][A-Z]/g, v => {\n return v.charAt(0) + '-' + v.charAt(1);\n })\n .toLowerCase();\n}\n\nconst IMPORTANT_FLAG = '!important';\n/**\n * Minimum amount of binding slots required in the runtime for style/class bindings.\n *\n * Styling in Angular uses up two slots in the runtime LView/TData data structures to\n * record binding data, property information and metadata.\n *\n * When a binding is registered it will place the following information in the `LView`:\n *\n * slot 1) binding value\n * slot 2) cached value (all other values collected before it in string form)\n *\n * When a binding is registered it will place the following information in the `TData`:\n *\n * slot 1) prop name\n * slot 2) binding index that points to the previous style/class binding (and some extra config\n * values)\n *\n * Let's imagine we have a binding that looks like so:\n *\n * ```\n * \n * ```\n *\n * Our `LView` and `TData` data-structures look like so:\n *\n * ```typescript\n * LView = [\n * // ...\n * x, // value of x\n * \"width: x\",\n *\n * y, // value of y\n * \"width: x; height: y\",\n * // ...\n * ];\n *\n * TData = [\n * // ...\n * \"width\", // binding slot 20\n * 0,\n *\n * \"height\",\n * 20,\n * // ...\n * ];\n * ```\n *\n * */\nconst MIN_STYLING_BINDING_SLOTS_REQUIRED = 2;\n/**\n * Produces creation/update instructions for all styling bindings (class and style)\n *\n * It also produces the creation instruction to register all initial styling values\n * (which are all the static class=\"...\" and style=\"...\" attribute values that exist\n * on an element within a template).\n *\n * The builder class below handles producing instructions for the following cases:\n *\n * - Static style/class attributes (style=\"...\" and class=\"...\")\n * - Dynamic style/class map bindings ([style]=\"map\" and [class]=\"map|string\")\n * - Dynamic style/class property bindings ([style.prop]=\"exp\" and [class.name]=\"exp\")\n *\n * Due to the complex relationship of all of these cases, the instructions generated\n * for these attributes/properties/bindings must be done so in the correct order. The\n * order which these must be generated is as follows:\n *\n * if (createMode) {\n * styling(...)\n * }\n * if (updateMode) {\n * styleMap(...)\n * classMap(...)\n * styleProp(...)\n * classProp(...)\n * }\n *\n * The creation/update methods within the builder class produce these instructions.\n */\nclass StylingBuilder {\n constructor(_directiveExpr) {\n this._directiveExpr = _directiveExpr;\n /** Whether or not there are any static styling values present */\n this._hasInitialValues = false;\n /**\n * Whether or not there are any styling bindings present\n * (i.e. `[style]`, `[class]`, `[style.prop]` or `[class.name]`)\n */\n this.hasBindings = false;\n this.hasBindingsWithPipes = false;\n /** the input for [class] (if it exists) */\n this._classMapInput = null;\n /** the input for [style] (if it exists) */\n this._styleMapInput = null;\n /** an array of each [style.prop] input */\n this._singleStyleInputs = null;\n /** an array of each [class.name] input */\n this._singleClassInputs = null;\n this._lastStylingInput = null;\n this._firstStylingInput = null;\n // maps are used instead of hash maps because a Map will\n // retain the ordering of the keys\n /**\n * Represents the location of each style binding in the template\n * (e.g. `
` implies\n * that `width=0` and `height=1`)\n */\n this._stylesIndex = new Map();\n /**\n * Represents the location of each class binding in the template\n * (e.g. `
` implies\n * that `big=0` and `hidden=1`)\n */\n this._classesIndex = new Map();\n this._initialStyleValues = [];\n this._initialClassValues = [];\n }\n /**\n * Registers a given input to the styling builder to be later used when producing AOT code.\n *\n * The code below will only accept the input if it is somehow tied to styling (whether it be\n * style/class bindings or static style/class attributes).\n */\n registerBoundInput(input) {\n // [attr.style] or [attr.class] are skipped in the code below,\n // they should not be treated as styling-based bindings since\n // they are intended to be written directly to the attr and\n // will therefore skip all style/class resolution that is present\n // with style=\"\", [style]=\"\" and [style.prop]=\"\", class=\"\",\n // [class.prop]=\"\". [class]=\"\" assignments\n let binding = null;\n let name = input.name;\n switch (input.type) {\n case 0 /* BindingType.Property */:\n binding = this.registerInputBasedOnName(name, input.value, input.sourceSpan);\n break;\n case 3 /* BindingType.Style */:\n binding = this.registerStyleInput(name, false, input.value, input.sourceSpan, input.unit);\n break;\n case 2 /* BindingType.Class */:\n binding = this.registerClassInput(name, false, input.value, input.sourceSpan);\n break;\n }\n return binding ? true : false;\n }\n registerInputBasedOnName(name, expression, sourceSpan) {\n let binding = null;\n const prefix = name.substring(0, 6);\n const isStyle = name === 'style' || prefix === 'style.' || prefix === 'style!';\n const isClass = !isStyle && (name === 'class' || prefix === 'class.' || prefix === 'class!');\n if (isStyle || isClass) {\n const isMapBased = name.charAt(5) !== '.'; // style.prop or class.prop makes this a no\n const property = name.slice(isMapBased ? 5 : 6); // the dot explains why there's a +1\n if (isStyle) {\n binding = this.registerStyleInput(property, isMapBased, expression, sourceSpan);\n }\n else {\n binding = this.registerClassInput(property, isMapBased, expression, sourceSpan);\n }\n }\n return binding;\n }\n registerStyleInput(name, isMapBased, value, sourceSpan, suffix) {\n if (isEmptyExpression(value)) {\n return null;\n }\n // CSS custom properties are case-sensitive so we shouldn't normalize them.\n // See: https://www.w3.org/TR/css-variables-1/#defining-variables\n if (!isCssCustomProperty(name)) {\n name = hyphenate(name);\n }\n const { property, hasOverrideFlag, suffix: bindingSuffix } = parseProperty(name);\n suffix = typeof suffix === 'string' && suffix.length !== 0 ? suffix : bindingSuffix;\n const entry = { name: property, suffix: suffix, value, sourceSpan, hasOverrideFlag };\n if (isMapBased) {\n this._styleMapInput = entry;\n }\n else {\n (this._singleStyleInputs = this._singleStyleInputs || []).push(entry);\n registerIntoMap(this._stylesIndex, property);\n }\n this._lastStylingInput = entry;\n this._firstStylingInput = this._firstStylingInput || entry;\n this._checkForPipes(value);\n this.hasBindings = true;\n return entry;\n }\n registerClassInput(name, isMapBased, value, sourceSpan) {\n if (isEmptyExpression(value)) {\n return null;\n }\n const { property, hasOverrideFlag } = parseProperty(name);\n const entry = { name: property, value, sourceSpan, hasOverrideFlag, suffix: null };\n if (isMapBased) {\n this._classMapInput = entry;\n }\n else {\n (this._singleClassInputs = this._singleClassInputs || []).push(entry);\n registerIntoMap(this._classesIndex, property);\n }\n this._lastStylingInput = entry;\n this._firstStylingInput = this._firstStylingInput || entry;\n this._checkForPipes(value);\n this.hasBindings = true;\n return entry;\n }\n _checkForPipes(value) {\n if ((value instanceof ASTWithSource) && (value.ast instanceof BindingPipe)) {\n this.hasBindingsWithPipes = true;\n }\n }\n /**\n * Registers the element's static style string value to the builder.\n *\n * @param value the style string (e.g. `width:100px; height:200px;`)\n */\n registerStyleAttr(value) {\n this._initialStyleValues = parse(value);\n this._hasInitialValues = true;\n }\n /**\n * Registers the element's static class string value to the builder.\n *\n * @param value the className string (e.g. `disabled gold zoom`)\n */\n registerClassAttr(value) {\n this._initialClassValues = value.trim().split(/\\s+/g);\n this._hasInitialValues = true;\n }\n /**\n * Appends all styling-related expressions to the provided attrs array.\n *\n * @param attrs an existing array where each of the styling expressions\n * will be inserted into.\n */\n populateInitialStylingAttrs(attrs) {\n // [CLASS_MARKER, 'foo', 'bar', 'baz' ...]\n if (this._initialClassValues.length) {\n attrs.push(literal(1 /* AttributeMarker.Classes */));\n for (let i = 0; i < this._initialClassValues.length; i++) {\n attrs.push(literal(this._initialClassValues[i]));\n }\n }\n // [STYLE_MARKER, 'width', '200px', 'height', '100px', ...]\n if (this._initialStyleValues.length) {\n attrs.push(literal(2 /* AttributeMarker.Styles */));\n for (let i = 0; i < this._initialStyleValues.length; i += 2) {\n attrs.push(literal(this._initialStyleValues[i]), literal(this._initialStyleValues[i + 1]));\n }\n }\n }\n /**\n * Builds an instruction with all the expressions and parameters for `elementHostAttrs`.\n *\n * The instruction generation code below is used for producing the AOT statement code which is\n * responsible for registering initial styles (within a directive hostBindings' creation block),\n * as well as any of the provided attribute values, to the directive host element.\n */\n assignHostAttrs(attrs, definitionMap) {\n if (this._directiveExpr && (attrs.length || this._hasInitialValues)) {\n this.populateInitialStylingAttrs(attrs);\n definitionMap.set('hostAttrs', literalArr(attrs));\n }\n }\n /**\n * Builds an instruction with all the expressions and parameters for `classMap`.\n *\n * The instruction data will contain all expressions for `classMap` to function\n * which includes the `[class]` expression params.\n */\n buildClassMapInstruction(valueConverter) {\n if (this._classMapInput) {\n return this._buildMapBasedInstruction(valueConverter, true, this._classMapInput);\n }\n return null;\n }\n /**\n * Builds an instruction with all the expressions and parameters for `styleMap`.\n *\n * The instruction data will contain all expressions for `styleMap` to function\n * which includes the `[style]` expression params.\n */\n buildStyleMapInstruction(valueConverter) {\n if (this._styleMapInput) {\n return this._buildMapBasedInstruction(valueConverter, false, this._styleMapInput);\n }\n return null;\n }\n _buildMapBasedInstruction(valueConverter, isClassBased, stylingInput) {\n // each styling binding value is stored in the LView\n // map-based bindings allocate two slots: one for the\n // previous binding value and another for the previous\n // className or style attribute value.\n let totalBindingSlotsRequired = MIN_STYLING_BINDING_SLOTS_REQUIRED;\n // these values must be outside of the update block so that they can\n // be evaluated (the AST visit call) during creation time so that any\n // pipes can be picked up in time before the template is built\n const mapValue = stylingInput.value.visit(valueConverter);\n let reference;\n if (mapValue instanceof Interpolation) {\n totalBindingSlotsRequired += mapValue.expressions.length;\n reference = isClassBased ? getClassMapInterpolationExpression(mapValue) :\n getStyleMapInterpolationExpression(mapValue);\n }\n else {\n reference = isClassBased ? Identifiers.classMap : Identifiers.styleMap;\n }\n return {\n reference,\n calls: [{\n supportsInterpolation: true,\n sourceSpan: stylingInput.sourceSpan,\n allocateBindingSlots: totalBindingSlotsRequired,\n params: (convertFn) => {\n const convertResult = convertFn(mapValue);\n const params = Array.isArray(convertResult) ? convertResult : [convertResult];\n return params;\n }\n }]\n };\n }\n _buildSingleInputs(reference, inputs, valueConverter, getInterpolationExpressionFn, isClassBased) {\n const instructions = [];\n inputs.forEach(input => {\n const previousInstruction = instructions[instructions.length - 1];\n const value = input.value.visit(valueConverter);\n let referenceForCall = reference;\n // each styling binding value is stored in the LView\n // but there are two values stored for each binding:\n // 1) the value itself\n // 2) an intermediate value (concatenation of style up to this point).\n // We need to store the intermediate value so that we don't allocate\n // the strings on each CD.\n let totalBindingSlotsRequired = MIN_STYLING_BINDING_SLOTS_REQUIRED;\n if (value instanceof Interpolation) {\n totalBindingSlotsRequired += value.expressions.length;\n if (getInterpolationExpressionFn) {\n referenceForCall = getInterpolationExpressionFn(value);\n }\n }\n const call = {\n sourceSpan: input.sourceSpan,\n allocateBindingSlots: totalBindingSlotsRequired,\n supportsInterpolation: !!getInterpolationExpressionFn,\n params: (convertFn) => {\n // params => stylingProp(propName, value, suffix)\n const params = [];\n params.push(literal(input.name));\n const convertResult = convertFn(value);\n if (Array.isArray(convertResult)) {\n params.push(...convertResult);\n }\n else {\n params.push(convertResult);\n }\n // [style.prop] bindings may use suffix values (e.g. px, em, etc...), therefore,\n // if that is detected then we need to pass that in as an optional param.\n if (!isClassBased && input.suffix !== null) {\n params.push(literal(input.suffix));\n }\n return params;\n }\n };\n // If we ended up generating a call to the same instruction as the previous styling property\n // we can chain the calls together safely to save some bytes, otherwise we have to generate\n // a separate instruction call. This is primarily a concern with interpolation instructions\n // where we may start off with one `reference`, but end up using another based on the\n // number of interpolations.\n if (previousInstruction && previousInstruction.reference === referenceForCall) {\n previousInstruction.calls.push(call);\n }\n else {\n instructions.push({ reference: referenceForCall, calls: [call] });\n }\n });\n return instructions;\n }\n _buildClassInputs(valueConverter) {\n if (this._singleClassInputs) {\n return this._buildSingleInputs(Identifiers.classProp, this._singleClassInputs, valueConverter, null, true);\n }\n return [];\n }\n _buildStyleInputs(valueConverter) {\n if (this._singleStyleInputs) {\n return this._buildSingleInputs(Identifiers.styleProp, this._singleStyleInputs, valueConverter, getStylePropInterpolationExpression, false);\n }\n return [];\n }\n /**\n * Constructs all instructions which contain the expressions that will be placed\n * into the update block of a template function or a directive hostBindings function.\n */\n buildUpdateLevelInstructions(valueConverter) {\n const instructions = [];\n if (this.hasBindings) {\n const styleMapInstruction = this.buildStyleMapInstruction(valueConverter);\n if (styleMapInstruction) {\n instructions.push(styleMapInstruction);\n }\n const classMapInstruction = this.buildClassMapInstruction(valueConverter);\n if (classMapInstruction) {\n instructions.push(classMapInstruction);\n }\n instructions.push(...this._buildStyleInputs(valueConverter));\n instructions.push(...this._buildClassInputs(valueConverter));\n }\n return instructions;\n }\n}\nfunction registerIntoMap(map, key) {\n if (!map.has(key)) {\n map.set(key, map.size);\n }\n}\nfunction parseProperty(name) {\n let hasOverrideFlag = false;\n const overrideIndex = name.indexOf(IMPORTANT_FLAG);\n if (overrideIndex !== -1) {\n name = overrideIndex > 0 ? name.substring(0, overrideIndex) : '';\n hasOverrideFlag = true;\n }\n let suffix = null;\n let property = name;\n const unitIndex = name.lastIndexOf('.');\n if (unitIndex > 0) {\n suffix = name.slice(unitIndex + 1);\n property = name.substring(0, unitIndex);\n }\n return { property, suffix, hasOverrideFlag };\n}\n/**\n * Gets the instruction to generate for an interpolated class map.\n * @param interpolation An Interpolation AST\n */\nfunction getClassMapInterpolationExpression(interpolation) {\n switch (getInterpolationArgsLength(interpolation)) {\n case 1:\n return Identifiers.classMap;\n case 3:\n return Identifiers.classMapInterpolate1;\n case 5:\n return Identifiers.classMapInterpolate2;\n case 7:\n return Identifiers.classMapInterpolate3;\n case 9:\n return Identifiers.classMapInterpolate4;\n case 11:\n return Identifiers.classMapInterpolate5;\n case 13:\n return Identifiers.classMapInterpolate6;\n case 15:\n return Identifiers.classMapInterpolate7;\n case 17:\n return Identifiers.classMapInterpolate8;\n default:\n return Identifiers.classMapInterpolateV;\n }\n}\n/**\n * Gets the instruction to generate for an interpolated style map.\n * @param interpolation An Interpolation AST\n */\nfunction getStyleMapInterpolationExpression(interpolation) {\n switch (getInterpolationArgsLength(interpolation)) {\n case 1:\n return Identifiers.styleMap;\n case 3:\n return Identifiers.styleMapInterpolate1;\n case 5:\n return Identifiers.styleMapInterpolate2;\n case 7:\n return Identifiers.styleMapInterpolate3;\n case 9:\n return Identifiers.styleMapInterpolate4;\n case 11:\n return Identifiers.styleMapInterpolate5;\n case 13:\n return Identifiers.styleMapInterpolate6;\n case 15:\n return Identifiers.styleMapInterpolate7;\n case 17:\n return Identifiers.styleMapInterpolate8;\n default:\n return Identifiers.styleMapInterpolateV;\n }\n}\n/**\n * Gets the instruction to generate for an interpolated style prop.\n * @param interpolation An Interpolation AST\n */\nfunction getStylePropInterpolationExpression(interpolation) {\n switch (getInterpolationArgsLength(interpolation)) {\n case 1:\n return Identifiers.styleProp;\n case 3:\n return Identifiers.stylePropInterpolate1;\n case 5:\n return Identifiers.stylePropInterpolate2;\n case 7:\n return Identifiers.stylePropInterpolate3;\n case 9:\n return Identifiers.stylePropInterpolate4;\n case 11:\n return Identifiers.stylePropInterpolate5;\n case 13:\n return Identifiers.stylePropInterpolate6;\n case 15:\n return Identifiers.stylePropInterpolate7;\n case 17:\n return Identifiers.stylePropInterpolate8;\n default:\n return Identifiers.stylePropInterpolateV;\n }\n}\n/**\n * Checks whether property name is a custom CSS property.\n * See: https://www.w3.org/TR/css-variables-1\n */\nfunction isCssCustomProperty(name) {\n return name.startsWith('--');\n}\nfunction isEmptyExpression(ast) {\n if (ast instanceof ASTWithSource) {\n ast = ast.ast;\n }\n return ast instanceof EmptyExpr;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nvar TokenType;\n(function (TokenType) {\n TokenType[TokenType[\"Character\"] = 0] = \"Character\";\n TokenType[TokenType[\"Identifier\"] = 1] = \"Identifier\";\n TokenType[TokenType[\"PrivateIdentifier\"] = 2] = \"PrivateIdentifier\";\n TokenType[TokenType[\"Keyword\"] = 3] = \"Keyword\";\n TokenType[TokenType[\"String\"] = 4] = \"String\";\n TokenType[TokenType[\"Operator\"] = 5] = \"Operator\";\n TokenType[TokenType[\"Number\"] = 6] = \"Number\";\n TokenType[TokenType[\"Error\"] = 7] = \"Error\";\n})(TokenType || (TokenType = {}));\nconst KEYWORDS = ['var', 'let', 'as', 'null', 'undefined', 'true', 'false', 'if', 'else', 'this'];\nclass Lexer {\n tokenize(text) {\n const scanner = new _Scanner(text);\n const tokens = [];\n let token = scanner.scanToken();\n while (token != null) {\n tokens.push(token);\n token = scanner.scanToken();\n }\n return tokens;\n }\n}\nclass Token {\n constructor(index, end, type, numValue, strValue) {\n this.index = index;\n this.end = end;\n this.type = type;\n this.numValue = numValue;\n this.strValue = strValue;\n }\n isCharacter(code) {\n return this.type == TokenType.Character && this.numValue == code;\n }\n isNumber() {\n return this.type == TokenType.Number;\n }\n isString() {\n return this.type == TokenType.String;\n }\n isOperator(operator) {\n return this.type == TokenType.Operator && this.strValue == operator;\n }\n isIdentifier() {\n return this.type == TokenType.Identifier;\n }\n isPrivateIdentifier() {\n return this.type == TokenType.PrivateIdentifier;\n }\n isKeyword() {\n return this.type == TokenType.Keyword;\n }\n isKeywordLet() {\n return this.type == TokenType.Keyword && this.strValue == 'let';\n }\n isKeywordAs() {\n return this.type == TokenType.Keyword && this.strValue == 'as';\n }\n isKeywordNull() {\n return this.type == TokenType.Keyword && this.strValue == 'null';\n }\n isKeywordUndefined() {\n return this.type == TokenType.Keyword && this.strValue == 'undefined';\n }\n isKeywordTrue() {\n return this.type == TokenType.Keyword && this.strValue == 'true';\n }\n isKeywordFalse() {\n return this.type == TokenType.Keyword && this.strValue == 'false';\n }\n isKeywordThis() {\n return this.type == TokenType.Keyword && this.strValue == 'this';\n }\n isError() {\n return this.type == TokenType.Error;\n }\n toNumber() {\n return this.type == TokenType.Number ? this.numValue : -1;\n }\n toString() {\n switch (this.type) {\n case TokenType.Character:\n case TokenType.Identifier:\n case TokenType.Keyword:\n case TokenType.Operator:\n case TokenType.PrivateIdentifier:\n case TokenType.String:\n case TokenType.Error:\n return this.strValue;\n case TokenType.Number:\n return this.numValue.toString();\n default:\n return null;\n }\n }\n}\nfunction newCharacterToken(index, end, code) {\n return new Token(index, end, TokenType.Character, code, String.fromCharCode(code));\n}\nfunction newIdentifierToken(index, end, text) {\n return new Token(index, end, TokenType.Identifier, 0, text);\n}\nfunction newPrivateIdentifierToken(index, end, text) {\n return new Token(index, end, TokenType.PrivateIdentifier, 0, text);\n}\nfunction newKeywordToken(index, end, text) {\n return new Token(index, end, TokenType.Keyword, 0, text);\n}\nfunction newOperatorToken(index, end, text) {\n return new Token(index, end, TokenType.Operator, 0, text);\n}\nfunction newStringToken(index, end, text) {\n return new Token(index, end, TokenType.String, 0, text);\n}\nfunction newNumberToken(index, end, n) {\n return new Token(index, end, TokenType.Number, n, '');\n}\nfunction newErrorToken(index, end, message) {\n return new Token(index, end, TokenType.Error, 0, message);\n}\nconst EOF = new Token(-1, -1, TokenType.Character, 0, '');\nclass _Scanner {\n constructor(input) {\n this.input = input;\n this.peek = 0;\n this.index = -1;\n this.length = input.length;\n this.advance();\n }\n advance() {\n this.peek = ++this.index >= this.length ? $EOF : this.input.charCodeAt(this.index);\n }\n scanToken() {\n const input = this.input, length = this.length;\n let peek = this.peek, index = this.index;\n // Skip whitespace.\n while (peek <= $SPACE) {\n if (++index >= length) {\n peek = $EOF;\n break;\n }\n else {\n peek = input.charCodeAt(index);\n }\n }\n this.peek = peek;\n this.index = index;\n if (index >= length) {\n return null;\n }\n // Handle identifiers and numbers.\n if (isIdentifierStart(peek))\n return this.scanIdentifier();\n if (isDigit(peek))\n return this.scanNumber(index);\n const start = index;\n switch (peek) {\n case $PERIOD:\n this.advance();\n return isDigit(this.peek) ? this.scanNumber(start) :\n newCharacterToken(start, this.index, $PERIOD);\n case $LPAREN:\n case $RPAREN:\n case $LBRACE:\n case $RBRACE:\n case $LBRACKET:\n case $RBRACKET:\n case $COMMA:\n case $COLON:\n case $SEMICOLON:\n return this.scanCharacter(start, peek);\n case $SQ:\n case $DQ:\n return this.scanString();\n case $HASH:\n return this.scanPrivateIdentifier();\n case $PLUS:\n case $MINUS:\n case $STAR:\n case $SLASH:\n case $PERCENT:\n case $CARET:\n return this.scanOperator(start, String.fromCharCode(peek));\n case $QUESTION:\n return this.scanQuestion(start);\n case $LT:\n case $GT:\n return this.scanComplexOperator(start, String.fromCharCode(peek), $EQ, '=');\n case $BANG:\n case $EQ:\n return this.scanComplexOperator(start, String.fromCharCode(peek), $EQ, '=', $EQ, '=');\n case $AMPERSAND:\n return this.scanComplexOperator(start, '&', $AMPERSAND, '&');\n case $BAR:\n return this.scanComplexOperator(start, '|', $BAR, '|');\n case $NBSP:\n while (isWhitespace(this.peek))\n this.advance();\n return this.scanToken();\n }\n this.advance();\n return this.error(`Unexpected character [${String.fromCharCode(peek)}]`, 0);\n }\n scanCharacter(start, code) {\n this.advance();\n return newCharacterToken(start, this.index, code);\n }\n scanOperator(start, str) {\n this.advance();\n return newOperatorToken(start, this.index, str);\n }\n /**\n * Tokenize a 2/3 char long operator\n *\n * @param start start index in the expression\n * @param one first symbol (always part of the operator)\n * @param twoCode code point for the second symbol\n * @param two second symbol (part of the operator when the second code point matches)\n * @param threeCode code point for the third symbol\n * @param three third symbol (part of the operator when provided and matches source expression)\n */\n scanComplexOperator(start, one, twoCode, two, threeCode, three) {\n this.advance();\n let str = one;\n if (this.peek == twoCode) {\n this.advance();\n str += two;\n }\n if (threeCode != null && this.peek == threeCode) {\n this.advance();\n str += three;\n }\n return newOperatorToken(start, this.index, str);\n }\n scanIdentifier() {\n const start = this.index;\n this.advance();\n while (isIdentifierPart(this.peek))\n this.advance();\n const str = this.input.substring(start, this.index);\n return KEYWORDS.indexOf(str) > -1 ? newKeywordToken(start, this.index, str) :\n newIdentifierToken(start, this.index, str);\n }\n /** Scans an ECMAScript private identifier. */\n scanPrivateIdentifier() {\n const start = this.index;\n this.advance();\n if (!isIdentifierStart(this.peek)) {\n return this.error('Invalid character [#]', -1);\n }\n while (isIdentifierPart(this.peek))\n this.advance();\n const identifierName = this.input.substring(start, this.index);\n return newPrivateIdentifierToken(start, this.index, identifierName);\n }\n scanNumber(start) {\n let simple = (this.index === start);\n let hasSeparators = false;\n this.advance(); // Skip initial digit.\n while (true) {\n if (isDigit(this.peek)) {\n // Do nothing.\n }\n else if (this.peek === $_) {\n // Separators are only valid when they're surrounded by digits. E.g. `1_0_1` is\n // valid while `_101` and `101_` are not. The separator can't be next to the decimal\n // point or another separator either. Note that it's unlikely that we'll hit a case where\n // the underscore is at the start, because that's a valid identifier and it will be picked\n // up earlier in the parsing. We validate for it anyway just in case.\n if (!isDigit(this.input.charCodeAt(this.index - 1)) ||\n !isDigit(this.input.charCodeAt(this.index + 1))) {\n return this.error('Invalid numeric separator', 0);\n }\n hasSeparators = true;\n }\n else if (this.peek === $PERIOD) {\n simple = false;\n }\n else if (isExponentStart(this.peek)) {\n this.advance();\n if (isExponentSign(this.peek))\n this.advance();\n if (!isDigit(this.peek))\n return this.error('Invalid exponent', -1);\n simple = false;\n }\n else {\n break;\n }\n this.advance();\n }\n let str = this.input.substring(start, this.index);\n if (hasSeparators) {\n str = str.replace(/_/g, '');\n }\n const value = simple ? parseIntAutoRadix(str) : parseFloat(str);\n return newNumberToken(start, this.index, value);\n }\n scanString() {\n const start = this.index;\n const quote = this.peek;\n this.advance(); // Skip initial quote.\n let buffer = '';\n let marker = this.index;\n const input = this.input;\n while (this.peek != quote) {\n if (this.peek == $BACKSLASH) {\n buffer += input.substring(marker, this.index);\n this.advance();\n let unescapedCode;\n // Workaround for TS2.1-introduced type strictness\n this.peek = this.peek;\n if (this.peek == $u) {\n // 4 character hex code for unicode character.\n const hex = input.substring(this.index + 1, this.index + 5);\n if (/^[0-9a-f]+$/i.test(hex)) {\n unescapedCode = parseInt(hex, 16);\n }\n else {\n return this.error(`Invalid unicode escape [\\\\u${hex}]`, 0);\n }\n for (let i = 0; i < 5; i++) {\n this.advance();\n }\n }\n else {\n unescapedCode = unescape(this.peek);\n this.advance();\n }\n buffer += String.fromCharCode(unescapedCode);\n marker = this.index;\n }\n else if (this.peek == $EOF) {\n return this.error('Unterminated quote', 0);\n }\n else {\n this.advance();\n }\n }\n const last = input.substring(marker, this.index);\n this.advance(); // Skip terminating quote.\n return newStringToken(start, this.index, buffer + last);\n }\n scanQuestion(start) {\n this.advance();\n let str = '?';\n // Either `a ?? b` or 'a?.b'.\n if (this.peek === $QUESTION || this.peek === $PERIOD) {\n str += this.peek === $PERIOD ? '.' : '?';\n this.advance();\n }\n return newOperatorToken(start, this.index, str);\n }\n error(message, offset) {\n const position = this.index + offset;\n return newErrorToken(position, this.index, `Lexer Error: ${message} at column ${position} in expression [${this.input}]`);\n }\n}\nfunction isIdentifierStart(code) {\n return ($a <= code && code <= $z) || ($A <= code && code <= $Z) ||\n (code == $_) || (code == $$);\n}\nfunction isIdentifier(input) {\n if (input.length == 0)\n return false;\n const scanner = new _Scanner(input);\n if (!isIdentifierStart(scanner.peek))\n return false;\n scanner.advance();\n while (scanner.peek !== $EOF) {\n if (!isIdentifierPart(scanner.peek))\n return false;\n scanner.advance();\n }\n return true;\n}\nfunction isIdentifierPart(code) {\n return isAsciiLetter(code) || isDigit(code) || (code == $_) ||\n (code == $$);\n}\nfunction isExponentStart(code) {\n return code == $e || code == $E;\n}\nfunction isExponentSign(code) {\n return code == $MINUS || code == $PLUS;\n}\nfunction unescape(code) {\n switch (code) {\n case $n:\n return $LF;\n case $f:\n return $FF;\n case $r:\n return $CR;\n case $t:\n return $TAB;\n case $v:\n return $VTAB;\n default:\n return code;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass SplitInterpolation {\n constructor(strings, expressions, offsets) {\n this.strings = strings;\n this.expressions = expressions;\n this.offsets = offsets;\n }\n}\nclass TemplateBindingParseResult {\n constructor(templateBindings, warnings, errors) {\n this.templateBindings = templateBindings;\n this.warnings = warnings;\n this.errors = errors;\n }\n}\nclass Parser$1 {\n constructor(_lexer) {\n this._lexer = _lexer;\n this.errors = [];\n }\n parseAction(input, isAssignmentEvent, location, absoluteOffset, interpolationConfig = DEFAULT_INTERPOLATION_CONFIG) {\n this._checkNoInterpolation(input, location, interpolationConfig);\n const sourceToLex = this._stripComments(input);\n const tokens = this._lexer.tokenize(sourceToLex);\n let flags = 1 /* ParseFlags.Action */;\n if (isAssignmentEvent) {\n flags |= 2 /* ParseFlags.AssignmentEvent */;\n }\n const ast = new _ParseAST(input, location, absoluteOffset, tokens, flags, this.errors, 0).parseChain();\n return new ASTWithSource(ast, input, location, absoluteOffset, this.errors);\n }\n parseBinding(input, location, absoluteOffset, interpolationConfig = DEFAULT_INTERPOLATION_CONFIG) {\n const ast = this._parseBindingAst(input, location, absoluteOffset, interpolationConfig);\n return new ASTWithSource(ast, input, location, absoluteOffset, this.errors);\n }\n checkSimpleExpression(ast) {\n const checker = new SimpleExpressionChecker();\n ast.visit(checker);\n return checker.errors;\n }\n parseSimpleBinding(input, location, absoluteOffset, interpolationConfig = DEFAULT_INTERPOLATION_CONFIG) {\n const ast = this._parseBindingAst(input, location, absoluteOffset, interpolationConfig);\n const errors = this.checkSimpleExpression(ast);\n if (errors.length > 0) {\n this._reportError(`Host binding expression cannot contain ${errors.join(' ')}`, input, location);\n }\n return new ASTWithSource(ast, input, location, absoluteOffset, this.errors);\n }\n _reportError(message, input, errLocation, ctxLocation) {\n this.errors.push(new ParserError(message, input, errLocation, ctxLocation));\n }\n _parseBindingAst(input, location, absoluteOffset, interpolationConfig) {\n this._checkNoInterpolation(input, location, interpolationConfig);\n const sourceToLex = this._stripComments(input);\n const tokens = this._lexer.tokenize(sourceToLex);\n return new _ParseAST(input, location, absoluteOffset, tokens, 0 /* ParseFlags.None */, this.errors, 0)\n .parseChain();\n }\n /**\n * Parse microsyntax template expression and return a list of bindings or\n * parsing errors in case the given expression is invalid.\n *\n * For example,\n * ```\n *
\n * ^ ^ absoluteValueOffset for `templateValue`\n * absoluteKeyOffset for `templateKey`\n * ```\n * contains three bindings:\n * 1. ngFor -> null\n * 2. item -> NgForOfContext.$implicit\n * 3. ngForOf -> items\n *\n * This is apparent from the de-sugared template:\n * ```\n *
\n * ```\n *\n * @param templateKey name of directive, without the * prefix. For example: ngIf, ngFor\n * @param templateValue RHS of the microsyntax attribute\n * @param templateUrl template filename if it's external, component filename if it's inline\n * @param absoluteKeyOffset start of the `templateKey`\n * @param absoluteValueOffset start of the `templateValue`\n */\n parseTemplateBindings(templateKey, templateValue, templateUrl, absoluteKeyOffset, absoluteValueOffset) {\n const tokens = this._lexer.tokenize(templateValue);\n const parser = new _ParseAST(templateValue, templateUrl, absoluteValueOffset, tokens, 0 /* ParseFlags.None */, this.errors, 0 /* relative offset */);\n return parser.parseTemplateBindings({\n source: templateKey,\n span: new AbsoluteSourceSpan(absoluteKeyOffset, absoluteKeyOffset + templateKey.length),\n });\n }\n parseInterpolation(input, location, absoluteOffset, interpolatedTokens, interpolationConfig = DEFAULT_INTERPOLATION_CONFIG) {\n const { strings, expressions, offsets } = this.splitInterpolation(input, location, interpolatedTokens, interpolationConfig);\n if (expressions.length === 0)\n return null;\n const expressionNodes = [];\n for (let i = 0; i < expressions.length; ++i) {\n const expressionText = expressions[i].text;\n const sourceToLex = this._stripComments(expressionText);\n const tokens = this._lexer.tokenize(sourceToLex);\n const ast = new _ParseAST(input, location, absoluteOffset, tokens, 0 /* ParseFlags.None */, this.errors, offsets[i])\n .parseChain();\n expressionNodes.push(ast);\n }\n return this.createInterpolationAst(strings.map(s => s.text), expressionNodes, input, location, absoluteOffset);\n }\n /**\n * Similar to `parseInterpolation`, but treats the provided string as a single expression\n * element that would normally appear within the interpolation prefix and suffix (`{{` and `}}`).\n * This is used for parsing the switch expression in ICUs.\n */\n parseInterpolationExpression(expression, location, absoluteOffset) {\n const sourceToLex = this._stripComments(expression);\n const tokens = this._lexer.tokenize(sourceToLex);\n const ast = new _ParseAST(expression, location, absoluteOffset, tokens, 0 /* ParseFlags.None */, this.errors, 0)\n .parseChain();\n const strings = ['', '']; // The prefix and suffix strings are both empty\n return this.createInterpolationAst(strings, [ast], expression, location, absoluteOffset);\n }\n createInterpolationAst(strings, expressions, input, location, absoluteOffset) {\n const span = new ParseSpan(0, input.length);\n const interpolation = new Interpolation(span, span.toAbsolute(absoluteOffset), strings, expressions);\n return new ASTWithSource(interpolation, input, location, absoluteOffset, this.errors);\n }\n /**\n * Splits a string of text into \"raw\" text segments and expressions present in interpolations in\n * the string.\n * Returns `null` if there are no interpolations, otherwise a\n * `SplitInterpolation` with splits that look like\n * ... \n */\n splitInterpolation(input, location, interpolatedTokens, interpolationConfig = DEFAULT_INTERPOLATION_CONFIG) {\n var _a;\n const strings = [];\n const expressions = [];\n const offsets = [];\n const inputToTemplateIndexMap = interpolatedTokens ? getIndexMapForOriginalTemplate(interpolatedTokens) : null;\n let i = 0;\n let atInterpolation = false;\n let extendLastString = false;\n let { start: interpStart, end: interpEnd } = interpolationConfig;\n while (i < input.length) {\n if (!atInterpolation) {\n // parse until starting {{\n const start = i;\n i = input.indexOf(interpStart, i);\n if (i === -1) {\n i = input.length;\n }\n const text = input.substring(start, i);\n strings.push({ text, start, end: i });\n atInterpolation = true;\n }\n else {\n // parse from starting {{ to ending }} while ignoring content inside quotes.\n const fullStart = i;\n const exprStart = fullStart + interpStart.length;\n const exprEnd = this._getInterpolationEndIndex(input, interpEnd, exprStart);\n if (exprEnd === -1) {\n // Could not find the end of the interpolation; do not parse an expression.\n // Instead we should extend the content on the last raw string.\n atInterpolation = false;\n extendLastString = true;\n break;\n }\n const fullEnd = exprEnd + interpEnd.length;\n const text = input.substring(exprStart, exprEnd);\n if (text.trim().length === 0) {\n this._reportError('Blank expressions are not allowed in interpolated strings', input, `at column ${i} in`, location);\n }\n expressions.push({ text, start: fullStart, end: fullEnd });\n const startInOriginalTemplate = (_a = inputToTemplateIndexMap === null || inputToTemplateIndexMap === void 0 ? void 0 : inputToTemplateIndexMap.get(fullStart)) !== null && _a !== void 0 ? _a : fullStart;\n const offset = startInOriginalTemplate + interpStart.length;\n offsets.push(offset);\n i = fullEnd;\n atInterpolation = false;\n }\n }\n if (!atInterpolation) {\n // If we are now at a text section, add the remaining content as a raw string.\n if (extendLastString) {\n const piece = strings[strings.length - 1];\n piece.text += input.substring(i);\n piece.end = input.length;\n }\n else {\n strings.push({ text: input.substring(i), start: i, end: input.length });\n }\n }\n return new SplitInterpolation(strings, expressions, offsets);\n }\n wrapLiteralPrimitive(input, location, absoluteOffset) {\n const span = new ParseSpan(0, input == null ? 0 : input.length);\n return new ASTWithSource(new LiteralPrimitive(span, span.toAbsolute(absoluteOffset), input), input, location, absoluteOffset, this.errors);\n }\n _stripComments(input) {\n const i = this._commentStart(input);\n return i != null ? input.substring(0, i) : input;\n }\n _commentStart(input) {\n let outerQuote = null;\n for (let i = 0; i < input.length - 1; i++) {\n const char = input.charCodeAt(i);\n const nextChar = input.charCodeAt(i + 1);\n if (char === $SLASH && nextChar == $SLASH && outerQuote == null)\n return i;\n if (outerQuote === char) {\n outerQuote = null;\n }\n else if (outerQuote == null && isQuote(char)) {\n outerQuote = char;\n }\n }\n return null;\n }\n _checkNoInterpolation(input, location, { start, end }) {\n let startIndex = -1;\n let endIndex = -1;\n for (const charIndex of this._forEachUnquotedChar(input, 0)) {\n if (startIndex === -1) {\n if (input.startsWith(start)) {\n startIndex = charIndex;\n }\n }\n else {\n endIndex = this._getInterpolationEndIndex(input, end, charIndex);\n if (endIndex > -1) {\n break;\n }\n }\n }\n if (startIndex > -1 && endIndex > -1) {\n this._reportError(`Got interpolation (${start}${end}) where expression was expected`, input, `at column ${startIndex} in`, location);\n }\n }\n /**\n * Finds the index of the end of an interpolation expression\n * while ignoring comments and quoted content.\n */\n _getInterpolationEndIndex(input, expressionEnd, start) {\n for (const charIndex of this._forEachUnquotedChar(input, start)) {\n if (input.startsWith(expressionEnd, charIndex)) {\n return charIndex;\n }\n // Nothing else in the expression matters after we've\n // hit a comment so look directly for the end token.\n if (input.startsWith('//', charIndex)) {\n return input.indexOf(expressionEnd, charIndex);\n }\n }\n return -1;\n }\n /**\n * Generator used to iterate over the character indexes of a string that are outside of quotes.\n * @param input String to loop through.\n * @param start Index within the string at which to start.\n */\n *_forEachUnquotedChar(input, start) {\n let currentQuote = null;\n let escapeCount = 0;\n for (let i = start; i < input.length; i++) {\n const char = input[i];\n // Skip the characters inside quotes. Note that we only care about the outer-most\n // quotes matching up and we need to account for escape characters.\n if (isQuote(input.charCodeAt(i)) && (currentQuote === null || currentQuote === char) &&\n escapeCount % 2 === 0) {\n currentQuote = currentQuote === null ? char : null;\n }\n else if (currentQuote === null) {\n yield i;\n }\n escapeCount = char === '\\\\' ? escapeCount + 1 : 0;\n }\n }\n}\n/** Describes a stateful context an expression parser is in. */\nvar ParseContextFlags;\n(function (ParseContextFlags) {\n ParseContextFlags[ParseContextFlags[\"None\"] = 0] = \"None\";\n /**\n * A Writable context is one in which a value may be written to an lvalue.\n * For example, after we see a property access, we may expect a write to the\n * property via the \"=\" operator.\n * prop\n * ^ possible \"=\" after\n */\n ParseContextFlags[ParseContextFlags[\"Writable\"] = 1] = \"Writable\";\n})(ParseContextFlags || (ParseContextFlags = {}));\nclass _ParseAST {\n constructor(input, location, absoluteOffset, tokens, parseFlags, errors, offset) {\n this.input = input;\n this.location = location;\n this.absoluteOffset = absoluteOffset;\n this.tokens = tokens;\n this.parseFlags = parseFlags;\n this.errors = errors;\n this.offset = offset;\n this.rparensExpected = 0;\n this.rbracketsExpected = 0;\n this.rbracesExpected = 0;\n this.context = ParseContextFlags.None;\n // Cache of expression start and input indeces to the absolute source span they map to, used to\n // prevent creating superfluous source spans in `sourceSpan`.\n // A serial of the expression start and input index is used for mapping because both are stateful\n // and may change for subsequent expressions visited by the parser.\n this.sourceSpanCache = new Map();\n this.index = 0;\n }\n peek(offset) {\n const i = this.index + offset;\n return i < this.tokens.length ? this.tokens[i] : EOF;\n }\n get next() {\n return this.peek(0);\n }\n /** Whether all the parser input has been processed. */\n get atEOF() {\n return this.index >= this.tokens.length;\n }\n /**\n * Index of the next token to be processed, or the end of the last token if all have been\n * processed.\n */\n get inputIndex() {\n return this.atEOF ? this.currentEndIndex : this.next.index + this.offset;\n }\n /**\n * End index of the last processed token, or the start of the first token if none have been\n * processed.\n */\n get currentEndIndex() {\n if (this.index > 0) {\n const curToken = this.peek(-1);\n return curToken.end + this.offset;\n }\n // No tokens have been processed yet; return the next token's start or the length of the input\n // if there is no token.\n if (this.tokens.length === 0) {\n return this.input.length + this.offset;\n }\n return this.next.index + this.offset;\n }\n /**\n * Returns the absolute offset of the start of the current token.\n */\n get currentAbsoluteOffset() {\n return this.absoluteOffset + this.inputIndex;\n }\n /**\n * Retrieve a `ParseSpan` from `start` to the current position (or to `artificialEndIndex` if\n * provided).\n *\n * @param start Position from which the `ParseSpan` will start.\n * @param artificialEndIndex Optional ending index to be used if provided (and if greater than the\n * natural ending index)\n */\n span(start, artificialEndIndex) {\n let endIndex = this.currentEndIndex;\n if (artificialEndIndex !== undefined && artificialEndIndex > this.currentEndIndex) {\n endIndex = artificialEndIndex;\n }\n // In some unusual parsing scenarios (like when certain tokens are missing and an `EmptyExpr` is\n // being created), the current token may already be advanced beyond the `currentEndIndex`. This\n // appears to be a deep-seated parser bug.\n //\n // As a workaround for now, swap the start and end indices to ensure a valid `ParseSpan`.\n // TODO(alxhub): fix the bug upstream in the parser state, and remove this workaround.\n if (start > endIndex) {\n const tmp = endIndex;\n endIndex = start;\n start = tmp;\n }\n return new ParseSpan(start, endIndex);\n }\n sourceSpan(start, artificialEndIndex) {\n const serial = `${start}@${this.inputIndex}:${artificialEndIndex}`;\n if (!this.sourceSpanCache.has(serial)) {\n this.sourceSpanCache.set(serial, this.span(start, artificialEndIndex).toAbsolute(this.absoluteOffset));\n }\n return this.sourceSpanCache.get(serial);\n }\n advance() {\n this.index++;\n }\n /**\n * Executes a callback in the provided context.\n */\n withContext(context, cb) {\n this.context |= context;\n const ret = cb();\n this.context ^= context;\n return ret;\n }\n consumeOptionalCharacter(code) {\n if (this.next.isCharacter(code)) {\n this.advance();\n return true;\n }\n else {\n return false;\n }\n }\n peekKeywordLet() {\n return this.next.isKeywordLet();\n }\n peekKeywordAs() {\n return this.next.isKeywordAs();\n }\n /**\n * Consumes an expected character, otherwise emits an error about the missing expected character\n * and skips over the token stream until reaching a recoverable point.\n *\n * See `this.error` and `this.skip` for more details.\n */\n expectCharacter(code) {\n if (this.consumeOptionalCharacter(code))\n return;\n this.error(`Missing expected ${String.fromCharCode(code)}`);\n }\n consumeOptionalOperator(op) {\n if (this.next.isOperator(op)) {\n this.advance();\n return true;\n }\n else {\n return false;\n }\n }\n expectOperator(operator) {\n if (this.consumeOptionalOperator(operator))\n return;\n this.error(`Missing expected operator ${operator}`);\n }\n prettyPrintToken(tok) {\n return tok === EOF ? 'end of input' : `token ${tok}`;\n }\n expectIdentifierOrKeyword() {\n const n = this.next;\n if (!n.isIdentifier() && !n.isKeyword()) {\n if (n.isPrivateIdentifier()) {\n this._reportErrorForPrivateIdentifier(n, 'expected identifier or keyword');\n }\n else {\n this.error(`Unexpected ${this.prettyPrintToken(n)}, expected identifier or keyword`);\n }\n return null;\n }\n this.advance();\n return n.toString();\n }\n expectIdentifierOrKeywordOrString() {\n const n = this.next;\n if (!n.isIdentifier() && !n.isKeyword() && !n.isString()) {\n if (n.isPrivateIdentifier()) {\n this._reportErrorForPrivateIdentifier(n, 'expected identifier, keyword or string');\n }\n else {\n this.error(`Unexpected ${this.prettyPrintToken(n)}, expected identifier, keyword, or string`);\n }\n return '';\n }\n this.advance();\n return n.toString();\n }\n parseChain() {\n const exprs = [];\n const start = this.inputIndex;\n while (this.index < this.tokens.length) {\n const expr = this.parsePipe();\n exprs.push(expr);\n if (this.consumeOptionalCharacter($SEMICOLON)) {\n if (!(this.parseFlags & 1 /* ParseFlags.Action */)) {\n this.error('Binding expression cannot contain chained expression');\n }\n while (this.consumeOptionalCharacter($SEMICOLON)) {\n } // read all semicolons\n }\n else if (this.index < this.tokens.length) {\n const errorIndex = this.index;\n this.error(`Unexpected token '${this.next}'`);\n // The `error` call above will skip ahead to the next recovery point in an attempt to\n // recover part of the expression, but that might be the token we started from which will\n // lead to an infinite loop. If that's the case, break the loop assuming that we can't\n // parse further.\n if (this.index === errorIndex) {\n break;\n }\n }\n }\n if (exprs.length === 0) {\n // We have no expressions so create an empty expression that spans the entire input length\n const artificialStart = this.offset;\n const artificialEnd = this.offset + this.input.length;\n return new EmptyExpr(this.span(artificialStart, artificialEnd), this.sourceSpan(artificialStart, artificialEnd));\n }\n if (exprs.length == 1)\n return exprs[0];\n return new Chain(this.span(start), this.sourceSpan(start), exprs);\n }\n parsePipe() {\n const start = this.inputIndex;\n let result = this.parseExpression();\n if (this.consumeOptionalOperator('|')) {\n if (this.parseFlags & 1 /* ParseFlags.Action */) {\n this.error('Cannot have a pipe in an action expression');\n }\n do {\n const nameStart = this.inputIndex;\n let nameId = this.expectIdentifierOrKeyword();\n let nameSpan;\n let fullSpanEnd = undefined;\n if (nameId !== null) {\n nameSpan = this.sourceSpan(nameStart);\n }\n else {\n // No valid identifier was found, so we'll assume an empty pipe name ('').\n nameId = '';\n // However, there may have been whitespace present between the pipe character and the next\n // token in the sequence (or the end of input). We want to track this whitespace so that\n // the `BindingPipe` we produce covers not just the pipe character, but any trailing\n // whitespace beyond it. Another way of thinking about this is that the zero-length name\n // is assumed to be at the end of any whitespace beyond the pipe character.\n //\n // Therefore, we push the end of the `ParseSpan` for this pipe all the way up to the\n // beginning of the next token, or until the end of input if the next token is EOF.\n fullSpanEnd = this.next.index !== -1 ? this.next.index : this.input.length + this.offset;\n // The `nameSpan` for an empty pipe name is zero-length at the end of any whitespace\n // beyond the pipe character.\n nameSpan = new ParseSpan(fullSpanEnd, fullSpanEnd).toAbsolute(this.absoluteOffset);\n }\n const args = [];\n while (this.consumeOptionalCharacter($COLON)) {\n args.push(this.parseExpression());\n // If there are additional expressions beyond the name, then the artificial end for the\n // name is no longer relevant.\n }\n result = new BindingPipe(this.span(start), this.sourceSpan(start, fullSpanEnd), result, nameId, args, nameSpan);\n } while (this.consumeOptionalOperator('|'));\n }\n return result;\n }\n parseExpression() {\n return this.parseConditional();\n }\n parseConditional() {\n const start = this.inputIndex;\n const result = this.parseLogicalOr();\n if (this.consumeOptionalOperator('?')) {\n const yes = this.parsePipe();\n let no;\n if (!this.consumeOptionalCharacter($COLON)) {\n const end = this.inputIndex;\n const expression = this.input.substring(start, end);\n this.error(`Conditional expression ${expression} requires all 3 expressions`);\n no = new EmptyExpr(this.span(start), this.sourceSpan(start));\n }\n else {\n no = this.parsePipe();\n }\n return new Conditional(this.span(start), this.sourceSpan(start), result, yes, no);\n }\n else {\n return result;\n }\n }\n parseLogicalOr() {\n // '||'\n const start = this.inputIndex;\n let result = this.parseLogicalAnd();\n while (this.consumeOptionalOperator('||')) {\n const right = this.parseLogicalAnd();\n result = new Binary(this.span(start), this.sourceSpan(start), '||', result, right);\n }\n return result;\n }\n parseLogicalAnd() {\n // '&&'\n const start = this.inputIndex;\n let result = this.parseNullishCoalescing();\n while (this.consumeOptionalOperator('&&')) {\n const right = this.parseNullishCoalescing();\n result = new Binary(this.span(start), this.sourceSpan(start), '&&', result, right);\n }\n return result;\n }\n parseNullishCoalescing() {\n // '??'\n const start = this.inputIndex;\n let result = this.parseEquality();\n while (this.consumeOptionalOperator('??')) {\n const right = this.parseEquality();\n result = new Binary(this.span(start), this.sourceSpan(start), '??', result, right);\n }\n return result;\n }\n parseEquality() {\n // '==','!=','===','!=='\n const start = this.inputIndex;\n let result = this.parseRelational();\n while (this.next.type == TokenType.Operator) {\n const operator = this.next.strValue;\n switch (operator) {\n case '==':\n case '===':\n case '!=':\n case '!==':\n this.advance();\n const right = this.parseRelational();\n result = new Binary(this.span(start), this.sourceSpan(start), operator, result, right);\n continue;\n }\n break;\n }\n return result;\n }\n parseRelational() {\n // '<', '>', '<=', '>='\n const start = this.inputIndex;\n let result = this.parseAdditive();\n while (this.next.type == TokenType.Operator) {\n const operator = this.next.strValue;\n switch (operator) {\n case '<':\n case '>':\n case '<=':\n case '>=':\n this.advance();\n const right = this.parseAdditive();\n result = new Binary(this.span(start), this.sourceSpan(start), operator, result, right);\n continue;\n }\n break;\n }\n return result;\n }\n parseAdditive() {\n // '+', '-'\n const start = this.inputIndex;\n let result = this.parseMultiplicative();\n while (this.next.type == TokenType.Operator) {\n const operator = this.next.strValue;\n switch (operator) {\n case '+':\n case '-':\n this.advance();\n let right = this.parseMultiplicative();\n result = new Binary(this.span(start), this.sourceSpan(start), operator, result, right);\n continue;\n }\n break;\n }\n return result;\n }\n parseMultiplicative() {\n // '*', '%', '/'\n const start = this.inputIndex;\n let result = this.parsePrefix();\n while (this.next.type == TokenType.Operator) {\n const operator = this.next.strValue;\n switch (operator) {\n case '*':\n case '%':\n case '/':\n this.advance();\n let right = this.parsePrefix();\n result = new Binary(this.span(start), this.sourceSpan(start), operator, result, right);\n continue;\n }\n break;\n }\n return result;\n }\n parsePrefix() {\n if (this.next.type == TokenType.Operator) {\n const start = this.inputIndex;\n const operator = this.next.strValue;\n let result;\n switch (operator) {\n case '+':\n this.advance();\n result = this.parsePrefix();\n return Unary.createPlus(this.span(start), this.sourceSpan(start), result);\n case '-':\n this.advance();\n result = this.parsePrefix();\n return Unary.createMinus(this.span(start), this.sourceSpan(start), result);\n case '!':\n this.advance();\n result = this.parsePrefix();\n return new PrefixNot(this.span(start), this.sourceSpan(start), result);\n }\n }\n return this.parseCallChain();\n }\n parseCallChain() {\n const start = this.inputIndex;\n let result = this.parsePrimary();\n while (true) {\n if (this.consumeOptionalCharacter($PERIOD)) {\n result = this.parseAccessMember(result, start, false);\n }\n else if (this.consumeOptionalOperator('?.')) {\n if (this.consumeOptionalCharacter($LPAREN)) {\n result = this.parseCall(result, start, true);\n }\n else {\n result = this.consumeOptionalCharacter($LBRACKET) ?\n this.parseKeyedReadOrWrite(result, start, true) :\n this.parseAccessMember(result, start, true);\n }\n }\n else if (this.consumeOptionalCharacter($LBRACKET)) {\n result = this.parseKeyedReadOrWrite(result, start, false);\n }\n else if (this.consumeOptionalCharacter($LPAREN)) {\n result = this.parseCall(result, start, false);\n }\n else if (this.consumeOptionalOperator('!')) {\n result = new NonNullAssert(this.span(start), this.sourceSpan(start), result);\n }\n else {\n return result;\n }\n }\n }\n parsePrimary() {\n const start = this.inputIndex;\n if (this.consumeOptionalCharacter($LPAREN)) {\n this.rparensExpected++;\n const result = this.parsePipe();\n this.rparensExpected--;\n this.expectCharacter($RPAREN);\n return result;\n }\n else if (this.next.isKeywordNull()) {\n this.advance();\n return new LiteralPrimitive(this.span(start), this.sourceSpan(start), null);\n }\n else if (this.next.isKeywordUndefined()) {\n this.advance();\n return new LiteralPrimitive(this.span(start), this.sourceSpan(start), void 0);\n }\n else if (this.next.isKeywordTrue()) {\n this.advance();\n return new LiteralPrimitive(this.span(start), this.sourceSpan(start), true);\n }\n else if (this.next.isKeywordFalse()) {\n this.advance();\n return new LiteralPrimitive(this.span(start), this.sourceSpan(start), false);\n }\n else if (this.next.isKeywordThis()) {\n this.advance();\n return new ThisReceiver(this.span(start), this.sourceSpan(start));\n }\n else if (this.consumeOptionalCharacter($LBRACKET)) {\n this.rbracketsExpected++;\n const elements = this.parseExpressionList($RBRACKET);\n this.rbracketsExpected--;\n this.expectCharacter($RBRACKET);\n return new LiteralArray(this.span(start), this.sourceSpan(start), elements);\n }\n else if (this.next.isCharacter($LBRACE)) {\n return this.parseLiteralMap();\n }\n else if (this.next.isIdentifier()) {\n return this.parseAccessMember(new ImplicitReceiver(this.span(start), this.sourceSpan(start)), start, false);\n }\n else if (this.next.isNumber()) {\n const value = this.next.toNumber();\n this.advance();\n return new LiteralPrimitive(this.span(start), this.sourceSpan(start), value);\n }\n else if (this.next.isString()) {\n const literalValue = this.next.toString();\n this.advance();\n return new LiteralPrimitive(this.span(start), this.sourceSpan(start), literalValue);\n }\n else if (this.next.isPrivateIdentifier()) {\n this._reportErrorForPrivateIdentifier(this.next, null);\n return new EmptyExpr(this.span(start), this.sourceSpan(start));\n }\n else if (this.index >= this.tokens.length) {\n this.error(`Unexpected end of expression: ${this.input}`);\n return new EmptyExpr(this.span(start), this.sourceSpan(start));\n }\n else {\n this.error(`Unexpected token ${this.next}`);\n return new EmptyExpr(this.span(start), this.sourceSpan(start));\n }\n }\n parseExpressionList(terminator) {\n const result = [];\n do {\n if (!this.next.isCharacter(terminator)) {\n result.push(this.parsePipe());\n }\n else {\n break;\n }\n } while (this.consumeOptionalCharacter($COMMA));\n return result;\n }\n parseLiteralMap() {\n const keys = [];\n const values = [];\n const start = this.inputIndex;\n this.expectCharacter($LBRACE);\n if (!this.consumeOptionalCharacter($RBRACE)) {\n this.rbracesExpected++;\n do {\n const keyStart = this.inputIndex;\n const quoted = this.next.isString();\n const key = this.expectIdentifierOrKeywordOrString();\n keys.push({ key, quoted });\n // Properties with quoted keys can't use the shorthand syntax.\n if (quoted) {\n this.expectCharacter($COLON);\n values.push(this.parsePipe());\n }\n else if (this.consumeOptionalCharacter($COLON)) {\n values.push(this.parsePipe());\n }\n else {\n const span = this.span(keyStart);\n const sourceSpan = this.sourceSpan(keyStart);\n values.push(new PropertyRead(span, sourceSpan, sourceSpan, new ImplicitReceiver(span, sourceSpan), key));\n }\n } while (this.consumeOptionalCharacter($COMMA));\n this.rbracesExpected--;\n this.expectCharacter($RBRACE);\n }\n return new LiteralMap(this.span(start), this.sourceSpan(start), keys, values);\n }\n parseAccessMember(readReceiver, start, isSafe) {\n const nameStart = this.inputIndex;\n const id = this.withContext(ParseContextFlags.Writable, () => {\n var _a;\n const id = (_a = this.expectIdentifierOrKeyword()) !== null && _a !== void 0 ? _a : '';\n if (id.length === 0) {\n this.error(`Expected identifier for property access`, readReceiver.span.end);\n }\n return id;\n });\n const nameSpan = this.sourceSpan(nameStart);\n let receiver;\n if (isSafe) {\n if (this.consumeOptionalAssignment()) {\n this.error('The \\'?.\\' operator cannot be used in the assignment');\n receiver = new EmptyExpr(this.span(start), this.sourceSpan(start));\n }\n else {\n receiver = new SafePropertyRead(this.span(start), this.sourceSpan(start), nameSpan, readReceiver, id);\n }\n }\n else {\n if (this.consumeOptionalAssignment()) {\n if (!(this.parseFlags & 1 /* ParseFlags.Action */)) {\n this.error('Bindings cannot contain assignments');\n return new EmptyExpr(this.span(start), this.sourceSpan(start));\n }\n const value = this.parseConditional();\n receiver = new PropertyWrite(this.span(start), this.sourceSpan(start), nameSpan, readReceiver, id, value);\n }\n else {\n receiver =\n new PropertyRead(this.span(start), this.sourceSpan(start), nameSpan, readReceiver, id);\n }\n }\n return receiver;\n }\n parseCall(receiver, start, isSafe) {\n const argumentStart = this.inputIndex;\n this.rparensExpected++;\n const args = this.parseCallArguments();\n const argumentSpan = this.span(argumentStart, this.inputIndex).toAbsolute(this.absoluteOffset);\n this.expectCharacter($RPAREN);\n this.rparensExpected--;\n const span = this.span(start);\n const sourceSpan = this.sourceSpan(start);\n return isSafe ? new SafeCall(span, sourceSpan, receiver, args, argumentSpan) :\n new Call(span, sourceSpan, receiver, args, argumentSpan);\n }\n consumeOptionalAssignment() {\n // When parsing assignment events (originating from two-way-binding aka banana-in-a-box syntax),\n // it is valid for the primary expression to be terminated by the non-null operator. This\n // primary expression is substituted as LHS of the assignment operator to achieve\n // two-way-binding, such that the LHS could be the non-null operator. The grammar doesn't\n // naturally allow for this syntax, so assignment events are parsed specially.\n if ((this.parseFlags & 2 /* ParseFlags.AssignmentEvent */) && this.next.isOperator('!') &&\n this.peek(1).isOperator('=')) {\n // First skip over the ! operator.\n this.advance();\n // Then skip over the = operator, to fully consume the optional assignment operator.\n this.advance();\n return true;\n }\n return this.consumeOptionalOperator('=');\n }\n parseCallArguments() {\n if (this.next.isCharacter($RPAREN))\n return [];\n const positionals = [];\n do {\n positionals.push(this.parsePipe());\n } while (this.consumeOptionalCharacter($COMMA));\n return positionals;\n }\n /**\n * Parses an identifier, a keyword, a string with an optional `-` in between,\n * and returns the string along with its absolute source span.\n */\n expectTemplateBindingKey() {\n let result = '';\n let operatorFound = false;\n const start = this.currentAbsoluteOffset;\n do {\n result += this.expectIdentifierOrKeywordOrString();\n operatorFound = this.consumeOptionalOperator('-');\n if (operatorFound) {\n result += '-';\n }\n } while (operatorFound);\n return {\n source: result,\n span: new AbsoluteSourceSpan(start, start + result.length),\n };\n }\n /**\n * Parse microsyntax template expression and return a list of bindings or\n * parsing errors in case the given expression is invalid.\n *\n * For example,\n * ```\n * \n * ```\n * contains five bindings:\n * 1. ngFor -> null\n * 2. item -> NgForOfContext.$implicit\n * 3. ngForOf -> items\n * 4. i -> NgForOfContext.index\n * 5. ngForTrackBy -> func\n *\n * For a full description of the microsyntax grammar, see\n * https://gist.github.com/mhevery/d3530294cff2e4a1b3fe15ff75d08855\n *\n * @param templateKey name of the microsyntax directive, like ngIf, ngFor,\n * without the *, along with its absolute span.\n */\n parseTemplateBindings(templateKey) {\n const bindings = [];\n // The first binding is for the template key itself\n // In *ngFor=\"let item of items\", key = \"ngFor\", value = null\n // In *ngIf=\"cond | pipe\", key = \"ngIf\", value = \"cond | pipe\"\n bindings.push(...this.parseDirectiveKeywordBindings(templateKey));\n while (this.index < this.tokens.length) {\n // If it starts with 'let', then this must be variable declaration\n const letBinding = this.parseLetBinding();\n if (letBinding) {\n bindings.push(letBinding);\n }\n else {\n // Two possible cases here, either `value \"as\" key` or\n // \"directive-keyword expression\". We don't know which case, but both\n // \"value\" and \"directive-keyword\" are template binding key, so consume\n // the key first.\n const key = this.expectTemplateBindingKey();\n // Peek at the next token, if it is \"as\" then this must be variable\n // declaration.\n const binding = this.parseAsBinding(key);\n if (binding) {\n bindings.push(binding);\n }\n else {\n // Otherwise the key must be a directive keyword, like \"of\". Transform\n // the key to actual key. Eg. of -> ngForOf, trackBy -> ngForTrackBy\n key.source =\n templateKey.source + key.source.charAt(0).toUpperCase() + key.source.substring(1);\n bindings.push(...this.parseDirectiveKeywordBindings(key));\n }\n }\n this.consumeStatementTerminator();\n }\n return new TemplateBindingParseResult(bindings, [] /* warnings */, this.errors);\n }\n parseKeyedReadOrWrite(receiver, start, isSafe) {\n return this.withContext(ParseContextFlags.Writable, () => {\n this.rbracketsExpected++;\n const key = this.parsePipe();\n if (key instanceof EmptyExpr) {\n this.error(`Key access cannot be empty`);\n }\n this.rbracketsExpected--;\n this.expectCharacter($RBRACKET);\n if (this.consumeOptionalOperator('=')) {\n if (isSafe) {\n this.error('The \\'?.\\' operator cannot be used in the assignment');\n }\n else {\n const value = this.parseConditional();\n return new KeyedWrite(this.span(start), this.sourceSpan(start), receiver, key, value);\n }\n }\n else {\n return isSafe ? new SafeKeyedRead(this.span(start), this.sourceSpan(start), receiver, key) :\n new KeyedRead(this.span(start), this.sourceSpan(start), receiver, key);\n }\n return new EmptyExpr(this.span(start), this.sourceSpan(start));\n });\n }\n /**\n * Parse a directive keyword, followed by a mandatory expression.\n * For example, \"of items\", \"trackBy: func\".\n * The bindings are: ngForOf -> items, ngForTrackBy -> func\n * There could be an optional \"as\" binding that follows the expression.\n * For example,\n * ```\n * *ngFor=\"let item of items | slice:0:1 as collection\".\n * ^^ ^^^^^^^^^^^^^^^^^ ^^^^^^^^^^^^^\n * keyword bound target optional 'as' binding\n * ```\n *\n * @param key binding key, for example, ngFor, ngIf, ngForOf, along with its\n * absolute span.\n */\n parseDirectiveKeywordBindings(key) {\n const bindings = [];\n this.consumeOptionalCharacter($COLON); // trackBy: trackByFunction\n const value = this.getDirectiveBoundTarget();\n let spanEnd = this.currentAbsoluteOffset;\n // The binding could optionally be followed by \"as\". For example,\n // *ngIf=\"cond | pipe as x\". In this case, the key in the \"as\" binding\n // is \"x\" and the value is the template key itself (\"ngIf\"). Note that the\n // 'key' in the current context now becomes the \"value\" in the next binding.\n const asBinding = this.parseAsBinding(key);\n if (!asBinding) {\n this.consumeStatementTerminator();\n spanEnd = this.currentAbsoluteOffset;\n }\n const sourceSpan = new AbsoluteSourceSpan(key.span.start, spanEnd);\n bindings.push(new ExpressionBinding(sourceSpan, key, value));\n if (asBinding) {\n bindings.push(asBinding);\n }\n return bindings;\n }\n /**\n * Return the expression AST for the bound target of a directive keyword\n * binding. For example,\n * ```\n * *ngIf=\"condition | pipe\"\n * ^^^^^^^^^^^^^^^^ bound target for \"ngIf\"\n * *ngFor=\"let item of items\"\n * ^^^^^ bound target for \"ngForOf\"\n * ```\n */\n getDirectiveBoundTarget() {\n if (this.next === EOF || this.peekKeywordAs() || this.peekKeywordLet()) {\n return null;\n }\n const ast = this.parsePipe(); // example: \"condition | async\"\n const { start, end } = ast.span;\n const value = this.input.substring(start, end);\n return new ASTWithSource(ast, value, this.location, this.absoluteOffset + start, this.errors);\n }\n /**\n * Return the binding for a variable declared using `as`. Note that the order\n * of the key-value pair in this declaration is reversed. For example,\n * ```\n * *ngFor=\"let item of items; index as i\"\n * ^^^^^ ^\n * value key\n * ```\n *\n * @param value name of the value in the declaration, \"ngIf\" in the example\n * above, along with its absolute span.\n */\n parseAsBinding(value) {\n if (!this.peekKeywordAs()) {\n return null;\n }\n this.advance(); // consume the 'as' keyword\n const key = this.expectTemplateBindingKey();\n this.consumeStatementTerminator();\n const sourceSpan = new AbsoluteSourceSpan(value.span.start, this.currentAbsoluteOffset);\n return new VariableBinding(sourceSpan, key, value);\n }\n /**\n * Return the binding for a variable declared using `let`. For example,\n * ```\n * *ngFor=\"let item of items; let i=index;\"\n * ^^^^^^^^ ^^^^^^^^^^^\n * ```\n * In the first binding, `item` is bound to `NgForOfContext.$implicit`.\n * In the second binding, `i` is bound to `NgForOfContext.index`.\n */\n parseLetBinding() {\n if (!this.peekKeywordLet()) {\n return null;\n }\n const spanStart = this.currentAbsoluteOffset;\n this.advance(); // consume the 'let' keyword\n const key = this.expectTemplateBindingKey();\n let value = null;\n if (this.consumeOptionalOperator('=')) {\n value = this.expectTemplateBindingKey();\n }\n this.consumeStatementTerminator();\n const sourceSpan = new AbsoluteSourceSpan(spanStart, this.currentAbsoluteOffset);\n return new VariableBinding(sourceSpan, key, value);\n }\n /**\n * Consume the optional statement terminator: semicolon or comma.\n */\n consumeStatementTerminator() {\n this.consumeOptionalCharacter($SEMICOLON) || this.consumeOptionalCharacter($COMMA);\n }\n /**\n * Records an error and skips over the token stream until reaching a recoverable point. See\n * `this.skip` for more details on token skipping.\n */\n error(message, index = null) {\n this.errors.push(new ParserError(message, this.input, this.locationText(index), this.location));\n this.skip();\n }\n locationText(index = null) {\n if (index == null)\n index = this.index;\n return (index < this.tokens.length) ? `at column ${this.tokens[index].index + 1} in` :\n `at the end of the expression`;\n }\n /**\n * Records an error for an unexpected private identifier being discovered.\n * @param token Token representing a private identifier.\n * @param extraMessage Optional additional message being appended to the error.\n */\n _reportErrorForPrivateIdentifier(token, extraMessage) {\n let errorMessage = `Private identifiers are not supported. Unexpected private identifier: ${token}`;\n if (extraMessage !== null) {\n errorMessage += `, ${extraMessage}`;\n }\n this.error(errorMessage);\n }\n /**\n * Error recovery should skip tokens until it encounters a recovery point.\n *\n * The following are treated as unconditional recovery points:\n * - end of input\n * - ';' (parseChain() is always the root production, and it expects a ';')\n * - '|' (since pipes may be chained and each pipe expression may be treated independently)\n *\n * The following are conditional recovery points:\n * - ')', '}', ']' if one of calling productions is expecting one of these symbols\n * - This allows skip() to recover from errors such as '(a.) + 1' allowing more of the AST to\n * be retained (it doesn't skip any tokens as the ')' is retained because of the '(' begins\n * an '('
')' production).\n * The recovery points of grouping symbols must be conditional as they must be skipped if\n * none of the calling productions are not expecting the closing token else we will never\n * make progress in the case of an extraneous group closing symbol (such as a stray ')').\n * That is, we skip a closing symbol if we are not in a grouping production.\n * - '=' in a `Writable` context\n * - In this context, we are able to recover after seeing the `=` operator, which\n * signals the presence of an independent rvalue expression following the `=` operator.\n *\n * If a production expects one of these token it increments the corresponding nesting count,\n * and then decrements it just prior to checking if the token is in the input.\n */\n skip() {\n let n = this.next;\n while (this.index < this.tokens.length && !n.isCharacter($SEMICOLON) &&\n !n.isOperator('|') && (this.rparensExpected <= 0 || !n.isCharacter($RPAREN)) &&\n (this.rbracesExpected <= 0 || !n.isCharacter($RBRACE)) &&\n (this.rbracketsExpected <= 0 || !n.isCharacter($RBRACKET)) &&\n (!(this.context & ParseContextFlags.Writable) || !n.isOperator('='))) {\n if (this.next.isError()) {\n this.errors.push(new ParserError(this.next.toString(), this.input, this.locationText(), this.location));\n }\n this.advance();\n n = this.next;\n }\n }\n}\nclass SimpleExpressionChecker extends RecursiveAstVisitor {\n constructor() {\n super(...arguments);\n this.errors = [];\n }\n visitPipe() {\n this.errors.push('pipes');\n }\n}\n/**\n * Computes the real offset in the original template for indexes in an interpolation.\n *\n * Because templates can have encoded HTML entities and the input passed to the parser at this stage\n * of the compiler is the _decoded_ value, we need to compute the real offset using the original\n * encoded values in the interpolated tokens. Note that this is only a special case handling for\n * `MlParserTokenType.ENCODED_ENTITY` token types. All other interpolated tokens are expected to\n * have parts which exactly match the input string for parsing the interpolation.\n *\n * @param interpolatedTokens The tokens for the interpolated value.\n *\n * @returns A map of index locations in the decoded template to indexes in the original template\n */\nfunction getIndexMapForOriginalTemplate(interpolatedTokens) {\n let offsetMap = new Map();\n let consumedInOriginalTemplate = 0;\n let consumedInInput = 0;\n let tokenIndex = 0;\n while (tokenIndex < interpolatedTokens.length) {\n const currentToken = interpolatedTokens[tokenIndex];\n if (currentToken.type === 9 /* MlParserTokenType.ENCODED_ENTITY */) {\n const [decoded, encoded] = currentToken.parts;\n consumedInOriginalTemplate += encoded.length;\n consumedInInput += decoded.length;\n }\n else {\n const lengthOfParts = currentToken.parts.reduce((sum, current) => sum + current.length, 0);\n consumedInInput += lengthOfParts;\n consumedInOriginalTemplate += lengthOfParts;\n }\n offsetMap.set(consumedInInput, consumedInOriginalTemplate);\n tokenIndex++;\n }\n return offsetMap;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass NodeWithI18n {\n constructor(sourceSpan, i18n) {\n this.sourceSpan = sourceSpan;\n this.i18n = i18n;\n }\n}\nclass Text extends NodeWithI18n {\n constructor(value, sourceSpan, tokens, i18n) {\n super(sourceSpan, i18n);\n this.value = value;\n this.tokens = tokens;\n }\n visit(visitor, context) {\n return visitor.visitText(this, context);\n }\n}\nclass Expansion extends NodeWithI18n {\n constructor(switchValue, type, cases, sourceSpan, switchValueSourceSpan, i18n) {\n super(sourceSpan, i18n);\n this.switchValue = switchValue;\n this.type = type;\n this.cases = cases;\n this.switchValueSourceSpan = switchValueSourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitExpansion(this, context);\n }\n}\nclass ExpansionCase {\n constructor(value, expression, sourceSpan, valueSourceSpan, expSourceSpan) {\n this.value = value;\n this.expression = expression;\n this.sourceSpan = sourceSpan;\n this.valueSourceSpan = valueSourceSpan;\n this.expSourceSpan = expSourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitExpansionCase(this, context);\n }\n}\nclass Attribute extends NodeWithI18n {\n constructor(name, value, sourceSpan, keySpan, valueSpan, valueTokens, i18n) {\n super(sourceSpan, i18n);\n this.name = name;\n this.value = value;\n this.keySpan = keySpan;\n this.valueSpan = valueSpan;\n this.valueTokens = valueTokens;\n }\n visit(visitor, context) {\n return visitor.visitAttribute(this, context);\n }\n}\nclass Element extends NodeWithI18n {\n constructor(name, attrs, children, sourceSpan, startSourceSpan, endSourceSpan = null, i18n) {\n super(sourceSpan, i18n);\n this.name = name;\n this.attrs = attrs;\n this.children = children;\n this.startSourceSpan = startSourceSpan;\n this.endSourceSpan = endSourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitElement(this, context);\n }\n}\nclass Comment {\n constructor(value, sourceSpan) {\n this.value = value;\n this.sourceSpan = sourceSpan;\n }\n visit(visitor, context) {\n return visitor.visitComment(this, context);\n }\n}\nfunction visitAll(visitor, nodes, context = null) {\n const result = [];\n const visit = visitor.visit ?\n (ast) => visitor.visit(ast, context) || ast.visit(visitor, context) :\n (ast) => ast.visit(visitor, context);\n nodes.forEach(ast => {\n const astResult = visit(ast);\n if (astResult) {\n result.push(astResult);\n }\n });\n return result;\n}\nclass RecursiveVisitor {\n constructor() { }\n visitElement(ast, context) {\n this.visitChildren(context, visit => {\n visit(ast.attrs);\n visit(ast.children);\n });\n }\n visitAttribute(ast, context) { }\n visitText(ast, context) { }\n visitComment(ast, context) { }\n visitExpansion(ast, context) {\n return this.visitChildren(context, visit => {\n visit(ast.cases);\n });\n }\n visitExpansionCase(ast, context) { }\n visitChildren(context, cb) {\n let results = [];\n let t = this;\n function visit(children) {\n if (children)\n results.push(visitAll(t, children, context));\n }\n cb(visit);\n return Array.prototype.concat.apply([], results);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Mapping between all HTML entity names and their unicode representation.\n// Generated from https://html.spec.whatwg.org/multipage/entities.json by stripping\n// the `&` and `;` from the keys and removing the duplicates.\n// see https://www.w3.org/TR/html51/syntax.html#named-character-references\nconst NAMED_ENTITIES = {\n 'AElig': '\\u00C6',\n 'AMP': '\\u0026',\n 'amp': '\\u0026',\n 'Aacute': '\\u00C1',\n 'Abreve': '\\u0102',\n 'Acirc': '\\u00C2',\n 'Acy': '\\u0410',\n 'Afr': '\\uD835\\uDD04',\n 'Agrave': '\\u00C0',\n 'Alpha': '\\u0391',\n 'Amacr': '\\u0100',\n 'And': '\\u2A53',\n 'Aogon': '\\u0104',\n 'Aopf': '\\uD835\\uDD38',\n 'ApplyFunction': '\\u2061',\n 'af': '\\u2061',\n 'Aring': '\\u00C5',\n 'angst': '\\u00C5',\n 'Ascr': '\\uD835\\uDC9C',\n 'Assign': '\\u2254',\n 'colone': '\\u2254',\n 'coloneq': '\\u2254',\n 'Atilde': '\\u00C3',\n 'Auml': '\\u00C4',\n 'Backslash': '\\u2216',\n 'setminus': '\\u2216',\n 'setmn': '\\u2216',\n 'smallsetminus': '\\u2216',\n 'ssetmn': '\\u2216',\n 'Barv': '\\u2AE7',\n 'Barwed': '\\u2306',\n 'doublebarwedge': '\\u2306',\n 'Bcy': '\\u0411',\n 'Because': '\\u2235',\n 'becaus': '\\u2235',\n 'because': '\\u2235',\n 'Bernoullis': '\\u212C',\n 'Bscr': '\\u212C',\n 'bernou': '\\u212C',\n 'Beta': '\\u0392',\n 'Bfr': '\\uD835\\uDD05',\n 'Bopf': '\\uD835\\uDD39',\n 'Breve': '\\u02D8',\n 'breve': '\\u02D8',\n 'Bumpeq': '\\u224E',\n 'HumpDownHump': '\\u224E',\n 'bump': '\\u224E',\n 'CHcy': '\\u0427',\n 'COPY': '\\u00A9',\n 'copy': '\\u00A9',\n 'Cacute': '\\u0106',\n 'Cap': '\\u22D2',\n 'CapitalDifferentialD': '\\u2145',\n 'DD': '\\u2145',\n 'Cayleys': '\\u212D',\n 'Cfr': '\\u212D',\n 'Ccaron': '\\u010C',\n 'Ccedil': '\\u00C7',\n 'Ccirc': '\\u0108',\n 'Cconint': '\\u2230',\n 'Cdot': '\\u010A',\n 'Cedilla': '\\u00B8',\n 'cedil': '\\u00B8',\n 'CenterDot': '\\u00B7',\n 'centerdot': '\\u00B7',\n 'middot': '\\u00B7',\n 'Chi': '\\u03A7',\n 'CircleDot': '\\u2299',\n 'odot': '\\u2299',\n 'CircleMinus': '\\u2296',\n 'ominus': '\\u2296',\n 'CirclePlus': '\\u2295',\n 'oplus': '\\u2295',\n 'CircleTimes': '\\u2297',\n 'otimes': '\\u2297',\n 'ClockwiseContourIntegral': '\\u2232',\n 'cwconint': '\\u2232',\n 'CloseCurlyDoubleQuote': '\\u201D',\n 'rdquo': '\\u201D',\n 'rdquor': '\\u201D',\n 'CloseCurlyQuote': '\\u2019',\n 'rsquo': '\\u2019',\n 'rsquor': '\\u2019',\n 'Colon': '\\u2237',\n 'Proportion': '\\u2237',\n 'Colone': '\\u2A74',\n 'Congruent': '\\u2261',\n 'equiv': '\\u2261',\n 'Conint': '\\u222F',\n 'DoubleContourIntegral': '\\u222F',\n 'ContourIntegral': '\\u222E',\n 'conint': '\\u222E',\n 'oint': '\\u222E',\n 'Copf': '\\u2102',\n 'complexes': '\\u2102',\n 'Coproduct': '\\u2210',\n 'coprod': '\\u2210',\n 'CounterClockwiseContourIntegral': '\\u2233',\n 'awconint': '\\u2233',\n 'Cross': '\\u2A2F',\n 'Cscr': '\\uD835\\uDC9E',\n 'Cup': '\\u22D3',\n 'CupCap': '\\u224D',\n 'asympeq': '\\u224D',\n 'DDotrahd': '\\u2911',\n 'DJcy': '\\u0402',\n 'DScy': '\\u0405',\n 'DZcy': '\\u040F',\n 'Dagger': '\\u2021',\n 'ddagger': '\\u2021',\n 'Darr': '\\u21A1',\n 'Dashv': '\\u2AE4',\n 'DoubleLeftTee': '\\u2AE4',\n 'Dcaron': '\\u010E',\n 'Dcy': '\\u0414',\n 'Del': '\\u2207',\n 'nabla': '\\u2207',\n 'Delta': '\\u0394',\n 'Dfr': '\\uD835\\uDD07',\n 'DiacriticalAcute': '\\u00B4',\n 'acute': '\\u00B4',\n 'DiacriticalDot': '\\u02D9',\n 'dot': '\\u02D9',\n 'DiacriticalDoubleAcute': '\\u02DD',\n 'dblac': '\\u02DD',\n 'DiacriticalGrave': '\\u0060',\n 'grave': '\\u0060',\n 'DiacriticalTilde': '\\u02DC',\n 'tilde': '\\u02DC',\n 'Diamond': '\\u22C4',\n 'diam': '\\u22C4',\n 'diamond': '\\u22C4',\n 'DifferentialD': '\\u2146',\n 'dd': '\\u2146',\n 'Dopf': '\\uD835\\uDD3B',\n 'Dot': '\\u00A8',\n 'DoubleDot': '\\u00A8',\n 'die': '\\u00A8',\n 'uml': '\\u00A8',\n 'DotDot': '\\u20DC',\n 'DotEqual': '\\u2250',\n 'doteq': '\\u2250',\n 'esdot': '\\u2250',\n 'DoubleDownArrow': '\\u21D3',\n 'Downarrow': '\\u21D3',\n 'dArr': '\\u21D3',\n 'DoubleLeftArrow': '\\u21D0',\n 'Leftarrow': '\\u21D0',\n 'lArr': '\\u21D0',\n 'DoubleLeftRightArrow': '\\u21D4',\n 'Leftrightarrow': '\\u21D4',\n 'hArr': '\\u21D4',\n 'iff': '\\u21D4',\n 'DoubleLongLeftArrow': '\\u27F8',\n 'Longleftarrow': '\\u27F8',\n 'xlArr': '\\u27F8',\n 'DoubleLongLeftRightArrow': '\\u27FA',\n 'Longleftrightarrow': '\\u27FA',\n 'xhArr': '\\u27FA',\n 'DoubleLongRightArrow': '\\u27F9',\n 'Longrightarrow': '\\u27F9',\n 'xrArr': '\\u27F9',\n 'DoubleRightArrow': '\\u21D2',\n 'Implies': '\\u21D2',\n 'Rightarrow': '\\u21D2',\n 'rArr': '\\u21D2',\n 'DoubleRightTee': '\\u22A8',\n 'vDash': '\\u22A8',\n 'DoubleUpArrow': '\\u21D1',\n 'Uparrow': '\\u21D1',\n 'uArr': '\\u21D1',\n 'DoubleUpDownArrow': '\\u21D5',\n 'Updownarrow': '\\u21D5',\n 'vArr': '\\u21D5',\n 'DoubleVerticalBar': '\\u2225',\n 'par': '\\u2225',\n 'parallel': '\\u2225',\n 'shortparallel': '\\u2225',\n 'spar': '\\u2225',\n 'DownArrow': '\\u2193',\n 'ShortDownArrow': '\\u2193',\n 'darr': '\\u2193',\n 'downarrow': '\\u2193',\n 'DownArrowBar': '\\u2913',\n 'DownArrowUpArrow': '\\u21F5',\n 'duarr': '\\u21F5',\n 'DownBreve': '\\u0311',\n 'DownLeftRightVector': '\\u2950',\n 'DownLeftTeeVector': '\\u295E',\n 'DownLeftVector': '\\u21BD',\n 'leftharpoondown': '\\u21BD',\n 'lhard': '\\u21BD',\n 'DownLeftVectorBar': '\\u2956',\n 'DownRightTeeVector': '\\u295F',\n 'DownRightVector': '\\u21C1',\n 'rhard': '\\u21C1',\n 'rightharpoondown': '\\u21C1',\n 'DownRightVectorBar': '\\u2957',\n 'DownTee': '\\u22A4',\n 'top': '\\u22A4',\n 'DownTeeArrow': '\\u21A7',\n 'mapstodown': '\\u21A7',\n 'Dscr': '\\uD835\\uDC9F',\n 'Dstrok': '\\u0110',\n 'ENG': '\\u014A',\n 'ETH': '\\u00D0',\n 'Eacute': '\\u00C9',\n 'Ecaron': '\\u011A',\n 'Ecirc': '\\u00CA',\n 'Ecy': '\\u042D',\n 'Edot': '\\u0116',\n 'Efr': '\\uD835\\uDD08',\n 'Egrave': '\\u00C8',\n 'Element': '\\u2208',\n 'in': '\\u2208',\n 'isin': '\\u2208',\n 'isinv': '\\u2208',\n 'Emacr': '\\u0112',\n 'EmptySmallSquare': '\\u25FB',\n 'EmptyVerySmallSquare': '\\u25AB',\n 'Eogon': '\\u0118',\n 'Eopf': '\\uD835\\uDD3C',\n 'Epsilon': '\\u0395',\n 'Equal': '\\u2A75',\n 'EqualTilde': '\\u2242',\n 'eqsim': '\\u2242',\n 'esim': '\\u2242',\n 'Equilibrium': '\\u21CC',\n 'rightleftharpoons': '\\u21CC',\n 'rlhar': '\\u21CC',\n 'Escr': '\\u2130',\n 'expectation': '\\u2130',\n 'Esim': '\\u2A73',\n 'Eta': '\\u0397',\n 'Euml': '\\u00CB',\n 'Exists': '\\u2203',\n 'exist': '\\u2203',\n 'ExponentialE': '\\u2147',\n 'ee': '\\u2147',\n 'exponentiale': '\\u2147',\n 'Fcy': '\\u0424',\n 'Ffr': '\\uD835\\uDD09',\n 'FilledSmallSquare': '\\u25FC',\n 'FilledVerySmallSquare': '\\u25AA',\n 'blacksquare': '\\u25AA',\n 'squarf': '\\u25AA',\n 'squf': '\\u25AA',\n 'Fopf': '\\uD835\\uDD3D',\n 'ForAll': '\\u2200',\n 'forall': '\\u2200',\n 'Fouriertrf': '\\u2131',\n 'Fscr': '\\u2131',\n 'GJcy': '\\u0403',\n 'GT': '\\u003E',\n 'gt': '\\u003E',\n 'Gamma': '\\u0393',\n 'Gammad': '\\u03DC',\n 'Gbreve': '\\u011E',\n 'Gcedil': '\\u0122',\n 'Gcirc': '\\u011C',\n 'Gcy': '\\u0413',\n 'Gdot': '\\u0120',\n 'Gfr': '\\uD835\\uDD0A',\n 'Gg': '\\u22D9',\n 'ggg': '\\u22D9',\n 'Gopf': '\\uD835\\uDD3E',\n 'GreaterEqual': '\\u2265',\n 'ge': '\\u2265',\n 'geq': '\\u2265',\n 'GreaterEqualLess': '\\u22DB',\n 'gel': '\\u22DB',\n 'gtreqless': '\\u22DB',\n 'GreaterFullEqual': '\\u2267',\n 'gE': '\\u2267',\n 'geqq': '\\u2267',\n 'GreaterGreater': '\\u2AA2',\n 'GreaterLess': '\\u2277',\n 'gl': '\\u2277',\n 'gtrless': '\\u2277',\n 'GreaterSlantEqual': '\\u2A7E',\n 'geqslant': '\\u2A7E',\n 'ges': '\\u2A7E',\n 'GreaterTilde': '\\u2273',\n 'gsim': '\\u2273',\n 'gtrsim': '\\u2273',\n 'Gscr': '\\uD835\\uDCA2',\n 'Gt': '\\u226B',\n 'NestedGreaterGreater': '\\u226B',\n 'gg': '\\u226B',\n 'HARDcy': '\\u042A',\n 'Hacek': '\\u02C7',\n 'caron': '\\u02C7',\n 'Hat': '\\u005E',\n 'Hcirc': '\\u0124',\n 'Hfr': '\\u210C',\n 'Poincareplane': '\\u210C',\n 'HilbertSpace': '\\u210B',\n 'Hscr': '\\u210B',\n 'hamilt': '\\u210B',\n 'Hopf': '\\u210D',\n 'quaternions': '\\u210D',\n 'HorizontalLine': '\\u2500',\n 'boxh': '\\u2500',\n 'Hstrok': '\\u0126',\n 'HumpEqual': '\\u224F',\n 'bumpe': '\\u224F',\n 'bumpeq': '\\u224F',\n 'IEcy': '\\u0415',\n 'IJlig': '\\u0132',\n 'IOcy': '\\u0401',\n 'Iacute': '\\u00CD',\n 'Icirc': '\\u00CE',\n 'Icy': '\\u0418',\n 'Idot': '\\u0130',\n 'Ifr': '\\u2111',\n 'Im': '\\u2111',\n 'image': '\\u2111',\n 'imagpart': '\\u2111',\n 'Igrave': '\\u00CC',\n 'Imacr': '\\u012A',\n 'ImaginaryI': '\\u2148',\n 'ii': '\\u2148',\n 'Int': '\\u222C',\n 'Integral': '\\u222B',\n 'int': '\\u222B',\n 'Intersection': '\\u22C2',\n 'bigcap': '\\u22C2',\n 'xcap': '\\u22C2',\n 'InvisibleComma': '\\u2063',\n 'ic': '\\u2063',\n 'InvisibleTimes': '\\u2062',\n 'it': '\\u2062',\n 'Iogon': '\\u012E',\n 'Iopf': '\\uD835\\uDD40',\n 'Iota': '\\u0399',\n 'Iscr': '\\u2110',\n 'imagline': '\\u2110',\n 'Itilde': '\\u0128',\n 'Iukcy': '\\u0406',\n 'Iuml': '\\u00CF',\n 'Jcirc': '\\u0134',\n 'Jcy': '\\u0419',\n 'Jfr': '\\uD835\\uDD0D',\n 'Jopf': '\\uD835\\uDD41',\n 'Jscr': '\\uD835\\uDCA5',\n 'Jsercy': '\\u0408',\n 'Jukcy': '\\u0404',\n 'KHcy': '\\u0425',\n 'KJcy': '\\u040C',\n 'Kappa': '\\u039A',\n 'Kcedil': '\\u0136',\n 'Kcy': '\\u041A',\n 'Kfr': '\\uD835\\uDD0E',\n 'Kopf': '\\uD835\\uDD42',\n 'Kscr': '\\uD835\\uDCA6',\n 'LJcy': '\\u0409',\n 'LT': '\\u003C',\n 'lt': '\\u003C',\n 'Lacute': '\\u0139',\n 'Lambda': '\\u039B',\n 'Lang': '\\u27EA',\n 'Laplacetrf': '\\u2112',\n 'Lscr': '\\u2112',\n 'lagran': '\\u2112',\n 'Larr': '\\u219E',\n 'twoheadleftarrow': '\\u219E',\n 'Lcaron': '\\u013D',\n 'Lcedil': '\\u013B',\n 'Lcy': '\\u041B',\n 'LeftAngleBracket': '\\u27E8',\n 'lang': '\\u27E8',\n 'langle': '\\u27E8',\n 'LeftArrow': '\\u2190',\n 'ShortLeftArrow': '\\u2190',\n 'larr': '\\u2190',\n 'leftarrow': '\\u2190',\n 'slarr': '\\u2190',\n 'LeftArrowBar': '\\u21E4',\n 'larrb': '\\u21E4',\n 'LeftArrowRightArrow': '\\u21C6',\n 'leftrightarrows': '\\u21C6',\n 'lrarr': '\\u21C6',\n 'LeftCeiling': '\\u2308',\n 'lceil': '\\u2308',\n 'LeftDoubleBracket': '\\u27E6',\n 'lobrk': '\\u27E6',\n 'LeftDownTeeVector': '\\u2961',\n 'LeftDownVector': '\\u21C3',\n 'dharl': '\\u21C3',\n 'downharpoonleft': '\\u21C3',\n 'LeftDownVectorBar': '\\u2959',\n 'LeftFloor': '\\u230A',\n 'lfloor': '\\u230A',\n 'LeftRightArrow': '\\u2194',\n 'harr': '\\u2194',\n 'leftrightarrow': '\\u2194',\n 'LeftRightVector': '\\u294E',\n 'LeftTee': '\\u22A3',\n 'dashv': '\\u22A3',\n 'LeftTeeArrow': '\\u21A4',\n 'mapstoleft': '\\u21A4',\n 'LeftTeeVector': '\\u295A',\n 'LeftTriangle': '\\u22B2',\n 'vartriangleleft': '\\u22B2',\n 'vltri': '\\u22B2',\n 'LeftTriangleBar': '\\u29CF',\n 'LeftTriangleEqual': '\\u22B4',\n 'ltrie': '\\u22B4',\n 'trianglelefteq': '\\u22B4',\n 'LeftUpDownVector': '\\u2951',\n 'LeftUpTeeVector': '\\u2960',\n 'LeftUpVector': '\\u21BF',\n 'uharl': '\\u21BF',\n 'upharpoonleft': '\\u21BF',\n 'LeftUpVectorBar': '\\u2958',\n 'LeftVector': '\\u21BC',\n 'leftharpoonup': '\\u21BC',\n 'lharu': '\\u21BC',\n 'LeftVectorBar': '\\u2952',\n 'LessEqualGreater': '\\u22DA',\n 'leg': '\\u22DA',\n 'lesseqgtr': '\\u22DA',\n 'LessFullEqual': '\\u2266',\n 'lE': '\\u2266',\n 'leqq': '\\u2266',\n 'LessGreater': '\\u2276',\n 'lessgtr': '\\u2276',\n 'lg': '\\u2276',\n 'LessLess': '\\u2AA1',\n 'LessSlantEqual': '\\u2A7D',\n 'leqslant': '\\u2A7D',\n 'les': '\\u2A7D',\n 'LessTilde': '\\u2272',\n 'lesssim': '\\u2272',\n 'lsim': '\\u2272',\n 'Lfr': '\\uD835\\uDD0F',\n 'Ll': '\\u22D8',\n 'Lleftarrow': '\\u21DA',\n 'lAarr': '\\u21DA',\n 'Lmidot': '\\u013F',\n 'LongLeftArrow': '\\u27F5',\n 'longleftarrow': '\\u27F5',\n 'xlarr': '\\u27F5',\n 'LongLeftRightArrow': '\\u27F7',\n 'longleftrightarrow': '\\u27F7',\n 'xharr': '\\u27F7',\n 'LongRightArrow': '\\u27F6',\n 'longrightarrow': '\\u27F6',\n 'xrarr': '\\u27F6',\n 'Lopf': '\\uD835\\uDD43',\n 'LowerLeftArrow': '\\u2199',\n 'swarr': '\\u2199',\n 'swarrow': '\\u2199',\n 'LowerRightArrow': '\\u2198',\n 'searr': '\\u2198',\n 'searrow': '\\u2198',\n 'Lsh': '\\u21B0',\n 'lsh': '\\u21B0',\n 'Lstrok': '\\u0141',\n 'Lt': '\\u226A',\n 'NestedLessLess': '\\u226A',\n 'll': '\\u226A',\n 'Map': '\\u2905',\n 'Mcy': '\\u041C',\n 'MediumSpace': '\\u205F',\n 'Mellintrf': '\\u2133',\n 'Mscr': '\\u2133',\n 'phmmat': '\\u2133',\n 'Mfr': '\\uD835\\uDD10',\n 'MinusPlus': '\\u2213',\n 'mnplus': '\\u2213',\n 'mp': '\\u2213',\n 'Mopf': '\\uD835\\uDD44',\n 'Mu': '\\u039C',\n 'NJcy': '\\u040A',\n 'Nacute': '\\u0143',\n 'Ncaron': '\\u0147',\n 'Ncedil': '\\u0145',\n 'Ncy': '\\u041D',\n 'NegativeMediumSpace': '\\u200B',\n 'NegativeThickSpace': '\\u200B',\n 'NegativeThinSpace': '\\u200B',\n 'NegativeVeryThinSpace': '\\u200B',\n 'ZeroWidthSpace': '\\u200B',\n 'NewLine': '\\u000A',\n 'Nfr': '\\uD835\\uDD11',\n 'NoBreak': '\\u2060',\n 'NonBreakingSpace': '\\u00A0',\n 'nbsp': '\\u00A0',\n 'Nopf': '\\u2115',\n 'naturals': '\\u2115',\n 'Not': '\\u2AEC',\n 'NotCongruent': '\\u2262',\n 'nequiv': '\\u2262',\n 'NotCupCap': '\\u226D',\n 'NotDoubleVerticalBar': '\\u2226',\n 'npar': '\\u2226',\n 'nparallel': '\\u2226',\n 'nshortparallel': '\\u2226',\n 'nspar': '\\u2226',\n 'NotElement': '\\u2209',\n 'notin': '\\u2209',\n 'notinva': '\\u2209',\n 'NotEqual': '\\u2260',\n 'ne': '\\u2260',\n 'NotEqualTilde': '\\u2242\\u0338',\n 'nesim': '\\u2242\\u0338',\n 'NotExists': '\\u2204',\n 'nexist': '\\u2204',\n 'nexists': '\\u2204',\n 'NotGreater': '\\u226F',\n 'ngt': '\\u226F',\n 'ngtr': '\\u226F',\n 'NotGreaterEqual': '\\u2271',\n 'nge': '\\u2271',\n 'ngeq': '\\u2271',\n 'NotGreaterFullEqual': '\\u2267\\u0338',\n 'ngE': '\\u2267\\u0338',\n 'ngeqq': '\\u2267\\u0338',\n 'NotGreaterGreater': '\\u226B\\u0338',\n 'nGtv': '\\u226B\\u0338',\n 'NotGreaterLess': '\\u2279',\n 'ntgl': '\\u2279',\n 'NotGreaterSlantEqual': '\\u2A7E\\u0338',\n 'ngeqslant': '\\u2A7E\\u0338',\n 'nges': '\\u2A7E\\u0338',\n 'NotGreaterTilde': '\\u2275',\n 'ngsim': '\\u2275',\n 'NotHumpDownHump': '\\u224E\\u0338',\n 'nbump': '\\u224E\\u0338',\n 'NotHumpEqual': '\\u224F\\u0338',\n 'nbumpe': '\\u224F\\u0338',\n 'NotLeftTriangle': '\\u22EA',\n 'nltri': '\\u22EA',\n 'ntriangleleft': '\\u22EA',\n 'NotLeftTriangleBar': '\\u29CF\\u0338',\n 'NotLeftTriangleEqual': '\\u22EC',\n 'nltrie': '\\u22EC',\n 'ntrianglelefteq': '\\u22EC',\n 'NotLess': '\\u226E',\n 'nless': '\\u226E',\n 'nlt': '\\u226E',\n 'NotLessEqual': '\\u2270',\n 'nle': '\\u2270',\n 'nleq': '\\u2270',\n 'NotLessGreater': '\\u2278',\n 'ntlg': '\\u2278',\n 'NotLessLess': '\\u226A\\u0338',\n 'nLtv': '\\u226A\\u0338',\n 'NotLessSlantEqual': '\\u2A7D\\u0338',\n 'nleqslant': '\\u2A7D\\u0338',\n 'nles': '\\u2A7D\\u0338',\n 'NotLessTilde': '\\u2274',\n 'nlsim': '\\u2274',\n 'NotNestedGreaterGreater': '\\u2AA2\\u0338',\n 'NotNestedLessLess': '\\u2AA1\\u0338',\n 'NotPrecedes': '\\u2280',\n 'npr': '\\u2280',\n 'nprec': '\\u2280',\n 'NotPrecedesEqual': '\\u2AAF\\u0338',\n 'npre': '\\u2AAF\\u0338',\n 'npreceq': '\\u2AAF\\u0338',\n 'NotPrecedesSlantEqual': '\\u22E0',\n 'nprcue': '\\u22E0',\n 'NotReverseElement': '\\u220C',\n 'notni': '\\u220C',\n 'notniva': '\\u220C',\n 'NotRightTriangle': '\\u22EB',\n 'nrtri': '\\u22EB',\n 'ntriangleright': '\\u22EB',\n 'NotRightTriangleBar': '\\u29D0\\u0338',\n 'NotRightTriangleEqual': '\\u22ED',\n 'nrtrie': '\\u22ED',\n 'ntrianglerighteq': '\\u22ED',\n 'NotSquareSubset': '\\u228F\\u0338',\n 'NotSquareSubsetEqual': '\\u22E2',\n 'nsqsube': '\\u22E2',\n 'NotSquareSuperset': '\\u2290\\u0338',\n 'NotSquareSupersetEqual': '\\u22E3',\n 'nsqsupe': '\\u22E3',\n 'NotSubset': '\\u2282\\u20D2',\n 'nsubset': '\\u2282\\u20D2',\n 'vnsub': '\\u2282\\u20D2',\n 'NotSubsetEqual': '\\u2288',\n 'nsube': '\\u2288',\n 'nsubseteq': '\\u2288',\n 'NotSucceeds': '\\u2281',\n 'nsc': '\\u2281',\n 'nsucc': '\\u2281',\n 'NotSucceedsEqual': '\\u2AB0\\u0338',\n 'nsce': '\\u2AB0\\u0338',\n 'nsucceq': '\\u2AB0\\u0338',\n 'NotSucceedsSlantEqual': '\\u22E1',\n 'nsccue': '\\u22E1',\n 'NotSucceedsTilde': '\\u227F\\u0338',\n 'NotSuperset': '\\u2283\\u20D2',\n 'nsupset': '\\u2283\\u20D2',\n 'vnsup': '\\u2283\\u20D2',\n 'NotSupersetEqual': '\\u2289',\n 'nsupe': '\\u2289',\n 'nsupseteq': '\\u2289',\n 'NotTilde': '\\u2241',\n 'nsim': '\\u2241',\n 'NotTildeEqual': '\\u2244',\n 'nsime': '\\u2244',\n 'nsimeq': '\\u2244',\n 'NotTildeFullEqual': '\\u2247',\n 'ncong': '\\u2247',\n 'NotTildeTilde': '\\u2249',\n 'nap': '\\u2249',\n 'napprox': '\\u2249',\n 'NotVerticalBar': '\\u2224',\n 'nmid': '\\u2224',\n 'nshortmid': '\\u2224',\n 'nsmid': '\\u2224',\n 'Nscr': '\\uD835\\uDCA9',\n 'Ntilde': '\\u00D1',\n 'Nu': '\\u039D',\n 'OElig': '\\u0152',\n 'Oacute': '\\u00D3',\n 'Ocirc': '\\u00D4',\n 'Ocy': '\\u041E',\n 'Odblac': '\\u0150',\n 'Ofr': '\\uD835\\uDD12',\n 'Ograve': '\\u00D2',\n 'Omacr': '\\u014C',\n 'Omega': '\\u03A9',\n 'ohm': '\\u03A9',\n 'Omicron': '\\u039F',\n 'Oopf': '\\uD835\\uDD46',\n 'OpenCurlyDoubleQuote': '\\u201C',\n 'ldquo': '\\u201C',\n 'OpenCurlyQuote': '\\u2018',\n 'lsquo': '\\u2018',\n 'Or': '\\u2A54',\n 'Oscr': '\\uD835\\uDCAA',\n 'Oslash': '\\u00D8',\n 'Otilde': '\\u00D5',\n 'Otimes': '\\u2A37',\n 'Ouml': '\\u00D6',\n 'OverBar': '\\u203E',\n 'oline': '\\u203E',\n 'OverBrace': '\\u23DE',\n 'OverBracket': '\\u23B4',\n 'tbrk': '\\u23B4',\n 'OverParenthesis': '\\u23DC',\n 'PartialD': '\\u2202',\n 'part': '\\u2202',\n 'Pcy': '\\u041F',\n 'Pfr': '\\uD835\\uDD13',\n 'Phi': '\\u03A6',\n 'Pi': '\\u03A0',\n 'PlusMinus': '\\u00B1',\n 'plusmn': '\\u00B1',\n 'pm': '\\u00B1',\n 'Popf': '\\u2119',\n 'primes': '\\u2119',\n 'Pr': '\\u2ABB',\n 'Precedes': '\\u227A',\n 'pr': '\\u227A',\n 'prec': '\\u227A',\n 'PrecedesEqual': '\\u2AAF',\n 'pre': '\\u2AAF',\n 'preceq': '\\u2AAF',\n 'PrecedesSlantEqual': '\\u227C',\n 'prcue': '\\u227C',\n 'preccurlyeq': '\\u227C',\n 'PrecedesTilde': '\\u227E',\n 'precsim': '\\u227E',\n 'prsim': '\\u227E',\n 'Prime': '\\u2033',\n 'Product': '\\u220F',\n 'prod': '\\u220F',\n 'Proportional': '\\u221D',\n 'prop': '\\u221D',\n 'propto': '\\u221D',\n 'varpropto': '\\u221D',\n 'vprop': '\\u221D',\n 'Pscr': '\\uD835\\uDCAB',\n 'Psi': '\\u03A8',\n 'QUOT': '\\u0022',\n 'quot': '\\u0022',\n 'Qfr': '\\uD835\\uDD14',\n 'Qopf': '\\u211A',\n 'rationals': '\\u211A',\n 'Qscr': '\\uD835\\uDCAC',\n 'RBarr': '\\u2910',\n 'drbkarow': '\\u2910',\n 'REG': '\\u00AE',\n 'circledR': '\\u00AE',\n 'reg': '\\u00AE',\n 'Racute': '\\u0154',\n 'Rang': '\\u27EB',\n 'Rarr': '\\u21A0',\n 'twoheadrightarrow': '\\u21A0',\n 'Rarrtl': '\\u2916',\n 'Rcaron': '\\u0158',\n 'Rcedil': '\\u0156',\n 'Rcy': '\\u0420',\n 'Re': '\\u211C',\n 'Rfr': '\\u211C',\n 'real': '\\u211C',\n 'realpart': '\\u211C',\n 'ReverseElement': '\\u220B',\n 'SuchThat': '\\u220B',\n 'ni': '\\u220B',\n 'niv': '\\u220B',\n 'ReverseEquilibrium': '\\u21CB',\n 'leftrightharpoons': '\\u21CB',\n 'lrhar': '\\u21CB',\n 'ReverseUpEquilibrium': '\\u296F',\n 'duhar': '\\u296F',\n 'Rho': '\\u03A1',\n 'RightAngleBracket': '\\u27E9',\n 'rang': '\\u27E9',\n 'rangle': '\\u27E9',\n 'RightArrow': '\\u2192',\n 'ShortRightArrow': '\\u2192',\n 'rarr': '\\u2192',\n 'rightarrow': '\\u2192',\n 'srarr': '\\u2192',\n 'RightArrowBar': '\\u21E5',\n 'rarrb': '\\u21E5',\n 'RightArrowLeftArrow': '\\u21C4',\n 'rightleftarrows': '\\u21C4',\n 'rlarr': '\\u21C4',\n 'RightCeiling': '\\u2309',\n 'rceil': '\\u2309',\n 'RightDoubleBracket': '\\u27E7',\n 'robrk': '\\u27E7',\n 'RightDownTeeVector': '\\u295D',\n 'RightDownVector': '\\u21C2',\n 'dharr': '\\u21C2',\n 'downharpoonright': '\\u21C2',\n 'RightDownVectorBar': '\\u2955',\n 'RightFloor': '\\u230B',\n 'rfloor': '\\u230B',\n 'RightTee': '\\u22A2',\n 'vdash': '\\u22A2',\n 'RightTeeArrow': '\\u21A6',\n 'map': '\\u21A6',\n 'mapsto': '\\u21A6',\n 'RightTeeVector': '\\u295B',\n 'RightTriangle': '\\u22B3',\n 'vartriangleright': '\\u22B3',\n 'vrtri': '\\u22B3',\n 'RightTriangleBar': '\\u29D0',\n 'RightTriangleEqual': '\\u22B5',\n 'rtrie': '\\u22B5',\n 'trianglerighteq': '\\u22B5',\n 'RightUpDownVector': '\\u294F',\n 'RightUpTeeVector': '\\u295C',\n 'RightUpVector': '\\u21BE',\n 'uharr': '\\u21BE',\n 'upharpoonright': '\\u21BE',\n 'RightUpVectorBar': '\\u2954',\n 'RightVector': '\\u21C0',\n 'rharu': '\\u21C0',\n 'rightharpoonup': '\\u21C0',\n 'RightVectorBar': '\\u2953',\n 'Ropf': '\\u211D',\n 'reals': '\\u211D',\n 'RoundImplies': '\\u2970',\n 'Rrightarrow': '\\u21DB',\n 'rAarr': '\\u21DB',\n 'Rscr': '\\u211B',\n 'realine': '\\u211B',\n 'Rsh': '\\u21B1',\n 'rsh': '\\u21B1',\n 'RuleDelayed': '\\u29F4',\n 'SHCHcy': '\\u0429',\n 'SHcy': '\\u0428',\n 'SOFTcy': '\\u042C',\n 'Sacute': '\\u015A',\n 'Sc': '\\u2ABC',\n 'Scaron': '\\u0160',\n 'Scedil': '\\u015E',\n 'Scirc': '\\u015C',\n 'Scy': '\\u0421',\n 'Sfr': '\\uD835\\uDD16',\n 'ShortUpArrow': '\\u2191',\n 'UpArrow': '\\u2191',\n 'uarr': '\\u2191',\n 'uparrow': '\\u2191',\n 'Sigma': '\\u03A3',\n 'SmallCircle': '\\u2218',\n 'compfn': '\\u2218',\n 'Sopf': '\\uD835\\uDD4A',\n 'Sqrt': '\\u221A',\n 'radic': '\\u221A',\n 'Square': '\\u25A1',\n 'squ': '\\u25A1',\n 'square': '\\u25A1',\n 'SquareIntersection': '\\u2293',\n 'sqcap': '\\u2293',\n 'SquareSubset': '\\u228F',\n 'sqsub': '\\u228F',\n 'sqsubset': '\\u228F',\n 'SquareSubsetEqual': '\\u2291',\n 'sqsube': '\\u2291',\n 'sqsubseteq': '\\u2291',\n 'SquareSuperset': '\\u2290',\n 'sqsup': '\\u2290',\n 'sqsupset': '\\u2290',\n 'SquareSupersetEqual': '\\u2292',\n 'sqsupe': '\\u2292',\n 'sqsupseteq': '\\u2292',\n 'SquareUnion': '\\u2294',\n 'sqcup': '\\u2294',\n 'Sscr': '\\uD835\\uDCAE',\n 'Star': '\\u22C6',\n 'sstarf': '\\u22C6',\n 'Sub': '\\u22D0',\n 'Subset': '\\u22D0',\n 'SubsetEqual': '\\u2286',\n 'sube': '\\u2286',\n 'subseteq': '\\u2286',\n 'Succeeds': '\\u227B',\n 'sc': '\\u227B',\n 'succ': '\\u227B',\n 'SucceedsEqual': '\\u2AB0',\n 'sce': '\\u2AB0',\n 'succeq': '\\u2AB0',\n 'SucceedsSlantEqual': '\\u227D',\n 'sccue': '\\u227D',\n 'succcurlyeq': '\\u227D',\n 'SucceedsTilde': '\\u227F',\n 'scsim': '\\u227F',\n 'succsim': '\\u227F',\n 'Sum': '\\u2211',\n 'sum': '\\u2211',\n 'Sup': '\\u22D1',\n 'Supset': '\\u22D1',\n 'Superset': '\\u2283',\n 'sup': '\\u2283',\n 'supset': '\\u2283',\n 'SupersetEqual': '\\u2287',\n 'supe': '\\u2287',\n 'supseteq': '\\u2287',\n 'THORN': '\\u00DE',\n 'TRADE': '\\u2122',\n 'trade': '\\u2122',\n 'TSHcy': '\\u040B',\n 'TScy': '\\u0426',\n 'Tab': '\\u0009',\n 'Tau': '\\u03A4',\n 'Tcaron': '\\u0164',\n 'Tcedil': '\\u0162',\n 'Tcy': '\\u0422',\n 'Tfr': '\\uD835\\uDD17',\n 'Therefore': '\\u2234',\n 'there4': '\\u2234',\n 'therefore': '\\u2234',\n 'Theta': '\\u0398',\n 'ThickSpace': '\\u205F\\u200A',\n 'ThinSpace': '\\u2009',\n 'thinsp': '\\u2009',\n 'Tilde': '\\u223C',\n 'sim': '\\u223C',\n 'thicksim': '\\u223C',\n 'thksim': '\\u223C',\n 'TildeEqual': '\\u2243',\n 'sime': '\\u2243',\n 'simeq': '\\u2243',\n 'TildeFullEqual': '\\u2245',\n 'cong': '\\u2245',\n 'TildeTilde': '\\u2248',\n 'ap': '\\u2248',\n 'approx': '\\u2248',\n 'asymp': '\\u2248',\n 'thickapprox': '\\u2248',\n 'thkap': '\\u2248',\n 'Topf': '\\uD835\\uDD4B',\n 'TripleDot': '\\u20DB',\n 'tdot': '\\u20DB',\n 'Tscr': '\\uD835\\uDCAF',\n 'Tstrok': '\\u0166',\n 'Uacute': '\\u00DA',\n 'Uarr': '\\u219F',\n 'Uarrocir': '\\u2949',\n 'Ubrcy': '\\u040E',\n 'Ubreve': '\\u016C',\n 'Ucirc': '\\u00DB',\n 'Ucy': '\\u0423',\n 'Udblac': '\\u0170',\n 'Ufr': '\\uD835\\uDD18',\n 'Ugrave': '\\u00D9',\n 'Umacr': '\\u016A',\n 'UnderBar': '\\u005F',\n 'lowbar': '\\u005F',\n 'UnderBrace': '\\u23DF',\n 'UnderBracket': '\\u23B5',\n 'bbrk': '\\u23B5',\n 'UnderParenthesis': '\\u23DD',\n 'Union': '\\u22C3',\n 'bigcup': '\\u22C3',\n 'xcup': '\\u22C3',\n 'UnionPlus': '\\u228E',\n 'uplus': '\\u228E',\n 'Uogon': '\\u0172',\n 'Uopf': '\\uD835\\uDD4C',\n 'UpArrowBar': '\\u2912',\n 'UpArrowDownArrow': '\\u21C5',\n 'udarr': '\\u21C5',\n 'UpDownArrow': '\\u2195',\n 'updownarrow': '\\u2195',\n 'varr': '\\u2195',\n 'UpEquilibrium': '\\u296E',\n 'udhar': '\\u296E',\n 'UpTee': '\\u22A5',\n 'bot': '\\u22A5',\n 'bottom': '\\u22A5',\n 'perp': '\\u22A5',\n 'UpTeeArrow': '\\u21A5',\n 'mapstoup': '\\u21A5',\n 'UpperLeftArrow': '\\u2196',\n 'nwarr': '\\u2196',\n 'nwarrow': '\\u2196',\n 'UpperRightArrow': '\\u2197',\n 'nearr': '\\u2197',\n 'nearrow': '\\u2197',\n 'Upsi': '\\u03D2',\n 'upsih': '\\u03D2',\n 'Upsilon': '\\u03A5',\n 'Uring': '\\u016E',\n 'Uscr': '\\uD835\\uDCB0',\n 'Utilde': '\\u0168',\n 'Uuml': '\\u00DC',\n 'VDash': '\\u22AB',\n 'Vbar': '\\u2AEB',\n 'Vcy': '\\u0412',\n 'Vdash': '\\u22A9',\n 'Vdashl': '\\u2AE6',\n 'Vee': '\\u22C1',\n 'bigvee': '\\u22C1',\n 'xvee': '\\u22C1',\n 'Verbar': '\\u2016',\n 'Vert': '\\u2016',\n 'VerticalBar': '\\u2223',\n 'mid': '\\u2223',\n 'shortmid': '\\u2223',\n 'smid': '\\u2223',\n 'VerticalLine': '\\u007C',\n 'verbar': '\\u007C',\n 'vert': '\\u007C',\n 'VerticalSeparator': '\\u2758',\n 'VerticalTilde': '\\u2240',\n 'wr': '\\u2240',\n 'wreath': '\\u2240',\n 'VeryThinSpace': '\\u200A',\n 'hairsp': '\\u200A',\n 'Vfr': '\\uD835\\uDD19',\n 'Vopf': '\\uD835\\uDD4D',\n 'Vscr': '\\uD835\\uDCB1',\n 'Vvdash': '\\u22AA',\n 'Wcirc': '\\u0174',\n 'Wedge': '\\u22C0',\n 'bigwedge': '\\u22C0',\n 'xwedge': '\\u22C0',\n 'Wfr': '\\uD835\\uDD1A',\n 'Wopf': '\\uD835\\uDD4E',\n 'Wscr': '\\uD835\\uDCB2',\n 'Xfr': '\\uD835\\uDD1B',\n 'Xi': '\\u039E',\n 'Xopf': '\\uD835\\uDD4F',\n 'Xscr': '\\uD835\\uDCB3',\n 'YAcy': '\\u042F',\n 'YIcy': '\\u0407',\n 'YUcy': '\\u042E',\n 'Yacute': '\\u00DD',\n 'Ycirc': '\\u0176',\n 'Ycy': '\\u042B',\n 'Yfr': '\\uD835\\uDD1C',\n 'Yopf': '\\uD835\\uDD50',\n 'Yscr': '\\uD835\\uDCB4',\n 'Yuml': '\\u0178',\n 'ZHcy': '\\u0416',\n 'Zacute': '\\u0179',\n 'Zcaron': '\\u017D',\n 'Zcy': '\\u0417',\n 'Zdot': '\\u017B',\n 'Zeta': '\\u0396',\n 'Zfr': '\\u2128',\n 'zeetrf': '\\u2128',\n 'Zopf': '\\u2124',\n 'integers': '\\u2124',\n 'Zscr': '\\uD835\\uDCB5',\n 'aacute': '\\u00E1',\n 'abreve': '\\u0103',\n 'ac': '\\u223E',\n 'mstpos': '\\u223E',\n 'acE': '\\u223E\\u0333',\n 'acd': '\\u223F',\n 'acirc': '\\u00E2',\n 'acy': '\\u0430',\n 'aelig': '\\u00E6',\n 'afr': '\\uD835\\uDD1E',\n 'agrave': '\\u00E0',\n 'alefsym': '\\u2135',\n 'aleph': '\\u2135',\n 'alpha': '\\u03B1',\n 'amacr': '\\u0101',\n 'amalg': '\\u2A3F',\n 'and': '\\u2227',\n 'wedge': '\\u2227',\n 'andand': '\\u2A55',\n 'andd': '\\u2A5C',\n 'andslope': '\\u2A58',\n 'andv': '\\u2A5A',\n 'ang': '\\u2220',\n 'angle': '\\u2220',\n 'ange': '\\u29A4',\n 'angmsd': '\\u2221',\n 'measuredangle': '\\u2221',\n 'angmsdaa': '\\u29A8',\n 'angmsdab': '\\u29A9',\n 'angmsdac': '\\u29AA',\n 'angmsdad': '\\u29AB',\n 'angmsdae': '\\u29AC',\n 'angmsdaf': '\\u29AD',\n 'angmsdag': '\\u29AE',\n 'angmsdah': '\\u29AF',\n 'angrt': '\\u221F',\n 'angrtvb': '\\u22BE',\n 'angrtvbd': '\\u299D',\n 'angsph': '\\u2222',\n 'angzarr': '\\u237C',\n 'aogon': '\\u0105',\n 'aopf': '\\uD835\\uDD52',\n 'apE': '\\u2A70',\n 'apacir': '\\u2A6F',\n 'ape': '\\u224A',\n 'approxeq': '\\u224A',\n 'apid': '\\u224B',\n 'apos': '\\u0027',\n 'aring': '\\u00E5',\n 'ascr': '\\uD835\\uDCB6',\n 'ast': '\\u002A',\n 'midast': '\\u002A',\n 'atilde': '\\u00E3',\n 'auml': '\\u00E4',\n 'awint': '\\u2A11',\n 'bNot': '\\u2AED',\n 'backcong': '\\u224C',\n 'bcong': '\\u224C',\n 'backepsilon': '\\u03F6',\n 'bepsi': '\\u03F6',\n 'backprime': '\\u2035',\n 'bprime': '\\u2035',\n 'backsim': '\\u223D',\n 'bsim': '\\u223D',\n 'backsimeq': '\\u22CD',\n 'bsime': '\\u22CD',\n 'barvee': '\\u22BD',\n 'barwed': '\\u2305',\n 'barwedge': '\\u2305',\n 'bbrktbrk': '\\u23B6',\n 'bcy': '\\u0431',\n 'bdquo': '\\u201E',\n 'ldquor': '\\u201E',\n 'bemptyv': '\\u29B0',\n 'beta': '\\u03B2',\n 'beth': '\\u2136',\n 'between': '\\u226C',\n 'twixt': '\\u226C',\n 'bfr': '\\uD835\\uDD1F',\n 'bigcirc': '\\u25EF',\n 'xcirc': '\\u25EF',\n 'bigodot': '\\u2A00',\n 'xodot': '\\u2A00',\n 'bigoplus': '\\u2A01',\n 'xoplus': '\\u2A01',\n 'bigotimes': '\\u2A02',\n 'xotime': '\\u2A02',\n 'bigsqcup': '\\u2A06',\n 'xsqcup': '\\u2A06',\n 'bigstar': '\\u2605',\n 'starf': '\\u2605',\n 'bigtriangledown': '\\u25BD',\n 'xdtri': '\\u25BD',\n 'bigtriangleup': '\\u25B3',\n 'xutri': '\\u25B3',\n 'biguplus': '\\u2A04',\n 'xuplus': '\\u2A04',\n 'bkarow': '\\u290D',\n 'rbarr': '\\u290D',\n 'blacklozenge': '\\u29EB',\n 'lozf': '\\u29EB',\n 'blacktriangle': '\\u25B4',\n 'utrif': '\\u25B4',\n 'blacktriangledown': '\\u25BE',\n 'dtrif': '\\u25BE',\n 'blacktriangleleft': '\\u25C2',\n 'ltrif': '\\u25C2',\n 'blacktriangleright': '\\u25B8',\n 'rtrif': '\\u25B8',\n 'blank': '\\u2423',\n 'blk12': '\\u2592',\n 'blk14': '\\u2591',\n 'blk34': '\\u2593',\n 'block': '\\u2588',\n 'bne': '\\u003D\\u20E5',\n 'bnequiv': '\\u2261\\u20E5',\n 'bnot': '\\u2310',\n 'bopf': '\\uD835\\uDD53',\n 'bowtie': '\\u22C8',\n 'boxDL': '\\u2557',\n 'boxDR': '\\u2554',\n 'boxDl': '\\u2556',\n 'boxDr': '\\u2553',\n 'boxH': '\\u2550',\n 'boxHD': '\\u2566',\n 'boxHU': '\\u2569',\n 'boxHd': '\\u2564',\n 'boxHu': '\\u2567',\n 'boxUL': '\\u255D',\n 'boxUR': '\\u255A',\n 'boxUl': '\\u255C',\n 'boxUr': '\\u2559',\n 'boxV': '\\u2551',\n 'boxVH': '\\u256C',\n 'boxVL': '\\u2563',\n 'boxVR': '\\u2560',\n 'boxVh': '\\u256B',\n 'boxVl': '\\u2562',\n 'boxVr': '\\u255F',\n 'boxbox': '\\u29C9',\n 'boxdL': '\\u2555',\n 'boxdR': '\\u2552',\n 'boxdl': '\\u2510',\n 'boxdr': '\\u250C',\n 'boxhD': '\\u2565',\n 'boxhU': '\\u2568',\n 'boxhd': '\\u252C',\n 'boxhu': '\\u2534',\n 'boxminus': '\\u229F',\n 'minusb': '\\u229F',\n 'boxplus': '\\u229E',\n 'plusb': '\\u229E',\n 'boxtimes': '\\u22A0',\n 'timesb': '\\u22A0',\n 'boxuL': '\\u255B',\n 'boxuR': '\\u2558',\n 'boxul': '\\u2518',\n 'boxur': '\\u2514',\n 'boxv': '\\u2502',\n 'boxvH': '\\u256A',\n 'boxvL': '\\u2561',\n 'boxvR': '\\u255E',\n 'boxvh': '\\u253C',\n 'boxvl': '\\u2524',\n 'boxvr': '\\u251C',\n 'brvbar': '\\u00A6',\n 'bscr': '\\uD835\\uDCB7',\n 'bsemi': '\\u204F',\n 'bsol': '\\u005C',\n 'bsolb': '\\u29C5',\n 'bsolhsub': '\\u27C8',\n 'bull': '\\u2022',\n 'bullet': '\\u2022',\n 'bumpE': '\\u2AAE',\n 'cacute': '\\u0107',\n 'cap': '\\u2229',\n 'capand': '\\u2A44',\n 'capbrcup': '\\u2A49',\n 'capcap': '\\u2A4B',\n 'capcup': '\\u2A47',\n 'capdot': '\\u2A40',\n 'caps': '\\u2229\\uFE00',\n 'caret': '\\u2041',\n 'ccaps': '\\u2A4D',\n 'ccaron': '\\u010D',\n 'ccedil': '\\u00E7',\n 'ccirc': '\\u0109',\n 'ccups': '\\u2A4C',\n 'ccupssm': '\\u2A50',\n 'cdot': '\\u010B',\n 'cemptyv': '\\u29B2',\n 'cent': '\\u00A2',\n 'cfr': '\\uD835\\uDD20',\n 'chcy': '\\u0447',\n 'check': '\\u2713',\n 'checkmark': '\\u2713',\n 'chi': '\\u03C7',\n 'cir': '\\u25CB',\n 'cirE': '\\u29C3',\n 'circ': '\\u02C6',\n 'circeq': '\\u2257',\n 'cire': '\\u2257',\n 'circlearrowleft': '\\u21BA',\n 'olarr': '\\u21BA',\n 'circlearrowright': '\\u21BB',\n 'orarr': '\\u21BB',\n 'circledS': '\\u24C8',\n 'oS': '\\u24C8',\n 'circledast': '\\u229B',\n 'oast': '\\u229B',\n 'circledcirc': '\\u229A',\n 'ocir': '\\u229A',\n 'circleddash': '\\u229D',\n 'odash': '\\u229D',\n 'cirfnint': '\\u2A10',\n 'cirmid': '\\u2AEF',\n 'cirscir': '\\u29C2',\n 'clubs': '\\u2663',\n 'clubsuit': '\\u2663',\n 'colon': '\\u003A',\n 'comma': '\\u002C',\n 'commat': '\\u0040',\n 'comp': '\\u2201',\n 'complement': '\\u2201',\n 'congdot': '\\u2A6D',\n 'copf': '\\uD835\\uDD54',\n 'copysr': '\\u2117',\n 'crarr': '\\u21B5',\n 'cross': '\\u2717',\n 'cscr': '\\uD835\\uDCB8',\n 'csub': '\\u2ACF',\n 'csube': '\\u2AD1',\n 'csup': '\\u2AD0',\n 'csupe': '\\u2AD2',\n 'ctdot': '\\u22EF',\n 'cudarrl': '\\u2938',\n 'cudarrr': '\\u2935',\n 'cuepr': '\\u22DE',\n 'curlyeqprec': '\\u22DE',\n 'cuesc': '\\u22DF',\n 'curlyeqsucc': '\\u22DF',\n 'cularr': '\\u21B6',\n 'curvearrowleft': '\\u21B6',\n 'cularrp': '\\u293D',\n 'cup': '\\u222A',\n 'cupbrcap': '\\u2A48',\n 'cupcap': '\\u2A46',\n 'cupcup': '\\u2A4A',\n 'cupdot': '\\u228D',\n 'cupor': '\\u2A45',\n 'cups': '\\u222A\\uFE00',\n 'curarr': '\\u21B7',\n 'curvearrowright': '\\u21B7',\n 'curarrm': '\\u293C',\n 'curlyvee': '\\u22CE',\n 'cuvee': '\\u22CE',\n 'curlywedge': '\\u22CF',\n 'cuwed': '\\u22CF',\n 'curren': '\\u00A4',\n 'cwint': '\\u2231',\n 'cylcty': '\\u232D',\n 'dHar': '\\u2965',\n 'dagger': '\\u2020',\n 'daleth': '\\u2138',\n 'dash': '\\u2010',\n 'hyphen': '\\u2010',\n 'dbkarow': '\\u290F',\n 'rBarr': '\\u290F',\n 'dcaron': '\\u010F',\n 'dcy': '\\u0434',\n 'ddarr': '\\u21CA',\n 'downdownarrows': '\\u21CA',\n 'ddotseq': '\\u2A77',\n 'eDDot': '\\u2A77',\n 'deg': '\\u00B0',\n 'delta': '\\u03B4',\n 'demptyv': '\\u29B1',\n 'dfisht': '\\u297F',\n 'dfr': '\\uD835\\uDD21',\n 'diamondsuit': '\\u2666',\n 'diams': '\\u2666',\n 'digamma': '\\u03DD',\n 'gammad': '\\u03DD',\n 'disin': '\\u22F2',\n 'div': '\\u00F7',\n 'divide': '\\u00F7',\n 'divideontimes': '\\u22C7',\n 'divonx': '\\u22C7',\n 'djcy': '\\u0452',\n 'dlcorn': '\\u231E',\n 'llcorner': '\\u231E',\n 'dlcrop': '\\u230D',\n 'dollar': '\\u0024',\n 'dopf': '\\uD835\\uDD55',\n 'doteqdot': '\\u2251',\n 'eDot': '\\u2251',\n 'dotminus': '\\u2238',\n 'minusd': '\\u2238',\n 'dotplus': '\\u2214',\n 'plusdo': '\\u2214',\n 'dotsquare': '\\u22A1',\n 'sdotb': '\\u22A1',\n 'drcorn': '\\u231F',\n 'lrcorner': '\\u231F',\n 'drcrop': '\\u230C',\n 'dscr': '\\uD835\\uDCB9',\n 'dscy': '\\u0455',\n 'dsol': '\\u29F6',\n 'dstrok': '\\u0111',\n 'dtdot': '\\u22F1',\n 'dtri': '\\u25BF',\n 'triangledown': '\\u25BF',\n 'dwangle': '\\u29A6',\n 'dzcy': '\\u045F',\n 'dzigrarr': '\\u27FF',\n 'eacute': '\\u00E9',\n 'easter': '\\u2A6E',\n 'ecaron': '\\u011B',\n 'ecir': '\\u2256',\n 'eqcirc': '\\u2256',\n 'ecirc': '\\u00EA',\n 'ecolon': '\\u2255',\n 'eqcolon': '\\u2255',\n 'ecy': '\\u044D',\n 'edot': '\\u0117',\n 'efDot': '\\u2252',\n 'fallingdotseq': '\\u2252',\n 'efr': '\\uD835\\uDD22',\n 'eg': '\\u2A9A',\n 'egrave': '\\u00E8',\n 'egs': '\\u2A96',\n 'eqslantgtr': '\\u2A96',\n 'egsdot': '\\u2A98',\n 'el': '\\u2A99',\n 'elinters': '\\u23E7',\n 'ell': '\\u2113',\n 'els': '\\u2A95',\n 'eqslantless': '\\u2A95',\n 'elsdot': '\\u2A97',\n 'emacr': '\\u0113',\n 'empty': '\\u2205',\n 'emptyset': '\\u2205',\n 'emptyv': '\\u2205',\n 'varnothing': '\\u2205',\n 'emsp13': '\\u2004',\n 'emsp14': '\\u2005',\n 'emsp': '\\u2003',\n 'eng': '\\u014B',\n 'ensp': '\\u2002',\n 'eogon': '\\u0119',\n 'eopf': '\\uD835\\uDD56',\n 'epar': '\\u22D5',\n 'eparsl': '\\u29E3',\n 'eplus': '\\u2A71',\n 'epsi': '\\u03B5',\n 'epsilon': '\\u03B5',\n 'epsiv': '\\u03F5',\n 'straightepsilon': '\\u03F5',\n 'varepsilon': '\\u03F5',\n 'equals': '\\u003D',\n 'equest': '\\u225F',\n 'questeq': '\\u225F',\n 'equivDD': '\\u2A78',\n 'eqvparsl': '\\u29E5',\n 'erDot': '\\u2253',\n 'risingdotseq': '\\u2253',\n 'erarr': '\\u2971',\n 'escr': '\\u212F',\n 'eta': '\\u03B7',\n 'eth': '\\u00F0',\n 'euml': '\\u00EB',\n 'euro': '\\u20AC',\n 'excl': '\\u0021',\n 'fcy': '\\u0444',\n 'female': '\\u2640',\n 'ffilig': '\\uFB03',\n 'fflig': '\\uFB00',\n 'ffllig': '\\uFB04',\n 'ffr': '\\uD835\\uDD23',\n 'filig': '\\uFB01',\n 'fjlig': '\\u0066\\u006A',\n 'flat': '\\u266D',\n 'fllig': '\\uFB02',\n 'fltns': '\\u25B1',\n 'fnof': '\\u0192',\n 'fopf': '\\uD835\\uDD57',\n 'fork': '\\u22D4',\n 'pitchfork': '\\u22D4',\n 'forkv': '\\u2AD9',\n 'fpartint': '\\u2A0D',\n 'frac12': '\\u00BD',\n 'half': '\\u00BD',\n 'frac13': '\\u2153',\n 'frac14': '\\u00BC',\n 'frac15': '\\u2155',\n 'frac16': '\\u2159',\n 'frac18': '\\u215B',\n 'frac23': '\\u2154',\n 'frac25': '\\u2156',\n 'frac34': '\\u00BE',\n 'frac35': '\\u2157',\n 'frac38': '\\u215C',\n 'frac45': '\\u2158',\n 'frac56': '\\u215A',\n 'frac58': '\\u215D',\n 'frac78': '\\u215E',\n 'frasl': '\\u2044',\n 'frown': '\\u2322',\n 'sfrown': '\\u2322',\n 'fscr': '\\uD835\\uDCBB',\n 'gEl': '\\u2A8C',\n 'gtreqqless': '\\u2A8C',\n 'gacute': '\\u01F5',\n 'gamma': '\\u03B3',\n 'gap': '\\u2A86',\n 'gtrapprox': '\\u2A86',\n 'gbreve': '\\u011F',\n 'gcirc': '\\u011D',\n 'gcy': '\\u0433',\n 'gdot': '\\u0121',\n 'gescc': '\\u2AA9',\n 'gesdot': '\\u2A80',\n 'gesdoto': '\\u2A82',\n 'gesdotol': '\\u2A84',\n 'gesl': '\\u22DB\\uFE00',\n 'gesles': '\\u2A94',\n 'gfr': '\\uD835\\uDD24',\n 'gimel': '\\u2137',\n 'gjcy': '\\u0453',\n 'glE': '\\u2A92',\n 'gla': '\\u2AA5',\n 'glj': '\\u2AA4',\n 'gnE': '\\u2269',\n 'gneqq': '\\u2269',\n 'gnap': '\\u2A8A',\n 'gnapprox': '\\u2A8A',\n 'gne': '\\u2A88',\n 'gneq': '\\u2A88',\n 'gnsim': '\\u22E7',\n 'gopf': '\\uD835\\uDD58',\n 'gscr': '\\u210A',\n 'gsime': '\\u2A8E',\n 'gsiml': '\\u2A90',\n 'gtcc': '\\u2AA7',\n 'gtcir': '\\u2A7A',\n 'gtdot': '\\u22D7',\n 'gtrdot': '\\u22D7',\n 'gtlPar': '\\u2995',\n 'gtquest': '\\u2A7C',\n 'gtrarr': '\\u2978',\n 'gvertneqq': '\\u2269\\uFE00',\n 'gvnE': '\\u2269\\uFE00',\n 'hardcy': '\\u044A',\n 'harrcir': '\\u2948',\n 'harrw': '\\u21AD',\n 'leftrightsquigarrow': '\\u21AD',\n 'hbar': '\\u210F',\n 'hslash': '\\u210F',\n 'planck': '\\u210F',\n 'plankv': '\\u210F',\n 'hcirc': '\\u0125',\n 'hearts': '\\u2665',\n 'heartsuit': '\\u2665',\n 'hellip': '\\u2026',\n 'mldr': '\\u2026',\n 'hercon': '\\u22B9',\n 'hfr': '\\uD835\\uDD25',\n 'hksearow': '\\u2925',\n 'searhk': '\\u2925',\n 'hkswarow': '\\u2926',\n 'swarhk': '\\u2926',\n 'hoarr': '\\u21FF',\n 'homtht': '\\u223B',\n 'hookleftarrow': '\\u21A9',\n 'larrhk': '\\u21A9',\n 'hookrightarrow': '\\u21AA',\n 'rarrhk': '\\u21AA',\n 'hopf': '\\uD835\\uDD59',\n 'horbar': '\\u2015',\n 'hscr': '\\uD835\\uDCBD',\n 'hstrok': '\\u0127',\n 'hybull': '\\u2043',\n 'iacute': '\\u00ED',\n 'icirc': '\\u00EE',\n 'icy': '\\u0438',\n 'iecy': '\\u0435',\n 'iexcl': '\\u00A1',\n 'ifr': '\\uD835\\uDD26',\n 'igrave': '\\u00EC',\n 'iiiint': '\\u2A0C',\n 'qint': '\\u2A0C',\n 'iiint': '\\u222D',\n 'tint': '\\u222D',\n 'iinfin': '\\u29DC',\n 'iiota': '\\u2129',\n 'ijlig': '\\u0133',\n 'imacr': '\\u012B',\n 'imath': '\\u0131',\n 'inodot': '\\u0131',\n 'imof': '\\u22B7',\n 'imped': '\\u01B5',\n 'incare': '\\u2105',\n 'infin': '\\u221E',\n 'infintie': '\\u29DD',\n 'intcal': '\\u22BA',\n 'intercal': '\\u22BA',\n 'intlarhk': '\\u2A17',\n 'intprod': '\\u2A3C',\n 'iprod': '\\u2A3C',\n 'iocy': '\\u0451',\n 'iogon': '\\u012F',\n 'iopf': '\\uD835\\uDD5A',\n 'iota': '\\u03B9',\n 'iquest': '\\u00BF',\n 'iscr': '\\uD835\\uDCBE',\n 'isinE': '\\u22F9',\n 'isindot': '\\u22F5',\n 'isins': '\\u22F4',\n 'isinsv': '\\u22F3',\n 'itilde': '\\u0129',\n 'iukcy': '\\u0456',\n 'iuml': '\\u00EF',\n 'jcirc': '\\u0135',\n 'jcy': '\\u0439',\n 'jfr': '\\uD835\\uDD27',\n 'jmath': '\\u0237',\n 'jopf': '\\uD835\\uDD5B',\n 'jscr': '\\uD835\\uDCBF',\n 'jsercy': '\\u0458',\n 'jukcy': '\\u0454',\n 'kappa': '\\u03BA',\n 'kappav': '\\u03F0',\n 'varkappa': '\\u03F0',\n 'kcedil': '\\u0137',\n 'kcy': '\\u043A',\n 'kfr': '\\uD835\\uDD28',\n 'kgreen': '\\u0138',\n 'khcy': '\\u0445',\n 'kjcy': '\\u045C',\n 'kopf': '\\uD835\\uDD5C',\n 'kscr': '\\uD835\\uDCC0',\n 'lAtail': '\\u291B',\n 'lBarr': '\\u290E',\n 'lEg': '\\u2A8B',\n 'lesseqqgtr': '\\u2A8B',\n 'lHar': '\\u2962',\n 'lacute': '\\u013A',\n 'laemptyv': '\\u29B4',\n 'lambda': '\\u03BB',\n 'langd': '\\u2991',\n 'lap': '\\u2A85',\n 'lessapprox': '\\u2A85',\n 'laquo': '\\u00AB',\n 'larrbfs': '\\u291F',\n 'larrfs': '\\u291D',\n 'larrlp': '\\u21AB',\n 'looparrowleft': '\\u21AB',\n 'larrpl': '\\u2939',\n 'larrsim': '\\u2973',\n 'larrtl': '\\u21A2',\n 'leftarrowtail': '\\u21A2',\n 'lat': '\\u2AAB',\n 'latail': '\\u2919',\n 'late': '\\u2AAD',\n 'lates': '\\u2AAD\\uFE00',\n 'lbarr': '\\u290C',\n 'lbbrk': '\\u2772',\n 'lbrace': '\\u007B',\n 'lcub': '\\u007B',\n 'lbrack': '\\u005B',\n 'lsqb': '\\u005B',\n 'lbrke': '\\u298B',\n 'lbrksld': '\\u298F',\n 'lbrkslu': '\\u298D',\n 'lcaron': '\\u013E',\n 'lcedil': '\\u013C',\n 'lcy': '\\u043B',\n 'ldca': '\\u2936',\n 'ldrdhar': '\\u2967',\n 'ldrushar': '\\u294B',\n 'ldsh': '\\u21B2',\n 'le': '\\u2264',\n 'leq': '\\u2264',\n 'leftleftarrows': '\\u21C7',\n 'llarr': '\\u21C7',\n 'leftthreetimes': '\\u22CB',\n 'lthree': '\\u22CB',\n 'lescc': '\\u2AA8',\n 'lesdot': '\\u2A7F',\n 'lesdoto': '\\u2A81',\n 'lesdotor': '\\u2A83',\n 'lesg': '\\u22DA\\uFE00',\n 'lesges': '\\u2A93',\n 'lessdot': '\\u22D6',\n 'ltdot': '\\u22D6',\n 'lfisht': '\\u297C',\n 'lfr': '\\uD835\\uDD29',\n 'lgE': '\\u2A91',\n 'lharul': '\\u296A',\n 'lhblk': '\\u2584',\n 'ljcy': '\\u0459',\n 'llhard': '\\u296B',\n 'lltri': '\\u25FA',\n 'lmidot': '\\u0140',\n 'lmoust': '\\u23B0',\n 'lmoustache': '\\u23B0',\n 'lnE': '\\u2268',\n 'lneqq': '\\u2268',\n 'lnap': '\\u2A89',\n 'lnapprox': '\\u2A89',\n 'lne': '\\u2A87',\n 'lneq': '\\u2A87',\n 'lnsim': '\\u22E6',\n 'loang': '\\u27EC',\n 'loarr': '\\u21FD',\n 'longmapsto': '\\u27FC',\n 'xmap': '\\u27FC',\n 'looparrowright': '\\u21AC',\n 'rarrlp': '\\u21AC',\n 'lopar': '\\u2985',\n 'lopf': '\\uD835\\uDD5D',\n 'loplus': '\\u2A2D',\n 'lotimes': '\\u2A34',\n 'lowast': '\\u2217',\n 'loz': '\\u25CA',\n 'lozenge': '\\u25CA',\n 'lpar': '\\u0028',\n 'lparlt': '\\u2993',\n 'lrhard': '\\u296D',\n 'lrm': '\\u200E',\n 'lrtri': '\\u22BF',\n 'lsaquo': '\\u2039',\n 'lscr': '\\uD835\\uDCC1',\n 'lsime': '\\u2A8D',\n 'lsimg': '\\u2A8F',\n 'lsquor': '\\u201A',\n 'sbquo': '\\u201A',\n 'lstrok': '\\u0142',\n 'ltcc': '\\u2AA6',\n 'ltcir': '\\u2A79',\n 'ltimes': '\\u22C9',\n 'ltlarr': '\\u2976',\n 'ltquest': '\\u2A7B',\n 'ltrPar': '\\u2996',\n 'ltri': '\\u25C3',\n 'triangleleft': '\\u25C3',\n 'lurdshar': '\\u294A',\n 'luruhar': '\\u2966',\n 'lvertneqq': '\\u2268\\uFE00',\n 'lvnE': '\\u2268\\uFE00',\n 'mDDot': '\\u223A',\n 'macr': '\\u00AF',\n 'strns': '\\u00AF',\n 'male': '\\u2642',\n 'malt': '\\u2720',\n 'maltese': '\\u2720',\n 'marker': '\\u25AE',\n 'mcomma': '\\u2A29',\n 'mcy': '\\u043C',\n 'mdash': '\\u2014',\n 'mfr': '\\uD835\\uDD2A',\n 'mho': '\\u2127',\n 'micro': '\\u00B5',\n 'midcir': '\\u2AF0',\n 'minus': '\\u2212',\n 'minusdu': '\\u2A2A',\n 'mlcp': '\\u2ADB',\n 'models': '\\u22A7',\n 'mopf': '\\uD835\\uDD5E',\n 'mscr': '\\uD835\\uDCC2',\n 'mu': '\\u03BC',\n 'multimap': '\\u22B8',\n 'mumap': '\\u22B8',\n 'nGg': '\\u22D9\\u0338',\n 'nGt': '\\u226B\\u20D2',\n 'nLeftarrow': '\\u21CD',\n 'nlArr': '\\u21CD',\n 'nLeftrightarrow': '\\u21CE',\n 'nhArr': '\\u21CE',\n 'nLl': '\\u22D8\\u0338',\n 'nLt': '\\u226A\\u20D2',\n 'nRightarrow': '\\u21CF',\n 'nrArr': '\\u21CF',\n 'nVDash': '\\u22AF',\n 'nVdash': '\\u22AE',\n 'nacute': '\\u0144',\n 'nang': '\\u2220\\u20D2',\n 'napE': '\\u2A70\\u0338',\n 'napid': '\\u224B\\u0338',\n 'napos': '\\u0149',\n 'natur': '\\u266E',\n 'natural': '\\u266E',\n 'ncap': '\\u2A43',\n 'ncaron': '\\u0148',\n 'ncedil': '\\u0146',\n 'ncongdot': '\\u2A6D\\u0338',\n 'ncup': '\\u2A42',\n 'ncy': '\\u043D',\n 'ndash': '\\u2013',\n 'neArr': '\\u21D7',\n 'nearhk': '\\u2924',\n 'nedot': '\\u2250\\u0338',\n 'nesear': '\\u2928',\n 'toea': '\\u2928',\n 'nfr': '\\uD835\\uDD2B',\n 'nharr': '\\u21AE',\n 'nleftrightarrow': '\\u21AE',\n 'nhpar': '\\u2AF2',\n 'nis': '\\u22FC',\n 'nisd': '\\u22FA',\n 'njcy': '\\u045A',\n 'nlE': '\\u2266\\u0338',\n 'nleqq': '\\u2266\\u0338',\n 'nlarr': '\\u219A',\n 'nleftarrow': '\\u219A',\n 'nldr': '\\u2025',\n 'nopf': '\\uD835\\uDD5F',\n 'not': '\\u00AC',\n 'notinE': '\\u22F9\\u0338',\n 'notindot': '\\u22F5\\u0338',\n 'notinvb': '\\u22F7',\n 'notinvc': '\\u22F6',\n 'notnivb': '\\u22FE',\n 'notnivc': '\\u22FD',\n 'nparsl': '\\u2AFD\\u20E5',\n 'npart': '\\u2202\\u0338',\n 'npolint': '\\u2A14',\n 'nrarr': '\\u219B',\n 'nrightarrow': '\\u219B',\n 'nrarrc': '\\u2933\\u0338',\n 'nrarrw': '\\u219D\\u0338',\n 'nscr': '\\uD835\\uDCC3',\n 'nsub': '\\u2284',\n 'nsubE': '\\u2AC5\\u0338',\n 'nsubseteqq': '\\u2AC5\\u0338',\n 'nsup': '\\u2285',\n 'nsupE': '\\u2AC6\\u0338',\n 'nsupseteqq': '\\u2AC6\\u0338',\n 'ntilde': '\\u00F1',\n 'nu': '\\u03BD',\n 'num': '\\u0023',\n 'numero': '\\u2116',\n 'numsp': '\\u2007',\n 'nvDash': '\\u22AD',\n 'nvHarr': '\\u2904',\n 'nvap': '\\u224D\\u20D2',\n 'nvdash': '\\u22AC',\n 'nvge': '\\u2265\\u20D2',\n 'nvgt': '\\u003E\\u20D2',\n 'nvinfin': '\\u29DE',\n 'nvlArr': '\\u2902',\n 'nvle': '\\u2264\\u20D2',\n 'nvlt': '\\u003C\\u20D2',\n 'nvltrie': '\\u22B4\\u20D2',\n 'nvrArr': '\\u2903',\n 'nvrtrie': '\\u22B5\\u20D2',\n 'nvsim': '\\u223C\\u20D2',\n 'nwArr': '\\u21D6',\n 'nwarhk': '\\u2923',\n 'nwnear': '\\u2927',\n 'oacute': '\\u00F3',\n 'ocirc': '\\u00F4',\n 'ocy': '\\u043E',\n 'odblac': '\\u0151',\n 'odiv': '\\u2A38',\n 'odsold': '\\u29BC',\n 'oelig': '\\u0153',\n 'ofcir': '\\u29BF',\n 'ofr': '\\uD835\\uDD2C',\n 'ogon': '\\u02DB',\n 'ograve': '\\u00F2',\n 'ogt': '\\u29C1',\n 'ohbar': '\\u29B5',\n 'olcir': '\\u29BE',\n 'olcross': '\\u29BB',\n 'olt': '\\u29C0',\n 'omacr': '\\u014D',\n 'omega': '\\u03C9',\n 'omicron': '\\u03BF',\n 'omid': '\\u29B6',\n 'oopf': '\\uD835\\uDD60',\n 'opar': '\\u29B7',\n 'operp': '\\u29B9',\n 'or': '\\u2228',\n 'vee': '\\u2228',\n 'ord': '\\u2A5D',\n 'order': '\\u2134',\n 'orderof': '\\u2134',\n 'oscr': '\\u2134',\n 'ordf': '\\u00AA',\n 'ordm': '\\u00BA',\n 'origof': '\\u22B6',\n 'oror': '\\u2A56',\n 'orslope': '\\u2A57',\n 'orv': '\\u2A5B',\n 'oslash': '\\u00F8',\n 'osol': '\\u2298',\n 'otilde': '\\u00F5',\n 'otimesas': '\\u2A36',\n 'ouml': '\\u00F6',\n 'ovbar': '\\u233D',\n 'para': '\\u00B6',\n 'parsim': '\\u2AF3',\n 'parsl': '\\u2AFD',\n 'pcy': '\\u043F',\n 'percnt': '\\u0025',\n 'period': '\\u002E',\n 'permil': '\\u2030',\n 'pertenk': '\\u2031',\n 'pfr': '\\uD835\\uDD2D',\n 'phi': '\\u03C6',\n 'phiv': '\\u03D5',\n 'straightphi': '\\u03D5',\n 'varphi': '\\u03D5',\n 'phone': '\\u260E',\n 'pi': '\\u03C0',\n 'piv': '\\u03D6',\n 'varpi': '\\u03D6',\n 'planckh': '\\u210E',\n 'plus': '\\u002B',\n 'plusacir': '\\u2A23',\n 'pluscir': '\\u2A22',\n 'plusdu': '\\u2A25',\n 'pluse': '\\u2A72',\n 'plussim': '\\u2A26',\n 'plustwo': '\\u2A27',\n 'pointint': '\\u2A15',\n 'popf': '\\uD835\\uDD61',\n 'pound': '\\u00A3',\n 'prE': '\\u2AB3',\n 'prap': '\\u2AB7',\n 'precapprox': '\\u2AB7',\n 'precnapprox': '\\u2AB9',\n 'prnap': '\\u2AB9',\n 'precneqq': '\\u2AB5',\n 'prnE': '\\u2AB5',\n 'precnsim': '\\u22E8',\n 'prnsim': '\\u22E8',\n 'prime': '\\u2032',\n 'profalar': '\\u232E',\n 'profline': '\\u2312',\n 'profsurf': '\\u2313',\n 'prurel': '\\u22B0',\n 'pscr': '\\uD835\\uDCC5',\n 'psi': '\\u03C8',\n 'puncsp': '\\u2008',\n 'qfr': '\\uD835\\uDD2E',\n 'qopf': '\\uD835\\uDD62',\n 'qprime': '\\u2057',\n 'qscr': '\\uD835\\uDCC6',\n 'quatint': '\\u2A16',\n 'quest': '\\u003F',\n 'rAtail': '\\u291C',\n 'rHar': '\\u2964',\n 'race': '\\u223D\\u0331',\n 'racute': '\\u0155',\n 'raemptyv': '\\u29B3',\n 'rangd': '\\u2992',\n 'range': '\\u29A5',\n 'raquo': '\\u00BB',\n 'rarrap': '\\u2975',\n 'rarrbfs': '\\u2920',\n 'rarrc': '\\u2933',\n 'rarrfs': '\\u291E',\n 'rarrpl': '\\u2945',\n 'rarrsim': '\\u2974',\n 'rarrtl': '\\u21A3',\n 'rightarrowtail': '\\u21A3',\n 'rarrw': '\\u219D',\n 'rightsquigarrow': '\\u219D',\n 'ratail': '\\u291A',\n 'ratio': '\\u2236',\n 'rbbrk': '\\u2773',\n 'rbrace': '\\u007D',\n 'rcub': '\\u007D',\n 'rbrack': '\\u005D',\n 'rsqb': '\\u005D',\n 'rbrke': '\\u298C',\n 'rbrksld': '\\u298E',\n 'rbrkslu': '\\u2990',\n 'rcaron': '\\u0159',\n 'rcedil': '\\u0157',\n 'rcy': '\\u0440',\n 'rdca': '\\u2937',\n 'rdldhar': '\\u2969',\n 'rdsh': '\\u21B3',\n 'rect': '\\u25AD',\n 'rfisht': '\\u297D',\n 'rfr': '\\uD835\\uDD2F',\n 'rharul': '\\u296C',\n 'rho': '\\u03C1',\n 'rhov': '\\u03F1',\n 'varrho': '\\u03F1',\n 'rightrightarrows': '\\u21C9',\n 'rrarr': '\\u21C9',\n 'rightthreetimes': '\\u22CC',\n 'rthree': '\\u22CC',\n 'ring': '\\u02DA',\n 'rlm': '\\u200F',\n 'rmoust': '\\u23B1',\n 'rmoustache': '\\u23B1',\n 'rnmid': '\\u2AEE',\n 'roang': '\\u27ED',\n 'roarr': '\\u21FE',\n 'ropar': '\\u2986',\n 'ropf': '\\uD835\\uDD63',\n 'roplus': '\\u2A2E',\n 'rotimes': '\\u2A35',\n 'rpar': '\\u0029',\n 'rpargt': '\\u2994',\n 'rppolint': '\\u2A12',\n 'rsaquo': '\\u203A',\n 'rscr': '\\uD835\\uDCC7',\n 'rtimes': '\\u22CA',\n 'rtri': '\\u25B9',\n 'triangleright': '\\u25B9',\n 'rtriltri': '\\u29CE',\n 'ruluhar': '\\u2968',\n 'rx': '\\u211E',\n 'sacute': '\\u015B',\n 'scE': '\\u2AB4',\n 'scap': '\\u2AB8',\n 'succapprox': '\\u2AB8',\n 'scaron': '\\u0161',\n 'scedil': '\\u015F',\n 'scirc': '\\u015D',\n 'scnE': '\\u2AB6',\n 'succneqq': '\\u2AB6',\n 'scnap': '\\u2ABA',\n 'succnapprox': '\\u2ABA',\n 'scnsim': '\\u22E9',\n 'succnsim': '\\u22E9',\n 'scpolint': '\\u2A13',\n 'scy': '\\u0441',\n 'sdot': '\\u22C5',\n 'sdote': '\\u2A66',\n 'seArr': '\\u21D8',\n 'sect': '\\u00A7',\n 'semi': '\\u003B',\n 'seswar': '\\u2929',\n 'tosa': '\\u2929',\n 'sext': '\\u2736',\n 'sfr': '\\uD835\\uDD30',\n 'sharp': '\\u266F',\n 'shchcy': '\\u0449',\n 'shcy': '\\u0448',\n 'shy': '\\u00AD',\n 'sigma': '\\u03C3',\n 'sigmaf': '\\u03C2',\n 'sigmav': '\\u03C2',\n 'varsigma': '\\u03C2',\n 'simdot': '\\u2A6A',\n 'simg': '\\u2A9E',\n 'simgE': '\\u2AA0',\n 'siml': '\\u2A9D',\n 'simlE': '\\u2A9F',\n 'simne': '\\u2246',\n 'simplus': '\\u2A24',\n 'simrarr': '\\u2972',\n 'smashp': '\\u2A33',\n 'smeparsl': '\\u29E4',\n 'smile': '\\u2323',\n 'ssmile': '\\u2323',\n 'smt': '\\u2AAA',\n 'smte': '\\u2AAC',\n 'smtes': '\\u2AAC\\uFE00',\n 'softcy': '\\u044C',\n 'sol': '\\u002F',\n 'solb': '\\u29C4',\n 'solbar': '\\u233F',\n 'sopf': '\\uD835\\uDD64',\n 'spades': '\\u2660',\n 'spadesuit': '\\u2660',\n 'sqcaps': '\\u2293\\uFE00',\n 'sqcups': '\\u2294\\uFE00',\n 'sscr': '\\uD835\\uDCC8',\n 'star': '\\u2606',\n 'sub': '\\u2282',\n 'subset': '\\u2282',\n 'subE': '\\u2AC5',\n 'subseteqq': '\\u2AC5',\n 'subdot': '\\u2ABD',\n 'subedot': '\\u2AC3',\n 'submult': '\\u2AC1',\n 'subnE': '\\u2ACB',\n 'subsetneqq': '\\u2ACB',\n 'subne': '\\u228A',\n 'subsetneq': '\\u228A',\n 'subplus': '\\u2ABF',\n 'subrarr': '\\u2979',\n 'subsim': '\\u2AC7',\n 'subsub': '\\u2AD5',\n 'subsup': '\\u2AD3',\n 'sung': '\\u266A',\n 'sup1': '\\u00B9',\n 'sup2': '\\u00B2',\n 'sup3': '\\u00B3',\n 'supE': '\\u2AC6',\n 'supseteqq': '\\u2AC6',\n 'supdot': '\\u2ABE',\n 'supdsub': '\\u2AD8',\n 'supedot': '\\u2AC4',\n 'suphsol': '\\u27C9',\n 'suphsub': '\\u2AD7',\n 'suplarr': '\\u297B',\n 'supmult': '\\u2AC2',\n 'supnE': '\\u2ACC',\n 'supsetneqq': '\\u2ACC',\n 'supne': '\\u228B',\n 'supsetneq': '\\u228B',\n 'supplus': '\\u2AC0',\n 'supsim': '\\u2AC8',\n 'supsub': '\\u2AD4',\n 'supsup': '\\u2AD6',\n 'swArr': '\\u21D9',\n 'swnwar': '\\u292A',\n 'szlig': '\\u00DF',\n 'target': '\\u2316',\n 'tau': '\\u03C4',\n 'tcaron': '\\u0165',\n 'tcedil': '\\u0163',\n 'tcy': '\\u0442',\n 'telrec': '\\u2315',\n 'tfr': '\\uD835\\uDD31',\n 'theta': '\\u03B8',\n 'thetasym': '\\u03D1',\n 'thetav': '\\u03D1',\n 'vartheta': '\\u03D1',\n 'thorn': '\\u00FE',\n 'times': '\\u00D7',\n 'timesbar': '\\u2A31',\n 'timesd': '\\u2A30',\n 'topbot': '\\u2336',\n 'topcir': '\\u2AF1',\n 'topf': '\\uD835\\uDD65',\n 'topfork': '\\u2ADA',\n 'tprime': '\\u2034',\n 'triangle': '\\u25B5',\n 'utri': '\\u25B5',\n 'triangleq': '\\u225C',\n 'trie': '\\u225C',\n 'tridot': '\\u25EC',\n 'triminus': '\\u2A3A',\n 'triplus': '\\u2A39',\n 'trisb': '\\u29CD',\n 'tritime': '\\u2A3B',\n 'trpezium': '\\u23E2',\n 'tscr': '\\uD835\\uDCC9',\n 'tscy': '\\u0446',\n 'tshcy': '\\u045B',\n 'tstrok': '\\u0167',\n 'uHar': '\\u2963',\n 'uacute': '\\u00FA',\n 'ubrcy': '\\u045E',\n 'ubreve': '\\u016D',\n 'ucirc': '\\u00FB',\n 'ucy': '\\u0443',\n 'udblac': '\\u0171',\n 'ufisht': '\\u297E',\n 'ufr': '\\uD835\\uDD32',\n 'ugrave': '\\u00F9',\n 'uhblk': '\\u2580',\n 'ulcorn': '\\u231C',\n 'ulcorner': '\\u231C',\n 'ulcrop': '\\u230F',\n 'ultri': '\\u25F8',\n 'umacr': '\\u016B',\n 'uogon': '\\u0173',\n 'uopf': '\\uD835\\uDD66',\n 'upsi': '\\u03C5',\n 'upsilon': '\\u03C5',\n 'upuparrows': '\\u21C8',\n 'uuarr': '\\u21C8',\n 'urcorn': '\\u231D',\n 'urcorner': '\\u231D',\n 'urcrop': '\\u230E',\n 'uring': '\\u016F',\n 'urtri': '\\u25F9',\n 'uscr': '\\uD835\\uDCCA',\n 'utdot': '\\u22F0',\n 'utilde': '\\u0169',\n 'uuml': '\\u00FC',\n 'uwangle': '\\u29A7',\n 'vBar': '\\u2AE8',\n 'vBarv': '\\u2AE9',\n 'vangrt': '\\u299C',\n 'varsubsetneq': '\\u228A\\uFE00',\n 'vsubne': '\\u228A\\uFE00',\n 'varsubsetneqq': '\\u2ACB\\uFE00',\n 'vsubnE': '\\u2ACB\\uFE00',\n 'varsupsetneq': '\\u228B\\uFE00',\n 'vsupne': '\\u228B\\uFE00',\n 'varsupsetneqq': '\\u2ACC\\uFE00',\n 'vsupnE': '\\u2ACC\\uFE00',\n 'vcy': '\\u0432',\n 'veebar': '\\u22BB',\n 'veeeq': '\\u225A',\n 'vellip': '\\u22EE',\n 'vfr': '\\uD835\\uDD33',\n 'vopf': '\\uD835\\uDD67',\n 'vscr': '\\uD835\\uDCCB',\n 'vzigzag': '\\u299A',\n 'wcirc': '\\u0175',\n 'wedbar': '\\u2A5F',\n 'wedgeq': '\\u2259',\n 'weierp': '\\u2118',\n 'wp': '\\u2118',\n 'wfr': '\\uD835\\uDD34',\n 'wopf': '\\uD835\\uDD68',\n 'wscr': '\\uD835\\uDCCC',\n 'xfr': '\\uD835\\uDD35',\n 'xi': '\\u03BE',\n 'xnis': '\\u22FB',\n 'xopf': '\\uD835\\uDD69',\n 'xscr': '\\uD835\\uDCCD',\n 'yacute': '\\u00FD',\n 'yacy': '\\u044F',\n 'ycirc': '\\u0177',\n 'ycy': '\\u044B',\n 'yen': '\\u00A5',\n 'yfr': '\\uD835\\uDD36',\n 'yicy': '\\u0457',\n 'yopf': '\\uD835\\uDD6A',\n 'yscr': '\\uD835\\uDCCE',\n 'yucy': '\\u044E',\n 'yuml': '\\u00FF',\n 'zacute': '\\u017A',\n 'zcaron': '\\u017E',\n 'zcy': '\\u0437',\n 'zdot': '\\u017C',\n 'zeta': '\\u03B6',\n 'zfr': '\\uD835\\uDD37',\n 'zhcy': '\\u0436',\n 'zigrarr': '\\u21DD',\n 'zopf': '\\uD835\\uDD6B',\n 'zscr': '\\uD835\\uDCCF',\n 'zwj': '\\u200D',\n 'zwnj': '\\u200C'\n};\n// The &ngsp; pseudo-entity is denoting a space. see:\n// https://github.com/dart-lang/angular/blob/0bb611387d29d65b5af7f9d2515ab571fd3fbee4/_tests/test/compiler/preserve_whitespace_test.dart\nconst NGSP_UNICODE = '\\uE500';\nNAMED_ENTITIES['ngsp'] = NGSP_UNICODE;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass TokenError extends ParseError {\n constructor(errorMsg, tokenType, span) {\n super(span, errorMsg);\n this.tokenType = tokenType;\n }\n}\nclass TokenizeResult {\n constructor(tokens, errors, nonNormalizedIcuExpressions) {\n this.tokens = tokens;\n this.errors = errors;\n this.nonNormalizedIcuExpressions = nonNormalizedIcuExpressions;\n }\n}\nfunction tokenize(source, url, getTagDefinition, options = {}) {\n const tokenizer = new _Tokenizer(new ParseSourceFile(source, url), getTagDefinition, options);\n tokenizer.tokenize();\n return new TokenizeResult(mergeTextTokens(tokenizer.tokens), tokenizer.errors, tokenizer.nonNormalizedIcuExpressions);\n}\nconst _CR_OR_CRLF_REGEXP = /\\r\\n?/g;\nfunction _unexpectedCharacterErrorMsg(charCode) {\n const char = charCode === $EOF ? 'EOF' : String.fromCharCode(charCode);\n return `Unexpected character \"${char}\"`;\n}\nfunction _unknownEntityErrorMsg(entitySrc) {\n return `Unknown entity \"${entitySrc}\" - use the \"&#;\" or \"&#x;\" syntax`;\n}\nfunction _unparsableEntityErrorMsg(type, entityStr) {\n return `Unable to parse entity \"${entityStr}\" - ${type} character reference entities must end with \";\"`;\n}\nvar CharacterReferenceType;\n(function (CharacterReferenceType) {\n CharacterReferenceType[\"HEX\"] = \"hexadecimal\";\n CharacterReferenceType[\"DEC\"] = \"decimal\";\n})(CharacterReferenceType || (CharacterReferenceType = {}));\nclass _ControlFlowError {\n constructor(error) {\n this.error = error;\n }\n}\n// See https://www.w3.org/TR/html51/syntax.html#writing-html-documents\nclass _Tokenizer {\n /**\n * @param _file The html source file being tokenized.\n * @param _getTagDefinition A function that will retrieve a tag definition for a given tag name.\n * @param options Configuration of the tokenization.\n */\n constructor(_file, _getTagDefinition, options) {\n this._getTagDefinition = _getTagDefinition;\n this._currentTokenStart = null;\n this._currentTokenType = null;\n this._expansionCaseStack = [];\n this._inInterpolation = false;\n this.tokens = [];\n this.errors = [];\n this.nonNormalizedIcuExpressions = [];\n this._tokenizeIcu = options.tokenizeExpansionForms || false;\n this._interpolationConfig = options.interpolationConfig || DEFAULT_INTERPOLATION_CONFIG;\n this._leadingTriviaCodePoints =\n options.leadingTriviaChars && options.leadingTriviaChars.map(c => c.codePointAt(0) || 0);\n const range = options.range || { endPos: _file.content.length, startPos: 0, startLine: 0, startCol: 0 };\n this._cursor = options.escapedString ? new EscapedCharacterCursor(_file, range) :\n new PlainCharacterCursor(_file, range);\n this._preserveLineEndings = options.preserveLineEndings || false;\n this._escapedString = options.escapedString || false;\n this._i18nNormalizeLineEndingsInICUs = options.i18nNormalizeLineEndingsInICUs || false;\n try {\n this._cursor.init();\n }\n catch (e) {\n this.handleError(e);\n }\n }\n _processCarriageReturns(content) {\n if (this._preserveLineEndings) {\n return content;\n }\n // https://www.w3.org/TR/html51/syntax.html#preprocessing-the-input-stream\n // In order to keep the original position in the source, we can not\n // pre-process it.\n // Instead CRs are processed right before instantiating the tokens.\n return content.replace(_CR_OR_CRLF_REGEXP, '\\n');\n }\n tokenize() {\n while (this._cursor.peek() !== $EOF) {\n const start = this._cursor.clone();\n try {\n if (this._attemptCharCode($LT)) {\n if (this._attemptCharCode($BANG)) {\n if (this._attemptCharCode($LBRACKET)) {\n this._consumeCdata(start);\n }\n else if (this._attemptCharCode($MINUS)) {\n this._consumeComment(start);\n }\n else {\n this._consumeDocType(start);\n }\n }\n else if (this._attemptCharCode($SLASH)) {\n this._consumeTagClose(start);\n }\n else {\n this._consumeTagOpen(start);\n }\n }\n else if (!(this._tokenizeIcu && this._tokenizeExpansionForm())) {\n // In (possibly interpolated) text the end of the text is given by `isTextEnd()`, while\n // the premature end of an interpolation is given by the start of a new HTML element.\n this._consumeWithInterpolation(5 /* TokenType.TEXT */, 8 /* TokenType.INTERPOLATION */, () => this._isTextEnd(), () => this._isTagStart());\n }\n }\n catch (e) {\n this.handleError(e);\n }\n }\n this._beginToken(24 /* TokenType.EOF */);\n this._endToken([]);\n }\n /**\n * @returns whether an ICU token has been created\n * @internal\n */\n _tokenizeExpansionForm() {\n if (this.isExpansionFormStart()) {\n this._consumeExpansionFormStart();\n return true;\n }\n if (isExpansionCaseStart(this._cursor.peek()) && this._isInExpansionForm()) {\n this._consumeExpansionCaseStart();\n return true;\n }\n if (this._cursor.peek() === $RBRACE) {\n if (this._isInExpansionCase()) {\n this._consumeExpansionCaseEnd();\n return true;\n }\n if (this._isInExpansionForm()) {\n this._consumeExpansionFormEnd();\n return true;\n }\n }\n return false;\n }\n _beginToken(type, start = this._cursor.clone()) {\n this._currentTokenStart = start;\n this._currentTokenType = type;\n }\n _endToken(parts, end) {\n if (this._currentTokenStart === null) {\n throw new TokenError('Programming error - attempted to end a token when there was no start to the token', this._currentTokenType, this._cursor.getSpan(end));\n }\n if (this._currentTokenType === null) {\n throw new TokenError('Programming error - attempted to end a token which has no token type', null, this._cursor.getSpan(this._currentTokenStart));\n }\n const token = {\n type: this._currentTokenType,\n parts,\n sourceSpan: (end !== null && end !== void 0 ? end : this._cursor).getSpan(this._currentTokenStart, this._leadingTriviaCodePoints),\n };\n this.tokens.push(token);\n this._currentTokenStart = null;\n this._currentTokenType = null;\n return token;\n }\n _createError(msg, span) {\n if (this._isInExpansionForm()) {\n msg += ` (Do you have an unescaped \"{\" in your template? Use \"{{ '{' }}\") to escape it.)`;\n }\n const error = new TokenError(msg, this._currentTokenType, span);\n this._currentTokenStart = null;\n this._currentTokenType = null;\n return new _ControlFlowError(error);\n }\n handleError(e) {\n if (e instanceof CursorError) {\n e = this._createError(e.msg, this._cursor.getSpan(e.cursor));\n }\n if (e instanceof _ControlFlowError) {\n this.errors.push(e.error);\n }\n else {\n throw e;\n }\n }\n _attemptCharCode(charCode) {\n if (this._cursor.peek() === charCode) {\n this._cursor.advance();\n return true;\n }\n return false;\n }\n _attemptCharCodeCaseInsensitive(charCode) {\n if (compareCharCodeCaseInsensitive(this._cursor.peek(), charCode)) {\n this._cursor.advance();\n return true;\n }\n return false;\n }\n _requireCharCode(charCode) {\n const location = this._cursor.clone();\n if (!this._attemptCharCode(charCode)) {\n throw this._createError(_unexpectedCharacterErrorMsg(this._cursor.peek()), this._cursor.getSpan(location));\n }\n }\n _attemptStr(chars) {\n const len = chars.length;\n if (this._cursor.charsLeft() < len) {\n return false;\n }\n const initialPosition = this._cursor.clone();\n for (let i = 0; i < len; i++) {\n if (!this._attemptCharCode(chars.charCodeAt(i))) {\n // If attempting to parse the string fails, we want to reset the parser\n // to where it was before the attempt\n this._cursor = initialPosition;\n return false;\n }\n }\n return true;\n }\n _attemptStrCaseInsensitive(chars) {\n for (let i = 0; i < chars.length; i++) {\n if (!this._attemptCharCodeCaseInsensitive(chars.charCodeAt(i))) {\n return false;\n }\n }\n return true;\n }\n _requireStr(chars) {\n const location = this._cursor.clone();\n if (!this._attemptStr(chars)) {\n throw this._createError(_unexpectedCharacterErrorMsg(this._cursor.peek()), this._cursor.getSpan(location));\n }\n }\n _attemptCharCodeUntilFn(predicate) {\n while (!predicate(this._cursor.peek())) {\n this._cursor.advance();\n }\n }\n _requireCharCodeUntilFn(predicate, len) {\n const start = this._cursor.clone();\n this._attemptCharCodeUntilFn(predicate);\n if (this._cursor.diff(start) < len) {\n throw this._createError(_unexpectedCharacterErrorMsg(this._cursor.peek()), this._cursor.getSpan(start));\n }\n }\n _attemptUntilChar(char) {\n while (this._cursor.peek() !== char) {\n this._cursor.advance();\n }\n }\n _readChar() {\n // Don't rely upon reading directly from `_input` as the actual char value\n // may have been generated from an escape sequence.\n const char = String.fromCodePoint(this._cursor.peek());\n this._cursor.advance();\n return char;\n }\n _consumeEntity(textTokenType) {\n this._beginToken(9 /* TokenType.ENCODED_ENTITY */);\n const start = this._cursor.clone();\n this._cursor.advance();\n if (this._attemptCharCode($HASH)) {\n const isHex = this._attemptCharCode($x) || this._attemptCharCode($X);\n const codeStart = this._cursor.clone();\n this._attemptCharCodeUntilFn(isDigitEntityEnd);\n if (this._cursor.peek() != $SEMICOLON) {\n // Advance cursor to include the peeked character in the string provided to the error\n // message.\n this._cursor.advance();\n const entityType = isHex ? CharacterReferenceType.HEX : CharacterReferenceType.DEC;\n throw this._createError(_unparsableEntityErrorMsg(entityType, this._cursor.getChars(start)), this._cursor.getSpan());\n }\n const strNum = this._cursor.getChars(codeStart);\n this._cursor.advance();\n try {\n const charCode = parseInt(strNum, isHex ? 16 : 10);\n this._endToken([String.fromCharCode(charCode), this._cursor.getChars(start)]);\n }\n catch (_a) {\n throw this._createError(_unknownEntityErrorMsg(this._cursor.getChars(start)), this._cursor.getSpan());\n }\n }\n else {\n const nameStart = this._cursor.clone();\n this._attemptCharCodeUntilFn(isNamedEntityEnd);\n if (this._cursor.peek() != $SEMICOLON) {\n // No semicolon was found so abort the encoded entity token that was in progress, and treat\n // this as a text token\n this._beginToken(textTokenType, start);\n this._cursor = nameStart;\n this._endToken(['&']);\n }\n else {\n const name = this._cursor.getChars(nameStart);\n this._cursor.advance();\n const char = NAMED_ENTITIES[name];\n if (!char) {\n throw this._createError(_unknownEntityErrorMsg(name), this._cursor.getSpan(start));\n }\n this._endToken([char, `&${name};`]);\n }\n }\n }\n _consumeRawText(consumeEntities, endMarkerPredicate) {\n this._beginToken(consumeEntities ? 6 /* TokenType.ESCAPABLE_RAW_TEXT */ : 7 /* TokenType.RAW_TEXT */);\n const parts = [];\n while (true) {\n const tagCloseStart = this._cursor.clone();\n const foundEndMarker = endMarkerPredicate();\n this._cursor = tagCloseStart;\n if (foundEndMarker) {\n break;\n }\n if (consumeEntities && this._cursor.peek() === $AMPERSAND) {\n this._endToken([this._processCarriageReturns(parts.join(''))]);\n parts.length = 0;\n this._consumeEntity(6 /* TokenType.ESCAPABLE_RAW_TEXT */);\n this._beginToken(6 /* TokenType.ESCAPABLE_RAW_TEXT */);\n }\n else {\n parts.push(this._readChar());\n }\n }\n this._endToken([this._processCarriageReturns(parts.join(''))]);\n }\n _consumeComment(start) {\n this._beginToken(10 /* TokenType.COMMENT_START */, start);\n this._requireCharCode($MINUS);\n this._endToken([]);\n this._consumeRawText(false, () => this._attemptStr('-->'));\n this._beginToken(11 /* TokenType.COMMENT_END */);\n this._requireStr('-->');\n this._endToken([]);\n }\n _consumeCdata(start) {\n this._beginToken(12 /* TokenType.CDATA_START */, start);\n this._requireStr('CDATA[');\n this._endToken([]);\n this._consumeRawText(false, () => this._attemptStr(']]>'));\n this._beginToken(13 /* TokenType.CDATA_END */);\n this._requireStr(']]>');\n this._endToken([]);\n }\n _consumeDocType(start) {\n this._beginToken(18 /* TokenType.DOC_TYPE */, start);\n const contentStart = this._cursor.clone();\n this._attemptUntilChar($GT);\n const content = this._cursor.getChars(contentStart);\n this._cursor.advance();\n this._endToken([content]);\n }\n _consumePrefixAndName() {\n const nameOrPrefixStart = this._cursor.clone();\n let prefix = '';\n while (this._cursor.peek() !== $COLON && !isPrefixEnd(this._cursor.peek())) {\n this._cursor.advance();\n }\n let nameStart;\n if (this._cursor.peek() === $COLON) {\n prefix = this._cursor.getChars(nameOrPrefixStart);\n this._cursor.advance();\n nameStart = this._cursor.clone();\n }\n else {\n nameStart = nameOrPrefixStart;\n }\n this._requireCharCodeUntilFn(isNameEnd, prefix === '' ? 0 : 1);\n const name = this._cursor.getChars(nameStart);\n return [prefix, name];\n }\n _consumeTagOpen(start) {\n let tagName;\n let prefix;\n let openTagToken;\n try {\n if (!isAsciiLetter(this._cursor.peek())) {\n throw this._createError(_unexpectedCharacterErrorMsg(this._cursor.peek()), this._cursor.getSpan(start));\n }\n openTagToken = this._consumeTagOpenStart(start);\n prefix = openTagToken.parts[0];\n tagName = openTagToken.parts[1];\n this._attemptCharCodeUntilFn(isNotWhitespace);\n while (this._cursor.peek() !== $SLASH && this._cursor.peek() !== $GT &&\n this._cursor.peek() !== $LT && this._cursor.peek() !== $EOF) {\n this._consumeAttributeName();\n this._attemptCharCodeUntilFn(isNotWhitespace);\n if (this._attemptCharCode($EQ)) {\n this._attemptCharCodeUntilFn(isNotWhitespace);\n this._consumeAttributeValue();\n }\n this._attemptCharCodeUntilFn(isNotWhitespace);\n }\n this._consumeTagOpenEnd();\n }\n catch (e) {\n if (e instanceof _ControlFlowError) {\n if (openTagToken) {\n // We errored before we could close the opening tag, so it is incomplete.\n openTagToken.type = 4 /* TokenType.INCOMPLETE_TAG_OPEN */;\n }\n else {\n // When the start tag is invalid, assume we want a \"<\" as text.\n // Back to back text tokens are merged at the end.\n this._beginToken(5 /* TokenType.TEXT */, start);\n this._endToken(['<']);\n }\n return;\n }\n throw e;\n }\n const contentTokenType = this._getTagDefinition(tagName).getContentType(prefix);\n if (contentTokenType === TagContentType.RAW_TEXT) {\n this._consumeRawTextWithTagClose(prefix, tagName, false);\n }\n else if (contentTokenType === TagContentType.ESCAPABLE_RAW_TEXT) {\n this._consumeRawTextWithTagClose(prefix, tagName, true);\n }\n }\n _consumeRawTextWithTagClose(prefix, tagName, consumeEntities) {\n this._consumeRawText(consumeEntities, () => {\n if (!this._attemptCharCode($LT))\n return false;\n if (!this._attemptCharCode($SLASH))\n return false;\n this._attemptCharCodeUntilFn(isNotWhitespace);\n if (!this._attemptStrCaseInsensitive(tagName))\n return false;\n this._attemptCharCodeUntilFn(isNotWhitespace);\n return this._attemptCharCode($GT);\n });\n this._beginToken(3 /* TokenType.TAG_CLOSE */);\n this._requireCharCodeUntilFn(code => code === $GT, 3);\n this._cursor.advance(); // Consume the `>`\n this._endToken([prefix, tagName]);\n }\n _consumeTagOpenStart(start) {\n this._beginToken(0 /* TokenType.TAG_OPEN_START */, start);\n const parts = this._consumePrefixAndName();\n return this._endToken(parts);\n }\n _consumeAttributeName() {\n const attrNameStart = this._cursor.peek();\n if (attrNameStart === $SQ || attrNameStart === $DQ) {\n throw this._createError(_unexpectedCharacterErrorMsg(attrNameStart), this._cursor.getSpan());\n }\n this._beginToken(14 /* TokenType.ATTR_NAME */);\n const prefixAndName = this._consumePrefixAndName();\n this._endToken(prefixAndName);\n }\n _consumeAttributeValue() {\n let value;\n if (this._cursor.peek() === $SQ || this._cursor.peek() === $DQ) {\n const quoteChar = this._cursor.peek();\n this._consumeQuote(quoteChar);\n // In an attribute then end of the attribute value and the premature end to an interpolation\n // are both triggered by the `quoteChar`.\n const endPredicate = () => this._cursor.peek() === quoteChar;\n this._consumeWithInterpolation(16 /* TokenType.ATTR_VALUE_TEXT */, 17 /* TokenType.ATTR_VALUE_INTERPOLATION */, endPredicate, endPredicate);\n this._consumeQuote(quoteChar);\n }\n else {\n const endPredicate = () => isNameEnd(this._cursor.peek());\n this._consumeWithInterpolation(16 /* TokenType.ATTR_VALUE_TEXT */, 17 /* TokenType.ATTR_VALUE_INTERPOLATION */, endPredicate, endPredicate);\n }\n }\n _consumeQuote(quoteChar) {\n this._beginToken(15 /* TokenType.ATTR_QUOTE */);\n this._requireCharCode(quoteChar);\n this._endToken([String.fromCodePoint(quoteChar)]);\n }\n _consumeTagOpenEnd() {\n const tokenType = this._attemptCharCode($SLASH) ? 2 /* TokenType.TAG_OPEN_END_VOID */ : 1 /* TokenType.TAG_OPEN_END */;\n this._beginToken(tokenType);\n this._requireCharCode($GT);\n this._endToken([]);\n }\n _consumeTagClose(start) {\n this._beginToken(3 /* TokenType.TAG_CLOSE */, start);\n this._attemptCharCodeUntilFn(isNotWhitespace);\n const prefixAndName = this._consumePrefixAndName();\n this._attemptCharCodeUntilFn(isNotWhitespace);\n this._requireCharCode($GT);\n this._endToken(prefixAndName);\n }\n _consumeExpansionFormStart() {\n this._beginToken(19 /* TokenType.EXPANSION_FORM_START */);\n this._requireCharCode($LBRACE);\n this._endToken([]);\n this._expansionCaseStack.push(19 /* TokenType.EXPANSION_FORM_START */);\n this._beginToken(7 /* TokenType.RAW_TEXT */);\n const condition = this._readUntil($COMMA);\n const normalizedCondition = this._processCarriageReturns(condition);\n if (this._i18nNormalizeLineEndingsInICUs) {\n // We explicitly want to normalize line endings for this text.\n this._endToken([normalizedCondition]);\n }\n else {\n // We are not normalizing line endings.\n const conditionToken = this._endToken([condition]);\n if (normalizedCondition !== condition) {\n this.nonNormalizedIcuExpressions.push(conditionToken);\n }\n }\n this._requireCharCode($COMMA);\n this._attemptCharCodeUntilFn(isNotWhitespace);\n this._beginToken(7 /* TokenType.RAW_TEXT */);\n const type = this._readUntil($COMMA);\n this._endToken([type]);\n this._requireCharCode($COMMA);\n this._attemptCharCodeUntilFn(isNotWhitespace);\n }\n _consumeExpansionCaseStart() {\n this._beginToken(20 /* TokenType.EXPANSION_CASE_VALUE */);\n const value = this._readUntil($LBRACE).trim();\n this._endToken([value]);\n this._attemptCharCodeUntilFn(isNotWhitespace);\n this._beginToken(21 /* TokenType.EXPANSION_CASE_EXP_START */);\n this._requireCharCode($LBRACE);\n this._endToken([]);\n this._attemptCharCodeUntilFn(isNotWhitespace);\n this._expansionCaseStack.push(21 /* TokenType.EXPANSION_CASE_EXP_START */);\n }\n _consumeExpansionCaseEnd() {\n this._beginToken(22 /* TokenType.EXPANSION_CASE_EXP_END */);\n this._requireCharCode($RBRACE);\n this._endToken([]);\n this._attemptCharCodeUntilFn(isNotWhitespace);\n this._expansionCaseStack.pop();\n }\n _consumeExpansionFormEnd() {\n this._beginToken(23 /* TokenType.EXPANSION_FORM_END */);\n this._requireCharCode($RBRACE);\n this._endToken([]);\n this._expansionCaseStack.pop();\n }\n /**\n * Consume a string that may contain interpolation expressions.\n *\n * The first token consumed will be of `tokenType` and then there will be alternating\n * `interpolationTokenType` and `tokenType` tokens until the `endPredicate()` returns true.\n *\n * If an interpolation token ends prematurely it will have no end marker in its `parts` array.\n *\n * @param textTokenType the kind of tokens to interleave around interpolation tokens.\n * @param interpolationTokenType the kind of tokens that contain interpolation.\n * @param endPredicate a function that should return true when we should stop consuming.\n * @param endInterpolation a function that should return true if there is a premature end to an\n * interpolation expression - i.e. before we get to the normal interpolation closing marker.\n */\n _consumeWithInterpolation(textTokenType, interpolationTokenType, endPredicate, endInterpolation) {\n this._beginToken(textTokenType);\n const parts = [];\n while (!endPredicate()) {\n const current = this._cursor.clone();\n if (this._interpolationConfig && this._attemptStr(this._interpolationConfig.start)) {\n this._endToken([this._processCarriageReturns(parts.join(''))], current);\n parts.length = 0;\n this._consumeInterpolation(interpolationTokenType, current, endInterpolation);\n this._beginToken(textTokenType);\n }\n else if (this._cursor.peek() === $AMPERSAND) {\n this._endToken([this._processCarriageReturns(parts.join(''))]);\n parts.length = 0;\n this._consumeEntity(textTokenType);\n this._beginToken(textTokenType);\n }\n else {\n parts.push(this._readChar());\n }\n }\n // It is possible that an interpolation was started but not ended inside this text token.\n // Make sure that we reset the state of the lexer correctly.\n this._inInterpolation = false;\n this._endToken([this._processCarriageReturns(parts.join(''))]);\n }\n /**\n * Consume a block of text that has been interpreted as an Angular interpolation.\n *\n * @param interpolationTokenType the type of the interpolation token to generate.\n * @param interpolationStart a cursor that points to the start of this interpolation.\n * @param prematureEndPredicate a function that should return true if the next characters indicate\n * an end to the interpolation before its normal closing marker.\n */\n _consumeInterpolation(interpolationTokenType, interpolationStart, prematureEndPredicate) {\n const parts = [];\n this._beginToken(interpolationTokenType, interpolationStart);\n parts.push(this._interpolationConfig.start);\n // Find the end of the interpolation, ignoring content inside quotes.\n const expressionStart = this._cursor.clone();\n let inQuote = null;\n let inComment = false;\n while (this._cursor.peek() !== $EOF &&\n (prematureEndPredicate === null || !prematureEndPredicate())) {\n const current = this._cursor.clone();\n if (this._isTagStart()) {\n // We are starting what looks like an HTML element in the middle of this interpolation.\n // Reset the cursor to before the `<` character and end the interpolation token.\n // (This is actually wrong but here for backward compatibility).\n this._cursor = current;\n parts.push(this._getProcessedChars(expressionStart, current));\n this._endToken(parts);\n return;\n }\n if (inQuote === null) {\n if (this._attemptStr(this._interpolationConfig.end)) {\n // We are not in a string, and we hit the end interpolation marker\n parts.push(this._getProcessedChars(expressionStart, current));\n parts.push(this._interpolationConfig.end);\n this._endToken(parts);\n return;\n }\n else if (this._attemptStr('//')) {\n // Once we are in a comment we ignore any quotes\n inComment = true;\n }\n }\n const char = this._cursor.peek();\n this._cursor.advance();\n if (char === $BACKSLASH) {\n // Skip the next character because it was escaped.\n this._cursor.advance();\n }\n else if (char === inQuote) {\n // Exiting the current quoted string\n inQuote = null;\n }\n else if (!inComment && inQuote === null && isQuote(char)) {\n // Entering a new quoted string\n inQuote = char;\n }\n }\n // We hit EOF without finding a closing interpolation marker\n parts.push(this._getProcessedChars(expressionStart, this._cursor));\n this._endToken(parts);\n }\n _getProcessedChars(start, end) {\n return this._processCarriageReturns(end.getChars(start));\n }\n _isTextEnd() {\n if (this._isTagStart() || this._cursor.peek() === $EOF) {\n return true;\n }\n if (this._tokenizeIcu && !this._inInterpolation) {\n if (this.isExpansionFormStart()) {\n // start of an expansion form\n return true;\n }\n if (this._cursor.peek() === $RBRACE && this._isInExpansionCase()) {\n // end of and expansion case\n return true;\n }\n }\n return false;\n }\n /**\n * Returns true if the current cursor is pointing to the start of a tag\n * (opening/closing/comments/cdata/etc).\n */\n _isTagStart() {\n if (this._cursor.peek() === $LT) {\n // We assume that `<` followed by whitespace is not the start of an HTML element.\n const tmp = this._cursor.clone();\n tmp.advance();\n // If the next character is alphabetic, ! nor / then it is a tag start\n const code = tmp.peek();\n if (($a <= code && code <= $z) || ($A <= code && code <= $Z) ||\n code === $SLASH || code === $BANG) {\n return true;\n }\n }\n return false;\n }\n _readUntil(char) {\n const start = this._cursor.clone();\n this._attemptUntilChar(char);\n return this._cursor.getChars(start);\n }\n _isInExpansionCase() {\n return this._expansionCaseStack.length > 0 &&\n this._expansionCaseStack[this._expansionCaseStack.length - 1] ===\n 21 /* TokenType.EXPANSION_CASE_EXP_START */;\n }\n _isInExpansionForm() {\n return this._expansionCaseStack.length > 0 &&\n this._expansionCaseStack[this._expansionCaseStack.length - 1] ===\n 19 /* TokenType.EXPANSION_FORM_START */;\n }\n isExpansionFormStart() {\n if (this._cursor.peek() !== $LBRACE) {\n return false;\n }\n if (this._interpolationConfig) {\n const start = this._cursor.clone();\n const isInterpolation = this._attemptStr(this._interpolationConfig.start);\n this._cursor = start;\n return !isInterpolation;\n }\n return true;\n }\n}\nfunction isNotWhitespace(code) {\n return !isWhitespace(code) || code === $EOF;\n}\nfunction isNameEnd(code) {\n return isWhitespace(code) || code === $GT || code === $LT ||\n code === $SLASH || code === $SQ || code === $DQ || code === $EQ ||\n code === $EOF;\n}\nfunction isPrefixEnd(code) {\n return (code < $a || $z < code) && (code < $A || $Z < code) &&\n (code < $0 || code > $9);\n}\nfunction isDigitEntityEnd(code) {\n return code === $SEMICOLON || code === $EOF || !isAsciiHexDigit(code);\n}\nfunction isNamedEntityEnd(code) {\n return code === $SEMICOLON || code === $EOF || !isAsciiLetter(code);\n}\nfunction isExpansionCaseStart(peek) {\n return peek !== $RBRACE;\n}\nfunction compareCharCodeCaseInsensitive(code1, code2) {\n return toUpperCaseCharCode(code1) === toUpperCaseCharCode(code2);\n}\nfunction toUpperCaseCharCode(code) {\n return code >= $a && code <= $z ? code - $a + $A : code;\n}\nfunction mergeTextTokens(srcTokens) {\n const dstTokens = [];\n let lastDstToken = undefined;\n for (let i = 0; i < srcTokens.length; i++) {\n const token = srcTokens[i];\n if ((lastDstToken && lastDstToken.type === 5 /* TokenType.TEXT */ && token.type === 5 /* TokenType.TEXT */) ||\n (lastDstToken && lastDstToken.type === 16 /* TokenType.ATTR_VALUE_TEXT */ &&\n token.type === 16 /* TokenType.ATTR_VALUE_TEXT */)) {\n lastDstToken.parts[0] += token.parts[0];\n lastDstToken.sourceSpan.end = token.sourceSpan.end;\n }\n else {\n lastDstToken = token;\n dstTokens.push(lastDstToken);\n }\n }\n return dstTokens;\n}\nclass PlainCharacterCursor {\n constructor(fileOrCursor, range) {\n if (fileOrCursor instanceof PlainCharacterCursor) {\n this.file = fileOrCursor.file;\n this.input = fileOrCursor.input;\n this.end = fileOrCursor.end;\n const state = fileOrCursor.state;\n // Note: avoid using `{...fileOrCursor.state}` here as that has a severe performance penalty.\n // In ES5 bundles the object spread operator is translated into the `__assign` helper, which\n // is not optimized by VMs as efficiently as a raw object literal. Since this constructor is\n // called in tight loops, this difference matters.\n this.state = {\n peek: state.peek,\n offset: state.offset,\n line: state.line,\n column: state.column,\n };\n }\n else {\n if (!range) {\n throw new Error('Programming error: the range argument must be provided with a file argument.');\n }\n this.file = fileOrCursor;\n this.input = fileOrCursor.content;\n this.end = range.endPos;\n this.state = {\n peek: -1,\n offset: range.startPos,\n line: range.startLine,\n column: range.startCol,\n };\n }\n }\n clone() {\n return new PlainCharacterCursor(this);\n }\n peek() {\n return this.state.peek;\n }\n charsLeft() {\n return this.end - this.state.offset;\n }\n diff(other) {\n return this.state.offset - other.state.offset;\n }\n advance() {\n this.advanceState(this.state);\n }\n init() {\n this.updatePeek(this.state);\n }\n getSpan(start, leadingTriviaCodePoints) {\n start = start || this;\n let fullStart = start;\n if (leadingTriviaCodePoints) {\n while (this.diff(start) > 0 && leadingTriviaCodePoints.indexOf(start.peek()) !== -1) {\n if (fullStart === start) {\n start = start.clone();\n }\n start.advance();\n }\n }\n const startLocation = this.locationFromCursor(start);\n const endLocation = this.locationFromCursor(this);\n const fullStartLocation = fullStart !== start ? this.locationFromCursor(fullStart) : startLocation;\n return new ParseSourceSpan(startLocation, endLocation, fullStartLocation);\n }\n getChars(start) {\n return this.input.substring(start.state.offset, this.state.offset);\n }\n charAt(pos) {\n return this.input.charCodeAt(pos);\n }\n advanceState(state) {\n if (state.offset >= this.end) {\n this.state = state;\n throw new CursorError('Unexpected character \"EOF\"', this);\n }\n const currentChar = this.charAt(state.offset);\n if (currentChar === $LF) {\n state.line++;\n state.column = 0;\n }\n else if (!isNewLine(currentChar)) {\n state.column++;\n }\n state.offset++;\n this.updatePeek(state);\n }\n updatePeek(state) {\n state.peek = state.offset >= this.end ? $EOF : this.charAt(state.offset);\n }\n locationFromCursor(cursor) {\n return new ParseLocation(cursor.file, cursor.state.offset, cursor.state.line, cursor.state.column);\n }\n}\nclass EscapedCharacterCursor extends PlainCharacterCursor {\n constructor(fileOrCursor, range) {\n if (fileOrCursor instanceof EscapedCharacterCursor) {\n super(fileOrCursor);\n this.internalState = Object.assign({}, fileOrCursor.internalState);\n }\n else {\n super(fileOrCursor, range);\n this.internalState = this.state;\n }\n }\n advance() {\n this.state = this.internalState;\n super.advance();\n this.processEscapeSequence();\n }\n init() {\n super.init();\n this.processEscapeSequence();\n }\n clone() {\n return new EscapedCharacterCursor(this);\n }\n getChars(start) {\n const cursor = start.clone();\n let chars = '';\n while (cursor.internalState.offset < this.internalState.offset) {\n chars += String.fromCodePoint(cursor.peek());\n cursor.advance();\n }\n return chars;\n }\n /**\n * Process the escape sequence that starts at the current position in the text.\n *\n * This method is called to ensure that `peek` has the unescaped value of escape sequences.\n */\n processEscapeSequence() {\n const peek = () => this.internalState.peek;\n if (peek() === $BACKSLASH) {\n // We have hit an escape sequence so we need the internal state to become independent\n // of the external state.\n this.internalState = Object.assign({}, this.state);\n // Move past the backslash\n this.advanceState(this.internalState);\n // First check for standard control char sequences\n if (peek() === $n) {\n this.state.peek = $LF;\n }\n else if (peek() === $r) {\n this.state.peek = $CR;\n }\n else if (peek() === $v) {\n this.state.peek = $VTAB;\n }\n else if (peek() === $t) {\n this.state.peek = $TAB;\n }\n else if (peek() === $b) {\n this.state.peek = $BSPACE;\n }\n else if (peek() === $f) {\n this.state.peek = $FF;\n }\n // Now consider more complex sequences\n else if (peek() === $u) {\n // Unicode code-point sequence\n this.advanceState(this.internalState); // advance past the `u` char\n if (peek() === $LBRACE) {\n // Variable length Unicode, e.g. `\\x{123}`\n this.advanceState(this.internalState); // advance past the `{` char\n // Advance past the variable number of hex digits until we hit a `}` char\n const digitStart = this.clone();\n let length = 0;\n while (peek() !== $RBRACE) {\n this.advanceState(this.internalState);\n length++;\n }\n this.state.peek = this.decodeHexDigits(digitStart, length);\n }\n else {\n // Fixed length Unicode, e.g. `\\u1234`\n const digitStart = this.clone();\n this.advanceState(this.internalState);\n this.advanceState(this.internalState);\n this.advanceState(this.internalState);\n this.state.peek = this.decodeHexDigits(digitStart, 4);\n }\n }\n else if (peek() === $x) {\n // Hex char code, e.g. `\\x2F`\n this.advanceState(this.internalState); // advance past the `x` char\n const digitStart = this.clone();\n this.advanceState(this.internalState);\n this.state.peek = this.decodeHexDigits(digitStart, 2);\n }\n else if (isOctalDigit(peek())) {\n // Octal char code, e.g. `\\012`,\n let octal = '';\n let length = 0;\n let previous = this.clone();\n while (isOctalDigit(peek()) && length < 3) {\n previous = this.clone();\n octal += String.fromCodePoint(peek());\n this.advanceState(this.internalState);\n length++;\n }\n this.state.peek = parseInt(octal, 8);\n // Backup one char\n this.internalState = previous.internalState;\n }\n else if (isNewLine(this.internalState.peek)) {\n // Line continuation `\\` followed by a new line\n this.advanceState(this.internalState); // advance over the newline\n this.state = this.internalState;\n }\n else {\n // If none of the `if` blocks were executed then we just have an escaped normal character.\n // In that case we just, effectively, skip the backslash from the character.\n this.state.peek = this.internalState.peek;\n }\n }\n }\n decodeHexDigits(start, length) {\n const hex = this.input.slice(start.internalState.offset, start.internalState.offset + length);\n const charCode = parseInt(hex, 16);\n if (!isNaN(charCode)) {\n return charCode;\n }\n else {\n start.state = start.internalState;\n throw new CursorError('Invalid hexadecimal escape sequence', start);\n }\n }\n}\nclass CursorError {\n constructor(msg, cursor) {\n this.msg = msg;\n this.cursor = cursor;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass TreeError extends ParseError {\n constructor(elementName, span, msg) {\n super(span, msg);\n this.elementName = elementName;\n }\n static create(elementName, span, msg) {\n return new TreeError(elementName, span, msg);\n }\n}\nclass ParseTreeResult {\n constructor(rootNodes, errors) {\n this.rootNodes = rootNodes;\n this.errors = errors;\n }\n}\nclass Parser {\n constructor(getTagDefinition) {\n this.getTagDefinition = getTagDefinition;\n }\n parse(source, url, options) {\n const tokenizeResult = tokenize(source, url, this.getTagDefinition, options);\n const parser = new _TreeBuilder(tokenizeResult.tokens, this.getTagDefinition);\n parser.build();\n return new ParseTreeResult(parser.rootNodes, tokenizeResult.errors.concat(parser.errors));\n }\n}\nclass _TreeBuilder {\n constructor(tokens, getTagDefinition) {\n this.tokens = tokens;\n this.getTagDefinition = getTagDefinition;\n this._index = -1;\n this._elementStack = [];\n this.rootNodes = [];\n this.errors = [];\n this._advance();\n }\n build() {\n while (this._peek.type !== 24 /* TokenType.EOF */) {\n if (this._peek.type === 0 /* TokenType.TAG_OPEN_START */ ||\n this._peek.type === 4 /* TokenType.INCOMPLETE_TAG_OPEN */) {\n this._consumeStartTag(this._advance());\n }\n else if (this._peek.type === 3 /* TokenType.TAG_CLOSE */) {\n this._consumeEndTag(this._advance());\n }\n else if (this._peek.type === 12 /* TokenType.CDATA_START */) {\n this._closeVoidElement();\n this._consumeCdata(this._advance());\n }\n else if (this._peek.type === 10 /* TokenType.COMMENT_START */) {\n this._closeVoidElement();\n this._consumeComment(this._advance());\n }\n else if (this._peek.type === 5 /* TokenType.TEXT */ || this._peek.type === 7 /* TokenType.RAW_TEXT */ ||\n this._peek.type === 6 /* TokenType.ESCAPABLE_RAW_TEXT */) {\n this._closeVoidElement();\n this._consumeText(this._advance());\n }\n else if (this._peek.type === 19 /* TokenType.EXPANSION_FORM_START */) {\n this._consumeExpansion(this._advance());\n }\n else {\n // Skip all other tokens...\n this._advance();\n }\n }\n }\n _advance() {\n const prev = this._peek;\n if (this._index < this.tokens.length - 1) {\n // Note: there is always an EOF token at the end\n this._index++;\n }\n this._peek = this.tokens[this._index];\n return prev;\n }\n _advanceIf(type) {\n if (this._peek.type === type) {\n return this._advance();\n }\n return null;\n }\n _consumeCdata(_startToken) {\n this._consumeText(this._advance());\n this._advanceIf(13 /* TokenType.CDATA_END */);\n }\n _consumeComment(token) {\n const text = this._advanceIf(7 /* TokenType.RAW_TEXT */);\n this._advanceIf(11 /* TokenType.COMMENT_END */);\n const value = text != null ? text.parts[0].trim() : null;\n this._addToParent(new Comment(value, token.sourceSpan));\n }\n _consumeExpansion(token) {\n const switchValue = this._advance();\n const type = this._advance();\n const cases = [];\n // read =\n while (this._peek.type === 20 /* TokenType.EXPANSION_CASE_VALUE */) {\n const expCase = this._parseExpansionCase();\n if (!expCase)\n return; // error\n cases.push(expCase);\n }\n // read the final }\n if (this._peek.type !== 23 /* TokenType.EXPANSION_FORM_END */) {\n this.errors.push(TreeError.create(null, this._peek.sourceSpan, `Invalid ICU message. Missing '}'.`));\n return;\n }\n const sourceSpan = new ParseSourceSpan(token.sourceSpan.start, this._peek.sourceSpan.end, token.sourceSpan.fullStart);\n this._addToParent(new Expansion(switchValue.parts[0], type.parts[0], cases, sourceSpan, switchValue.sourceSpan));\n this._advance();\n }\n _parseExpansionCase() {\n const value = this._advance();\n // read {\n if (this._peek.type !== 21 /* TokenType.EXPANSION_CASE_EXP_START */) {\n this.errors.push(TreeError.create(null, this._peek.sourceSpan, `Invalid ICU message. Missing '{'.`));\n return null;\n }\n // read until }\n const start = this._advance();\n const exp = this._collectExpansionExpTokens(start);\n if (!exp)\n return null;\n const end = this._advance();\n exp.push({ type: 24 /* TokenType.EOF */, parts: [], sourceSpan: end.sourceSpan });\n // parse everything in between { and }\n const expansionCaseParser = new _TreeBuilder(exp, this.getTagDefinition);\n expansionCaseParser.build();\n if (expansionCaseParser.errors.length > 0) {\n this.errors = this.errors.concat(expansionCaseParser.errors);\n return null;\n }\n const sourceSpan = new ParseSourceSpan(value.sourceSpan.start, end.sourceSpan.end, value.sourceSpan.fullStart);\n const expSourceSpan = new ParseSourceSpan(start.sourceSpan.start, end.sourceSpan.end, start.sourceSpan.fullStart);\n return new ExpansionCase(value.parts[0], expansionCaseParser.rootNodes, sourceSpan, value.sourceSpan, expSourceSpan);\n }\n _collectExpansionExpTokens(start) {\n const exp = [];\n const expansionFormStack = [21 /* TokenType.EXPANSION_CASE_EXP_START */];\n while (true) {\n if (this._peek.type === 19 /* TokenType.EXPANSION_FORM_START */ ||\n this._peek.type === 21 /* TokenType.EXPANSION_CASE_EXP_START */) {\n expansionFormStack.push(this._peek.type);\n }\n if (this._peek.type === 22 /* TokenType.EXPANSION_CASE_EXP_END */) {\n if (lastOnStack(expansionFormStack, 21 /* TokenType.EXPANSION_CASE_EXP_START */)) {\n expansionFormStack.pop();\n if (expansionFormStack.length === 0)\n return exp;\n }\n else {\n this.errors.push(TreeError.create(null, start.sourceSpan, `Invalid ICU message. Missing '}'.`));\n return null;\n }\n }\n if (this._peek.type === 23 /* TokenType.EXPANSION_FORM_END */) {\n if (lastOnStack(expansionFormStack, 19 /* TokenType.EXPANSION_FORM_START */)) {\n expansionFormStack.pop();\n }\n else {\n this.errors.push(TreeError.create(null, start.sourceSpan, `Invalid ICU message. Missing '}'.`));\n return null;\n }\n }\n if (this._peek.type === 24 /* TokenType.EOF */) {\n this.errors.push(TreeError.create(null, start.sourceSpan, `Invalid ICU message. Missing '}'.`));\n return null;\n }\n exp.push(this._advance());\n }\n }\n _consumeText(token) {\n const tokens = [token];\n const startSpan = token.sourceSpan;\n let text = token.parts[0];\n if (text.length > 0 && text[0] === '\\n') {\n const parent = this._getParentElement();\n if (parent != null && parent.children.length === 0 &&\n this.getTagDefinition(parent.name).ignoreFirstLf) {\n text = text.substring(1);\n tokens[0] = { type: token.type, sourceSpan: token.sourceSpan, parts: [text] };\n }\n }\n while (this._peek.type === 8 /* TokenType.INTERPOLATION */ || this._peek.type === 5 /* TokenType.TEXT */ ||\n this._peek.type === 9 /* TokenType.ENCODED_ENTITY */) {\n token = this._advance();\n tokens.push(token);\n if (token.type === 8 /* TokenType.INTERPOLATION */) {\n // For backward compatibility we decode HTML entities that appear in interpolation\n // expressions. This is arguably a bug, but it could be a considerable breaking change to\n // fix it. It should be addressed in a larger project to refactor the entire parser/lexer\n // chain after View Engine has been removed.\n text += token.parts.join('').replace(/&([^;]+);/g, decodeEntity);\n }\n else if (token.type === 9 /* TokenType.ENCODED_ENTITY */) {\n text += token.parts[0];\n }\n else {\n text += token.parts.join('');\n }\n }\n if (text.length > 0) {\n const endSpan = token.sourceSpan;\n this._addToParent(new Text(text, new ParseSourceSpan(startSpan.start, endSpan.end, startSpan.fullStart, startSpan.details), tokens));\n }\n }\n _closeVoidElement() {\n const el = this._getParentElement();\n if (el && this.getTagDefinition(el.name).isVoid) {\n this._elementStack.pop();\n }\n }\n _consumeStartTag(startTagToken) {\n const [prefix, name] = startTagToken.parts;\n const attrs = [];\n while (this._peek.type === 14 /* TokenType.ATTR_NAME */) {\n attrs.push(this._consumeAttr(this._advance()));\n }\n const fullName = this._getElementFullName(prefix, name, this._getParentElement());\n let selfClosing = false;\n // Note: There could have been a tokenizer error\n // so that we don't get a token for the end tag...\n if (this._peek.type === 2 /* TokenType.TAG_OPEN_END_VOID */) {\n this._advance();\n selfClosing = true;\n const tagDef = this.getTagDefinition(fullName);\n if (!(tagDef.canSelfClose || getNsPrefix(fullName) !== null || tagDef.isVoid)) {\n this.errors.push(TreeError.create(fullName, startTagToken.sourceSpan, `Only void and foreign elements can be self closed \"${startTagToken.parts[1]}\"`));\n }\n }\n else if (this._peek.type === 1 /* TokenType.TAG_OPEN_END */) {\n this._advance();\n selfClosing = false;\n }\n const end = this._peek.sourceSpan.fullStart;\n const span = new ParseSourceSpan(startTagToken.sourceSpan.start, end, startTagToken.sourceSpan.fullStart);\n // Create a separate `startSpan` because `span` will be modified when there is an `end` span.\n const startSpan = new ParseSourceSpan(startTagToken.sourceSpan.start, end, startTagToken.sourceSpan.fullStart);\n const el = new Element(fullName, attrs, [], span, startSpan, undefined);\n this._pushElement(el);\n if (selfClosing) {\n // Elements that are self-closed have their `endSourceSpan` set to the full span, as the\n // element start tag also represents the end tag.\n this._popElement(fullName, span);\n }\n else if (startTagToken.type === 4 /* TokenType.INCOMPLETE_TAG_OPEN */) {\n // We already know the opening tag is not complete, so it is unlikely it has a corresponding\n // close tag. Let's optimistically parse it as a full element and emit an error.\n this._popElement(fullName, null);\n this.errors.push(TreeError.create(fullName, span, `Opening tag \"${fullName}\" not terminated.`));\n }\n }\n _pushElement(el) {\n const parentEl = this._getParentElement();\n if (parentEl && this.getTagDefinition(parentEl.name).isClosedByChild(el.name)) {\n this._elementStack.pop();\n }\n this._addToParent(el);\n this._elementStack.push(el);\n }\n _consumeEndTag(endTagToken) {\n const fullName = this._getElementFullName(endTagToken.parts[0], endTagToken.parts[1], this._getParentElement());\n if (this.getTagDefinition(fullName).isVoid) {\n this.errors.push(TreeError.create(fullName, endTagToken.sourceSpan, `Void elements do not have end tags \"${endTagToken.parts[1]}\"`));\n }\n else if (!this._popElement(fullName, endTagToken.sourceSpan)) {\n const errMsg = `Unexpected closing tag \"${fullName}\". It may happen when the tag has already been closed by another tag. For more info see https://www.w3.org/TR/html5/syntax.html#closing-elements-that-have-implied-end-tags`;\n this.errors.push(TreeError.create(fullName, endTagToken.sourceSpan, errMsg));\n }\n }\n /**\n * Closes the nearest element with the tag name `fullName` in the parse tree.\n * `endSourceSpan` is the span of the closing tag, or null if the element does\n * not have a closing tag (for example, this happens when an incomplete\n * opening tag is recovered).\n */\n _popElement(fullName, endSourceSpan) {\n let unexpectedCloseTagDetected = false;\n for (let stackIndex = this._elementStack.length - 1; stackIndex >= 0; stackIndex--) {\n const el = this._elementStack[stackIndex];\n if (el.name === fullName) {\n // Record the parse span with the element that is being closed. Any elements that are\n // removed from the element stack at this point are closed implicitly, so they won't get\n // an end source span (as there is no explicit closing element).\n el.endSourceSpan = endSourceSpan;\n el.sourceSpan.end = endSourceSpan !== null ? endSourceSpan.end : el.sourceSpan.end;\n this._elementStack.splice(stackIndex, this._elementStack.length - stackIndex);\n return !unexpectedCloseTagDetected;\n }\n if (!this.getTagDefinition(el.name).closedByParent) {\n // Note that we encountered an unexpected close tag but continue processing the element\n // stack so we can assign an `endSourceSpan` if there is a corresponding start tag for this\n // end tag in the stack.\n unexpectedCloseTagDetected = true;\n }\n }\n return false;\n }\n _consumeAttr(attrName) {\n const fullName = mergeNsAndName(attrName.parts[0], attrName.parts[1]);\n let attrEnd = attrName.sourceSpan.end;\n // Consume any quote\n if (this._peek.type === 15 /* TokenType.ATTR_QUOTE */) {\n this._advance();\n }\n // Consume the attribute value\n let value = '';\n const valueTokens = [];\n let valueStartSpan = undefined;\n let valueEnd = undefined;\n // NOTE: We need to use a new variable `nextTokenType` here to hide the actual type of\n // `_peek.type` from TS. Otherwise TS will narrow the type of `_peek.type` preventing it from\n // being able to consider `ATTR_VALUE_INTERPOLATION` as an option. This is because TS is not\n // able to see that `_advance()` will actually mutate `_peek`.\n const nextTokenType = this._peek.type;\n if (nextTokenType === 16 /* TokenType.ATTR_VALUE_TEXT */) {\n valueStartSpan = this._peek.sourceSpan;\n valueEnd = this._peek.sourceSpan.end;\n while (this._peek.type === 16 /* TokenType.ATTR_VALUE_TEXT */ ||\n this._peek.type === 17 /* TokenType.ATTR_VALUE_INTERPOLATION */ ||\n this._peek.type === 9 /* TokenType.ENCODED_ENTITY */) {\n const valueToken = this._advance();\n valueTokens.push(valueToken);\n if (valueToken.type === 17 /* TokenType.ATTR_VALUE_INTERPOLATION */) {\n // For backward compatibility we decode HTML entities that appear in interpolation\n // expressions. This is arguably a bug, but it could be a considerable breaking change to\n // fix it. It should be addressed in a larger project to refactor the entire parser/lexer\n // chain after View Engine has been removed.\n value += valueToken.parts.join('').replace(/&([^;]+);/g, decodeEntity);\n }\n else if (valueToken.type === 9 /* TokenType.ENCODED_ENTITY */) {\n value += valueToken.parts[0];\n }\n else {\n value += valueToken.parts.join('');\n }\n valueEnd = attrEnd = valueToken.sourceSpan.end;\n }\n }\n // Consume any quote\n if (this._peek.type === 15 /* TokenType.ATTR_QUOTE */) {\n const quoteToken = this._advance();\n attrEnd = quoteToken.sourceSpan.end;\n }\n const valueSpan = valueStartSpan && valueEnd &&\n new ParseSourceSpan(valueStartSpan.start, valueEnd, valueStartSpan.fullStart);\n return new Attribute(fullName, value, new ParseSourceSpan(attrName.sourceSpan.start, attrEnd, attrName.sourceSpan.fullStart), attrName.sourceSpan, valueSpan, valueTokens.length > 0 ? valueTokens : undefined, undefined);\n }\n _getParentElement() {\n return this._elementStack.length > 0 ? this._elementStack[this._elementStack.length - 1] : null;\n }\n _addToParent(node) {\n const parent = this._getParentElement();\n if (parent != null) {\n parent.children.push(node);\n }\n else {\n this.rootNodes.push(node);\n }\n }\n _getElementFullName(prefix, localName, parentElement) {\n if (prefix === '') {\n prefix = this.getTagDefinition(localName).implicitNamespacePrefix || '';\n if (prefix === '' && parentElement != null) {\n const parentTagName = splitNsName(parentElement.name)[1];\n const parentTagDefinition = this.getTagDefinition(parentTagName);\n if (!parentTagDefinition.preventNamespaceInheritance) {\n prefix = getNsPrefix(parentElement.name);\n }\n }\n }\n return mergeNsAndName(prefix, localName);\n }\n}\nfunction lastOnStack(stack, element) {\n return stack.length > 0 && stack[stack.length - 1] === element;\n}\n/**\n * Decode the `entity` string, which we believe is the contents of an HTML entity.\n *\n * If the string is not actually a valid/known entity then just return the original `match` string.\n */\nfunction decodeEntity(match, entity) {\n if (NAMED_ENTITIES[entity] !== undefined) {\n return NAMED_ENTITIES[entity] || match;\n }\n if (/^#x[a-f0-9]+$/i.test(entity)) {\n return String.fromCodePoint(parseInt(entity.slice(2), 16));\n }\n if (/^#\\d+$/.test(entity)) {\n return String.fromCodePoint(parseInt(entity.slice(1), 10));\n }\n return match;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass HtmlParser extends Parser {\n constructor() {\n super(getHtmlTagDefinition);\n }\n parse(source, url, options) {\n return super.parse(source, url, options);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PRESERVE_WS_ATTR_NAME = 'ngPreserveWhitespaces';\nconst SKIP_WS_TRIM_TAGS = new Set(['pre', 'template', 'textarea', 'script', 'style']);\n// Equivalent to \\s with \\u00a0 (non-breaking space) excluded.\n// Based on https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/RegExp\nconst WS_CHARS = ' \\f\\n\\r\\t\\v\\u1680\\u180e\\u2000-\\u200a\\u2028\\u2029\\u202f\\u205f\\u3000\\ufeff';\nconst NO_WS_REGEXP = new RegExp(`[^${WS_CHARS}]`);\nconst WS_REPLACE_REGEXP = new RegExp(`[${WS_CHARS}]{2,}`, 'g');\nfunction hasPreserveWhitespacesAttr(attrs) {\n return attrs.some((attr) => attr.name === PRESERVE_WS_ATTR_NAME);\n}\n/**\n * Angular Dart introduced &ngsp; as a placeholder for non-removable space, see:\n * https://github.com/dart-lang/angular/blob/0bb611387d29d65b5af7f9d2515ab571fd3fbee4/_tests/test/compiler/preserve_whitespace_test.dart#L25-L32\n * In Angular Dart &ngsp; is converted to the 0xE500 PUA (Private Use Areas) unicode character\n * and later on replaced by a space. We are re-implementing the same idea here.\n */\nfunction replaceNgsp(value) {\n // lexer is replacing the &ngsp; pseudo-entity with NGSP_UNICODE\n return value.replace(new RegExp(NGSP_UNICODE, 'g'), ' ');\n}\n/**\n * This visitor can walk HTML parse tree and remove / trim text nodes using the following rules:\n * - consider spaces, tabs and new lines as whitespace characters;\n * - drop text nodes consisting of whitespace characters only;\n * - for all other text nodes replace consecutive whitespace characters with one space;\n * - convert &ngsp; pseudo-entity to a single space;\n *\n * Removal and trimming of whitespaces have positive performance impact (less code to generate\n * while compiling templates, faster view creation). At the same time it can be \"destructive\"\n * in some cases (whitespaces can influence layout). Because of the potential of breaking layout\n * this visitor is not activated by default in Angular 5 and people need to explicitly opt-in for\n * whitespace removal. The default option for whitespace removal will be revisited in Angular 6\n * and might be changed to \"on\" by default.\n */\nclass WhitespaceVisitor {\n visitElement(element, context) {\n if (SKIP_WS_TRIM_TAGS.has(element.name) || hasPreserveWhitespacesAttr(element.attrs)) {\n // don't descent into elements where we need to preserve whitespaces\n // but still visit all attributes to eliminate one used as a market to preserve WS\n return new Element(element.name, visitAll(this, element.attrs), element.children, element.sourceSpan, element.startSourceSpan, element.endSourceSpan, element.i18n);\n }\n return new Element(element.name, element.attrs, visitAllWithSiblings(this, element.children), element.sourceSpan, element.startSourceSpan, element.endSourceSpan, element.i18n);\n }\n visitAttribute(attribute, context) {\n return attribute.name !== PRESERVE_WS_ATTR_NAME ? attribute : null;\n }\n visitText(text, context) {\n const isNotBlank = text.value.match(NO_WS_REGEXP);\n const hasExpansionSibling = context &&\n (context.prev instanceof Expansion || context.next instanceof Expansion);\n if (isNotBlank || hasExpansionSibling) {\n // Process the whitespace in the tokens of this Text node\n const tokens = text.tokens.map(token => token.type === 5 /* TokenType.TEXT */ ? createWhitespaceProcessedTextToken(token) : token);\n // Process the whitespace of the value of this Text node\n const value = processWhitespace(text.value);\n return new Text(value, text.sourceSpan, tokens, text.i18n);\n }\n return null;\n }\n visitComment(comment, context) {\n return comment;\n }\n visitExpansion(expansion, context) {\n return expansion;\n }\n visitExpansionCase(expansionCase, context) {\n return expansionCase;\n }\n}\nfunction createWhitespaceProcessedTextToken({ type, parts, sourceSpan }) {\n return { type, parts: [processWhitespace(parts[0])], sourceSpan };\n}\nfunction processWhitespace(text) {\n return replaceNgsp(text).replace(WS_REPLACE_REGEXP, ' ');\n}\nfunction removeWhitespaces(htmlAstWithErrors) {\n return new ParseTreeResult(visitAll(new WhitespaceVisitor(), htmlAstWithErrors.rootNodes), htmlAstWithErrors.errors);\n}\nfunction visitAllWithSiblings(visitor, nodes) {\n const result = [];\n nodes.forEach((ast, i) => {\n const context = { prev: nodes[i - 1], next: nodes[i + 1] };\n const astResult = ast.visit(visitor, context);\n if (astResult) {\n result.push(astResult);\n }\n });\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction mapEntry(key, value) {\n return { key, value, quoted: false };\n}\nfunction mapLiteral(obj, quoted = false) {\n return literalMap(Object.keys(obj).map(key => ({\n key,\n quoted,\n value: obj[key],\n })));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// =================================================================================================\n// =================================================================================================\n// =========== S T O P - S T O P - S T O P - S T O P - S T O P - S T O P ===========\n// =================================================================================================\n// =================================================================================================\n//\n// DO NOT EDIT THIS LIST OF SECURITY SENSITIVE PROPERTIES WITHOUT A SECURITY REVIEW!\n// Reach out to mprobst for details.\n//\n// =================================================================================================\n/** Map from tagName|propertyName to SecurityContext. Properties applying to all tags use '*'. */\nlet _SECURITY_SCHEMA;\nfunction SECURITY_SCHEMA() {\n if (!_SECURITY_SCHEMA) {\n _SECURITY_SCHEMA = {};\n // Case is insignificant below, all element and attribute names are lower-cased for lookup.\n registerContext(SecurityContext.HTML, [\n 'iframe|srcdoc',\n '*|innerHTML',\n '*|outerHTML',\n ]);\n registerContext(SecurityContext.STYLE, ['*|style']);\n // NB: no SCRIPT contexts here, they are never allowed due to the parser stripping them.\n registerContext(SecurityContext.URL, [\n '*|formAction',\n 'area|href',\n 'area|ping',\n 'audio|src',\n 'a|href',\n 'a|ping',\n 'blockquote|cite',\n 'body|background',\n 'del|cite',\n 'form|action',\n 'img|src',\n 'input|src',\n 'ins|cite',\n 'q|cite',\n 'source|src',\n 'track|src',\n 'video|poster',\n 'video|src',\n ]);\n registerContext(SecurityContext.RESOURCE_URL, [\n 'applet|code',\n 'applet|codebase',\n 'base|href',\n 'embed|src',\n 'frame|src',\n 'head|profile',\n 'html|manifest',\n 'iframe|src',\n 'link|href',\n 'media|src',\n 'object|codebase',\n 'object|data',\n 'script|src',\n ]);\n }\n return _SECURITY_SCHEMA;\n}\nfunction registerContext(ctx, specs) {\n for (const spec of specs)\n _SECURITY_SCHEMA[spec.toLowerCase()] = ctx;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ElementSchemaRegistry {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst EVENT = 'event';\nconst BOOLEAN = 'boolean';\nconst NUMBER = 'number';\nconst STRING = 'string';\nconst OBJECT = 'object';\n/**\n * This array represents the DOM schema. It encodes inheritance, properties, and events.\n *\n * ## Overview\n *\n * Each line represents one kind of element. The `element_inheritance` and properties are joined\n * using `element_inheritance|properties` syntax.\n *\n * ## Element Inheritance\n *\n * The `element_inheritance` can be further subdivided as `element1,element2,...^parentElement`.\n * Here the individual elements are separated by `,` (commas). Every element in the list\n * has identical properties.\n *\n * An `element` may inherit additional properties from `parentElement` If no `^parentElement` is\n * specified then `\"\"` (blank) element is assumed.\n *\n * NOTE: The blank element inherits from root `[Element]` element, the super element of all\n * elements.\n *\n * NOTE an element prefix such as `:svg:` has no special meaning to the schema.\n *\n * ## Properties\n *\n * Each element has a set of properties separated by `,` (commas). Each property can be prefixed\n * by a special character designating its type:\n *\n * - (no prefix): property is a string.\n * - `*`: property represents an event.\n * - `!`: property is a boolean.\n * - `#`: property is a number.\n * - `%`: property is an object.\n *\n * ## Query\n *\n * The class creates an internal squas representation which allows to easily answer the query of\n * if a given property exist on a given element.\n *\n * NOTE: We don't yet support querying for types or events.\n * NOTE: This schema is auto extracted from `schema_extractor.ts` located in the test folder,\n * see dom_element_schema_registry_spec.ts\n */\n// =================================================================================================\n// =================================================================================================\n// =========== S T O P - S T O P - S T O P - S T O P - S T O P - S T O P ===========\n// =================================================================================================\n// =================================================================================================\n//\n// DO NOT EDIT THIS DOM SCHEMA WITHOUT A SECURITY REVIEW!\n//\n// Newly added properties must be security reviewed and assigned an appropriate SecurityContext in\n// dom_security_schema.ts. Reach out to mprobst & rjamet for details.\n//\n// =================================================================================================\nconst SCHEMA = [\n '[Element]|textContent,%classList,className,id,innerHTML,*beforecopy,*beforecut,*beforepaste,*copy,*cut,*paste,*search,*selectstart,*webkitfullscreenchange,*webkitfullscreenerror,*wheel,outerHTML,#scrollLeft,#scrollTop,slot' +\n /* added manually to avoid breaking changes */\n ',*message,*mozfullscreenchange,*mozfullscreenerror,*mozpointerlockchange,*mozpointerlockerror,*webglcontextcreationerror,*webglcontextlost,*webglcontextrestored',\n '[HTMLElement]^[Element]|accessKey,contentEditable,dir,!draggable,!hidden,innerText,lang,*abort,*auxclick,*blur,*cancel,*canplay,*canplaythrough,*change,*click,*close,*contextmenu,*cuechange,*dblclick,*drag,*dragend,*dragenter,*dragleave,*dragover,*dragstart,*drop,*durationchange,*emptied,*ended,*error,*focus,*gotpointercapture,*input,*invalid,*keydown,*keypress,*keyup,*load,*loadeddata,*loadedmetadata,*loadstart,*lostpointercapture,*mousedown,*mouseenter,*mouseleave,*mousemove,*mouseout,*mouseover,*mouseup,*mousewheel,*pause,*play,*playing,*pointercancel,*pointerdown,*pointerenter,*pointerleave,*pointermove,*pointerout,*pointerover,*pointerup,*progress,*ratechange,*reset,*resize,*scroll,*seeked,*seeking,*select,*show,*stalled,*submit,*suspend,*timeupdate,*toggle,*volumechange,*waiting,outerText,!spellcheck,%style,#tabIndex,title,!translate',\n 'abbr,address,article,aside,b,bdi,bdo,cite,code,dd,dfn,dt,em,figcaption,figure,footer,header,i,kbd,main,mark,nav,noscript,rb,rp,rt,rtc,ruby,s,samp,section,small,strong,sub,sup,u,var,wbr^[HTMLElement]|accessKey,contentEditable,dir,!draggable,!hidden,innerText,lang,*abort,*auxclick,*blur,*cancel,*canplay,*canplaythrough,*change,*click,*close,*contextmenu,*cuechange,*dblclick,*drag,*dragend,*dragenter,*dragleave,*dragover,*dragstart,*drop,*durationchange,*emptied,*ended,*error,*focus,*gotpointercapture,*input,*invalid,*keydown,*keypress,*keyup,*load,*loadeddata,*loadedmetadata,*loadstart,*lostpointercapture,*mousedown,*mouseenter,*mouseleave,*mousemove,*mouseout,*mouseover,*mouseup,*mousewheel,*pause,*play,*playing,*pointercancel,*pointerdown,*pointerenter,*pointerleave,*pointermove,*pointerout,*pointerover,*pointerup,*progress,*ratechange,*reset,*resize,*scroll,*seeked,*seeking,*select,*show,*stalled,*submit,*suspend,*timeupdate,*toggle,*volumechange,*waiting,outerText,!spellcheck,%style,#tabIndex,title,!translate',\n 'media^[HTMLElement]|!autoplay,!controls,%controlsList,%crossOrigin,#currentTime,!defaultMuted,#defaultPlaybackRate,!disableRemotePlayback,!loop,!muted,*encrypted,*waitingforkey,#playbackRate,preload,src,%srcObject,#volume',\n ':svg:^[HTMLElement]|*abort,*auxclick,*blur,*cancel,*canplay,*canplaythrough,*change,*click,*close,*contextmenu,*cuechange,*dblclick,*drag,*dragend,*dragenter,*dragleave,*dragover,*dragstart,*drop,*durationchange,*emptied,*ended,*error,*focus,*gotpointercapture,*input,*invalid,*keydown,*keypress,*keyup,*load,*loadeddata,*loadedmetadata,*loadstart,*lostpointercapture,*mousedown,*mouseenter,*mouseleave,*mousemove,*mouseout,*mouseover,*mouseup,*mousewheel,*pause,*play,*playing,*pointercancel,*pointerdown,*pointerenter,*pointerleave,*pointermove,*pointerout,*pointerover,*pointerup,*progress,*ratechange,*reset,*resize,*scroll,*seeked,*seeking,*select,*show,*stalled,*submit,*suspend,*timeupdate,*toggle,*volumechange,*waiting,%style,#tabIndex',\n ':svg:graphics^:svg:|',\n ':svg:animation^:svg:|*begin,*end,*repeat',\n ':svg:geometry^:svg:|',\n ':svg:componentTransferFunction^:svg:|',\n ':svg:gradient^:svg:|',\n ':svg:textContent^:svg:graphics|',\n ':svg:textPositioning^:svg:textContent|',\n 'a^[HTMLElement]|charset,coords,download,hash,host,hostname,href,hreflang,name,password,pathname,ping,port,protocol,referrerPolicy,rel,rev,search,shape,target,text,type,username',\n 'area^[HTMLElement]|alt,coords,download,hash,host,hostname,href,!noHref,password,pathname,ping,port,protocol,referrerPolicy,rel,search,shape,target,username',\n 'audio^media|',\n 'br^[HTMLElement]|clear',\n 'base^[HTMLElement]|href,target',\n 'body^[HTMLElement]|aLink,background,bgColor,link,*beforeunload,*blur,*error,*focus,*hashchange,*languagechange,*load,*message,*offline,*online,*pagehide,*pageshow,*popstate,*rejectionhandled,*resize,*scroll,*storage,*unhandledrejection,*unload,text,vLink',\n 'button^[HTMLElement]|!autofocus,!disabled,formAction,formEnctype,formMethod,!formNoValidate,formTarget,name,type,value',\n 'canvas^[HTMLElement]|#height,#width',\n 'content^[HTMLElement]|select',\n 'dl^[HTMLElement]|!compact',\n 'datalist^[HTMLElement]|',\n 'details^[HTMLElement]|!open',\n 'dialog^[HTMLElement]|!open,returnValue',\n 'dir^[HTMLElement]|!compact',\n 'div^[HTMLElement]|align',\n 'embed^[HTMLElement]|align,height,name,src,type,width',\n 'fieldset^[HTMLElement]|!disabled,name',\n 'font^[HTMLElement]|color,face,size',\n 'form^[HTMLElement]|acceptCharset,action,autocomplete,encoding,enctype,method,name,!noValidate,target',\n 'frame^[HTMLElement]|frameBorder,longDesc,marginHeight,marginWidth,name,!noResize,scrolling,src',\n 'frameset^[HTMLElement]|cols,*beforeunload,*blur,*error,*focus,*hashchange,*languagechange,*load,*message,*offline,*online,*pagehide,*pageshow,*popstate,*rejectionhandled,*resize,*scroll,*storage,*unhandledrejection,*unload,rows',\n 'hr^[HTMLElement]|align,color,!noShade,size,width',\n 'head^[HTMLElement]|',\n 'h1,h2,h3,h4,h5,h6^[HTMLElement]|align',\n 'html^[HTMLElement]|version',\n 'iframe^[HTMLElement]|align,!allowFullscreen,frameBorder,height,longDesc,marginHeight,marginWidth,name,referrerPolicy,%sandbox,scrolling,src,srcdoc,width',\n 'img^[HTMLElement]|align,alt,border,%crossOrigin,#height,#hspace,!isMap,longDesc,lowsrc,name,referrerPolicy,sizes,src,srcset,useMap,#vspace,#width',\n 'input^[HTMLElement]|accept,align,alt,autocapitalize,autocomplete,!autofocus,!checked,!defaultChecked,defaultValue,dirName,!disabled,%files,formAction,formEnctype,formMethod,!formNoValidate,formTarget,#height,!incremental,!indeterminate,max,#maxLength,min,#minLength,!multiple,name,pattern,placeholder,!readOnly,!required,selectionDirection,#selectionEnd,#selectionStart,#size,src,step,type,useMap,value,%valueAsDate,#valueAsNumber,#width',\n 'li^[HTMLElement]|type,#value',\n 'label^[HTMLElement]|htmlFor',\n 'legend^[HTMLElement]|align',\n 'link^[HTMLElement]|as,charset,%crossOrigin,!disabled,href,hreflang,integrity,media,referrerPolicy,rel,%relList,rev,%sizes,target,type',\n 'map^[HTMLElement]|name',\n 'marquee^[HTMLElement]|behavior,bgColor,direction,height,#hspace,#loop,#scrollAmount,#scrollDelay,!trueSpeed,#vspace,width',\n 'menu^[HTMLElement]|!compact',\n 'meta^[HTMLElement]|content,httpEquiv,name,scheme',\n 'meter^[HTMLElement]|#high,#low,#max,#min,#optimum,#value',\n 'ins,del^[HTMLElement]|cite,dateTime',\n 'ol^[HTMLElement]|!compact,!reversed,#start,type',\n 'object^[HTMLElement]|align,archive,border,code,codeBase,codeType,data,!declare,height,#hspace,name,standby,type,useMap,#vspace,width',\n 'optgroup^[HTMLElement]|!disabled,label',\n 'option^[HTMLElement]|!defaultSelected,!disabled,label,!selected,text,value',\n 'output^[HTMLElement]|defaultValue,%htmlFor,name,value',\n 'p^[HTMLElement]|align',\n 'param^[HTMLElement]|name,type,value,valueType',\n 'picture^[HTMLElement]|',\n 'pre^[HTMLElement]|#width',\n 'progress^[HTMLElement]|#max,#value',\n 'q,blockquote,cite^[HTMLElement]|',\n 'script^[HTMLElement]|!async,charset,%crossOrigin,!defer,event,htmlFor,integrity,src,text,type',\n 'select^[HTMLElement]|autocomplete,!autofocus,!disabled,#length,!multiple,name,!required,#selectedIndex,#size,value',\n 'shadow^[HTMLElement]|',\n 'slot^[HTMLElement]|name',\n 'source^[HTMLElement]|media,sizes,src,srcset,type',\n 'span^[HTMLElement]|',\n 'style^[HTMLElement]|!disabled,media,type',\n 'caption^[HTMLElement]|align',\n 'th,td^[HTMLElement]|abbr,align,axis,bgColor,ch,chOff,#colSpan,headers,height,!noWrap,#rowSpan,scope,vAlign,width',\n 'col,colgroup^[HTMLElement]|align,ch,chOff,#span,vAlign,width',\n 'table^[HTMLElement]|align,bgColor,border,%caption,cellPadding,cellSpacing,frame,rules,summary,%tFoot,%tHead,width',\n 'tr^[HTMLElement]|align,bgColor,ch,chOff,vAlign',\n 'tfoot,thead,tbody^[HTMLElement]|align,ch,chOff,vAlign',\n 'template^[HTMLElement]|',\n 'textarea^[HTMLElement]|autocapitalize,autocomplete,!autofocus,#cols,defaultValue,dirName,!disabled,#maxLength,#minLength,name,placeholder,!readOnly,!required,#rows,selectionDirection,#selectionEnd,#selectionStart,value,wrap',\n 'title^[HTMLElement]|text',\n 'track^[HTMLElement]|!default,kind,label,src,srclang',\n 'ul^[HTMLElement]|!compact,type',\n 'unknown^[HTMLElement]|',\n 'video^media|#height,poster,#width',\n ':svg:a^:svg:graphics|',\n ':svg:animate^:svg:animation|',\n ':svg:animateMotion^:svg:animation|',\n ':svg:animateTransform^:svg:animation|',\n ':svg:circle^:svg:geometry|',\n ':svg:clipPath^:svg:graphics|',\n ':svg:defs^:svg:graphics|',\n ':svg:desc^:svg:|',\n ':svg:discard^:svg:|',\n ':svg:ellipse^:svg:geometry|',\n ':svg:feBlend^:svg:|',\n ':svg:feColorMatrix^:svg:|',\n ':svg:feComponentTransfer^:svg:|',\n ':svg:feComposite^:svg:|',\n ':svg:feConvolveMatrix^:svg:|',\n ':svg:feDiffuseLighting^:svg:|',\n ':svg:feDisplacementMap^:svg:|',\n ':svg:feDistantLight^:svg:|',\n ':svg:feDropShadow^:svg:|',\n ':svg:feFlood^:svg:|',\n ':svg:feFuncA^:svg:componentTransferFunction|',\n ':svg:feFuncB^:svg:componentTransferFunction|',\n ':svg:feFuncG^:svg:componentTransferFunction|',\n ':svg:feFuncR^:svg:componentTransferFunction|',\n ':svg:feGaussianBlur^:svg:|',\n ':svg:feImage^:svg:|',\n ':svg:feMerge^:svg:|',\n ':svg:feMergeNode^:svg:|',\n ':svg:feMorphology^:svg:|',\n ':svg:feOffset^:svg:|',\n ':svg:fePointLight^:svg:|',\n ':svg:feSpecularLighting^:svg:|',\n ':svg:feSpotLight^:svg:|',\n ':svg:feTile^:svg:|',\n ':svg:feTurbulence^:svg:|',\n ':svg:filter^:svg:|',\n ':svg:foreignObject^:svg:graphics|',\n ':svg:g^:svg:graphics|',\n ':svg:image^:svg:graphics|',\n ':svg:line^:svg:geometry|',\n ':svg:linearGradient^:svg:gradient|',\n ':svg:mpath^:svg:|',\n ':svg:marker^:svg:|',\n ':svg:mask^:svg:|',\n ':svg:metadata^:svg:|',\n ':svg:path^:svg:geometry|',\n ':svg:pattern^:svg:|',\n ':svg:polygon^:svg:geometry|',\n ':svg:polyline^:svg:geometry|',\n ':svg:radialGradient^:svg:gradient|',\n ':svg:rect^:svg:geometry|',\n ':svg:svg^:svg:graphics|#currentScale,#zoomAndPan',\n ':svg:script^:svg:|type',\n ':svg:set^:svg:animation|',\n ':svg:stop^:svg:|',\n ':svg:style^:svg:|!disabled,media,title,type',\n ':svg:switch^:svg:graphics|',\n ':svg:symbol^:svg:|',\n ':svg:tspan^:svg:textPositioning|',\n ':svg:text^:svg:textPositioning|',\n ':svg:textPath^:svg:textContent|',\n ':svg:title^:svg:|',\n ':svg:use^:svg:graphics|',\n ':svg:view^:svg:|#zoomAndPan',\n 'data^[HTMLElement]|value',\n 'keygen^[HTMLElement]|!autofocus,challenge,!disabled,form,keytype,name',\n 'menuitem^[HTMLElement]|type,label,icon,!disabled,!checked,radiogroup,!default',\n 'summary^[HTMLElement]|',\n 'time^[HTMLElement]|dateTime',\n ':svg:cursor^:svg:|',\n];\nconst _ATTR_TO_PROP = new Map(Object.entries({\n 'class': 'className',\n 'for': 'htmlFor',\n 'formaction': 'formAction',\n 'innerHtml': 'innerHTML',\n 'readonly': 'readOnly',\n 'tabindex': 'tabIndex',\n}));\n// Invert _ATTR_TO_PROP.\nconst _PROP_TO_ATTR = Array.from(_ATTR_TO_PROP).reduce((inverted, [propertyName, attributeName]) => {\n inverted.set(propertyName, attributeName);\n return inverted;\n}, new Map());\nclass DomElementSchemaRegistry extends ElementSchemaRegistry {\n constructor() {\n super();\n this._schema = new Map();\n // We don't allow binding to events for security reasons. Allowing event bindings would almost\n // certainly introduce bad XSS vulnerabilities. Instead, we store events in a separate schema.\n this._eventSchema = new Map;\n SCHEMA.forEach(encodedType => {\n const type = new Map();\n const events = new Set();\n const [strType, strProperties] = encodedType.split('|');\n const properties = strProperties.split(',');\n const [typeNames, superName] = strType.split('^');\n typeNames.split(',').forEach(tag => {\n this._schema.set(tag.toLowerCase(), type);\n this._eventSchema.set(tag.toLowerCase(), events);\n });\n const superType = superName && this._schema.get(superName.toLowerCase());\n if (superType) {\n for (const [prop, value] of superType) {\n type.set(prop, value);\n }\n for (const superEvent of this._eventSchema.get(superName.toLowerCase())) {\n events.add(superEvent);\n }\n }\n properties.forEach((property) => {\n if (property.length > 0) {\n switch (property[0]) {\n case '*':\n events.add(property.substring(1));\n break;\n case '!':\n type.set(property.substring(1), BOOLEAN);\n break;\n case '#':\n type.set(property.substring(1), NUMBER);\n break;\n case '%':\n type.set(property.substring(1), OBJECT);\n break;\n default:\n type.set(property, STRING);\n }\n }\n });\n });\n }\n hasProperty(tagName, propName, schemaMetas) {\n if (schemaMetas.some((schema) => schema.name === NO_ERRORS_SCHEMA.name)) {\n return true;\n }\n if (tagName.indexOf('-') > -1) {\n if (isNgContainer(tagName) || isNgContent(tagName)) {\n return false;\n }\n if (schemaMetas.some((schema) => schema.name === CUSTOM_ELEMENTS_SCHEMA.name)) {\n // Can't tell now as we don't know which properties a custom element will get\n // once it is instantiated\n return true;\n }\n }\n const elementProperties = this._schema.get(tagName.toLowerCase()) || this._schema.get('unknown');\n return elementProperties.has(propName);\n }\n hasElement(tagName, schemaMetas) {\n if (schemaMetas.some((schema) => schema.name === NO_ERRORS_SCHEMA.name)) {\n return true;\n }\n if (tagName.indexOf('-') > -1) {\n if (isNgContainer(tagName) || isNgContent(tagName)) {\n return true;\n }\n if (schemaMetas.some((schema) => schema.name === CUSTOM_ELEMENTS_SCHEMA.name)) {\n // Allow any custom elements\n return true;\n }\n }\n return this._schema.has(tagName.toLowerCase());\n }\n /**\n * securityContext returns the security context for the given property on the given DOM tag.\n *\n * Tag and property name are statically known and cannot change at runtime, i.e. it is not\n * possible to bind a value into a changing attribute or tag name.\n *\n * The filtering is based on a list of allowed tags|attributes. All attributes in the schema\n * above are assumed to have the 'NONE' security context, i.e. that they are safe inert\n * string values. Only specific well known attack vectors are assigned their appropriate context.\n */\n securityContext(tagName, propName, isAttribute) {\n if (isAttribute) {\n // NB: For security purposes, use the mapped property name, not the attribute name.\n propName = this.getMappedPropName(propName);\n }\n // Make sure comparisons are case insensitive, so that case differences between attribute and\n // property names do not have a security impact.\n tagName = tagName.toLowerCase();\n propName = propName.toLowerCase();\n let ctx = SECURITY_SCHEMA()[tagName + '|' + propName];\n if (ctx) {\n return ctx;\n }\n ctx = SECURITY_SCHEMA()['*|' + propName];\n return ctx ? ctx : SecurityContext.NONE;\n }\n getMappedPropName(propName) {\n var _a;\n return (_a = _ATTR_TO_PROP.get(propName)) !== null && _a !== void 0 ? _a : propName;\n }\n getDefaultComponentElementName() {\n return 'ng-component';\n }\n validateProperty(name) {\n if (name.toLowerCase().startsWith('on')) {\n const msg = `Binding to event property '${name}' is disallowed for security reasons, ` +\n `please use (${name.slice(2)})=...` +\n `\\nIf '${name}' is a directive input, make sure the directive is imported by the` +\n ` current module.`;\n return { error: true, msg: msg };\n }\n else {\n return { error: false };\n }\n }\n validateAttribute(name) {\n if (name.toLowerCase().startsWith('on')) {\n const msg = `Binding to event attribute '${name}' is disallowed for security reasons, ` +\n `please use (${name.slice(2)})=...`;\n return { error: true, msg: msg };\n }\n else {\n return { error: false };\n }\n }\n allKnownElementNames() {\n return Array.from(this._schema.keys());\n }\n allKnownAttributesOfElement(tagName) {\n const elementProperties = this._schema.get(tagName.toLowerCase()) || this._schema.get('unknown');\n // Convert properties to attributes.\n return Array.from(elementProperties.keys()).map(prop => { var _a; return (_a = _PROP_TO_ATTR.get(prop)) !== null && _a !== void 0 ? _a : prop; });\n }\n allKnownEventsOfElement(tagName) {\n var _a;\n return Array.from((_a = this._eventSchema.get(tagName.toLowerCase())) !== null && _a !== void 0 ? _a : []);\n }\n normalizeAnimationStyleProperty(propName) {\n return dashCaseToCamelCase(propName);\n }\n normalizeAnimationStyleValue(camelCaseProp, userProvidedProp, val) {\n let unit = '';\n const strVal = val.toString().trim();\n let errorMsg = null;\n if (_isPixelDimensionStyle(camelCaseProp) && val !== 0 && val !== '0') {\n if (typeof val === 'number') {\n unit = 'px';\n }\n else {\n const valAndSuffixMatch = val.match(/^[+-]?[\\d\\.]+([a-z]*)$/);\n if (valAndSuffixMatch && valAndSuffixMatch[1].length == 0) {\n errorMsg = `Please provide a CSS unit value for ${userProvidedProp}:${val}`;\n }\n }\n }\n return { error: errorMsg, value: strVal + unit };\n }\n}\nfunction _isPixelDimensionStyle(prop) {\n switch (prop) {\n case 'width':\n case 'height':\n case 'minWidth':\n case 'minHeight':\n case 'maxWidth':\n case 'maxHeight':\n case 'left':\n case 'top':\n case 'bottom':\n case 'right':\n case 'fontSize':\n case 'outlineWidth':\n case 'outlineOffset':\n case 'paddingTop':\n case 'paddingLeft':\n case 'paddingBottom':\n case 'paddingRight':\n case 'marginTop':\n case 'marginLeft':\n case 'marginBottom':\n case 'marginRight':\n case 'borderRadius':\n case 'borderWidth':\n case 'borderTopWidth':\n case 'borderLeftWidth':\n case 'borderRightWidth':\n case 'borderBottomWidth':\n case 'textIndent':\n return true;\n default:\n return false;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Set of tagName|propertyName corresponding to Trusted Types sinks. Properties applying to all\n * tags use '*'.\n *\n * Extracted from, and should be kept in sync with\n * https://w3c.github.io/webappsec-trusted-types/dist/spec/#integrations\n */\nconst TRUSTED_TYPES_SINKS = new Set([\n // NOTE: All strings in this set *must* be lowercase!\n // TrustedHTML\n 'iframe|srcdoc',\n '*|innerhtml',\n '*|outerhtml',\n // NB: no TrustedScript here, as the corresponding tags are stripped by the compiler.\n // TrustedScriptURL\n 'embed|src',\n 'object|codebase',\n 'object|data',\n]);\n/**\n * isTrustedTypesSink returns true if the given property on the given DOM tag is a Trusted Types\n * sink. In that case, use `ElementSchemaRegistry.securityContext` to determine which particular\n * Trusted Type is required for values passed to the sink:\n * - SecurityContext.HTML corresponds to TrustedHTML\n * - SecurityContext.RESOURCE_URL corresponds to TrustedScriptURL\n */\nfunction isTrustedTypesSink(tagName, propName) {\n // Make sure comparisons are case insensitive, so that case differences between attribute and\n // property names do not have a security impact.\n tagName = tagName.toLowerCase();\n propName = propName.toLowerCase();\n return TRUSTED_TYPES_SINKS.has(tagName + '|' + propName) ||\n TRUSTED_TYPES_SINKS.has('*|' + propName);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst PROPERTY_PARTS_SEPARATOR = '.';\nconst ATTRIBUTE_PREFIX = 'attr';\nconst CLASS_PREFIX = 'class';\nconst STYLE_PREFIX = 'style';\nconst TEMPLATE_ATTR_PREFIX$1 = '*';\nconst ANIMATE_PROP_PREFIX = 'animate-';\n/**\n * Parses bindings in templates and in the directive host area.\n */\nclass BindingParser {\n constructor(_exprParser, _interpolationConfig, _schemaRegistry, errors) {\n this._exprParser = _exprParser;\n this._interpolationConfig = _interpolationConfig;\n this._schemaRegistry = _schemaRegistry;\n this.errors = errors;\n }\n get interpolationConfig() {\n return this._interpolationConfig;\n }\n createBoundHostProperties(properties, sourceSpan) {\n const boundProps = [];\n for (const propName of Object.keys(properties)) {\n const expression = properties[propName];\n if (typeof expression === 'string') {\n this.parsePropertyBinding(propName, expression, true, sourceSpan, sourceSpan.start.offset, undefined, [], \n // Use the `sourceSpan` for `keySpan`. This isn't really accurate, but neither is the\n // sourceSpan, as it represents the sourceSpan of the host itself rather than the\n // source of the host binding (which doesn't exist in the template). Regardless,\n // neither of these values are used in Ivy but are only here to satisfy the function\n // signature. This should likely be refactored in the future so that `sourceSpan`\n // isn't being used inaccurately.\n boundProps, sourceSpan);\n }\n else {\n this._reportError(`Value of the host property binding \"${propName}\" needs to be a string representing an expression but got \"${expression}\" (${typeof expression})`, sourceSpan);\n }\n }\n return boundProps;\n }\n createDirectiveHostEventAsts(hostListeners, sourceSpan) {\n const targetEvents = [];\n for (const propName of Object.keys(hostListeners)) {\n const expression = hostListeners[propName];\n if (typeof expression === 'string') {\n // Use the `sourceSpan` for `keySpan` and `handlerSpan`. This isn't really accurate, but\n // neither is the `sourceSpan`, as it represents the `sourceSpan` of the host itself\n // rather than the source of the host binding (which doesn't exist in the template).\n // Regardless, neither of these values are used in Ivy but are only here to satisfy the\n // function signature. This should likely be refactored in the future so that `sourceSpan`\n // isn't being used inaccurately.\n this.parseEvent(propName, expression, /* isAssignmentEvent */ false, sourceSpan, sourceSpan, [], targetEvents, sourceSpan);\n }\n else {\n this._reportError(`Value of the host listener \"${propName}\" needs to be a string representing an expression but got \"${expression}\" (${typeof expression})`, sourceSpan);\n }\n }\n return targetEvents;\n }\n parseInterpolation(value, sourceSpan, interpolatedTokens) {\n const sourceInfo = sourceSpan.start.toString();\n const absoluteOffset = sourceSpan.fullStart.offset;\n try {\n const ast = this._exprParser.parseInterpolation(value, sourceInfo, absoluteOffset, interpolatedTokens, this._interpolationConfig);\n if (ast)\n this._reportExpressionParserErrors(ast.errors, sourceSpan);\n return ast;\n }\n catch (e) {\n this._reportError(`${e}`, sourceSpan);\n return this._exprParser.wrapLiteralPrimitive('ERROR', sourceInfo, absoluteOffset);\n }\n }\n /**\n * Similar to `parseInterpolation`, but treats the provided string as a single expression\n * element that would normally appear within the interpolation prefix and suffix (`{{` and `}}`).\n * This is used for parsing the switch expression in ICUs.\n */\n parseInterpolationExpression(expression, sourceSpan) {\n const sourceInfo = sourceSpan.start.toString();\n const absoluteOffset = sourceSpan.start.offset;\n try {\n const ast = this._exprParser.parseInterpolationExpression(expression, sourceInfo, absoluteOffset);\n if (ast)\n this._reportExpressionParserErrors(ast.errors, sourceSpan);\n return ast;\n }\n catch (e) {\n this._reportError(`${e}`, sourceSpan);\n return this._exprParser.wrapLiteralPrimitive('ERROR', sourceInfo, absoluteOffset);\n }\n }\n /**\n * Parses the bindings in a microsyntax expression, and converts them to\n * `ParsedProperty` or `ParsedVariable`.\n *\n * @param tplKey template binding name\n * @param tplValue template binding value\n * @param sourceSpan span of template binding relative to entire the template\n * @param absoluteValueOffset start of the tplValue relative to the entire template\n * @param targetMatchableAttrs potential attributes to match in the template\n * @param targetProps target property bindings in the template\n * @param targetVars target variables in the template\n */\n parseInlineTemplateBinding(tplKey, tplValue, sourceSpan, absoluteValueOffset, targetMatchableAttrs, targetProps, targetVars, isIvyAst) {\n const absoluteKeyOffset = sourceSpan.start.offset + TEMPLATE_ATTR_PREFIX$1.length;\n const bindings = this._parseTemplateBindings(tplKey, tplValue, sourceSpan, absoluteKeyOffset, absoluteValueOffset);\n for (const binding of bindings) {\n // sourceSpan is for the entire HTML attribute. bindingSpan is for a particular\n // binding within the microsyntax expression so it's more narrow than sourceSpan.\n const bindingSpan = moveParseSourceSpan(sourceSpan, binding.sourceSpan);\n const key = binding.key.source;\n const keySpan = moveParseSourceSpan(sourceSpan, binding.key.span);\n if (binding instanceof VariableBinding) {\n const value = binding.value ? binding.value.source : '$implicit';\n const valueSpan = binding.value ? moveParseSourceSpan(sourceSpan, binding.value.span) : undefined;\n targetVars.push(new ParsedVariable(key, value, bindingSpan, keySpan, valueSpan));\n }\n else if (binding.value) {\n const srcSpan = isIvyAst ? bindingSpan : sourceSpan;\n const valueSpan = moveParseSourceSpan(sourceSpan, binding.value.ast.sourceSpan);\n this._parsePropertyAst(key, binding.value, srcSpan, keySpan, valueSpan, targetMatchableAttrs, targetProps);\n }\n else {\n targetMatchableAttrs.push([key, '' /* value */]);\n // Since this is a literal attribute with no RHS, source span should be\n // just the key span.\n this.parseLiteralAttr(key, null /* value */, keySpan, absoluteValueOffset, undefined /* valueSpan */, targetMatchableAttrs, targetProps, keySpan);\n }\n }\n }\n /**\n * Parses the bindings in a microsyntax expression, e.g.\n * ```\n * \n * ```\n *\n * @param tplKey template binding name\n * @param tplValue template binding value\n * @param sourceSpan span of template binding relative to entire the template\n * @param absoluteKeyOffset start of the `tplKey`\n * @param absoluteValueOffset start of the `tplValue`\n */\n _parseTemplateBindings(tplKey, tplValue, sourceSpan, absoluteKeyOffset, absoluteValueOffset) {\n const sourceInfo = sourceSpan.start.toString();\n try {\n const bindingsResult = this._exprParser.parseTemplateBindings(tplKey, tplValue, sourceInfo, absoluteKeyOffset, absoluteValueOffset);\n this._reportExpressionParserErrors(bindingsResult.errors, sourceSpan);\n bindingsResult.warnings.forEach((warning) => {\n this._reportError(warning, sourceSpan, ParseErrorLevel.WARNING);\n });\n return bindingsResult.templateBindings;\n }\n catch (e) {\n this._reportError(`${e}`, sourceSpan);\n return [];\n }\n }\n parseLiteralAttr(name, value, sourceSpan, absoluteOffset, valueSpan, targetMatchableAttrs, targetProps, keySpan) {\n if (isAnimationLabel(name)) {\n name = name.substring(1);\n if (keySpan !== undefined) {\n keySpan = moveParseSourceSpan(keySpan, new AbsoluteSourceSpan(keySpan.start.offset + 1, keySpan.end.offset));\n }\n if (value) {\n this._reportError(`Assigning animation triggers via @prop=\"exp\" attributes with an expression is invalid.` +\n ` Use property bindings (e.g. [@prop]=\"exp\") or use an attribute without a value (e.g. @prop) instead.`, sourceSpan, ParseErrorLevel.ERROR);\n }\n this._parseAnimation(name, value, sourceSpan, absoluteOffset, keySpan, valueSpan, targetMatchableAttrs, targetProps);\n }\n else {\n targetProps.push(new ParsedProperty(name, this._exprParser.wrapLiteralPrimitive(value, '', absoluteOffset), ParsedPropertyType.LITERAL_ATTR, sourceSpan, keySpan, valueSpan));\n }\n }\n parsePropertyBinding(name, expression, isHost, sourceSpan, absoluteOffset, valueSpan, targetMatchableAttrs, targetProps, keySpan) {\n if (name.length === 0) {\n this._reportError(`Property name is missing in binding`, sourceSpan);\n }\n let isAnimationProp = false;\n if (name.startsWith(ANIMATE_PROP_PREFIX)) {\n isAnimationProp = true;\n name = name.substring(ANIMATE_PROP_PREFIX.length);\n if (keySpan !== undefined) {\n keySpan = moveParseSourceSpan(keySpan, new AbsoluteSourceSpan(keySpan.start.offset + ANIMATE_PROP_PREFIX.length, keySpan.end.offset));\n }\n }\n else if (isAnimationLabel(name)) {\n isAnimationProp = true;\n name = name.substring(1);\n if (keySpan !== undefined) {\n keySpan = moveParseSourceSpan(keySpan, new AbsoluteSourceSpan(keySpan.start.offset + 1, keySpan.end.offset));\n }\n }\n if (isAnimationProp) {\n this._parseAnimation(name, expression, sourceSpan, absoluteOffset, keySpan, valueSpan, targetMatchableAttrs, targetProps);\n }\n else {\n this._parsePropertyAst(name, this._parseBinding(expression, isHost, valueSpan || sourceSpan, absoluteOffset), sourceSpan, keySpan, valueSpan, targetMatchableAttrs, targetProps);\n }\n }\n parsePropertyInterpolation(name, value, sourceSpan, valueSpan, targetMatchableAttrs, targetProps, keySpan, interpolatedTokens) {\n const expr = this.parseInterpolation(value, valueSpan || sourceSpan, interpolatedTokens);\n if (expr) {\n this._parsePropertyAst(name, expr, sourceSpan, keySpan, valueSpan, targetMatchableAttrs, targetProps);\n return true;\n }\n return false;\n }\n _parsePropertyAst(name, ast, sourceSpan, keySpan, valueSpan, targetMatchableAttrs, targetProps) {\n targetMatchableAttrs.push([name, ast.source]);\n targetProps.push(new ParsedProperty(name, ast, ParsedPropertyType.DEFAULT, sourceSpan, keySpan, valueSpan));\n }\n _parseAnimation(name, expression, sourceSpan, absoluteOffset, keySpan, valueSpan, targetMatchableAttrs, targetProps) {\n if (name.length === 0) {\n this._reportError('Animation trigger is missing', sourceSpan);\n }\n // This will occur when a @trigger is not paired with an expression.\n // For animations it is valid to not have an expression since */void\n // states will be applied by angular when the element is attached/detached\n const ast = this._parseBinding(expression || 'undefined', false, valueSpan || sourceSpan, absoluteOffset);\n targetMatchableAttrs.push([name, ast.source]);\n targetProps.push(new ParsedProperty(name, ast, ParsedPropertyType.ANIMATION, sourceSpan, keySpan, valueSpan));\n }\n _parseBinding(value, isHostBinding, sourceSpan, absoluteOffset) {\n const sourceInfo = (sourceSpan && sourceSpan.start || '(unknown)').toString();\n try {\n const ast = isHostBinding ?\n this._exprParser.parseSimpleBinding(value, sourceInfo, absoluteOffset, this._interpolationConfig) :\n this._exprParser.parseBinding(value, sourceInfo, absoluteOffset, this._interpolationConfig);\n if (ast)\n this._reportExpressionParserErrors(ast.errors, sourceSpan);\n return ast;\n }\n catch (e) {\n this._reportError(`${e}`, sourceSpan);\n return this._exprParser.wrapLiteralPrimitive('ERROR', sourceInfo, absoluteOffset);\n }\n }\n createBoundElementProperty(elementSelector, boundProp, skipValidation = false, mapPropertyName = true) {\n if (boundProp.isAnimation) {\n return new BoundElementProperty(boundProp.name, 4 /* BindingType.Animation */, SecurityContext.NONE, boundProp.expression, null, boundProp.sourceSpan, boundProp.keySpan, boundProp.valueSpan);\n }\n let unit = null;\n let bindingType = undefined;\n let boundPropertyName = null;\n const parts = boundProp.name.split(PROPERTY_PARTS_SEPARATOR);\n let securityContexts = undefined;\n // Check for special cases (prefix style, attr, class)\n if (parts.length > 1) {\n if (parts[0] == ATTRIBUTE_PREFIX) {\n boundPropertyName = parts.slice(1).join(PROPERTY_PARTS_SEPARATOR);\n if (!skipValidation) {\n this._validatePropertyOrAttributeName(boundPropertyName, boundProp.sourceSpan, true);\n }\n securityContexts = calcPossibleSecurityContexts(this._schemaRegistry, elementSelector, boundPropertyName, true);\n const nsSeparatorIdx = boundPropertyName.indexOf(':');\n if (nsSeparatorIdx > -1) {\n const ns = boundPropertyName.substring(0, nsSeparatorIdx);\n const name = boundPropertyName.substring(nsSeparatorIdx + 1);\n boundPropertyName = mergeNsAndName(ns, name);\n }\n bindingType = 1 /* BindingType.Attribute */;\n }\n else if (parts[0] == CLASS_PREFIX) {\n boundPropertyName = parts[1];\n bindingType = 2 /* BindingType.Class */;\n securityContexts = [SecurityContext.NONE];\n }\n else if (parts[0] == STYLE_PREFIX) {\n unit = parts.length > 2 ? parts[2] : null;\n boundPropertyName = parts[1];\n bindingType = 3 /* BindingType.Style */;\n securityContexts = [SecurityContext.STYLE];\n }\n }\n // If not a special case, use the full property name\n if (boundPropertyName === null) {\n const mappedPropName = this._schemaRegistry.getMappedPropName(boundProp.name);\n boundPropertyName = mapPropertyName ? mappedPropName : boundProp.name;\n securityContexts = calcPossibleSecurityContexts(this._schemaRegistry, elementSelector, mappedPropName, false);\n bindingType = 0 /* BindingType.Property */;\n if (!skipValidation) {\n this._validatePropertyOrAttributeName(mappedPropName, boundProp.sourceSpan, false);\n }\n }\n return new BoundElementProperty(boundPropertyName, bindingType, securityContexts[0], boundProp.expression, unit, boundProp.sourceSpan, boundProp.keySpan, boundProp.valueSpan);\n }\n // TODO: keySpan should be required but was made optional to avoid changing VE parser.\n parseEvent(name, expression, isAssignmentEvent, sourceSpan, handlerSpan, targetMatchableAttrs, targetEvents, keySpan) {\n if (name.length === 0) {\n this._reportError(`Event name is missing in binding`, sourceSpan);\n }\n if (isAnimationLabel(name)) {\n name = name.slice(1);\n if (keySpan !== undefined) {\n keySpan = moveParseSourceSpan(keySpan, new AbsoluteSourceSpan(keySpan.start.offset + 1, keySpan.end.offset));\n }\n this._parseAnimationEvent(name, expression, isAssignmentEvent, sourceSpan, handlerSpan, targetEvents, keySpan);\n }\n else {\n this._parseRegularEvent(name, expression, isAssignmentEvent, sourceSpan, handlerSpan, targetMatchableAttrs, targetEvents, keySpan);\n }\n }\n calcPossibleSecurityContexts(selector, propName, isAttribute) {\n const prop = this._schemaRegistry.getMappedPropName(propName);\n return calcPossibleSecurityContexts(this._schemaRegistry, selector, prop, isAttribute);\n }\n _parseAnimationEvent(name, expression, isAssignmentEvent, sourceSpan, handlerSpan, targetEvents, keySpan) {\n const matches = splitAtPeriod(name, [name, '']);\n const eventName = matches[0];\n const phase = matches[1].toLowerCase();\n const ast = this._parseAction(expression, isAssignmentEvent, handlerSpan);\n targetEvents.push(new ParsedEvent(eventName, phase, 1 /* ParsedEventType.Animation */, ast, sourceSpan, handlerSpan, keySpan));\n if (eventName.length === 0) {\n this._reportError(`Animation event name is missing in binding`, sourceSpan);\n }\n if (phase) {\n if (phase !== 'start' && phase !== 'done') {\n this._reportError(`The provided animation output phase value \"${phase}\" for \"@${eventName}\" is not supported (use start or done)`, sourceSpan);\n }\n }\n else {\n this._reportError(`The animation trigger output event (@${eventName}) is missing its phase value name (start or done are currently supported)`, sourceSpan);\n }\n }\n _parseRegularEvent(name, expression, isAssignmentEvent, sourceSpan, handlerSpan, targetMatchableAttrs, targetEvents, keySpan) {\n // long format: 'target: eventName'\n const [target, eventName] = splitAtColon(name, [null, name]);\n const ast = this._parseAction(expression, isAssignmentEvent, handlerSpan);\n targetMatchableAttrs.push([name, ast.source]);\n targetEvents.push(new ParsedEvent(eventName, target, 0 /* ParsedEventType.Regular */, ast, sourceSpan, handlerSpan, keySpan));\n // Don't detect directives for event names for now,\n // so don't add the event name to the matchableAttrs\n }\n _parseAction(value, isAssignmentEvent, sourceSpan) {\n const sourceInfo = (sourceSpan && sourceSpan.start || '(unknown').toString();\n const absoluteOffset = (sourceSpan && sourceSpan.start) ? sourceSpan.start.offset : 0;\n try {\n const ast = this._exprParser.parseAction(value, isAssignmentEvent, sourceInfo, absoluteOffset, this._interpolationConfig);\n if (ast) {\n this._reportExpressionParserErrors(ast.errors, sourceSpan);\n }\n if (!ast || ast.ast instanceof EmptyExpr) {\n this._reportError(`Empty expressions are not allowed`, sourceSpan);\n return this._exprParser.wrapLiteralPrimitive('ERROR', sourceInfo, absoluteOffset);\n }\n return ast;\n }\n catch (e) {\n this._reportError(`${e}`, sourceSpan);\n return this._exprParser.wrapLiteralPrimitive('ERROR', sourceInfo, absoluteOffset);\n }\n }\n _reportError(message, sourceSpan, level = ParseErrorLevel.ERROR) {\n this.errors.push(new ParseError(sourceSpan, message, level));\n }\n _reportExpressionParserErrors(errors, sourceSpan) {\n for (const error of errors) {\n this._reportError(error.message, sourceSpan);\n }\n }\n /**\n * @param propName the name of the property / attribute\n * @param sourceSpan\n * @param isAttr true when binding to an attribute\n */\n _validatePropertyOrAttributeName(propName, sourceSpan, isAttr) {\n const report = isAttr ? this._schemaRegistry.validateAttribute(propName) :\n this._schemaRegistry.validateProperty(propName);\n if (report.error) {\n this._reportError(report.msg, sourceSpan, ParseErrorLevel.ERROR);\n }\n }\n}\nclass PipeCollector extends RecursiveAstVisitor {\n constructor() {\n super(...arguments);\n this.pipes = new Map();\n }\n visitPipe(ast, context) {\n this.pipes.set(ast.name, ast);\n ast.exp.visit(this);\n this.visitAll(ast.args, context);\n return null;\n }\n}\nfunction isAnimationLabel(name) {\n return name[0] == '@';\n}\nfunction calcPossibleSecurityContexts(registry, selector, propName, isAttribute) {\n const ctxs = [];\n CssSelector.parse(selector).forEach((selector) => {\n const elementNames = selector.element ? [selector.element] : registry.allKnownElementNames();\n const notElementNames = new Set(selector.notSelectors.filter(selector => selector.isElementSelector())\n .map((selector) => selector.element));\n const possibleElementNames = elementNames.filter(elementName => !notElementNames.has(elementName));\n ctxs.push(...possibleElementNames.map(elementName => registry.securityContext(elementName, propName, isAttribute)));\n });\n return ctxs.length === 0 ? [SecurityContext.NONE] : Array.from(new Set(ctxs)).sort();\n}\n/**\n * Compute a new ParseSourceSpan based off an original `sourceSpan` by using\n * absolute offsets from the specified `absoluteSpan`.\n *\n * @param sourceSpan original source span\n * @param absoluteSpan absolute source span to move to\n */\nfunction moveParseSourceSpan(sourceSpan, absoluteSpan) {\n // The difference of two absolute offsets provide the relative offset\n const startDiff = absoluteSpan.start - sourceSpan.start.offset;\n const endDiff = absoluteSpan.end - sourceSpan.end.offset;\n return new ParseSourceSpan(sourceSpan.start.moveBy(startDiff), sourceSpan.end.moveBy(endDiff), sourceSpan.fullStart.moveBy(startDiff), sourceSpan.details);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Some of the code comes from WebComponents.JS\n// https://github.com/webcomponents/webcomponentsjs/blob/master/src/HTMLImports/path.js\nfunction isStyleUrlResolvable(url) {\n if (url == null || url.length === 0 || url[0] == '/')\n return false;\n const schemeMatch = url.match(URL_WITH_SCHEMA_REGEXP);\n return schemeMatch === null || schemeMatch[1] == 'package' || schemeMatch[1] == 'asset';\n}\nconst URL_WITH_SCHEMA_REGEXP = /^([^:/?#]+):/;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst NG_CONTENT_SELECT_ATTR$1 = 'select';\nconst LINK_ELEMENT = 'link';\nconst LINK_STYLE_REL_ATTR = 'rel';\nconst LINK_STYLE_HREF_ATTR = 'href';\nconst LINK_STYLE_REL_VALUE = 'stylesheet';\nconst STYLE_ELEMENT = 'style';\nconst SCRIPT_ELEMENT = 'script';\nconst NG_NON_BINDABLE_ATTR = 'ngNonBindable';\nconst NG_PROJECT_AS = 'ngProjectAs';\nfunction preparseElement(ast) {\n let selectAttr = null;\n let hrefAttr = null;\n let relAttr = null;\n let nonBindable = false;\n let projectAs = '';\n ast.attrs.forEach(attr => {\n const lcAttrName = attr.name.toLowerCase();\n if (lcAttrName == NG_CONTENT_SELECT_ATTR$1) {\n selectAttr = attr.value;\n }\n else if (lcAttrName == LINK_STYLE_HREF_ATTR) {\n hrefAttr = attr.value;\n }\n else if (lcAttrName == LINK_STYLE_REL_ATTR) {\n relAttr = attr.value;\n }\n else if (attr.name == NG_NON_BINDABLE_ATTR) {\n nonBindable = true;\n }\n else if (attr.name == NG_PROJECT_AS) {\n if (attr.value.length > 0) {\n projectAs = attr.value;\n }\n }\n });\n selectAttr = normalizeNgContentSelect(selectAttr);\n const nodeName = ast.name.toLowerCase();\n let type = PreparsedElementType.OTHER;\n if (isNgContent(nodeName)) {\n type = PreparsedElementType.NG_CONTENT;\n }\n else if (nodeName == STYLE_ELEMENT) {\n type = PreparsedElementType.STYLE;\n }\n else if (nodeName == SCRIPT_ELEMENT) {\n type = PreparsedElementType.SCRIPT;\n }\n else if (nodeName == LINK_ELEMENT && relAttr == LINK_STYLE_REL_VALUE) {\n type = PreparsedElementType.STYLESHEET;\n }\n return new PreparsedElement(type, selectAttr, hrefAttr, nonBindable, projectAs);\n}\nvar PreparsedElementType;\n(function (PreparsedElementType) {\n PreparsedElementType[PreparsedElementType[\"NG_CONTENT\"] = 0] = \"NG_CONTENT\";\n PreparsedElementType[PreparsedElementType[\"STYLE\"] = 1] = \"STYLE\";\n PreparsedElementType[PreparsedElementType[\"STYLESHEET\"] = 2] = \"STYLESHEET\";\n PreparsedElementType[PreparsedElementType[\"SCRIPT\"] = 3] = \"SCRIPT\";\n PreparsedElementType[PreparsedElementType[\"OTHER\"] = 4] = \"OTHER\";\n})(PreparsedElementType || (PreparsedElementType = {}));\nclass PreparsedElement {\n constructor(type, selectAttr, hrefAttr, nonBindable, projectAs) {\n this.type = type;\n this.selectAttr = selectAttr;\n this.hrefAttr = hrefAttr;\n this.nonBindable = nonBindable;\n this.projectAs = projectAs;\n }\n}\nfunction normalizeNgContentSelect(selectAttr) {\n if (selectAttr === null || selectAttr.length === 0) {\n return '*';\n }\n return selectAttr;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst BIND_NAME_REGEXP = /^(?:(bind-)|(let-)|(ref-|#)|(on-)|(bindon-)|(@))(.*)$/;\n// Group 1 = \"bind-\"\nconst KW_BIND_IDX = 1;\n// Group 2 = \"let-\"\nconst KW_LET_IDX = 2;\n// Group 3 = \"ref-/#\"\nconst KW_REF_IDX = 3;\n// Group 4 = \"on-\"\nconst KW_ON_IDX = 4;\n// Group 5 = \"bindon-\"\nconst KW_BINDON_IDX = 5;\n// Group 6 = \"@\"\nconst KW_AT_IDX = 6;\n// Group 7 = the identifier after \"bind-\", \"let-\", \"ref-/#\", \"on-\", \"bindon-\" or \"@\"\nconst IDENT_KW_IDX = 7;\nconst BINDING_DELIMS = {\n BANANA_BOX: { start: '[(', end: ')]' },\n PROPERTY: { start: '[', end: ']' },\n EVENT: { start: '(', end: ')' },\n};\nconst TEMPLATE_ATTR_PREFIX = '*';\nfunction htmlAstToRender3Ast(htmlNodes, bindingParser, options) {\n const transformer = new HtmlAstToIvyAst(bindingParser, options);\n const ivyNodes = visitAll(transformer, htmlNodes);\n // Errors might originate in either the binding parser or the html to ivy transformer\n const allErrors = bindingParser.errors.concat(transformer.errors);\n const result = {\n nodes: ivyNodes,\n errors: allErrors,\n styleUrls: transformer.styleUrls,\n styles: transformer.styles,\n ngContentSelectors: transformer.ngContentSelectors\n };\n if (options.collectCommentNodes) {\n result.commentNodes = transformer.commentNodes;\n }\n return result;\n}\nclass HtmlAstToIvyAst {\n constructor(bindingParser, options) {\n this.bindingParser = bindingParser;\n this.options = options;\n this.errors = [];\n this.styles = [];\n this.styleUrls = [];\n this.ngContentSelectors = [];\n // This array will be populated if `Render3ParseOptions['collectCommentNodes']` is true\n this.commentNodes = [];\n this.inI18nBlock = false;\n }\n // HTML visitor\n visitElement(element) {\n const isI18nRootElement = isI18nRootNode(element.i18n);\n if (isI18nRootElement) {\n if (this.inI18nBlock) {\n this.reportError('Cannot mark an element as translatable inside of a translatable section. Please remove the nested i18n marker.', element.sourceSpan);\n }\n this.inI18nBlock = true;\n }\n const preparsedElement = preparseElement(element);\n if (preparsedElement.type === PreparsedElementType.SCRIPT) {\n return null;\n }\n else if (preparsedElement.type === PreparsedElementType.STYLE) {\n const contents = textContents(element);\n if (contents !== null) {\n this.styles.push(contents);\n }\n return null;\n }\n else if (preparsedElement.type === PreparsedElementType.STYLESHEET &&\n isStyleUrlResolvable(preparsedElement.hrefAttr)) {\n this.styleUrls.push(preparsedElement.hrefAttr);\n return null;\n }\n // Whether the element is a ``\n const isTemplateElement = isNgTemplate(element.name);\n const parsedProperties = [];\n const boundEvents = [];\n const variables = [];\n const references = [];\n const attributes = [];\n const i18nAttrsMeta = {};\n const templateParsedProperties = [];\n const templateVariables = [];\n // Whether the element has any *-attribute\n let elementHasInlineTemplate = false;\n for (const attribute of element.attrs) {\n let hasBinding = false;\n const normalizedName = normalizeAttributeName(attribute.name);\n // `*attr` defines template bindings\n let isTemplateBinding = false;\n if (attribute.i18n) {\n i18nAttrsMeta[attribute.name] = attribute.i18n;\n }\n if (normalizedName.startsWith(TEMPLATE_ATTR_PREFIX)) {\n // *-attributes\n if (elementHasInlineTemplate) {\n this.reportError(`Can't have multiple template bindings on one element. Use only one attribute prefixed with *`, attribute.sourceSpan);\n }\n isTemplateBinding = true;\n elementHasInlineTemplate = true;\n const templateValue = attribute.value;\n const templateKey = normalizedName.substring(TEMPLATE_ATTR_PREFIX.length);\n const parsedVariables = [];\n const absoluteValueOffset = attribute.valueSpan ?\n attribute.valueSpan.start.offset :\n // If there is no value span the attribute does not have a value, like `attr` in\n //``. In this case, point to one character beyond the last character of\n // the attribute name.\n attribute.sourceSpan.start.offset + attribute.name.length;\n this.bindingParser.parseInlineTemplateBinding(templateKey, templateValue, attribute.sourceSpan, absoluteValueOffset, [], templateParsedProperties, parsedVariables, true /* isIvyAst */);\n templateVariables.push(...parsedVariables.map(v => new Variable(v.name, v.value, v.sourceSpan, v.keySpan, v.valueSpan)));\n }\n else {\n // Check for variables, events, property bindings, interpolation\n hasBinding = this.parseAttribute(isTemplateElement, attribute, [], parsedProperties, boundEvents, variables, references);\n }\n if (!hasBinding && !isTemplateBinding) {\n // don't include the bindings as attributes as well in the AST\n attributes.push(this.visitAttribute(attribute));\n }\n }\n const children = visitAll(preparsedElement.nonBindable ? NON_BINDABLE_VISITOR : this, element.children);\n let parsedElement;\n if (preparsedElement.type === PreparsedElementType.NG_CONTENT) {\n // ``\n if (element.children &&\n !element.children.every((node) => isEmptyTextNode(node) || isCommentNode(node))) {\n this.reportError(` element cannot have content.`, element.sourceSpan);\n }\n const selector = preparsedElement.selectAttr;\n const attrs = element.attrs.map(attr => this.visitAttribute(attr));\n parsedElement = new Content(selector, attrs, element.sourceSpan, element.i18n);\n this.ngContentSelectors.push(selector);\n }\n else if (isTemplateElement) {\n // ``\n const attrs = this.extractAttributes(element.name, parsedProperties, i18nAttrsMeta);\n parsedElement = new Template(element.name, attributes, attrs.bound, boundEvents, [ /* no template attributes */], children, references, variables, element.sourceSpan, element.startSourceSpan, element.endSourceSpan, element.i18n);\n }\n else {\n const attrs = this.extractAttributes(element.name, parsedProperties, i18nAttrsMeta);\n parsedElement = new Element$1(element.name, attributes, attrs.bound, boundEvents, children, references, element.sourceSpan, element.startSourceSpan, element.endSourceSpan, element.i18n);\n }\n if (elementHasInlineTemplate) {\n // If this node is an inline-template (e.g. has *ngFor) then we need to create a template\n // node that contains this node.\n // Moreover, if the node is an element, then we need to hoist its attributes to the template\n // node for matching against content projection selectors.\n const attrs = this.extractAttributes('ng-template', templateParsedProperties, i18nAttrsMeta);\n const templateAttrs = [];\n attrs.literal.forEach(attr => templateAttrs.push(attr));\n attrs.bound.forEach(attr => templateAttrs.push(attr));\n const hoistedAttrs = parsedElement instanceof Element$1 ?\n {\n attributes: parsedElement.attributes,\n inputs: parsedElement.inputs,\n outputs: parsedElement.outputs,\n } :\n { attributes: [], inputs: [], outputs: [] };\n // For s with structural directives on them, avoid passing i18n information to\n // the wrapping template to prevent unnecessary i18n instructions from being generated. The\n // necessary i18n meta information will be extracted from child elements.\n const i18n = isTemplateElement && isI18nRootElement ? undefined : element.i18n;\n const name = parsedElement instanceof Template ? null : parsedElement.name;\n parsedElement = new Template(name, hoistedAttrs.attributes, hoistedAttrs.inputs, hoistedAttrs.outputs, templateAttrs, [parsedElement], [ /* no references */], templateVariables, element.sourceSpan, element.startSourceSpan, element.endSourceSpan, i18n);\n }\n if (isI18nRootElement) {\n this.inI18nBlock = false;\n }\n return parsedElement;\n }\n visitAttribute(attribute) {\n return new TextAttribute(attribute.name, attribute.value, attribute.sourceSpan, attribute.keySpan, attribute.valueSpan, attribute.i18n);\n }\n visitText(text) {\n return this._visitTextWithInterpolation(text.value, text.sourceSpan, text.tokens, text.i18n);\n }\n visitExpansion(expansion) {\n if (!expansion.i18n) {\n // do not generate Icu in case it was created\n // outside of i18n block in a template\n return null;\n }\n if (!isI18nRootNode(expansion.i18n)) {\n throw new Error(`Invalid type \"${expansion.i18n.constructor}\" for \"i18n\" property of ${expansion.sourceSpan.toString()}. Expected a \"Message\"`);\n }\n const message = expansion.i18n;\n const vars = {};\n const placeholders = {};\n // extract VARs from ICUs - we process them separately while\n // assembling resulting message via goog.getMsg function, since\n // we need to pass them to top-level goog.getMsg call\n Object.keys(message.placeholders).forEach(key => {\n const value = message.placeholders[key];\n if (key.startsWith(I18N_ICU_VAR_PREFIX)) {\n // Currently when the `plural` or `select` keywords in an ICU contain trailing spaces (e.g.\n // `{count, select , ...}`), these spaces are also included into the key names in ICU vars\n // (e.g. \"VAR_SELECT \"). These trailing spaces are not desirable, since they will later be\n // converted into `_` symbols while normalizing placeholder names, which might lead to\n // mismatches at runtime (i.e. placeholder will not be replaced with the correct value).\n const formattedKey = key.trim();\n const ast = this.bindingParser.parseInterpolationExpression(value.text, value.sourceSpan);\n vars[formattedKey] = new BoundText(ast, value.sourceSpan);\n }\n else {\n placeholders[key] = this._visitTextWithInterpolation(value.text, value.sourceSpan, null);\n }\n });\n return new Icu$1(vars, placeholders, expansion.sourceSpan, message);\n }\n visitExpansionCase(expansionCase) {\n return null;\n }\n visitComment(comment) {\n if (this.options.collectCommentNodes) {\n this.commentNodes.push(new Comment$1(comment.value || '', comment.sourceSpan));\n }\n return null;\n }\n // convert view engine `ParsedProperty` to a format suitable for IVY\n extractAttributes(elementName, properties, i18nPropsMeta) {\n const bound = [];\n const literal = [];\n properties.forEach(prop => {\n const i18n = i18nPropsMeta[prop.name];\n if (prop.isLiteral) {\n literal.push(new TextAttribute(prop.name, prop.expression.source || '', prop.sourceSpan, prop.keySpan, prop.valueSpan, i18n));\n }\n else {\n // Note that validation is skipped and property mapping is disabled\n // due to the fact that we need to make sure a given prop is not an\n // input of a directive and directive matching happens at runtime.\n const bep = this.bindingParser.createBoundElementProperty(elementName, prop, /* skipValidation */ true, /* mapPropertyName */ false);\n bound.push(BoundAttribute.fromBoundElementProperty(bep, i18n));\n }\n });\n return { bound, literal };\n }\n parseAttribute(isTemplateElement, attribute, matchableAttributes, parsedProperties, boundEvents, variables, references) {\n var _a;\n const name = normalizeAttributeName(attribute.name);\n const value = attribute.value;\n const srcSpan = attribute.sourceSpan;\n const absoluteOffset = attribute.valueSpan ? attribute.valueSpan.start.offset : srcSpan.start.offset;\n function createKeySpan(srcSpan, prefix, identifier) {\n // We need to adjust the start location for the keySpan to account for the removed 'data-'\n // prefix from `normalizeAttributeName`.\n const normalizationAdjustment = attribute.name.length - name.length;\n const keySpanStart = srcSpan.start.moveBy(prefix.length + normalizationAdjustment);\n const keySpanEnd = keySpanStart.moveBy(identifier.length);\n return new ParseSourceSpan(keySpanStart, keySpanEnd, keySpanStart, identifier);\n }\n const bindParts = name.match(BIND_NAME_REGEXP);\n if (bindParts) {\n if (bindParts[KW_BIND_IDX] != null) {\n const identifier = bindParts[IDENT_KW_IDX];\n const keySpan = createKeySpan(srcSpan, bindParts[KW_BIND_IDX], identifier);\n this.bindingParser.parsePropertyBinding(identifier, value, false, srcSpan, absoluteOffset, attribute.valueSpan, matchableAttributes, parsedProperties, keySpan);\n }\n else if (bindParts[KW_LET_IDX]) {\n if (isTemplateElement) {\n const identifier = bindParts[IDENT_KW_IDX];\n const keySpan = createKeySpan(srcSpan, bindParts[KW_LET_IDX], identifier);\n this.parseVariable(identifier, value, srcSpan, keySpan, attribute.valueSpan, variables);\n }\n else {\n this.reportError(`\"let-\" is only supported on ng-template elements.`, srcSpan);\n }\n }\n else if (bindParts[KW_REF_IDX]) {\n const identifier = bindParts[IDENT_KW_IDX];\n const keySpan = createKeySpan(srcSpan, bindParts[KW_REF_IDX], identifier);\n this.parseReference(identifier, value, srcSpan, keySpan, attribute.valueSpan, references);\n }\n else if (bindParts[KW_ON_IDX]) {\n const events = [];\n const identifier = bindParts[IDENT_KW_IDX];\n const keySpan = createKeySpan(srcSpan, bindParts[KW_ON_IDX], identifier);\n this.bindingParser.parseEvent(identifier, value, /* isAssignmentEvent */ false, srcSpan, attribute.valueSpan || srcSpan, matchableAttributes, events, keySpan);\n addEvents(events, boundEvents);\n }\n else if (bindParts[KW_BINDON_IDX]) {\n const identifier = bindParts[IDENT_KW_IDX];\n const keySpan = createKeySpan(srcSpan, bindParts[KW_BINDON_IDX], identifier);\n this.bindingParser.parsePropertyBinding(identifier, value, false, srcSpan, absoluteOffset, attribute.valueSpan, matchableAttributes, parsedProperties, keySpan);\n this.parseAssignmentEvent(identifier, value, srcSpan, attribute.valueSpan, matchableAttributes, boundEvents, keySpan);\n }\n else if (bindParts[KW_AT_IDX]) {\n const keySpan = createKeySpan(srcSpan, '', name);\n this.bindingParser.parseLiteralAttr(name, value, srcSpan, absoluteOffset, attribute.valueSpan, matchableAttributes, parsedProperties, keySpan);\n }\n return true;\n }\n // We didn't see a kw-prefixed property binding, but we have not yet checked\n // for the []/()/[()] syntax.\n let delims = null;\n if (name.startsWith(BINDING_DELIMS.BANANA_BOX.start)) {\n delims = BINDING_DELIMS.BANANA_BOX;\n }\n else if (name.startsWith(BINDING_DELIMS.PROPERTY.start)) {\n delims = BINDING_DELIMS.PROPERTY;\n }\n else if (name.startsWith(BINDING_DELIMS.EVENT.start)) {\n delims = BINDING_DELIMS.EVENT;\n }\n if (delims !== null &&\n // NOTE: older versions of the parser would match a start/end delimited\n // binding iff the property name was terminated by the ending delimiter\n // and the identifier in the binding was non-empty.\n // TODO(ayazhafiz): update this to handle malformed bindings.\n name.endsWith(delims.end) && name.length > delims.start.length + delims.end.length) {\n const identifier = name.substring(delims.start.length, name.length - delims.end.length);\n const keySpan = createKeySpan(srcSpan, delims.start, identifier);\n if (delims.start === BINDING_DELIMS.BANANA_BOX.start) {\n this.bindingParser.parsePropertyBinding(identifier, value, false, srcSpan, absoluteOffset, attribute.valueSpan, matchableAttributes, parsedProperties, keySpan);\n this.parseAssignmentEvent(identifier, value, srcSpan, attribute.valueSpan, matchableAttributes, boundEvents, keySpan);\n }\n else if (delims.start === BINDING_DELIMS.PROPERTY.start) {\n this.bindingParser.parsePropertyBinding(identifier, value, false, srcSpan, absoluteOffset, attribute.valueSpan, matchableAttributes, parsedProperties, keySpan);\n }\n else {\n const events = [];\n this.bindingParser.parseEvent(identifier, value, /* isAssignmentEvent */ false, srcSpan, attribute.valueSpan || srcSpan, matchableAttributes, events, keySpan);\n addEvents(events, boundEvents);\n }\n return true;\n }\n // No explicit binding found.\n const keySpan = createKeySpan(srcSpan, '' /* prefix */, name);\n const hasBinding = this.bindingParser.parsePropertyInterpolation(name, value, srcSpan, attribute.valueSpan, matchableAttributes, parsedProperties, keySpan, (_a = attribute.valueTokens) !== null && _a !== void 0 ? _a : null);\n return hasBinding;\n }\n _visitTextWithInterpolation(value, sourceSpan, interpolatedTokens, i18n) {\n const valueNoNgsp = replaceNgsp(value);\n const expr = this.bindingParser.parseInterpolation(valueNoNgsp, sourceSpan, interpolatedTokens);\n return expr ? new BoundText(expr, sourceSpan, i18n) : new Text$3(valueNoNgsp, sourceSpan);\n }\n parseVariable(identifier, value, sourceSpan, keySpan, valueSpan, variables) {\n if (identifier.indexOf('-') > -1) {\n this.reportError(`\"-\" is not allowed in variable names`, sourceSpan);\n }\n else if (identifier.length === 0) {\n this.reportError(`Variable does not have a name`, sourceSpan);\n }\n variables.push(new Variable(identifier, value, sourceSpan, keySpan, valueSpan));\n }\n parseReference(identifier, value, sourceSpan, keySpan, valueSpan, references) {\n if (identifier.indexOf('-') > -1) {\n this.reportError(`\"-\" is not allowed in reference names`, sourceSpan);\n }\n else if (identifier.length === 0) {\n this.reportError(`Reference does not have a name`, sourceSpan);\n }\n else if (references.some(reference => reference.name === identifier)) {\n this.reportError(`Reference \"#${identifier}\" is defined more than once`, sourceSpan);\n }\n references.push(new Reference(identifier, value, sourceSpan, keySpan, valueSpan));\n }\n parseAssignmentEvent(name, expression, sourceSpan, valueSpan, targetMatchableAttrs, boundEvents, keySpan) {\n const events = [];\n this.bindingParser.parseEvent(`${name}Change`, `${expression} =$event`, /* isAssignmentEvent */ true, sourceSpan, valueSpan || sourceSpan, targetMatchableAttrs, events, keySpan);\n addEvents(events, boundEvents);\n }\n reportError(message, sourceSpan, level = ParseErrorLevel.ERROR) {\n this.errors.push(new ParseError(sourceSpan, message, level));\n }\n}\nclass NonBindableVisitor {\n visitElement(ast) {\n const preparsedElement = preparseElement(ast);\n if (preparsedElement.type === PreparsedElementType.SCRIPT ||\n preparsedElement.type === PreparsedElementType.STYLE ||\n preparsedElement.type === PreparsedElementType.STYLESHEET) {\n // Skipping